Update documentation

Co-authored-by: arm64v8a <48624112+arm64v8a@users.noreply.github.com>

.github/workflows/debug.yml

@@ -3,6 +3,7 @@ name: Debug build
 on:
   push:
     branches:
+      - main
       - dev
       - dev-next
     paths-ignore:
@@ -11,6 +12,7 @@ on:
       - '!.github/workflows/debug.yml'
   pull_request:
     branches:
+      - main
       - dev
       - dev-next
 

.golangci.yml

@@ -7,6 +7,10 @@ linters:
     - staticcheck
     - paralleltest
 
+run:
+  skip-dirs:
+    - transport/cloudflaretls
+
 linters-settings:
 #  gci:
 #    sections:

Makefile

@@ -64,7 +64,7 @@ test:
 	@go test -v . && \
 	pushd test && \
 	go mod tidy && \
-	go test -v -tags with_quic,with_wireguard,with_grpc . && \
+	go test -v -tags with_quic,with_wireguard,with_grpc,with_ech,with_utls,with_shadowsocksr . && \
 	popd
 
 clean:

adapter/experimental.go

@@ -9,18 +9,22 @@ import (
 
 type ClashServer interface {
 	Service
-	TrafficController
+	Mode() string
+	StoreSelected() bool
+	CacheFile() ClashCacheFile
+	RoutedConnection(ctx context.Context, conn net.Conn, metadata InboundContext, matchedRule Rule) (net.Conn, Tracker)
+	RoutedPacketConnection(ctx context.Context, conn N.PacketConn, metadata InboundContext, matchedRule Rule) (N.PacketConn, Tracker)
+}
+
+type ClashCacheFile interface {
+	LoadSelected(group string) string
+	StoreSelected(group string, selected string) error
 }
 
 type Tracker interface {
 	Leave()
 }
 
-type TrafficController interface {
-	RoutedConnection(ctx context.Context, conn net.Conn, metadata InboundContext, matchedRule Rule) (net.Conn, Tracker)
-	RoutedPacketConnection(ctx context.Context, conn N.PacketConn, metadata InboundContext, matchedRule Rule) (N.PacketConn, Tracker)
-}
-
 type OutboundGroup interface {
 	Now() string
 	All() []string

adapter/router.go

@@ -39,7 +39,9 @@ type Router interface {
 	InterfaceMonitor() tun.DefaultInterfaceMonitor
 	PackageManager() tun.PackageManager
 	Rules() []Rule
-	SetTrafficController(controller TrafficController)
+
+	ClashServer() ClashServer
+	SetClashServer(controller ClashServer)
 }
 
 type Rule interface {

box.go

@@ -154,7 +154,7 @@ func New(ctx context.Context, options option.Options) (*Box, error) {
 		if err != nil {
 			return nil, E.Cause(err, "create clash api server")
 		}
-		router.SetTrafficController(clashServer)
+		router.SetClashServer(clashServer)
 	}
 	return &Box{
 		router:      router,

common/tls/acme.go

@@ -1,6 +1,6 @@
 //go:build with_acme
 
-package inbound
+package tls
 
 import (
 	"context"

common/tls/acme_stub.go

@@ -1,6 +1,6 @@
 //go:build !with_acme
 
-package inbound
+package tls
 
 import (
 	"context"

common/tls/client.go

@@ -0,0 +1,63 @@
+package tls
+
+import (
+	"context"
+	"net"
+	"os"
+
+	"github.com/sagernet/sing-box/adapter"
+	C "github.com/sagernet/sing-box/constant"
+	"github.com/sagernet/sing-box/option"
+	M "github.com/sagernet/sing/common/metadata"
+	N "github.com/sagernet/sing/common/network"
+)
+
+func NewDialerFromOptions(router adapter.Router, dialer N.Dialer, serverAddress string, options option.OutboundTLSOptions) (N.Dialer, error) {
+	config, err := NewClient(router, serverAddress, options)
+	if err != nil {
+		return nil, err
+	}
+	return NewDialer(dialer, config), nil
+}
+
+func NewClient(router adapter.Router, serverAddress string, options option.OutboundTLSOptions) (Config, error) {
+	if options.ECH != nil && options.ECH.Enabled {
+		return newECHClient(router, serverAddress, options)
+	} else if options.UTLS != nil && options.UTLS.Enabled {
+		return newUTLSClient(router, serverAddress, options)
+	} else {
+		return newStdClient(serverAddress, options)
+	}
+}
+
+func ClientHandshake(ctx context.Context, conn net.Conn, config Config) (Conn, error) {
+	tlsConn := config.Client(conn)
+	ctx, cancel := context.WithTimeout(ctx, C.TCPTimeout)
+	defer cancel()
+	err := tlsConn.HandshakeContext(ctx)
+	return tlsConn, err
+}
+
+type Dialer struct {
+	dialer N.Dialer
+	config Config
+}
+
+func NewDialer(dialer N.Dialer, config Config) N.Dialer {
+	return &Dialer{dialer, config}
+}
+
+func (d *Dialer) DialContext(ctx context.Context, network string, destination M.Socksaddr) (net.Conn, error) {
+	if network != N.NetworkTCP {
+		return nil, os.ErrInvalid
+	}
+	conn, err := d.dialer.DialContext(ctx, network, destination)
+	if err != nil {
+		return nil, err
+	}
+	return ClientHandshake(ctx, conn, d.config)
+}
+
+func (d *Dialer) ListenPacket(ctx context.Context, destination M.Socksaddr) (net.PacketConn, error) {
+	return nil, os.ErrInvalid
+}

common/tls/common.go

@@ -0,0 +1,12 @@
+package tls
+
+const (
+	VersionTLS10 = 0x0301
+	VersionTLS11 = 0x0302
+	VersionTLS12 = 0x0303
+	VersionTLS13 = 0x0304
+
+	// Deprecated: SSLv3 is cryptographically broken, and is no longer
+	// supported by this package. See golang.org/issue/32716.
+	VersionSSL30 = 0x0300
+)

common/tls/config.go

@@ -0,0 +1,49 @@
+package tls
+
+import (
+	"context"
+	"crypto/tls"
+	"net"
+
+	"github.com/sagernet/sing-box/adapter"
+	E "github.com/sagernet/sing/common/exceptions"
+)
+
+type (
+	STDConfig = tls.Config
+	STDConn   = tls.Conn
+)
+
+type Config interface {
+	NextProtos() []string
+	SetNextProtos(nextProto []string)
+	Config() (*STDConfig, error)
+	Client(conn net.Conn) Conn
+}
+
+type ServerConfig interface {
+	Config
+	adapter.Service
+	Server(conn net.Conn) Conn
+}
+
+type Conn interface {
+	net.Conn
+	HandshakeContext(ctx context.Context) error
+	ConnectionState() tls.ConnectionState
+}
+
+func ParseTLSVersion(version string) (uint16, error) {
+	switch version {
+	case "1.0":
+		return tls.VersionTLS10, nil
+	case "1.1":
+		return tls.VersionTLS11, nil
+	case "1.2":
+		return tls.VersionTLS12, nil
+	case "1.3":
+		return tls.VersionTLS13, nil
+	default:
+		return 0, E.New("unknown tls version:", version)
+	}
+}

common/tls/ech_client.go

@@ -0,0 +1,219 @@
+//go:build with_ech
+
+package tls
+
+import (
+	"context"
+	"crypto/tls"
+	"crypto/x509"
+	"encoding/base64"
+	"net"
+	"net/netip"
+	"os"
+
+	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/option"
+	cftls "github.com/sagernet/sing-box/transport/cloudflaretls"
+	"github.com/sagernet/sing-dns"
+	E "github.com/sagernet/sing/common/exceptions"
+
+	mDNS "github.com/miekg/dns"
+	"golang.org/x/net/dns/dnsmessage"
+)
+
+type echClientConfig struct {
+	config *cftls.Config
+}
+
+func (e *echClientConfig) NextProtos() []string {
+	return e.config.NextProtos
+}
+
+func (e *echClientConfig) SetNextProtos(nextProto []string) {
+	e.config.NextProtos = nextProto
+}
+
+func (e *echClientConfig) Config() (*STDConfig, error) {
+	return nil, E.New("unsupported usage for ECH")
+}
+
+func (e *echClientConfig) Client(conn net.Conn) Conn {
+	return &echConnWrapper{cftls.Client(conn, e.config)}
+}
+
+type echConnWrapper struct {
+	*cftls.Conn
+}
+
+func (c *echConnWrapper) ConnectionState() tls.ConnectionState {
+	state := c.Conn.ConnectionState()
+	return tls.ConnectionState{
+		Version:                     state.Version,
+		HandshakeComplete:           state.HandshakeComplete,
+		DidResume:                   state.DidResume,
+		CipherSuite:                 state.CipherSuite,
+		NegotiatedProtocol:          state.NegotiatedProtocol,
+		NegotiatedProtocolIsMutual:  state.NegotiatedProtocolIsMutual,
+		ServerName:                  state.ServerName,
+		PeerCertificates:            state.PeerCertificates,
+		VerifiedChains:              state.VerifiedChains,
+		SignedCertificateTimestamps: state.SignedCertificateTimestamps,
+		OCSPResponse:                state.OCSPResponse,
+		TLSUnique:                   state.TLSUnique,
+	}
+}
+
+func newECHClient(router adapter.Router, serverAddress string, options option.OutboundTLSOptions) (Config, error) {
+	var serverName string
+	if options.ServerName != "" {
+		serverName = options.ServerName
+	} else if serverAddress != "" {
+		if _, err := netip.ParseAddr(serverName); err != nil {
+			serverName = serverAddress
+		}
+	}
+	if serverName == "" && !options.Insecure {
+		return nil, E.New("missing server_name or insecure=true")
+	}
+
+	var tlsConfig cftls.Config
+	if options.DisableSNI {
+		tlsConfig.ServerName = "127.0.0.1"
+	} else {
+		tlsConfig.ServerName = serverName
+	}
+	if options.Insecure {
+		tlsConfig.InsecureSkipVerify = options.Insecure
+	} else if options.DisableSNI {
+		tlsConfig.InsecureSkipVerify = true
+		tlsConfig.VerifyConnection = func(state cftls.ConnectionState) error {
+			verifyOptions := x509.VerifyOptions{
+				DNSName:       serverName,
+				Intermediates: x509.NewCertPool(),
+			}
+			for _, cert := range state.PeerCertificates[1:] {
+				verifyOptions.Intermediates.AddCert(cert)
+			}
+			_, err := state.PeerCertificates[0].Verify(verifyOptions)
+			return err
+		}
+	}
+	if len(options.ALPN) > 0 {
+		tlsConfig.NextProtos = options.ALPN
+	}
+	if options.MinVersion != "" {
+		minVersion, err := ParseTLSVersion(options.MinVersion)
+		if err != nil {
+			return nil, E.Cause(err, "parse min_version")
+		}
+		tlsConfig.MinVersion = minVersion
+	}
+	if options.MaxVersion != "" {
+		maxVersion, err := ParseTLSVersion(options.MaxVersion)
+		if err != nil {
+			return nil, E.Cause(err, "parse max_version")
+		}
+		tlsConfig.MaxVersion = maxVersion
+	}
+	if options.CipherSuites != nil {
+	find:
+		for _, cipherSuite := range options.CipherSuites {
+			for _, tlsCipherSuite := range cftls.CipherSuites() {
+				if cipherSuite == tlsCipherSuite.Name {
+					tlsConfig.CipherSuites = append(tlsConfig.CipherSuites, tlsCipherSuite.ID)
+					continue find
+				}
+			}
+			return nil, E.New("unknown cipher_suite: ", cipherSuite)
+		}
+	}
+	var certificate []byte
+	if options.Certificate != "" {
+		certificate = []byte(options.Certificate)
+	} else if options.CertificatePath != "" {
+		content, err := os.ReadFile(options.CertificatePath)
+		if err != nil {
+			return nil, E.Cause(err, "read certificate")
+		}
+		certificate = content
+	}
+	if len(certificate) > 0 {
+		certPool := x509.NewCertPool()
+		if !certPool.AppendCertsFromPEM(certificate) {
+			return nil, E.New("failed to parse certificate:\n\n", certificate)
+		}
+		tlsConfig.RootCAs = certPool
+	}
+
+	// ECH Config
+
+	tlsConfig.ECHEnabled = true
+	tlsConfig.PQSignatureSchemesEnabled = options.ECH.PQSignatureSchemesEnabled
+	tlsConfig.DynamicRecordSizingDisabled = options.ECH.DynamicRecordSizingDisabled
+	if options.ECH.Config != "" {
+		clientConfigContent, err := base64.StdEncoding.DecodeString(options.ECH.Config)
+		if err != nil {
+			return nil, err
+		}
+		clientConfig, err := cftls.UnmarshalECHConfigs(clientConfigContent)
+		if err != nil {
+			return nil, err
+		}
+		tlsConfig.ClientECHConfigs = clientConfig
+	} else {
+		tlsConfig.GetClientECHConfigs = fetchECHClientConfig(router)
+	}
+	return &echClientConfig{&tlsConfig}, nil
+}
+
+const typeHTTPS = 65
+
+func fetchECHClientConfig(router adapter.Router) func(ctx context.Context, serverName string) ([]cftls.ECHConfig, error) {
+	return func(ctx context.Context, serverName string) ([]cftls.ECHConfig, error) {
+		message := &dnsmessage.Message{
+			Header: dnsmessage.Header{
+				RecursionDesired: true,
+			},
+			Questions: []dnsmessage.Question{
+				{
+					Name:  dnsmessage.MustNewName(serverName + "."),
+					Type:  typeHTTPS,
+					Class: dnsmessage.ClassINET,
+				},
+			},
+		}
+		response, err := router.Exchange(ctx, message)
+		if err != nil {
+			return nil, err
+		}
+		if response.RCode != dnsmessage.RCodeSuccess {
+			return nil, dns.RCodeError(response.RCode)
+		}
+		content, err := response.Pack()
+		if err != nil {
+			return nil, err
+		}
+		var mMsg mDNS.Msg
+		err = mMsg.Unpack(content)
+		if err != nil {
+			return nil, err
+		}
+		for _, rr := range mMsg.Answer {
+			switch resource := rr.(type) {
+			case *mDNS.HTTPS:
+				for _, value := range resource.Value {
+					if value.Key().String() == "ech" {
+						echConfig, err := base64.StdEncoding.DecodeString(value.String())
+						if err != nil {
+							return nil, E.Cause(err, "decode ECH config")
+						}
+						return cftls.UnmarshalECHConfigs(echConfig)
+					}
+				}
+			default:
+				return nil, E.New("unknown resource record type: ", resource.Header().Rrtype)
+			}
+		}
+		return nil, E.New("no ECH config found")
+	}
+}

common/tls/ech_stub.go

@@ -0,0 +1,13 @@
+//go:build !with_ech
+
+package tls
+
+import (
+	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/option"
+	E "github.com/sagernet/sing/common/exceptions"
+)
+
+func newECHClient(router adapter.Router, serverAddress string, options option.OutboundTLSOptions) (Config, error) {
+	return nil, E.New(`ECH is not included in this build, rebuild with -tags with_ech`)
+}

common/tls/server.go

@@ -0,0 +1,12 @@
+package tls
+
+import (
+	"context"
+
+	"github.com/sagernet/sing-box/log"
+	"github.com/sagernet/sing-box/option"
+)
+
+func NewServer(ctx context.Context, logger log.Logger, options option.InboundTLSOptions) (ServerConfig, error) {
+	return newSTDServer(ctx, logger, options)
+}

common/tls/std_client.go

@@ -1,34 +1,26 @@
-package dialer
+package tls
 
 import (
-	"context"
 	"crypto/tls"
 	"crypto/x509"
 	"net"
 	"net/netip"
 	"os"
 
-	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/option"
 	E "github.com/sagernet/sing/common/exceptions"
-	M "github.com/sagernet/sing/common/metadata"
-	N "github.com/sagernet/sing/common/network"
 )
 
-type TLSDialer struct {
-	dialer N.Dialer
+type stdClientConfig struct {
 	config *tls.Config
 }
 
-func TLSConfig(serverAddress string, options option.OutboundTLSOptions) (*tls.Config, error) {
-	if !options.Enabled {
-		return nil, nil
-	}
+func newStdClient(serverAddress string, options option.OutboundTLSOptions) (Config, error) {
 	var serverName string
 	if options.ServerName != "" {
 		serverName = options.ServerName
 	} else if serverAddress != "" {
-		if _, err := netip.ParseAddr(serverName); err == nil {
+		if _, err := netip.ParseAddr(serverName); err != nil {
 			serverName = serverAddress
 		}
 	}
@@ -62,14 +54,14 @@ func TLSConfig(serverAddress string, options option.OutboundTLSOptions) (*tls.Co
 		tlsConfig.NextProtos = options.ALPN
 	}
 	if options.MinVersion != "" {
-		minVersion, err := option.ParseTLSVersion(options.MinVersion)
+		minVersion, err := ParseTLSVersion(options.MinVersion)
 		if err != nil {
 			return nil, E.Cause(err, "parse min_version")
 		}
 		tlsConfig.MinVersion = minVersion
 	}
 	if options.MaxVersion != "" {
-		maxVersion, err := option.ParseTLSVersion(options.MaxVersion)
+		maxVersion, err := ParseTLSVersion(options.MaxVersion)
 		if err != nil {
 			return nil, E.Cause(err, "parse max_version")
 		}
@@ -104,42 +96,21 @@ func TLSConfig(serverAddress string, options option.OutboundTLSOptions) (*tls.Co
 		}
 		tlsConfig.RootCAs = certPool
 	}
-	return &tlsConfig, nil
+	return &stdClientConfig{&tlsConfig}, nil
 }
 
-func NewTLS(dialer N.Dialer, serverAddress string, options option.OutboundTLSOptions) (N.Dialer, error) {
-	if !options.Enabled {
-		return dialer, nil
-	}
-	tlsConfig, err := TLSConfig(serverAddress, options)
-	if err != nil {
-		return nil, err
-	}
-	return &TLSDialer{
-		dialer: dialer,
-		config: tlsConfig,
-	}, nil
+func (s *stdClientConfig) NextProtos() []string {
+	return s.config.NextProtos
 }
 
-func (d *TLSDialer) DialContext(ctx context.Context, network string, destination M.Socksaddr) (net.Conn, error) {
-	if network != N.NetworkTCP {
-		return nil, os.ErrInvalid
-	}
-	conn, err := d.dialer.DialContext(ctx, network, destination)
-	if err != nil {
-		return nil, err
-	}
-	return TLSClient(ctx, conn, d.config)
+func (s *stdClientConfig) SetNextProtos(nextProto []string) {
+	s.config.NextProtos = nextProto
 }
 
-func (d *TLSDialer) ListenPacket(ctx context.Context, destination M.Socksaddr) (net.PacketConn, error) {
-	return nil, os.ErrInvalid
+func (s *stdClientConfig) Config() (*STDConfig, error) {
+	return s.config, nil
 }
 
-func TLSClient(ctx context.Context, conn net.Conn, tlsConfig *tls.Config) (*tls.Conn, error) {
-	tlsConn := tls.Client(conn, tlsConfig)
-	ctx, cancel := context.WithTimeout(ctx, C.TCPTimeout)
-	defer cancel()
-	err := tlsConn.HandshakeContext(ctx)
-	return tlsConn, err
+func (s *stdClientConfig) Client(conn net.Conn) Conn {
+	return tls.Client(conn, s.config)
 }

common/tls/std_server.go

@@ -1,8 +1,9 @@
-package inbound
+package tls
 
 import (
 	"context"
 	"crypto/tls"
+	"net"
 	"os"
 
 	"github.com/sagernet/sing-box/adapter"
@@ -14,9 +15,7 @@ import (
 	"github.com/fsnotify/fsnotify"
 )
 
-var _ adapter.Service = (*TLSConfig)(nil)
-
-type TLSConfig struct {
+type STDServerConfig struct {
 	config          *tls.Config
 	logger          log.Logger
 	acmeService     adapter.Service
@@ -27,105 +26,15 @@ type TLSConfig struct {
 	watcher         *fsnotify.Watcher
 }
 
-func (c *TLSConfig) Config() *tls.Config {
-	return c.config
+func (c *STDServerConfig) NextProtos() []string {
+	return c.config.NextProtos
 }
 
-func (c *TLSConfig) Start() error {
-	if c.acmeService != nil {
-		return c.acmeService.Start()
-	} else {
-		if c.certificatePath == "" && c.keyPath == "" {
-			return nil
-		}
-		err := c.startWatcher()
-		if err != nil {
-			c.logger.Warn("create fsnotify watcher: ", err)
-		}
-		return nil
-	}
+func (c *STDServerConfig) SetNextProtos(nextProto []string) {
+	c.config.NextProtos = nextProto
 }
 
-func (c *TLSConfig) startWatcher() error {
-	watcher, err := fsnotify.NewWatcher()
-	if err != nil {
-		return err
-	}
-	if c.certificatePath != "" {
-		err = watcher.Add(c.certificatePath)
-		if err != nil {
-			return err
-		}
-	}
-	if c.keyPath != "" {
-		err = watcher.Add(c.keyPath)
-		if err != nil {
-			return err
-		}
-	}
-	c.watcher = watcher
-	go c.loopUpdate()
-	return nil
-}
-
-func (c *TLSConfig) loopUpdate() {
-	for {
-		select {
-		case event, ok := <-c.watcher.Events:
-			if !ok {
-				return
-			}
-			if event.Op&fsnotify.Write != fsnotify.Write {
-				continue
-			}
-			err := c.reloadKeyPair()
-			if err != nil {
-				c.logger.Error(E.Cause(err, "reload TLS key pair"))
-			}
-		case err, ok := <-c.watcher.Errors:
-			if !ok {
-				return
-			}
-			c.logger.Error(E.Cause(err, "fsnotify error"))
-		}
-	}
-}
-
-func (c *TLSConfig) reloadKeyPair() error {
-	if c.certificatePath != "" {
-		certificate, err := os.ReadFile(c.certificatePath)
-		if err != nil {
-			return E.Cause(err, "reload certificate from ", c.certificatePath)
-		}
-		c.certificate = certificate
-	}
-	if c.keyPath != "" {
-		key, err := os.ReadFile(c.keyPath)
-		if err != nil {
-			return E.Cause(err, "reload key from ", c.keyPath)
-		}
-		c.key = key
-	}
-	keyPair, err := tls.X509KeyPair(c.certificate, c.key)
-	if err != nil {
-		return E.Cause(err, "reload key pair")
-	}
-	c.config.Certificates = []tls.Certificate{keyPair}
-	c.logger.Info("reloaded TLS certificate")
-	return nil
-}
-
-func (c *TLSConfig) Close() error {
-	if c.acmeService != nil {
-		return c.acmeService.Close()
-	}
-	if c.watcher != nil {
-		return c.watcher.Close()
-	}
-	return nil
-}
-
-func NewTLSConfig(ctx context.Context, logger log.Logger, options option.InboundTLSOptions) (*TLSConfig, error) {
+func newSTDServer(ctx context.Context, logger log.Logger, options option.InboundTLSOptions) (ServerConfig, error) {
 	if !options.Enabled {
 		return nil, nil
 	}
@@ -147,14 +56,14 @@ func NewTLSConfig(ctx context.Context, logger log.Logger, options option.Inbound
 		tlsConfig.NextProtos = append(tlsConfig.NextProtos, options.ALPN...)
 	}
 	if options.MinVersion != "" {
-		minVersion, err := option.ParseTLSVersion(options.MinVersion)
+		minVersion, err := ParseTLSVersion(options.MinVersion)
 		if err != nil {
 			return nil, E.Cause(err, "parse min_version")
 		}
 		tlsConfig.MinVersion = minVersion
 	}
 	if options.MaxVersion != "" {
-		maxVersion, err := option.ParseTLSVersion(options.MaxVersion)
+		maxVersion, err := ParseTLSVersion(options.MaxVersion)
 		if err != nil {
 			return nil, E.Cause(err, "parse max_version")
 		}
@@ -205,7 +114,7 @@ func NewTLSConfig(ctx context.Context, logger log.Logger, options option.Inbound
 		}
 		tlsConfig.Certificates = []tls.Certificate{keyPair}
 	}
-	return &TLSConfig{
+	return &STDServerConfig{
 		config:          tlsConfig,
 		logger:          logger,
 		acmeService:     acmeService,
@@ -215,3 +124,109 @@ func NewTLSConfig(ctx context.Context, logger log.Logger, options option.Inbound
 		keyPath:         options.KeyPath,
 	}, nil
 }
+
+func (c *STDServerConfig) Config() (*STDConfig, error) {
+	return c.config, nil
+}
+
+func (c *STDServerConfig) Client(conn net.Conn) Conn {
+	return tls.Client(conn, c.config)
+}
+
+func (c *STDServerConfig) Server(conn net.Conn) Conn {
+	return tls.Server(conn, c.config)
+}
+
+func (c *STDServerConfig) Start() error {
+	if c.acmeService != nil {
+		return c.acmeService.Start()
+	} else {
+		if c.certificatePath == "" && c.keyPath == "" {
+			return nil
+		}
+		err := c.startWatcher()
+		if err != nil {
+			c.logger.Warn("create fsnotify watcher: ", err)
+		}
+		return nil
+	}
+}
+
+func (c *STDServerConfig) startWatcher() error {
+	watcher, err := fsnotify.NewWatcher()
+	if err != nil {
+		return err
+	}
+	if c.certificatePath != "" {
+		err = watcher.Add(c.certificatePath)
+		if err != nil {
+			return err
+		}
+	}
+	if c.keyPath != "" {
+		err = watcher.Add(c.keyPath)
+		if err != nil {
+			return err
+		}
+	}
+	c.watcher = watcher
+	go c.loopUpdate()
+	return nil
+}
+
+func (c *STDServerConfig) loopUpdate() {
+	for {
+		select {
+		case event, ok := <-c.watcher.Events:
+			if !ok {
+				return
+			}
+			if event.Op&fsnotify.Write != fsnotify.Write {
+				continue
+			}
+			err := c.reloadKeyPair()
+			if err != nil {
+				c.logger.Error(E.Cause(err, "reload TLS key pair"))
+			}
+		case err, ok := <-c.watcher.Errors:
+			if !ok {
+				return
+			}
+			c.logger.Error(E.Cause(err, "fsnotify error"))
+		}
+	}
+}
+
+func (c *STDServerConfig) reloadKeyPair() error {
+	if c.certificatePath != "" {
+		certificate, err := os.ReadFile(c.certificatePath)
+		if err != nil {
+			return E.Cause(err, "reload certificate from ", c.certificatePath)
+		}
+		c.certificate = certificate
+	}
+	if c.keyPath != "" {
+		key, err := os.ReadFile(c.keyPath)
+		if err != nil {
+			return E.Cause(err, "reload key from ", c.keyPath)
+		}
+		c.key = key
+	}
+	keyPair, err := tls.X509KeyPair(c.certificate, c.key)
+	if err != nil {
+		return E.Cause(err, "reload key pair")
+	}
+	c.config.Certificates = []tls.Certificate{keyPair}
+	c.logger.Info("reloaded TLS certificate")
+	return nil
+}
+
+func (c *STDServerConfig) Close() error {
+	if c.acmeService != nil {
+		return c.acmeService.Close()
+	}
+	if c.watcher != nil {
+		return c.watcher.Close()
+	}
+	return nil
+}

common/tls/utls_client.go

@@ -0,0 +1,151 @@
+//go:build with_utls
+
+package tls
+
+import (
+	"context"
+	"crypto/tls"
+	"crypto/x509"
+	"net"
+	"net/netip"
+	"os"
+
+	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/option"
+	E "github.com/sagernet/sing/common/exceptions"
+
+	utls "github.com/refraction-networking/utls"
+)
+
+type utlsClientConfig struct {
+	config *utls.Config
+	id     utls.ClientHelloID
+}
+
+func (e *utlsClientConfig) NextProtos() []string {
+	return e.config.NextProtos
+}
+
+func (e *utlsClientConfig) SetNextProtos(nextProto []string) {
+	e.config.NextProtos = nextProto
+}
+
+func (e *utlsClientConfig) Config() (*STDConfig, error) {
+	return nil, E.New("unsupported usage for uTLS")
+}
+
+func (e *utlsClientConfig) Client(conn net.Conn) Conn {
+	return &utlsConnWrapper{utls.UClient(conn, e.config, e.id)}
+}
+
+type utlsConnWrapper struct {
+	*utls.UConn
+}
+
+func (c *utlsConnWrapper) HandshakeContext(ctx context.Context) error {
+	return c.Conn.Handshake()
+}
+
+func (c *utlsConnWrapper) ConnectionState() tls.ConnectionState {
+	state := c.Conn.ConnectionState()
+	return tls.ConnectionState{
+		Version:                     state.Version,
+		HandshakeComplete:           state.HandshakeComplete,
+		DidResume:                   state.DidResume,
+		CipherSuite:                 state.CipherSuite,
+		NegotiatedProtocol:          state.NegotiatedProtocol,
+		NegotiatedProtocolIsMutual:  state.NegotiatedProtocolIsMutual,
+		ServerName:                  state.ServerName,
+		PeerCertificates:            state.PeerCertificates,
+		VerifiedChains:              state.VerifiedChains,
+		SignedCertificateTimestamps: state.SignedCertificateTimestamps,
+		OCSPResponse:                state.OCSPResponse,
+		TLSUnique:                   state.TLSUnique,
+	}
+}
+
+func newUTLSClient(router adapter.Router, serverAddress string, options option.OutboundTLSOptions) (Config, error) {
+	var serverName string
+	if options.ServerName != "" {
+		serverName = options.ServerName
+	} else if serverAddress != "" {
+		if _, err := netip.ParseAddr(serverName); err != nil {
+			serverName = serverAddress
+		}
+	}
+	if serverName == "" && !options.Insecure {
+		return nil, E.New("missing server_name or insecure=true")
+	}
+
+	var tlsConfig utls.Config
+	if options.DisableSNI {
+		tlsConfig.ServerName = "127.0.0.1"
+	} else {
+		tlsConfig.ServerName = serverName
+	}
+	if options.Insecure {
+		tlsConfig.InsecureSkipVerify = options.Insecure
+	} else if options.DisableSNI {
+		return nil, E.New("disable_sni is unsupported in uTLS")
+	}
+	if len(options.ALPN) > 0 {
+		tlsConfig.NextProtos = options.ALPN
+	}
+	if options.MinVersion != "" {
+		minVersion, err := ParseTLSVersion(options.MinVersion)
+		if err != nil {
+			return nil, E.Cause(err, "parse min_version")
+		}
+		tlsConfig.MinVersion = minVersion
+	}
+	if options.MaxVersion != "" {
+		maxVersion, err := ParseTLSVersion(options.MaxVersion)
+		if err != nil {
+			return nil, E.Cause(err, "parse max_version")
+		}
+		tlsConfig.MaxVersion = maxVersion
+	}
+	if options.CipherSuites != nil {
+	find:
+		for _, cipherSuite := range options.CipherSuites {
+			for _, tlsCipherSuite := range tls.CipherSuites() {
+				if cipherSuite == tlsCipherSuite.Name {
+					tlsConfig.CipherSuites = append(tlsConfig.CipherSuites, tlsCipherSuite.ID)
+					continue find
+				}
+			}
+			return nil, E.New("unknown cipher_suite: ", cipherSuite)
+		}
+	}
+	var certificate []byte
+	if options.Certificate != "" {
+		certificate = []byte(options.Certificate)
+	} else if options.CertificatePath != "" {
+		content, err := os.ReadFile(options.CertificatePath)
+		if err != nil {
+			return nil, E.Cause(err, "read certificate")
+		}
+		certificate = content
+	}
+	if len(certificate) > 0 {
+		certPool := x509.NewCertPool()
+		if !certPool.AppendCertsFromPEM(certificate) {
+			return nil, E.New("failed to parse certificate:\n\n", certificate)
+		}
+		tlsConfig.RootCAs = certPool
+	}
+	var id utls.ClientHelloID
+	switch options.UTLS.Fingerprint {
+	case "chrome", "":
+		id = utls.HelloChrome_Auto
+	case "firefox":
+		id = utls.HelloFirefox_Auto
+	case "ios":
+		id = utls.HelloIOS_Auto
+	case "android":
+		id = utls.HelloAndroid_11_OkHttp
+	case "random":
+		id = utls.HelloRandomized
+	}
+	return &utlsClientConfig{&tlsConfig, id}, nil
+}

common/tls/utls_stub.go

@@ -0,0 +1,13 @@
+//go:build !with_utls
+
+package tls
+
+import (
+	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/option"
+	E "github.com/sagernet/sing/common/exceptions"
+)
+
+func newUTLSClient(router adapter.Router, serverAddress string, options option.OutboundTLSOptions) (Config, error) {
+	return nil, E.New(`uTLS is not included in this build, rebuild with -tags with_utls`)
+}

constant/proxy.go

@@ -1,24 +1,26 @@
 package constant
 
 const (
-	TypeTun         = "tun"
-	TypeRedirect    = "redirect"
-	TypeTProxy      = "tproxy"
-	TypeDirect      = "direct"
-	TypeBlock       = "block"
-	TypeDNS         = "dns"
-	TypeSocks       = "socks"
-	TypeHTTP        = "http"
-	TypeMixed       = "mixed"
-	TypeShadowsocks = "shadowsocks"
-	TypeVMess       = "vmess"
-	TypeTrojan      = "trojan"
-	TypeNaive       = "naive"
-	TypeWireGuard   = "wireguard"
-	TypeHysteria    = "hysteria"
-	TypeTor         = "tor"
-	TypeSSH         = "ssh"
-	TypeShadowTLS   = "shadowtls"
+	TypeTun          = "tun"
+	TypeRedirect     = "redirect"
+	TypeTProxy       = "tproxy"
+	TypeDirect       = "direct"
+	TypeBlock        = "block"
+	TypeDNS          = "dns"
+	TypeSocks        = "socks"
+	TypeHTTP         = "http"
+	TypeMixed        = "mixed"
+	TypeShadowsocks  = "shadowsocks"
+	TypeVMess        = "vmess"
+	TypeTrojan       = "trojan"
+	TypeNaive        = "naive"
+	TypeWireGuard    = "wireguard"
+	TypeHysteria     = "hysteria"
+	TypeTor          = "tor"
+	TypeSSH          = "ssh"
+	TypeShadowTLS    = "shadowtls"
+	TypeShadowsocksR = "shadowsocksr"
+	TypeVLESS        = "vless"
 )
 
 const (

constant/version.go

@@ -1,6 +1,6 @@
 package constant
 
 var (
-	Version = "1.1-beta1"
+	Version = "1.1-beta4"
 	Commit  = ""
 )

docs/changelog.md

@@ -1,3 +1,49 @@
+#### 1.1-beta4
+
+* Add internal simple-obfs and v2ray-plugin [Shadowsocks plugins](/configuration/outbound/shadowsocks#plugin)
+* Add [ShadowsocksR outbound](/configuration/outbound/shadowsocksr)
+* Add [VLESS outbound and XUDP](/configuration/outbound/vless)
+* Skip wait for hysteria tcp handshake response
+* Fix socks4 client
+* Fix hysteria inbound
+* Fix concurrent write
+
+#### 1.0.3
+
+* Fix socks4 client
+* Fix hysteria inbound
+* Fix concurrent write
+
+#### 1.1-beta3
+
+* Fix using custom TLS client in http2 client
+* Fix bugs in 1.1-beta2
+
+#### 1.1-beta2
+
+* Add Clash mode and persistence support **1**
+* Add TLS ECH and uTLS support for outbound TLS options **2**
+* Fix socks4 request
+* Fix processing empty dns result
+
+*1*:
+
+Switching modes using the Clash API, and `store-selected` are now supported,
+see [Experimental](/configuration/experimental).
+
+*2*:
+
+ECH (Encrypted Client Hello) is a TLS extension that allows a client to encrypt the first part of its ClientHello
+message, see [TLS#ECH](/configuration/shared/tls#ech).
+
+uTLS is a fork of "crypto/tls", which provides ClientHello fingerprinting resistance,
+see [TLS#uTLS](/configuration/shared/tls#utls).
+
+#### 1.0.2
+
+* Fix socks4 request
+* Fix processing empty dns result
+
 #### 1.1-beta1
 
 * Add support for use with android VPNService **1**

docs/configuration/dns/rule.md

@@ -73,6 +73,7 @@
         "user_id": [
           1000
         ],
+        "clash_mode": "direct",
         "invert": false,
         "outbound": [
           "direct"
@@ -208,6 +209,10 @@ Match user name.
 
 Match user id.
 
+#### clash_mode
+
+Match Clash mode.
+
 #### invert
 
 Invert match result.

docs/configuration/dns/rule.zh.md

@@ -72,6 +72,7 @@
         "user_id": [
           1000
         ],
+        "clash_mode": "direct",
         "invert": false,
         "outbound": [
           "direct"
@@ -207,6 +208,10 @@
 
 匹配用户 ID。
 
+#### clash_mode
+
+匹配 Clash 模式。
+
 #### invert
 
 反选匹配结果。

docs/configuration/experimental/index.md

@@ -8,7 +8,10 @@
     "clash_api": {
       "external_controller": "127.0.0.1:9090",
       "external_ui": "folder",
-      "secret": ""
+      "secret": "",
+      "default_mode": "rule",
+      "store_selected": false,
+      "cache_file": "cache.db"
     }
   }
 }
@@ -26,7 +29,7 @@
 
 #### external_controller
 
-RESTful web API listening address. Disabled if empty.
+RESTful web API listening address. Clash API will be disabled if empty.
 
 #### external_ui
 
@@ -38,4 +41,22 @@ serve it at `http://{{external-controller}}/ui`.
 
 Secret for the RESTful API (optional)
 Authenticate by spedifying HTTP header `Authorization: Bearer ${secret}`
-ALWAYS set a secret if RESTful API is listening on 0.0.0.0
+ALWAYS set a secret if RESTful API is listening on 0.0.0.0
+
+#### default_mode
+
+Default mode in clash, `rule` will be used if empty.
+
+This setting has no direct effect, but can be used in routing and DNS rules via the `clash_mode` rule item.
+
+#### store_selected
+
+!!! note ""
+
+    The tag must be set for target outbounds.
+
+Store selected outbound for the `Selector` outbound in cache file.
+
+#### cache_file
+
+Cache file path, `cache.db` will be used if empty.

docs/configuration/experimental/index.zh.md

@@ -8,7 +8,10 @@
     "clash_api": {
       "external_controller": "127.0.0.1:9090",
       "external_ui": "folder",
-      "secret": ""
+      "secret": "",
+      "default_mode": "rule",
+      "store_selected": false,
+      "cache_file": "cache.db"
     }
   }
 }
@@ -26,7 +29,7 @@
 
 #### external_controller
 
-RESTful web API 监听地址。
+RESTful web API 监听地址。如果为空，则禁用 Clash API。
 
 #### external_ui
 
@@ -36,4 +39,22 @@ RESTful web API 监听地址。
 
 RESTful API 的密钥（可选）
 通过指定 HTTP 标头 `Authorization: Bearer ${secret}` 进行身份验证
-如果 RESTful API 正在监听 0.0.0.0，请始终设置一个密钥。
+如果 RESTful API 正在监听 0.0.0.0，请始终设置一个密钥。
+
+#### default_mode
+
+Clash 中的默认模式，默认使用 `rule`。
+
+此设置没有直接影响，但可以通过 `clash_mode` 规则项在路由和 DNS 规则中使用。
+
+#### store_selected
+
+!!! note ""
+
+    必须为目标出站设置标签。
+
+将 `Selector` 中出站的选定的目标出站存储在缓存文件中。
+
+#### cache_file
+
+缓存文件路径，默认使用`cache.db`。

docs/configuration/inbound/tun.md

@@ -11,7 +11,7 @@
   
   "interface_name": "tun0",
   "inet4_address": "172.19.0.1/30",
-  "inet6_address": "fdfe:dcba:9876::1/128",
+  "inet6_address": "fdfe:dcba:9876::1/126",
   "mtu": 9000,
   "auto_route": true,
   "strict_route": true,

docs/configuration/inbound/tun.zh.md

@@ -11,7 +11,7 @@
 
   "interface_name": "tun0",
   "inet4_address": "172.19.0.1/30",
-  "inet6_address": "fdfe:dcba:9876::1/128",
+  "inet6_address": "fdfe:dcba:9876::1/126",
   "mtu": 9000,
   "auto_route": true,
   "strict_route": true,

docs/configuration/outbound/shadowsocks.md

@@ -9,6 +9,8 @@
   "server_port": 1080,
   "method": "2022-blake3-aes-128-gcm",
   "password": "8JCsPssfgS8tiRwiMlhARg==",
+  "plugin": "",
+  "plugin_opts": "",
   "network": "udp",
   "udp_over_tcp": false,
   "multiplex": {},
@@ -65,6 +67,16 @@ Legacy encryption methods:
 
 The shadowsocks password.
 
+#### plugin
+
+Shadowsocks SIP003 plugin, implemented in internal.
+
+Only `obfs-local` and `v2ray-plugin` are supported.
+
+#### plugin_opts
+
+Shadowsocks SIP003 plugin options.
+
 #### network
 
 Enabled network

docs/configuration/outbound/shadowsocks.zh.md

@@ -9,6 +9,8 @@
   "server_port": 1080,
   "method": "2022-blake3-aes-128-gcm",
   "password": "8JCsPssfgS8tiRwiMlhARg==",
+  "plugin": "",
+  "plugin_opts": "",
   "network": "udp",
   "udp_over_tcp": false,
   "multiplex": {},
@@ -65,6 +67,16 @@
 
 Shadowsocks 密码。
 
+#### plugin
+
+Shadowsocks SIP003 插件，由内部实现。
+
+仅支持 `obfs-local` 和 `v2ray-plugin`。
+
+#### plugin_opts
+
+Shadowsocks SIP003 插件参数。
+
 #### network
 
 启用的网络协议

docs/configuration/outbound/shadowsocksr.md

@@ -0,0 +1,106 @@
+### Structure
+
+```json
+{
+  "type": "shadowsocksr",
+  "tag": "ssr-out",
+  
+  "server": "127.0.0.1",
+  "server_port": 1080,
+  "method": "aes-128-cfb",
+  "password": "8JCsPssfgS8tiRwiMlhARg==",
+  "obfs": "plain",
+  "obfs_param": "",
+  "protocol": "origin",
+  "protocol_param": "",
+  "network": "udp",
+
+  ... // Dial Fields
+}
+```
+
+!!! warning ""
+
+    The ShadowsocksR protocol is obsolete and unmaintained. This outbound is provided for compatibility only.
+
+!!! warning ""
+
+    ShadowsocksR is not included by default, see [Installation](/#installation).
+
+### Fields
+
+#### server
+
+==Required==
+
+The server address.
+
+#### server_port
+
+==Required==
+
+The server port.
+
+#### method
+
+==Required==
+
+Encryption methods:
+
+* `aes-128-ctr`
+* `aes-192-ctr`
+* `aes-256-ctr`
+* `aes-128-cfb`
+* `aes-192-cfb`
+* `aes-256-cfb`
+* `rc4-md5`
+* `chacha20-ietf`
+* `xchacha20`
+
+#### password
+
+==Required==
+
+The shadowsocks password.
+
+#### obfs
+
+The ShadowsocksR obfuscate.
+
+* plain
+* http_simple
+* http_post
+* random_head
+* tls1.2_ticket_auth
+
+#### obfs_param
+
+The ShadowsocksR obfuscate parameter.
+
+#### protocol
+
+The ShadowsocksR protocol.
+
+* origin
+* verify_sha1
+* auth_sha1_v4
+* auth_aes128_md5
+* auth_aes128_sha1
+* auth_chain_a
+* auth_chain_b
+
+#### protocol_param
+
+The ShadowsocksR protocol parameter.
+
+#### network
+
+Enabled network
+
+One of `tcp` `udp`.
+
+Both is enabled by default.
+
+### Dial Fields
+
+See [Dial Fields](/configuration/shared/dial) for details.

docs/configuration/outbound/shadowsocksr.zh.md

@@ -0,0 +1,106 @@
+### 结构
+
+```json
+{
+  "type": "shadowsocksr",
+  "tag": "ssr-out",
+
+  "server": "127.0.0.1",
+  "server_port": 1080,
+  "method": "aes-128-cfb",
+  "password": "8JCsPssfgS8tiRwiMlhARg==",
+  "obfs": "plain",
+  "obfs_param": "",
+  "protocol": "origin",
+  "protocol_param": "",
+  "network": "udp",
+
+  ... // 拨号字段
+}
+```
+
+!!! warning ""
+
+    ShadowsocksR 协议已过时且无人维护。 提供此出站仅出于兼容性目的。
+
+!!! warning ""
+
+    默认安装不包含被 ShadowsocksR，参阅 [安装](/zh/#_2)。
+
+### 字段
+
+#### server
+
+==必填==
+
+服务器地址。
+
+#### server_port
+
+==必填==
+
+服务器端口。
+
+#### method
+
+==必填==
+
+加密方法：
+
+* `aes-128-ctr`
+* `aes-192-ctr`
+* `aes-256-ctr`
+* `aes-128-cfb`
+* `aes-192-cfb`
+* `aes-256-cfb`
+* `rc4-md5`
+* `chacha20-ietf`
+* `xchacha20`
+
+#### password
+
+==必填==
+
+Shadowsocks 密码。
+
+#### obfs
+
+ShadowsocksR 混淆。
+
+* plain
+* http_simple
+* http_post
+* random_head
+* tls1.2_ticket_auth
+
+#### obfs_param
+
+ShadowsocksR 混淆参数。
+
+#### protocol
+
+ShadowsocksR 协议。
+
+* origin
+* verify_sha1
+* auth_sha1_v4
+* auth_aes128_md5
+* auth_aes128_sha1
+* auth_chain_a
+* auth_chain_b
+
+#### protocol_param
+
+ShadowsocksR 协议参数。
+
+#### network
+
+启用的网络协议
+
+`tcp` 或 `udp`。
+
+默认所有。
+
+### 拨号字段
+
+参阅 [拨号字段](/zh/configuration/shared/dial/)。

docs/configuration/outbound/vless.md

@@ -0,0 +1,70 @@
+### Structure
+
+```json
+{
+  "type": "vless",
+  "tag": "vless-out",
+  
+  "server": "127.0.0.1",
+  "server_port": 1080,
+  "uuid": "bf000d23-0752-40b4-affe-68f7707a9661",
+  "network": "tcp",
+  "tls": {},
+  "packet_encoding": "",
+  "transport": {},
+
+  ... // Dial Fields
+}
+```
+
+!!! warning ""
+
+    The VLESS protocol is architecturally coupled to v2ray and is unmaintained. This outbound is provided for compatibility purposes only.
+
+### Fields
+
+#### server
+
+==Required==
+
+The server address.
+
+#### server_port
+
+==Required==
+
+The server port.
+
+#### uuid
+
+==Required==
+
+The VLESS user id.
+
+#### network
+
+Enabled network
+
+One of `tcp` `udp`.
+
+Both is enabled by default.
+
+#### tls
+
+TLS configuration, see [TLS](/configuration/shared/tls/#outbound).
+
+#### packet_encoding
+
+| Encoding   | Description           |
+|------------|-----------------------|
+| (none)     | Disabled              |
+| packetaddr | Supported by v2ray 5+ |
+| xudp       | Supported by xray     |
+
+#### transport
+
+V2Ray Transport configuration, see [V2Ray Transport](/configuration/shared/v2ray-transport).
+
+### Dial Fields
+
+See [Dial Fields](/configuration/shared/dial) for details.

docs/configuration/outbound/vless.zh.md

@@ -0,0 +1,70 @@
+### 结构
+
+```json
+{
+  "type": "vless",
+  "tag": "vless-out",
+
+  "server": "127.0.0.1",
+  "server_port": 1080,
+  "uuid": "bf000d23-0752-40b4-affe-68f7707a9661",
+  "network": "tcp",
+  "tls": {},
+  "packet_encoding": "",
+  "transport": {},
+  
+  ... // 拨号字段
+}
+```
+
+!!! warning ""
+
+    VLESS 协议与 v2ray 架构耦合且无人维护。 提供此出站仅出于兼容性目的。
+
+### 字段
+
+#### server
+
+==必填==
+
+服务器地址。
+
+#### server_port
+
+==必填==
+
+服务器端口。
+
+#### uuid
+
+==必填==
+
+VLESS 用户 ID。
+
+#### network
+
+启用的网络协议。
+
+`tcp` 或 `udp`。
+
+默认所有。
+
+#### tls
+
+TLS 配置, 参阅 [TLS](/zh/configuration/shared/tls/#outbound)。
+
+#### packet_encoding
+
+| 编码         | 描述            |
+|------------|---------------|
+| (空)        | 禁用            |
+| packetaddr | 由 v2ray 5+ 支持 |
+| xudp       | 由 xray 支持     |
+
+#### transport
+
+V2Ray 传输配置，参阅 [V2Ray 传输层](/zh/configuration/shared/v2ray-transport)。
+
+### 拨号字段
+
+参阅 [拨号字段](/zh/configuration/shared/dial/)。

docs/configuration/route/rule.md

@@ -80,6 +80,7 @@
         "user_id": [
           1000
         ],
+        "clash_mode": "direct",
         "invert": false,
         "outbound": "direct"
       },
@@ -219,6 +220,10 @@ Match user name.
 
 Match user id.
 
+#### clash_mode
+
+Match Clash mode.
+
 #### invert
 
 Invert match result.

docs/configuration/route/rule.zh.md

@@ -78,6 +78,7 @@
         "user_id": [
           1000
         ],
+        "clash_mode": "direct",
         "invert": false,
         "outbound": "direct"
       },
@@ -217,6 +218,10 @@
 
 匹配用户 ID。
 
+#### clash_mode
+
+匹配 Clash 模式。
+
 #### invert
 
 反选匹配结果。

docs/configuration/shared/tls.md

@@ -30,10 +30,6 @@
 }
 ```
 
-!!! warning ""
-
-    ACME is not included by default, see [Installation](/#installation).
-
 ### Outbound
 
 ```json
@@ -47,7 +43,17 @@
   "max_version": "",
   "cipher_suites": [],
   "certificate": "",
-  "certificate_path": ""
+  "certificate_path": "",
+  "ech": {
+    "enabled": false,
+    "pq_signature_schemes_enabled": false,
+    "dynamic_record_sizing_disabled": false,
+    "config": ""
+  },
+  "utls": {
+    "enabled": false,
+    "fingerprint": ""
+  }
 }
 ```
 
@@ -155,8 +161,48 @@ The server private key, in PEM format.
 
 The path to the server private key, in PEM format.
 
+#### ech
+
+==Client only==
+
+!!! warning ""
+
+    ECH is not included by default, see [Installation](/#installation).
+
+ECH (Encrypted Client Hello) is a TLS extension that allows a client to encrypt the first part of its ClientHello
+message.
+
+If you don't know how to fill in the other configuration, just set `enabled`.
+
+#### utls
+
+==Client only==
+
+!!! warning ""
+
+    uTLS is not included by default, see [Installation](/#installation).
+
+!!! note ""
+
+    uTLS is poorly maintained and the effect may be unproven, use at your own risk.
+
+uTLS is a fork of "crypto/tls", which provides ClientHello fingerprinting resistance.
+
+Available fingerprint values:
+
+* chrome
+* firefox
+* ios
+* android
+* random
+
+
 ### ACME Fields
 
+!!! warning ""
+
+    ACME is not included by default, see [Installation](/#installation).
+
 #### domain
 
 List of domain.
@@ -205,10 +251,6 @@ listener for the HTTP challenge.
 The alternate port to use for the ACME TLS-ALPN challenge; the system must forward 443 to this port for challenge to
 succeed.
 
-### Reload
-
-For server configuration, certificate and key will be automatically reloaded if modified.
-
 #### external_account
 
 EAB (External Account Binding) contains information necessary to bind or map an ACME account to some other account known
@@ -226,4 +268,8 @@ The key identifier.
 
 #### external_account.mac_key
 
-The MAC key.
+The MAC key.
+
+### Reload
+
+For server configuration, certificate and key will be automatically reloaded if modified.

docs/configuration/shared/tls.zh.md

@@ -30,10 +30,6 @@
 }
 ```
 
-!!! warning ""
-
-    默认安装不包含 ACME，参阅 [安装](/zh/#_2)。
-
 ### 出站
 
 ```json
@@ -47,7 +43,17 @@
   "max_version": "",
   "cipher_suites": [],
   "certificate": "",
-  "certificate_path": ""
+  "certificate_path": "",
+  "ech": {
+    "enabled": false,
+    "pq_signature_schemes_enabled": false,
+    "dynamic_record_sizing_disabled": false,
+    "config": ""
+  },
+  "utls": {
+    "enabled": false,
+    "fingerprint": ""
+  }
 }
 ```
 
@@ -155,8 +161,47 @@ TLS 版本值：
 
 服务器 PEM 私钥路径。
 
+#### ech
+
+==仅客户端==
+
+!!! warning ""
+
+    默认安装不包含 ECH, 参阅 [安装](/zh/#_2)。
+
+ECH (Encrypted Client Hello) 是一个 TLS 扩展，它允许客户端加密其 ClientHello 的第一部分
+信息。
+
+如果您不知道如何填写其他配置，只需设置 `enabled` 即可。
+
+#### utls
+
+==仅客户端==
+
+!!! warning ""
+
+    默认安装不包含 uTLS, 参阅 [安装](/zh/#_2)。
+
+!!! note ""
+
+    uTLS 维护不善且其效果可能未经证实，使用风险自负。
+
+uTLS 是 "crypto/tls" 的一个分支，它提供了 ClientHello 指纹识别阻力。
+
+可用的指纹值：
+
+* chrome
+* firefox
+* ios
+* android
+* random
+
 ### ACME 字段
 
+!!! warning ""
+
+    默认安装不包含 ACME，参阅 [安装](/zh/#_2)。
+
 #### domain
 
 一组域名。
@@ -203,10 +248,6 @@ ACME 数据目录。
 
 用于 ACME TLS-ALPN 质询的备用端口； 系统必须将 443 转发到此端口以使质询成功。
 
-### Reload
-
-对于服务器配置，如果修改，证书和密钥将自动重新加载。
-
 #### external_account
 
 EAB（外部帐户绑定）包含将 ACME 帐户绑定或映射到其他已知帐户所需的信息由 CA。
@@ -222,4 +263,8 @@ EAB（外部帐户绑定）包含将 ACME 帐户绑定或映射到其他已知
 
 #### external_account.mac_key
 
-MAC 密钥。
+MAC 密钥。
+
+### 重载
+
+对于服务器配置，如果修改，证书和密钥将自动重新加载。

docs/index.md

@@ -27,6 +27,9 @@ go install -v -tags with_clash_api github.com/sagernet/sing-box/cmd/sing-box@lat
 | `with_quic`                        | Build with QUIC support, see [QUIC and HTTP3 dns transports](./configuration/dns/server), [Naive inbound](./configuration/inbound/naive), [Hysteria Inbound](./configuration/inbound/hysteria), [Hysteria Outbound](./configuration/outbound/hysteria) and [V2Ray Transport#QUIC](./configuration/shared/v2ray-transport#quic). |
 | `with_grpc`                        | Build with standard gRPC support, see [V2Ray Transport#gRPC](./configuration/shared/v2ray-transport#grpc).                                                                                                                                                                                                                      |
 | `with_wireguard`                   | Build with WireGuard support, see [WireGuard outbound](./configuration/outbound/wireguard).                                                                                                                                                                                                                                     |
+| `with_shadowsocksr`                | Build with ShadowsocksR support, see [ShadowsocksR outbound](./configuration/outbound/shadowsocksr).                                                                                                                                                                                                                            |
+| `with_ech`                         | Build with TLS ECH extension support for TLS outbound, see [TLS](./configuration/shared/tls#ech).                                                                                                                                                                                                                               |
+| `with_utls`                        | Build with [uTLS](https://github.com/refraction-networking/utls) support for TLS outbound, see [TLS](./configuration/shared/tls#utls).                                                                                                                                                                                          |
 | `with_acme`                        | Build with ACME TLS certificate issuer support, see [TLS](./configuration/shared/tls).                                                                                                                                                                                                                                          |
 | `with_clash_api`                   | Build with Clash API support, see [Experimental](./configuration/experimental#clash-api-fields).                                                                                                                                                                                                                                |
 | `no_gvisor`                        | Build without gVisor Tun stack support, see [Tun inbound](./configuration/inbound/tun#stack).                                                                                                                                                                                                                                   |

docs/index.zh.md

@@ -27,6 +27,9 @@ go install -v -tags with_clash_api github.com/sagernet/sing-box/cmd/sing-box@lat
 | `with_quic`                  | 启用 QUIC 支持，参阅 [QUIC 和 HTTP3 DNS 传输层](./configuration/dns/server)，[Naive 入站](./configuration/inbound/naive)，[Hysteria 入站](./configuration/inbound/hysteria)，[Hysteria 出站](./configuration/outbound/hysteria) 和 [V2Ray 传输层#QUIC](./configuration/shared/v2ray-transport#quic)。 |
 | `with_grpc`                  | 启用标准 gRPC 支持，参阅 [V2Ray 传输层#gRPC](./configuration/shared/v2ray-transport#grpc)。                                                                                                                                                                                               |
 | `with_wireguard`             | 启用 WireGuard 支持，参阅 [WireGuard 出站](./configuration/outbound/wireguard)。                                                                                                                                                                                                       |
+| `with_shadowsocksr`          | 启用 ShadowsocksR 支持，参阅 [ShadowsocksR 出站](./configuration/outbound/shadowsocksr)。                                                                                                                                                                                              |
+| `with_ech`                   | 启用 TLS ECH 扩展支持，参阅 [TLS](./configuration/shared/tls#ech)。                                                                                                                                                                                                                    |
+| `with_utls`                  | 启用 [uTLS](https://github.com/refraction-networking/utls) 支持， 参阅 [TLS](./configuration/shared/tls#utls)。                                                                                                                                                                      |
 | `with_acme`                  | 启用 ACME TLS 证书签发支持，参阅 [TLS](./configuration/shared/tls)。                                                                                                                                                                                                                     |
 | `with_clash_api`             | 启用 Clash api 支持，参阅 [实验性](./configuration/experimental#clash-api-fields)。                                                                                                                                                                                                     |
 | `no_gvisor`                  | 禁用 gVisor Tun 栈支持，参阅 [Tun 入站](./configuration/inbound/tun#stack)。                                                                                                                                                                                                            |

experimental/clashapi.go

@@ -10,5 +10,5 @@ import (
 )
 
 func NewClashServer(router adapter.Router, logFactory log.ObservableFactory, options option.ClashAPIOptions) (adapter.ClashServer, error) {
-	return clashapi.NewServer(router, logFactory, options), nil
+	return clashapi.NewServer(router, logFactory, options)
 }

experimental/clashapi/cachefile/cache.go

@@ -0,0 +1,61 @@
+package cachefile
+
+import (
+	"os"
+	"time"
+
+	"github.com/sagernet/sing-box/adapter"
+
+	"go.etcd.io/bbolt"
+)
+
+var bucketSelected = []byte("selected")
+
+var _ adapter.ClashCacheFile = (*CacheFile)(nil)
+
+type CacheFile struct {
+	DB *bbolt.DB
+}
+
+func Open(path string) (*CacheFile, error) {
+	const fileMode = 0o666
+	options := bbolt.Options{Timeout: time.Second}
+	db, err := bbolt.Open(path, fileMode, &options)
+	switch err {
+	case bbolt.ErrInvalid, bbolt.ErrChecksum, bbolt.ErrVersionMismatch:
+		if err = os.Remove(path); err != nil {
+			break
+		}
+		db, err = bbolt.Open(path, 0o666, &options)
+	}
+	if err != nil {
+		return nil, err
+	}
+	return &CacheFile{db}, nil
+}
+
+func (c *CacheFile) LoadSelected(group string) string {
+	var selected string
+	c.DB.View(func(t *bbolt.Tx) error {
+		bucket := t.Bucket(bucketSelected)
+		if bucket == nil {
+			return nil
+		}
+		selectedBytes := bucket.Get([]byte(group))
+		if len(selectedBytes) > 0 {
+			selected = string(selectedBytes)
+		}
+		return nil
+	})
+	return selected
+}
+
+func (c *CacheFile) StoreSelected(group, selected string) error {
+	return c.DB.Batch(func(t *bbolt.Tx) error {
+		bucket, err := t.CreateBucketIfNotExists(bucketSelected)
+		if err != nil {
+			return err
+		}
+		return bucket.Put([]byte(group), []byte(selected))
+	})
+}

experimental/clashapi/configs.go

@@ -2,6 +2,7 @@ package clashapi
 
 import (
 	"net/http"
+	"strings"
 
 	"github.com/sagernet/sing-box/log"
 
@@ -9,11 +10,11 @@ import (
 	"github.com/go-chi/render"
 )
 
-func configRouter(logFactory log.Factory) http.Handler {
+func configRouter(server *Server, logFactory log.Factory, logger log.Logger) http.Handler {
 	r := chi.NewRouter()
-	r.Get("/", getConfigs(logFactory))
+	r.Get("/", getConfigs(server, logFactory))
 	r.Put("/", updateConfigs)
-	r.Patch("/", patchConfigs)
+	r.Patch("/", patchConfigs(server, logger))
 	return r
 }
 
@@ -31,7 +32,7 @@ type configSchema struct {
 	Tun         map[string]any `json:"tun"`
 }
 
-func getConfigs(logFactory log.Factory) func(w http.ResponseWriter, r *http.Request) {
+func getConfigs(server *Server, logFactory log.Factory) func(w http.ResponseWriter, r *http.Request) {
 	return func(w http.ResponseWriter, r *http.Request) {
 		logLevel := logFactory.Level()
 		if logLevel == log.LevelTrace {
@@ -40,15 +41,31 @@ func getConfigs(logFactory log.Factory) func(w http.ResponseWriter, r *http.Requ
 			logLevel = log.LevelError
 		}
 		render.JSON(w, r, &configSchema{
-			Mode:        "rule",
+			Mode:        server.mode,
 			BindAddress: "*",
 			LogLevel:    log.FormatLevel(logLevel),
 		})
 	}
 }
 
-func patchConfigs(w http.ResponseWriter, r *http.Request) {
-	render.NoContent(w, r)
+func patchConfigs(server *Server, logger log.Logger) func(w http.ResponseWriter, r *http.Request) {
+	return func(w http.ResponseWriter, r *http.Request) {
+		var newConfig configSchema
+		err := render.DecodeJSON(r.Body, &newConfig)
+		if err != nil {
+			render.Status(r, http.StatusBadRequest)
+			render.JSON(w, r, ErrBadRequest)
+			return
+		}
+		if newConfig.Mode != "" {
+			mode := strings.ToLower(newConfig.Mode)
+			if server.mode != mode {
+				server.mode = mode
+				logger.Info("updated mode: ", mode)
+			}
+		}
+		render.NoContent(w, r)
+	}
 }
 
 func updateConfigs(w http.ResponseWriter, r *http.Request) {

experimental/clashapi/connections.go

@@ -8,10 +8,10 @@ import (
 
 	"github.com/sagernet/sing-box/common/json"
 	"github.com/sagernet/sing-box/experimental/clashapi/trafficontrol"
+	"github.com/sagernet/websocket"
 
 	"github.com/go-chi/chi/v5"
 	"github.com/go-chi/render"
-	"github.com/gorilla/websocket"
 )
 
 func connectionRouter(trafficManager *trafficontrol.Manager) http.Handler {

experimental/clashapi/server.go

@@ -14,6 +14,7 @@ import (
 	"github.com/sagernet/sing-box/common/json"
 	"github.com/sagernet/sing-box/common/urltest"
 	C "github.com/sagernet/sing-box/constant"
+	"github.com/sagernet/sing-box/experimental/clashapi/cachefile"
 	"github.com/sagernet/sing-box/experimental/clashapi/trafficontrol"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
@@ -21,11 +22,11 @@ import (
 	E "github.com/sagernet/sing/common/exceptions"
 	F "github.com/sagernet/sing/common/format"
 	N "github.com/sagernet/sing/common/network"
+	"github.com/sagernet/websocket"
 
 	"github.com/go-chi/chi/v5"
 	"github.com/go-chi/cors"
 	"github.com/go-chi/render"
-	"github.com/gorilla/websocket"
 )
 
 var _ adapter.ClashServer = (*Server)(nil)
@@ -37,9 +38,12 @@ type Server struct {
 	trafficManager *trafficontrol.Manager
 	urlTestHistory *urltest.HistoryStorage
 	tcpListener    net.Listener
+	mode           string
+	storeSelected  bool
+	cacheFile      adapter.ClashCacheFile
 }
 
-func NewServer(router adapter.Router, logFactory log.ObservableFactory, options option.ClashAPIOptions) *Server {
+func NewServer(router adapter.Router, logFactory log.ObservableFactory, options option.ClashAPIOptions) (*Server, error) {
 	trafficManager := trafficontrol.NewManager()
 	chiRouter := chi.NewRouter()
 	server := &Server{
@@ -51,6 +55,21 @@ func NewServer(router adapter.Router, logFactory log.ObservableFactory, options
 		},
 		trafficManager: trafficManager,
 		urlTestHistory: urltest.NewHistoryStorage(),
+		mode:           strings.ToLower(options.DefaultMode),
+	}
+	if server.mode == "" {
+		server.mode = "rule"
+	}
+	if options.StoreSelected {
+		cachePath := os.ExpandEnv(options.CacheFile)
+		if cachePath == "" {
+			cachePath = "cache.db"
+		}
+		cacheFile, err := cachefile.Open(cachePath)
+		if err != nil {
+			return nil, E.Cause(err, "open cache file")
+		}
+		server.cacheFile = cacheFile
 	}
 	cors := cors.New(cors.Options{
 		AllowedOrigins: []string{"*"},
@@ -65,7 +84,7 @@ func NewServer(router adapter.Router, logFactory log.ObservableFactory, options
 		r.Get("/logs", getLogs(logFactory))
 		r.Get("/traffic", traffic(trafficManager))
 		r.Get("/version", version)
-		r.Mount("/configs", configRouter(logFactory))
+		r.Mount("/configs", configRouter(server, logFactory, server.logger))
 		r.Mount("/proxies", proxyRouter(server, router))
 		r.Mount("/rules", ruleRouter(router))
 		r.Mount("/connections", connectionRouter(trafficManager))
@@ -84,7 +103,7 @@ func NewServer(router adapter.Router, logFactory log.ObservableFactory, options
 			})
 		})
 	}
-	return server
+	return server, nil
 }
 
 func (s *Server) Start() error {
@@ -108,9 +127,22 @@ func (s *Server) Close() error {
 		common.PtrOrNil(s.httpServer),
 		s.tcpListener,
 		s.trafficManager,
+		s.cacheFile,
 	)
 }
 
+func (s *Server) Mode() string {
+	return s.mode
+}
+
+func (s *Server) StoreSelected() bool {
+	return s.storeSelected
+}
+
+func (s *Server) CacheFile() adapter.ClashCacheFile {
+	return s.cacheFile
+}
+
 func (s *Server) RoutedConnection(ctx context.Context, conn net.Conn, metadata adapter.InboundContext, matchedRule adapter.Rule) (net.Conn, adapter.Tracker) {
 	tracker := trafficontrol.NewTCPTracker(conn, s.trafficManager, castMetadata(metadata), s.router, matchedRule)
 	return tracker, tracker

go.mod

@@ -4,6 +4,7 @@ go 1.18
 
 require (
 	berty.tech/go-libtor v1.0.385
+	github.com/cloudflare/circl v1.2.1-0.20220831060716-4cf0150356fc
 	github.com/cretz/bine v0.2.0
 	github.com/database64128/tfo-go v1.1.2
 	github.com/dustin/go-humanize v1.0.0
@@ -11,28 +12,32 @@ require (
 	github.com/go-chi/chi/v5 v5.0.7
 	github.com/go-chi/cors v1.2.1
 	github.com/go-chi/render v1.0.2
-	github.com/gofrs/uuid v4.2.0+incompatible
-	github.com/gorilla/websocket v1.5.0
+	github.com/gofrs/uuid v4.3.0+incompatible
 	github.com/hashicorp/yamux v0.1.1
 	github.com/logrusorgru/aurora v2.0.3+incompatible
 	github.com/mholt/acmez v1.0.4
+	github.com/miekg/dns v1.1.50
 	github.com/oschwald/maxminddb-golang v1.10.0
 	github.com/pires/go-proxyproto v0.6.2
+	github.com/refraction-networking/utls v1.1.2
 	github.com/sagernet/certmagic v0.0.0-20220819042630-4a57f8b6853a
 	github.com/sagernet/quic-go v0.0.0-20220818150011-de611ab3e2bb
-	github.com/sagernet/sing v0.0.0-20220905164441-f3d346256d4a
+	github.com/sagernet/shadowsocksr v0.0.0-20220912092645-c9ab93f81bb0
+	github.com/sagernet/sing v0.0.0-20220913004915-27ddefbb8921
 	github.com/sagernet/sing-dns v0.0.0-20220822023312-3e086b06d666
 	github.com/sagernet/sing-shadowsocks v0.0.0-20220819002358-7461bb09a8f6
-	github.com/sagernet/sing-tun v0.0.0-20220909054347-575ac2941790
-	github.com/sagernet/sing-vmess v0.0.0-20220907073918-72d7fdf6825f
-	github.com/sagernet/smux v0.0.0-20220907034654-1acb8471c15a
+	github.com/sagernet/sing-tun v0.0.0-20220911034209-c7dd5d457e24
+	github.com/sagernet/sing-vmess v0.0.0-20220913015714-c4ab86d40e12
+	github.com/sagernet/smux v0.0.0-20220831015742-e0f1988e3195
+	github.com/sagernet/websocket v0.0.0-20220913015213-615516348b4e
 	github.com/spf13/cobra v1.5.0
 	github.com/stretchr/testify v1.8.0
+	go.etcd.io/bbolt v1.3.6
 	go.uber.org/atomic v1.10.0
 	go4.org/netipx v0.0.0-20220812043211-3cc044ffd68d
 	golang.org/x/crypto v0.0.0-20220829220503-c86fa9a7ed90
-	golang.org/x/net v0.0.0-20220907135653-1e95f45603a7
-	golang.org/x/sys v0.0.0-20220908164124-27713097b956
+	golang.org/x/net v0.0.0-20220909164309-bea034e7d591
+	golang.org/x/sys v0.0.0-20220909162455-aba9fc2a8ff2
 	golang.zx2c4.com/wireguard v0.0.0-20220904105730-b51010ba13f0
 	google.golang.org/grpc v1.49.0
 	google.golang.org/protobuf v1.28.1
@@ -43,12 +48,14 @@ require (
 
 require (
 	github.com/ajg/form v1.5.1 // indirect
+	github.com/andybalholm/brotli v1.0.4 // indirect
 	github.com/davecgh/go-spew v1.1.1 // indirect
 	github.com/go-task/slim-sprig v0.0.0-20210107165309-348f09dbbbc0 // indirect
 	github.com/golang/mock v1.6.0 // indirect
 	github.com/golang/protobuf v1.5.2 // indirect
 	github.com/google/btree v1.0.1 // indirect
 	github.com/inconshreveable/mousetrap v1.0.0 // indirect
+	github.com/klauspost/compress v1.13.6 // indirect
 	github.com/klauspost/cpuid/v2 v2.1.0 // indirect
 	github.com/libdns/libdns v0.2.1 // indirect
 	github.com/marten-seemann/qpack v0.2.1 // indirect

go.sum

@@ -5,11 +5,15 @@ cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMT
 github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
 github.com/ajg/form v1.5.1 h1:t9c7v8JUKu/XxOGBU0yjNpaMloxGEJhUkqFRq0ibGeU=
 github.com/ajg/form v1.5.1/go.mod h1:uL1WgH+h2mgNtvBq0339dVnzXdBETtL2LeUXaIv25UY=
+github.com/andybalholm/brotli v1.0.4 h1:V7DdXeJtZscaqfNuAdSRuRFzuiKlHSC/Zh3zl9qY3JY=
+github.com/andybalholm/brotli v1.0.4/go.mod h1:fO7iG3H7G2nSZ7m0zPUDn85XEX2GTukHGRSepvi9Eig=
 github.com/antihax/optional v1.0.0/go.mod h1:uupD/76wgC+ih3iEmQUL+0Ugr19nfwCT1kdvxnR2qWY=
 github.com/benbjohnson/clock v1.1.0 h1:Q92kusRqC1XV2MjkWETPvjJVqKetz1OzxZB7mHJLju8=
 github.com/benbjohnson/clock v1.1.0/go.mod h1:J11/hYXuz8f4ySSvYwY0FKfm+ezbsZBKZxNJlLklBHA=
 github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU=
 github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
+github.com/cloudflare/circl v1.2.1-0.20220831060716-4cf0150356fc h1:307gdRLiZ08dwOIKwc5lAQ19DRFaQQvdhHalyB4Asx8=
+github.com/cloudflare/circl v1.2.1-0.20220831060716-4cf0150356fc/go.mod h1:+CauBF6R70Jqcyl8N2hC8pAXYbWkGIezuSbuGLtRhnw=
 github.com/cncf/udpa/go v0.0.0-20191209042840-269d4d468f6f/go.mod h1:M8M6+tZqaGXZJjfX53e64911xZQV5JYwmTeXPW+k8Sc=
 github.com/cncf/udpa/go v0.0.0-20201120205902-5459f2c99403/go.mod h1:WmhPx2Nbnhtbo57+VJT5O0JRkEi1Wbu0z5j0R8u5Hbk=
 github.com/cncf/xds/go v0.0.0-20210312221358-fbca930ec8ed/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs=
@@ -43,8 +47,8 @@ github.com/go-chi/render v1.0.2 h1:4ER/udB0+fMWB2Jlf15RV3F4A2FDuYi/9f+lFttR/Lg=
 github.com/go-chi/render v1.0.2/go.mod h1:/gr3hVkmYR0YlEy3LxCuVRFzEu9Ruok+gFqbIofjao0=
 github.com/go-task/slim-sprig v0.0.0-20210107165309-348f09dbbbc0 h1:p104kn46Q8WdvHunIJ9dAyjPVtrBPhSr3KT2yUst43I=
 github.com/go-task/slim-sprig v0.0.0-20210107165309-348f09dbbbc0/go.mod h1:fyg7847qk6SyHyPtNmDHnmrv/HOrqktSC+C9fM+CJOE=
-github.com/gofrs/uuid v4.2.0+incompatible h1:yyYWMnhkhrKwwr8gAOcOCYxOOscHgDS9yZgBrnJfGa0=
-github.com/gofrs/uuid v4.2.0+incompatible/go.mod h1:b2aQJv3Z4Fp6yNu3cdSllBxTCLRxnplIgP/c0N/04lM=
+github.com/gofrs/uuid v4.3.0+incompatible h1:CaSVZxm5B+7o45rtab4jC2G37WGYX1zQfuU2i6DSvnc=
+github.com/gofrs/uuid v4.3.0+incompatible/go.mod h1:b2aQJv3Z4Fp6yNu3cdSllBxTCLRxnplIgP/c0N/04lM=
 github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
 github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
 github.com/golang/mock v1.6.0 h1:ErTB+efbowRARo13NNdxyJji2egdxLGQhRaY+DUumQc=
@@ -73,14 +77,14 @@ github.com/google/go-cmp v0.5.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/
 github.com/google/go-cmp v0.5.5/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
 github.com/google/go-cmp v0.5.8 h1:e6P7q2lk1O+qJJb4BtCQXlK8vWEO8V1ZeuEdJNOqZyg=
 github.com/google/uuid v1.1.2/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
-github.com/gorilla/websocket v1.5.0 h1:PPwGk2jz7EePpoHN/+ClbZu8SPxiqlu12wZP/3sWmnc=
-github.com/gorilla/websocket v1.5.0/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE=
 github.com/grpc-ecosystem/grpc-gateway v1.16.0/go.mod h1:BDjrQk3hbvj6Nolgz8mAMFbcEtjT1g+wF4CSlocrBnw=
 github.com/hashicorp/yamux v0.1.1 h1:yrQxtgseBDrq9Y652vSRDvsKCJKOUD+GzTS4Y0Y8pvE=
 github.com/hashicorp/yamux v0.1.1/go.mod h1:CtWFDAQgb7dxtzFs4tWbplKIe2jSi3+5vKbgIO0SLnQ=
 github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU=
 github.com/inconshreveable/mousetrap v1.0.0 h1:Z8tu5sraLXCXIcARxBp/8cbvlwVa7Z1NHg9XEKhtSvM=
 github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8=
+github.com/klauspost/compress v1.13.6 h1:P76CopJELS0TiO2mebmnzgWaajssP/EszplttgQxcgc=
+github.com/klauspost/compress v1.13.6/go.mod h1:/3/Vjq9QcHkK5uEr5lBEmyoZ1iFhe47etQ6QUkpK6sk=
 github.com/klauspost/cpuid/v2 v2.0.9/go.mod h1:FInQzS24/EEf25PyTYn52gqo7WaD8xa0213Md/qVLRg=
 github.com/klauspost/cpuid/v2 v2.1.0 h1:eyi1Ad2aNJMW95zcSbmGg7Cg6cq3ADwLpMAP96d8rF0=
 github.com/klauspost/cpuid/v2 v2.1.0/go.mod h1:RVVoqg1df56z8g3pUjL/3lE5UfnlrJX8tyFgg4nqhuY=
@@ -101,6 +105,8 @@ github.com/marten-seemann/qtls-go1-19 v0.1.0 h1:rLFKD/9mp/uq1SYGYuVZhm83wkmU95pK
 github.com/marten-seemann/qtls-go1-19 v0.1.0/go.mod h1:5HTDWtVudo/WFsHKRNuOhWlbdjrfs5JHrYb0wIJqGpI=
 github.com/mholt/acmez v1.0.4 h1:N3cE4Pek+dSolbsofIkAYz6H1d3pE+2G0os7QHslf80=
 github.com/mholt/acmez v1.0.4/go.mod h1:qFGLZ4u+ehWINeJZjzPlsnjJBCPAADWTcIqE/7DAYQY=
+github.com/miekg/dns v1.1.50 h1:DQUfb9uc6smULcREF09Uc+/Gd46YWqJd5DbpPE9xkcA=
+github.com/miekg/dns v1.1.50/go.mod h1:e3IlAVfNqAllflbibAZEWOXOQ+Ynzk/dDozDxY7XnME=
 github.com/nxadm/tail v1.4.4/go.mod h1:kenIhsEOeOJmVchQTgglprH7qJGnHDVpk1VPCcaMI8A=
 github.com/nxadm/tail v1.4.8 h1:nPr65rt6Y5JFSKQO7qToXr7pePgD6Gwiw05lkbyAQTE=
 github.com/nxadm/tail v1.4.8/go.mod h1:+ncqLTQzXmGhMZNUePPaPqPvBxHAIsmXswZKocGu+AU=
@@ -121,6 +127,8 @@ github.com/pkg/errors v0.9.1 h1:FEBLx1zS214owpjy7qsBeixbURkuhQAwrK5UwLGTwt4=
 github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
 github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
 github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
+github.com/refraction-networking/utls v1.1.2 h1:a7GQauRt72VG+wtNm0lnrAaCGlyX47gEi1++dSsDBpw=
+github.com/refraction-networking/utls v1.1.2/go.mod h1:+D89TUtA8+NKVFj1IXWr0p3tSdX1+SqUB7rL0QnGqyg=
 github.com/rogpeppe/fastuuid v1.2.0/go.mod h1:jVj6XXZzXRy/MSR5jhDC/2q6DgLz+nrA6LYCDYWNEvQ=
 github.com/russross/blackfriday/v2 v2.1.0/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
 github.com/sagernet/abx-go v0.0.0-20220819185957-dba1257d738e h1:5CFRo8FJbCuf5s/eTBdZpmMbn8Fe2eSMLNAYfKanA34=
@@ -133,20 +141,24 @@ github.com/sagernet/netlink v0.0.0-20220905062125-8043b4a9aa97 h1:iL5gZI3uFp0X6E
 github.com/sagernet/netlink v0.0.0-20220905062125-8043b4a9aa97/go.mod h1:xLnfdiJbSp8rNqYEdIW/6eDO4mVoogml14Bh2hSiFpM=
 github.com/sagernet/quic-go v0.0.0-20220818150011-de611ab3e2bb h1:wc0yQ+SBn4TaTYRwpwvEm3nc4eRdxk6vtRbouLVZAzk=
 github.com/sagernet/quic-go v0.0.0-20220818150011-de611ab3e2bb/go.mod h1:MIccjRKnPTjWwAOpl+AUGWOkzyTd9tERytudxu+1ra4=
+github.com/sagernet/shadowsocksr v0.0.0-20220912092645-c9ab93f81bb0 h1:lQ4RFWY/wBYmXl/zJJCwQbhiEIbgEqC7j+nhZYkgwmU=
+github.com/sagernet/shadowsocksr v0.0.0-20220912092645-c9ab93f81bb0/go.mod h1:xSHLCsdgy5QIozXFEv6uDgMWzyrRdFFjr3TgL+juu6g=
 github.com/sagernet/sing v0.0.0-20220812082120-05f9836bff8f/go.mod h1:QVsS5L/ZA2Q5UhQwLrn0Trw+msNd/NPGEhBKR/ioWiY=
 github.com/sagernet/sing v0.0.0-20220817130738-ce854cda8522/go.mod h1:QVsS5L/ZA2Q5UhQwLrn0Trw+msNd/NPGEhBKR/ioWiY=
-github.com/sagernet/sing v0.0.0-20220905164441-f3d346256d4a h1:Bqt+eYP7vJocAgAVAXC0B0ZN0uMr6g6exAoF3Ado2pg=
-github.com/sagernet/sing v0.0.0-20220905164441-f3d346256d4a/go.mod h1:kZvzh1VDa/Dg/Bt5WaYKU0jl5ept8KKDpl3Ay4gRtRQ=
+github.com/sagernet/sing v0.0.0-20220913004915-27ddefbb8921 h1:xUHzlIbdlPV/fkToIO9futp9lmKIY+72ezk/whQ8XsI=
+github.com/sagernet/sing v0.0.0-20220913004915-27ddefbb8921/go.mod h1:kZvzh1VDa/Dg/Bt5WaYKU0jl5ept8KKDpl3Ay4gRtRQ=
 github.com/sagernet/sing-dns v0.0.0-20220822023312-3e086b06d666 h1:XUTocA/Ek0dFxUX+xJCWMPPFZCn2GC/uLrBjTSr1vHY=
 github.com/sagernet/sing-dns v0.0.0-20220822023312-3e086b06d666/go.mod h1:eDyH7AJmqBGjZQdQmpZIzlbTREudZuWDExMuGKgjRVM=
 github.com/sagernet/sing-shadowsocks v0.0.0-20220819002358-7461bb09a8f6 h1:JJfDeYYhWunvtxsU/mOVNTmFQmnzGx9dY034qG6G3g4=
 github.com/sagernet/sing-shadowsocks v0.0.0-20220819002358-7461bb09a8f6/go.mod h1:EX3RbZvrwAkPI2nuGa78T2iQXmrkT+/VQtskjou42xM=
-github.com/sagernet/sing-tun v0.0.0-20220909054347-575ac2941790 h1:SnIhaHWVk3tTTx/zFEor9zRItcbzTYMoC8F22FAZ/Iw=
-github.com/sagernet/sing-tun v0.0.0-20220909054347-575ac2941790/go.mod h1:5AhPUv9jWDQ3pv3Mj78SL/1TSjhoaj6WNASxRKLqXqM=
-github.com/sagernet/sing-vmess v0.0.0-20220907073918-72d7fdf6825f h1:6l9aXZqAl1JqXJWi89KHpWnM/moQUPGG+XiwMc+yD0A=
-github.com/sagernet/sing-vmess v0.0.0-20220907073918-72d7fdf6825f/go.mod h1:u66Vv7NHXJWfeAmhh7JuJp/cwxmuQlM56QoZ7B7Mmd0=
-github.com/sagernet/smux v0.0.0-20220907034654-1acb8471c15a h1:GCNwsN8MEckpjGJjK3qjQBQ9qHsoXB9B/KHUWBvE1V4=
-github.com/sagernet/smux v0.0.0-20220907034654-1acb8471c15a/go.mod h1:yedWtra8nyGJ+SyI+ziwuaGMzBatbB10P1IOOZbbSK8=
+github.com/sagernet/sing-tun v0.0.0-20220911034209-c7dd5d457e24 h1:LsmPeFvj4GhiV5Y7Rm8I845XysdxVN4MQmfZ36P5bmw=
+github.com/sagernet/sing-tun v0.0.0-20220911034209-c7dd5d457e24/go.mod h1:5AhPUv9jWDQ3pv3Mj78SL/1TSjhoaj6WNASxRKLqXqM=
+github.com/sagernet/sing-vmess v0.0.0-20220913015714-c4ab86d40e12 h1:4HYGbTDDemgBVTmaspXbkgjJlXc3hYVjNxSddJndq8Y=
+github.com/sagernet/sing-vmess v0.0.0-20220913015714-c4ab86d40e12/go.mod h1:u66Vv7NHXJWfeAmhh7JuJp/cwxmuQlM56QoZ7B7Mmd0=
+github.com/sagernet/smux v0.0.0-20220831015742-e0f1988e3195 h1:5VBIbVw9q7aKbrFdT83mjkyvQ+VaRsQ6yflTepfln38=
+github.com/sagernet/smux v0.0.0-20220831015742-e0f1988e3195/go.mod h1:yedWtra8nyGJ+SyI+ziwuaGMzBatbB10P1IOOZbbSK8=
+github.com/sagernet/websocket v0.0.0-20220913015213-615516348b4e h1:7uw2njHFGE+VpWamge6o56j2RWk4omF6uLKKxMmcWvs=
+github.com/sagernet/websocket v0.0.0-20220913015213-615516348b4e/go.mod h1:45TUl8+gH4SIKr4ykREbxKWTxkDlSzFENzctB1dVRRY=
 github.com/spf13/cobra v1.5.0 h1:X+jTBEBqF0bHN+9cSMgmfuvv2VHJ9ezmFNf9Y/XstYU=
 github.com/spf13/cobra v1.5.0/go.mod h1:dWXEIy2H428czQCjInthrTRUg7yKbok+2Qi/yBIJoUM=
 github.com/spf13/pflag v1.0.5 h1:iy+VFUOCP1a+8yFto/drg2CJ5u0yRoB7fZw3DKv/JXA=
@@ -163,6 +175,8 @@ github.com/vishvananda/netns v0.0.0-20211101163701-50045581ed74 h1:gga7acRE695AP
 github.com/vishvananda/netns v0.0.0-20211101163701-50045581ed74/go.mod h1:DD4vA1DwXk04H54A1oHXtwZmA0grkVMdPxx/VGLCah0=
 github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
 github.com/yuin/goldmark v1.3.5/go.mod h1:mwnBkeHKe2W/ZEtQ+71ViKU8L12m81fl3OWwC1Zlc8k=
+go.etcd.io/bbolt v1.3.6 h1:/ecaJf0sk1l4l6V4awd65v2C3ILy7MSj+s/x1ADCIMU=
+go.etcd.io/bbolt v1.3.6/go.mod h1:qXsaaIqmgQH0T+OPdb99Bf+PKfBBQVAdyD6TY9G8XM4=
 go.opentelemetry.io/proto/otlp v0.7.0/go.mod h1:PqfVotwruBrMGOCsRd/89rSnXhoiJIqeYNgFYFoEGnI=
 go.uber.org/atomic v1.7.0/go.mod h1:fEN4uk6kAWBTFdckzkM89CLk9XfWZrxpCo0nPH17wJc=
 go.uber.org/atomic v1.10.0 h1:9qC72Qh0+3MqyJbAn8YU5xVq1frD8bn3JtD2oXtafVQ=
@@ -180,7 +194,9 @@ golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACk
 golang.org/x/crypto v0.0.0-20190404164418-38d8ce5564a5/go.mod h1:WFFai1msRO1wXaEeE5yQxYXgSfI8pQAWXbQop6sCtWE=
 golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
 golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
+golang.org/x/crypto v0.0.0-20201203163018-be400aefbc4c/go.mod h1:jdWPYTVW3xRLrWPugEBEK3UY2ZEsg3UU495nc5E+M+I=
 golang.org/x/crypto v0.0.0-20210513164829-c07d793c2f9a/go.mod h1:P+XmwS30IXTQdn5tA2iutPOUgjI07+tq3H3K9MVA1s8=
+golang.org/x/crypto v0.0.0-20211108221036-ceb1ce70b4fa/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc=
 golang.org/x/crypto v0.0.0-20220829220503-c86fa9a7ed90 h1:Y/gsMcFOcR+6S6f3YeMKl5g+dZMEWqcz5Czj/GWYbkM=
 golang.org/x/crypto v0.0.0-20220829220503-c86fa9a7ed90/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4=
 golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
@@ -211,9 +227,11 @@ golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwY
 golang.org/x/net v0.0.0-20210226172049-e18ecbb05110/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
 golang.org/x/net v0.0.0-20210405180319-a5a99cb37ef4/go.mod h1:p54w0d4576C0XHj96bSt6lcn1PtDYWL6XObtHCRCNQM=
 golang.org/x/net v0.0.0-20210525063256-abc453219eb5/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y=
+golang.org/x/net v0.0.0-20210726213435-c6fcb2dbf985/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y=
+golang.org/x/net v0.0.0-20211111160137-58aab5ef257a/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y=
 golang.org/x/net v0.0.0-20220630215102-69896b714898/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c=
-golang.org/x/net v0.0.0-20220907135653-1e95f45603a7 h1:1WGATo9HAhkWMbfyuVU0tEFP88OIkUvwaHFveQPvzCQ=
-golang.org/x/net v0.0.0-20220907135653-1e95f45603a7/go.mod h1:YDH+HFinaLZZlnHAfSS6ZXJJ9M9t4Dl22yv3iI2vPwk=
+golang.org/x/net v0.0.0-20220909164309-bea034e7d591 h1:D0B/7al0LLrVC8aWF4+oxpv/m8bc7ViFfVS8/gXGdqI=
+golang.org/x/net v0.0.0-20220909164309-bea034e7d591/go.mod h1:YDH+HFinaLZZlnHAfSS6ZXJJ9M9t4Dl22yv3iI2vPwk=
 golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
 golang.org/x/oauth2 v0.0.0-20200107190931-bf48bf16ab8d/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
 golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
@@ -221,6 +239,7 @@ golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJ
 golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20210220032951-036812b2e83c h1:5KslGYwFpkhGh+Q16bwMP3cOontH8FOep7tGV86Y7SQ=
 golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
 golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
@@ -229,10 +248,12 @@ golang.org/x/sys v0.0.0-20190403152447-81d4e9dc473e/go.mod h1:h1NjWce9XRLGQEsW7w
 golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190904154756-749cb33beabd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20191005200804-aed5e4c7ecf9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20191026070338-33540a1f6037/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20200217220822-9197077df867/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20200519105757-fe76b779f299/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200923182605-d9f96fdee20d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20210112080510-489259a85091/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
@@ -240,12 +261,14 @@ golang.org/x/sys v0.0.0-20210330210617-4fbd30eecc44/go.mod h1:h1NjWce9XRLGQEsW7w
 golang.org/x/sys v0.0.0-20210423082822-04245dca01da/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20210510120138-977fb7262007/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210630005230-0f9fa26af87c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220412211240-33da011f77ad/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220704084225-05e143d24a9e/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220731174439-a90be440212d/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
-golang.org/x/sys v0.0.0-20220908164124-27713097b956 h1:XeJjHH1KiLpKGb6lvMiksZ9l0fVUh+AmGcm0nOMEBOY=
-golang.org/x/sys v0.0.0-20220908164124-27713097b956/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20220909162455-aba9fc2a8ff2 h1:wM1k/lXfpc5HdkJJyW9GELpd8ERGdnh8sMGL6Gzq3Ho=
+golang.org/x/sys v0.0.0-20220909162455-aba9fc2a8ff2/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/term v0.0.0-20201117132131-f5c789dd3221/go.mod h1:Nr5EML6q2oocZ2LXRh80K7BxOlk5/8JxuGnuhpl+muw=
 golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo=
 golang.org/x/term v0.0.0-20210927222741-03fcf44c2211 h1:JGgROgKl9N8DuW20oFS5gxc+lE67/N3FcwmBPMe7ArY=
 golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
@@ -268,6 +291,7 @@ golang.org/x/tools v0.0.0-20200130002326-2f3ba24bd6e7/go.mod h1:TB2adYChydJhpapK
 golang.org/x/tools v0.0.0-20201224043029-2b0845dc783e/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
 golang.org/x/tools v0.1.1/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
 golang.org/x/tools v0.1.5/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
+golang.org/x/tools v0.1.6-0.20210726203631-07bc1bf47fb2/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
 golang.org/x/tools v0.1.11-0.20220513221640-090b14e8501f h1:OKYpQQVE3DKSc3r3zHVzq46vq5YH7x8xpR3/k9ixmUg=
 golang.org/x/tools v0.1.11-0.20220513221640-090b14e8501f/go.mod h1:SgwaegtQh8clINPpECJMqnxLv9I09HLqnW3RMqW0CA4=
 golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=

inbound/default.go

@@ -3,7 +3,6 @@ package inbound
 import (
 	"context"
 	"net"
-	"sync"
 
 	"github.com/sagernet/sing-box/adapter"
 	"github.com/sagernet/sing-box/common/settings"
@@ -42,7 +41,6 @@ type myInboundAdapter struct {
 	tcpListener          net.Listener
 	udpConn              *net.UDPConn
 	udpAddr              M.Socksaddr
-	packetAccess         sync.RWMutex
 	packetOutboundClosed chan struct{}
 	packetOutbound       chan *myInboundPacket
 }

inbound/default_udp.go

@@ -208,17 +208,12 @@ func (s *myInboundPacketAdapter) Upstream() any {
 }
 
 func (s *myInboundPacketAdapter) WritePacket(buffer *buf.Buffer, destination M.Socksaddr) error {
-	s.packetAccess.RLock()
-	defer s.packetAccess.RUnlock()
-
 	select {
+	case s.packetOutbound <- &myInboundPacket{buffer, destination}:
+		return nil
 	case <-s.packetOutboundClosed:
 		return os.ErrClosed
-	default:
 	}
-
-	s.packetOutbound <- &myInboundPacket{buffer, destination}
-	return nil
 }
 
 func (s *myInboundPacketAdapter) Close() error {

inbound/http.go

@@ -3,11 +3,11 @@ package inbound
 import (
 	std_bufio "bufio"
 	"context"
-	"crypto/tls"
 	"net"
 	"os"
 
 	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/common/tls"
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
@@ -26,7 +26,7 @@ var (
 type HTTP struct {
 	myInboundAdapter
 	authenticator auth.Authenticator
-	tlsConfig     *TLSConfig
+	tlsConfig     tls.ServerConfig
 }
 
 func NewHTTP(ctx context.Context, router adapter.Router, logger log.ContextLogger, tag string, options option.HTTPMixedInboundOptions) (*HTTP, error) {
@@ -44,7 +44,7 @@ func NewHTTP(ctx context.Context, router adapter.Router, logger log.ContextLogge
 		authenticator: auth.NewAuthenticator(options.Users),
 	}
 	if options.TLS != nil {
-		tlsConfig, err := NewTLSConfig(ctx, logger, common.PtrValueOrDefault(options.TLS))
+		tlsConfig, err := tls.NewServer(ctx, logger, common.PtrValueOrDefault(options.TLS))
 		if err != nil {
 			return nil, err
 		}
@@ -67,13 +67,13 @@ func (h *HTTP) Start() error {
 func (h *HTTP) Close() error {
 	return common.Close(
 		&h.myInboundAdapter,
-		common.PtrOrNil(h.tlsConfig),
+		h.tlsConfig,
 	)
 }
 
 func (h *HTTP) NewConnection(ctx context.Context, conn net.Conn, metadata adapter.InboundContext) error {
 	if h.tlsConfig != nil {
-		conn = tls.Server(conn, h.tlsConfig.Config())
+		conn = h.tlsConfig.Server(conn)
 	}
 	return http.HandleConnection(ctx, conn, std_bufio.NewReader(conn), h.authenticator, h.upstreamUserHandler(metadata), adapter.UpstreamMetadata(metadata))
 }

inbound/hysteria.go

@@ -10,6 +10,7 @@ import (
 	"github.com/sagernet/quic-go"
 	"github.com/sagernet/quic-go/congestion"
 	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/common/tls"
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
@@ -26,7 +27,7 @@ var _ adapter.Inbound = (*Hysteria)(nil)
 type Hysteria struct {
 	myInboundAdapter
 	quicConfig   *quic.Config
-	tlsConfig    *TLSConfig
+	tlsConfig    tls.ServerConfig
 	authKey      []byte
 	xplusKey     []byte
 	sendBPS      uint64
@@ -116,7 +117,7 @@ func NewHysteria(ctx context.Context, router adapter.Router, logger log.ContextL
 	if len(options.TLS.ALPN) == 0 {
 		options.TLS.ALPN = []string{hysteria.DefaultALPN}
 	}
-	tlsConfig, err := NewTLSConfig(ctx, logger, common.PtrValueOrDefault(options.TLS))
+	tlsConfig, err := tls.NewServer(ctx, logger, common.PtrValueOrDefault(options.TLS))
 	if err != nil {
 		return nil, err
 	}
@@ -137,7 +138,11 @@ func (h *Hysteria) Start() error {
 	if err != nil {
 		return err
 	}
-	listener, err := quic.Listen(packetConn, h.tlsConfig.Config(), h.quicConfig)
+	rawConfig, err := h.tlsConfig.Config()
+	if err != nil {
+		return err
+	}
+	listener, err := quic.Listen(packetConn, rawConfig, h.quicConfig)
 	if err != nil {
 		return err
 	}
@@ -250,12 +255,6 @@ func (h *Hysteria) acceptStream(ctx context.Context, conn quic.Connection, strea
 	if err != nil {
 		return err
 	}
-	err = hysteria.WriteServerResponse(stream, hysteria.ServerResponse{
-		OK: true,
-	})
-	if err != nil {
-		return err
-	}
 	var metadata adapter.InboundContext
 	metadata.Inbound = h.tag
 	metadata.InboundType = C.TypeHysteria
@@ -265,9 +264,16 @@ func (h *Hysteria) acceptStream(ctx context.Context, conn quic.Connection, strea
 	metadata.Source = M.SocksaddrFromNet(conn.RemoteAddr())
 	metadata.OriginDestination = M.SocksaddrFromNet(conn.LocalAddr())
 	metadata.Destination = M.ParseSocksaddrHostPort(request.Host, request.Port)
+
 	if !request.UDP {
+		err = hysteria.WriteServerResponse(stream, hysteria.ServerResponse{
+			OK: true,
+		})
+		if err != nil {
+			return err
+		}
 		h.logger.InfoContext(ctx, "inbound connection to ", metadata.Destination)
-		return h.router.RouteConnection(ctx, hysteria.NewConn(stream, metadata.Destination), metadata)
+		return h.router.RouteConnection(ctx, hysteria.NewConn(stream, metadata.Destination, false), metadata)
 	} else {
 		h.logger.InfoContext(ctx, "inbound packet connection to ", metadata.Destination)
 		var id uint32
@@ -277,6 +283,13 @@ func (h *Hysteria) acceptStream(ctx context.Context, conn quic.Connection, strea
 		h.udpSessions[id] = nCh
 		h.udpSessionId += 1
 		h.udpAccess.Unlock()
+		err = hysteria.WriteServerResponse(stream, hysteria.ServerResponse{
+			OK:           true,
+			UDPSessionID: id,
+		})
+		if err != nil {
+			return err
+		}
 		packetConn := hysteria.NewPacketConn(conn, stream, id, metadata.Destination, nCh, common.Closer(func() error {
 			h.udpAccess.Lock()
 			if ch, ok := h.udpSessions[id]; ok {
@@ -301,6 +314,6 @@ func (h *Hysteria) Close() error {
 	return common.Close(
 		&h.myInboundAdapter,
 		h.listener,
-		common.PtrOrNil(h.tlsConfig),
+		h.tlsConfig,
 	)
 }

inbound/naive.go

@@ -2,7 +2,6 @@ package inbound
 
 import (
 	"context"
-	"crypto/tls"
 	"encoding/base64"
 	"encoding/binary"
 	"io"
@@ -14,6 +13,7 @@ import (
 	"time"
 
 	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/common/tls"
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
@@ -32,7 +32,7 @@ var _ adapter.Inbound = (*Naive)(nil)
 type Naive struct {
 	myInboundAdapter
 	authenticator auth.Authenticator
-	tlsConfig     *TLSConfig
+	tlsConfig     tls.ServerConfig
 	httpServer    *http.Server
 	h3Server      any
 }
@@ -59,7 +59,7 @@ func NewNaive(ctx context.Context, router adapter.Router, logger log.ContextLogg
 		return nil, E.New("missing users")
 	}
 	if options.TLS != nil {
-		tlsConfig, err := NewTLSConfig(ctx, logger, common.PtrValueOrDefault(options.TLS))
+		tlsConfig, err := tls.NewServer(ctx, logger, common.PtrValueOrDefault(options.TLS))
 		if err != nil {
 			return nil, err
 		}
@@ -69,13 +69,16 @@ func NewNaive(ctx context.Context, router adapter.Router, logger log.ContextLogg
 }
 
 func (n *Naive) Start() error {
-	var tlsConfig *tls.Config
+	var tlsConfig *tls.STDConfig
 	if n.tlsConfig != nil {
 		err := n.tlsConfig.Start()
 		if err != nil {
 			return E.Cause(err, "create TLS config")
 		}
-		tlsConfig = n.tlsConfig.Config()
+		tlsConfig, err = n.tlsConfig.Config()
+		if err != nil {
+			return err
+		}
 	}
 
 	if common.Contains(n.network, N.NetworkTCP) {
@@ -117,7 +120,7 @@ func (n *Naive) Close() error {
 		&n.myInboundAdapter,
 		common.PtrOrNil(n.httpServer),
 		n.h3Server,
-		common.PtrOrNil(n.tlsConfig),
+		n.tlsConfig,
 	)
 }
 

inbound/naive_quic.go

@@ -8,9 +8,13 @@ import (
 )
 
 func (n *Naive) configureHTTP3Listener() error {
+	tlsConfig, err := n.tlsConfig.Config()
+	if err != nil {
+		return err
+	}
 	h3Server := &http3.Server{
 		Port:      int(n.listenOptions.ListenPort),
-		TLSConfig: n.tlsConfig.Config(),
+		TLSConfig: tlsConfig,
 		Handler:   n,
 	}
 

inbound/trojan.go

@@ -2,11 +2,11 @@ package inbound
 
 import (
 	"context"
-	"crypto/tls"
 	"net"
 	"os"
 
 	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/common/tls"
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
@@ -29,7 +29,7 @@ type Trojan struct {
 	myInboundAdapter
 	service                  *trojan.Service[int]
 	users                    []option.TrojanUser
-	tlsConfig                *TLSConfig
+	tlsConfig                tls.ServerConfig
 	fallbackAddr             M.Socksaddr
 	fallbackAddrTLSNextProto map[string]M.Socksaddr
 	transport                adapter.V2RayServerTransport
@@ -49,7 +49,7 @@ func NewTrojan(ctx context.Context, router adapter.Router, logger log.ContextLog
 		users: options.Users,
 	}
 	if options.TLS != nil {
-		tlsConfig, err := NewTLSConfig(ctx, logger, common.PtrValueOrDefault(options.TLS))
+		tlsConfig, err := tls.NewServer(ctx, logger, common.PtrValueOrDefault(options.TLS))
 		if err != nil {
 			return nil, err
 		}
@@ -89,11 +89,7 @@ func NewTrojan(ctx context.Context, router adapter.Router, logger log.ContextLog
 		return nil, err
 	}
 	if options.Transport != nil {
-		var tlsConfig *tls.Config
-		if inbound.tlsConfig != nil {
-			tlsConfig = inbound.tlsConfig.Config()
-		}
-		inbound.transport, err = v2ray.NewServerTransport(ctx, common.PtrValueOrDefault(options.Transport), tlsConfig, adapter.NewUpstreamHandler(adapter.InboundContext{}, inbound.newTransportConnection, nil, nil), inbound)
+		inbound.transport, err = v2ray.NewServerTransport(ctx, common.PtrValueOrDefault(options.Transport), inbound.tlsConfig, adapter.NewUpstreamHandler(adapter.InboundContext{}, inbound.newTransportConnection, nil, nil), inbound)
 		if err != nil {
 			return nil, E.Cause(err, "create server transport: ", options.Transport.Type)
 		}
@@ -143,7 +139,7 @@ func (h *Trojan) Start() error {
 func (h *Trojan) Close() error {
 	return common.Close(
 		&h.myInboundAdapter,
-		common.PtrOrNil(h.tlsConfig),
+		h.tlsConfig,
 		h.transport,
 	)
 }
@@ -155,7 +151,7 @@ func (h *Trojan) newTransportConnection(ctx context.Context, conn net.Conn, meta
 
 func (h *Trojan) NewConnection(ctx context.Context, conn net.Conn, metadata adapter.InboundContext) error {
 	if h.tlsConfig != nil && h.transport == nil {
-		conn = tls.Server(conn, h.tlsConfig.Config())
+		conn = h.tlsConfig.Server(conn)
 	}
 	return h.service.NewConnection(adapter.WithContext(log.ContextWithNewID(ctx), &metadata), conn, adapter.UpstreamMetadata(metadata))
 }
@@ -182,7 +178,7 @@ func (h *Trojan) newConnection(ctx context.Context, conn net.Conn, metadata adap
 func (h *Trojan) fallbackConnection(ctx context.Context, conn net.Conn, metadata adapter.InboundContext) error {
 	var fallbackAddr M.Socksaddr
 	if len(h.fallbackAddrTLSNextProto) > 0 {
-		if tlsConn, loaded := common.Cast[*tls.Conn](conn); loaded {
+		if tlsConn, loaded := common.Cast[*tls.STDConn](conn); loaded {
 			connectionState := tlsConn.ConnectionState()
 			if connectionState.NegotiatedProtocol != "" {
 				if fallbackAddr, loaded = h.fallbackAddrTLSNextProto[connectionState.NegotiatedProtocol]; !loaded {

inbound/vmess.go

@@ -2,11 +2,11 @@ package inbound
 
 import (
 	"context"
-	"crypto/tls"
 	"net"
 	"os"
 
 	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/common/tls"
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
@@ -31,7 +31,7 @@ type VMess struct {
 	ctx       context.Context
 	service   *vmess.Service[int]
 	users     []option.VMessUser
-	tlsConfig *TLSConfig
+	tlsConfig tls.ServerConfig
 	transport adapter.V2RayServerTransport
 }
 
@@ -62,17 +62,13 @@ func NewVMess(ctx context.Context, router adapter.Router, logger log.ContextLogg
 		return nil, err
 	}
 	if options.TLS != nil {
-		inbound.tlsConfig, err = NewTLSConfig(ctx, logger, common.PtrValueOrDefault(options.TLS))
+		inbound.tlsConfig, err = tls.NewServer(ctx, logger, common.PtrValueOrDefault(options.TLS))
 		if err != nil {
 			return nil, err
 		}
 	}
 	if options.Transport != nil {
-		var tlsConfig *tls.Config
-		if inbound.tlsConfig != nil {
-			tlsConfig = inbound.tlsConfig.Config()
-		}
-		inbound.transport, err = v2ray.NewServerTransport(ctx, common.PtrValueOrDefault(options.Transport), tlsConfig, adapter.NewUpstreamHandler(adapter.InboundContext{}, inbound.newTransportConnection, nil, nil), inbound)
+		inbound.transport, err = v2ray.NewServerTransport(ctx, common.PtrValueOrDefault(options.Transport), inbound.tlsConfig, adapter.NewUpstreamHandler(adapter.InboundContext{}, inbound.newTransportConnection, nil, nil), inbound)
 		if err != nil {
 			return nil, E.Cause(err, "create server transport: ", options.Transport.Type)
 		}
@@ -84,7 +80,7 @@ func NewVMess(ctx context.Context, router adapter.Router, logger log.ContextLogg
 func (h *VMess) Start() error {
 	err := common.Start(
 		h.service,
-		common.PtrOrNil(h.tlsConfig),
+		h.tlsConfig,
 	)
 	if err != nil {
 		return err
@@ -123,7 +119,7 @@ func (h *VMess) Close() error {
 	return common.Close(
 		h.service,
 		&h.myInboundAdapter,
-		common.PtrOrNil(h.tlsConfig),
+		h.tlsConfig,
 		h.transport,
 	)
 }
@@ -135,7 +131,7 @@ func (h *VMess) newTransportConnection(ctx context.Context, conn net.Conn, metad
 
 func (h *VMess) NewConnection(ctx context.Context, conn net.Conn, metadata adapter.InboundContext) error {
 	if h.tlsConfig != nil && h.transport == nil {
-		conn = tls.Server(conn, h.tlsConfig.Config())
+		conn = h.tlsConfig.Server(conn)
 	}
 	return h.service.NewConnection(adapter.WithContext(log.ContextWithNewID(ctx), &metadata), conn, adapter.UpstreamMetadata(metadata))
 }

mkdocs.yml

@@ -84,6 +84,8 @@ nav:
           - WireGuard: configuration/outbound/wireguard.md
           - Hysteria: configuration/outbound/hysteria.md
           - ShadowTLS: configuration/outbound/shadowtls.md
+          - ShadowsocksR: configuration/outbound/shadowsocksr.md
+          - VLESS: configuration/outbound/vless.md
           - Tor: configuration/outbound/tor.md
           - SSH: configuration/outbound/ssh.md
           - DNS: configuration/outbound/dns.md

option/clash.go

@@ -4,6 +4,10 @@ type ClashAPIOptions struct {
 	ExternalController string `json:"external_controller,omitempty"`
 	ExternalUI         string `json:"external_ui,omitempty"`
 	Secret             string `json:"secret,omitempty"`
+
+	DefaultMode   string `json:"default_mode,omitempty"`
+	StoreSelected bool   `json:"store_selected,omitempty"`
+	CacheFile     string `json:"cache_file,omitempty"`
 }
 
 type SelectorOutboundOptions struct {

option/dns.go

@@ -99,6 +99,7 @@ type DefaultDNSRule struct {
 	User            Listable[string] `json:"user,omitempty"`
 	UserID          Listable[int32]  `json:"user_id,omitempty"`
 	Outbound        Listable[string] `json:"outbound,omitempty"`
+	ClashMode       string           `json:"clash_mode,omitempty"`
 	Invert          bool             `json:"invert,omitempty"`
 	Server          string           `json:"server,omitempty"`
 	DisableCache    bool             `json:"disable_cache,omitempty"`

option/outbound.go

@@ -8,20 +8,22 @@ import (
 )
 
 type _Outbound struct {
-	Type               string                     `json:"type"`
-	Tag                string                     `json:"tag,omitempty"`
-	DirectOptions      DirectOutboundOptions      `json:"-"`
-	SocksOptions       SocksOutboundOptions       `json:"-"`
-	HTTPOptions        HTTPOutboundOptions        `json:"-"`
-	ShadowsocksOptions ShadowsocksOutboundOptions `json:"-"`
-	VMessOptions       VMessOutboundOptions       `json:"-"`
-	TrojanOptions      TrojanOutboundOptions      `json:"-"`
-	WireGuardOptions   WireGuardOutboundOptions   `json:"-"`
-	HysteriaOptions    HysteriaOutboundOptions    `json:"-"`
-	TorOptions         TorOutboundOptions         `json:"-"`
-	SSHOptions         SSHOutboundOptions         `json:"-"`
-	ShadowTLSOptions   ShadowTLSOutboundOptions   `json:"-"`
-	SelectorOptions    SelectorOutboundOptions    `json:"-"`
+	Type                string                      `json:"type"`
+	Tag                 string                      `json:"tag,omitempty"`
+	DirectOptions       DirectOutboundOptions       `json:"-"`
+	SocksOptions        SocksOutboundOptions        `json:"-"`
+	HTTPOptions         HTTPOutboundOptions         `json:"-"`
+	ShadowsocksOptions  ShadowsocksOutboundOptions  `json:"-"`
+	VMessOptions        VMessOutboundOptions        `json:"-"`
+	TrojanOptions       TrojanOutboundOptions       `json:"-"`
+	WireGuardOptions    WireGuardOutboundOptions    `json:"-"`
+	HysteriaOptions     HysteriaOutboundOptions     `json:"-"`
+	TorOptions          TorOutboundOptions          `json:"-"`
+	SSHOptions          SSHOutboundOptions          `json:"-"`
+	ShadowTLSOptions    ShadowTLSOutboundOptions    `json:"-"`
+	ShadowsocksROptions ShadowsocksROutboundOptions `json:"-"`
+	VLESSOptions        VLESSOutboundOptions        `json:"-"`
+	SelectorOptions     SelectorOutboundOptions     `json:"-"`
 }
 
 type Outbound _Outbound
@@ -53,6 +55,10 @@ func (h Outbound) MarshalJSON() ([]byte, error) {
 		v = h.SSHOptions
 	case C.TypeShadowTLS:
 		v = h.ShadowTLSOptions
+	case C.TypeShadowsocksR:
+		v = h.ShadowsocksROptions
+	case C.TypeVLESS:
+		v = h.VLESSOptions
 	case C.TypeSelector:
 		v = h.SelectorOptions
 	default:
@@ -92,6 +98,10 @@ func (h *Outbound) UnmarshalJSON(bytes []byte) error {
 		v = &h.SSHOptions
 	case C.TypeShadowTLS:
 		v = &h.ShadowTLSOptions
+	case C.TypeShadowsocksR:
+		v = &h.ShadowsocksROptions
+	case C.TypeVLESS:
+		v = &h.VLESSOptions
 	case C.TypeSelector:
 		v = &h.SelectorOptions
 	default:

option/route.go

@@ -101,6 +101,7 @@ type DefaultRule struct {
 	PackageName     Listable[string] `json:"package_name,omitempty"`
 	User            Listable[string] `json:"user,omitempty"`
 	UserID          Listable[int32]  `json:"user_id,omitempty"`
+	ClashMode       string           `json:"clash_mode,omitempty"`
 	Invert          bool             `json:"invert,omitempty"`
 	Outbound        string           `json:"outbound,omitempty"`
 }

option/shadowsocks.go

@@ -26,6 +26,8 @@ type ShadowsocksOutboundOptions struct {
 	ServerOptions
 	Method           string            `json:"method"`
 	Password         string            `json:"password"`
+	Plugin           string            `json:"plugin,omitempty"`
+	PluginOptions    string            `json:"plugin_opts,omitempty"`
 	Network          NetworkList       `json:"network,omitempty"`
 	UoT              bool              `json:"udp_over_tcp,omitempty"`
 	MultiplexOptions *MultiplexOptions `json:"multiplex,omitempty"`

option/shadowsocksr.go

@@ -0,0 +1,13 @@
+package option
+
+type ShadowsocksROutboundOptions struct {
+	DialerOptions
+	ServerOptions
+	Method        string      `json:"method"`
+	Password      string      `json:"password"`
+	Obfs          string      `json:"obfs,omitempty"`
+	ObfsParam     string      `json:"obfs_param,omitempty"`
+	Protocol      string      `json:"protocol,omitempty"`
+	ProtocolParam string      `json:"protocol_param,omitempty"`
+	Network       NetworkList `json:"network,omitempty"`
+}

option/tls.go

@@ -1,11 +1,5 @@
 package option
 
-import (
-	"crypto/tls"
-
-	E "github.com/sagernet/sing/common/exceptions"
-)
-
 type InboundTLSOptions struct {
 	Enabled         bool                `json:"enabled,omitempty"`
 	ServerName      string              `json:"server_name,omitempty"`
@@ -21,29 +15,28 @@ type InboundTLSOptions struct {
 }
 
 type OutboundTLSOptions struct {
-	Enabled         bool             `json:"enabled,omitempty"`
-	DisableSNI      bool             `json:"disable_sni,omitempty"`
-	ServerName      string           `json:"server_name,omitempty"`
-	Insecure        bool             `json:"insecure,omitempty"`
-	ALPN            Listable[string] `json:"alpn,omitempty"`
-	MinVersion      string           `json:"min_version,omitempty"`
-	MaxVersion      string           `json:"max_version,omitempty"`
-	CipherSuites    Listable[string] `json:"cipher_suites,omitempty"`
-	Certificate     string           `json:"certificate,omitempty"`
-	CertificatePath string           `json:"certificate_path,omitempty"`
+	Enabled         bool                 `json:"enabled,omitempty"`
+	DisableSNI      bool                 `json:"disable_sni,omitempty"`
+	ServerName      string               `json:"server_name,omitempty"`
+	Insecure        bool                 `json:"insecure,omitempty"`
+	ALPN            Listable[string]     `json:"alpn,omitempty"`
+	MinVersion      string               `json:"min_version,omitempty"`
+	MaxVersion      string               `json:"max_version,omitempty"`
+	CipherSuites    Listable[string]     `json:"cipher_suites,omitempty"`
+	Certificate     string               `json:"certificate,omitempty"`
+	CertificatePath string               `json:"certificate_path,omitempty"`
+	ECH             *OutboundECHOptions  `json:"ech,omitempty"`
+	UTLS            *OutboundUTLSOptions `json:"utls,omitempty"`
 }
 
-func ParseTLSVersion(version string) (uint16, error) {
-	switch version {
-	case "1.0":
-		return tls.VersionTLS10, nil
-	case "1.1":
-		return tls.VersionTLS11, nil
-	case "1.2":
-		return tls.VersionTLS12, nil
-	case "1.3":
-		return tls.VersionTLS13, nil
-	default:
-		return 0, E.New("unknown tls version:", version)
-	}
+type OutboundECHOptions struct {
+	Enabled                     bool   `json:"enabled,omitempty"`
+	PQSignatureSchemesEnabled   bool   `json:"pq_signature_schemes_enabled,omitempty"`
+	DynamicRecordSizingDisabled bool   `json:"dynamic_record_sizing_disabled,omitempty"`
+	Config                      string `json:"config,omitempty"`
+}
+
+type OutboundUTLSOptions struct {
+	Enabled     bool   `json:"enabled,omitempty"`
+	Fingerprint string `json:"fingerprint,omitempty"`
 }

option/vless.go

@@ -0,0 +1,11 @@
+package option
+
+type VLESSOutboundOptions struct {
+	DialerOptions
+	ServerOptions
+	UUID           string                 `json:"uuid"`
+	Network        NetworkList            `json:"network,omitempty"`
+	TLS            *OutboundTLSOptions    `json:"tls,omitempty"`
+	Transport      *V2RayTransportOptions `json:"transport,omitempty"`
+	PacketEncoding string                 `json:"packet_encoding,omitempty"`
+}

outbound/builder.go

@@ -41,6 +41,10 @@ func New(ctx context.Context, router adapter.Router, logger log.ContextLogger, o
 		return NewSSH(ctx, router, logger, options.Tag, options.SSHOptions)
 	case C.TypeShadowTLS:
 		return NewShadowTLS(ctx, router, logger, options.Tag, options.ShadowTLSOptions)
+	case C.TypeShadowsocksR:
+		return NewShadowsocksR(ctx, router, logger, options.Tag, options.ShadowsocksROptions)
+	case C.TypeVLESS:
+		return NewVLESS(ctx, router, logger, options.Tag, options.VLESSOptions)
 	case C.TypeSelector:
 		return NewSelector(router, logger, options.Tag, options.SelectorOptions)
 	default:

outbound/http.go

@@ -7,6 +7,7 @@ import (
 
 	"github.com/sagernet/sing-box/adapter"
 	"github.com/sagernet/sing-box/common/dialer"
+	"github.com/sagernet/sing-box/common/tls"
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
@@ -24,7 +25,7 @@ type HTTP struct {
 }
 
 func NewHTTP(router adapter.Router, logger log.ContextLogger, tag string, options option.HTTPOutboundOptions) (*HTTP, error) {
-	detour, err := dialer.NewTLS(dialer.New(router, options.DialerOptions), options.Server, common.PtrValueOrDefault(options.TLS))
+	detour, err := tls.NewDialerFromOptions(router, dialer.New(router, options.DialerOptions), options.Server, common.PtrValueOrDefault(options.TLS))
 	if err != nil {
 		return nil, err
 	}

outbound/hysteria.go

@@ -4,7 +4,6 @@ package outbound
 
 import (
 	"context"
-	"crypto/tls"
 	"net"
 	"sync"
 
@@ -12,6 +11,7 @@ import (
 	"github.com/sagernet/quic-go/congestion"
 	"github.com/sagernet/sing-box/adapter"
 	"github.com/sagernet/sing-box/common/dialer"
+	"github.com/sagernet/sing-box/common/tls"
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
@@ -30,7 +30,7 @@ type Hysteria struct {
 	ctx          context.Context
 	dialer       N.Dialer
 	serverAddr   M.Socksaddr
-	tlsConfig    *tls.Config
+	tlsConfig    *tls.STDConfig
 	quicConfig   *quic.Config
 	authKey      []byte
 	xplusKey     []byte
@@ -47,7 +47,11 @@ func NewHysteria(ctx context.Context, router adapter.Router, logger log.ContextL
 	if options.TLS == nil || !options.TLS.Enabled {
 		return nil, C.ErrTLSRequired
 	}
-	tlsConfig, err := dialer.TLSConfig(options.Server, common.PtrValueOrDefault(options.TLS))
+	abstractTLSConfig, err := tls.NewClient(router, options.Server, common.PtrValueOrDefault(options.TLS))
+	if err != nil {
+		return nil, err
+	}
+	tlsConfig, err := abstractTLSConfig.Config()
 	if err != nil {
 		return nil, err
 	}
@@ -272,16 +276,7 @@ func (h *Hysteria) DialContext(ctx context.Context, network string, destination
 			stream.Close()
 			return nil, err
 		}
-		response, err := hysteria.ReadServerResponse(stream)
-		if err != nil {
-			stream.Close()
-			return nil, err
-		}
-		if !response.OK {
-			stream.Close()
-			return nil, E.New("remote error: ", response.Message)
-		}
-		return hysteria.NewConn(stream, destination), nil
+		return hysteria.NewConn(stream, destination, true), nil
 	case N.NetworkUDP:
 		conn, err := h.ListenPacket(ctx, destination)
 		if err != nil {

outbound/selector.go

@@ -59,15 +59,30 @@ func (s *Selector) Start() error {
 		}
 		s.outbounds[tag] = detour
 	}
+
+	if s.tag != "" {
+		if clashServer := s.router.ClashServer(); clashServer != nil && clashServer.StoreSelected() {
+			selected := clashServer.CacheFile().LoadSelected(s.tag)
+			if selected != "" {
+				detour, loaded := s.outbounds[selected]
+				if loaded {
+					s.selected = detour
+					return nil
+				}
+			}
+		}
+	}
+
 	if s.defaultTag != "" {
 		detour, loaded := s.outbounds[s.defaultTag]
 		if !loaded {
 			return E.New("default outbound not found: ", s.defaultTag)
 		}
 		s.selected = detour
-	} else {
-		s.selected = s.outbounds[s.tags[0]]
+		return nil
 	}
+
+	s.selected = s.outbounds[s.tags[0]]
 	return nil
 }
 
@@ -85,6 +100,14 @@ func (s *Selector) SelectOutbound(tag string) bool {
 		return false
 	}
 	s.selected = detour
+	if s.tag != "" {
+		if clashServer := s.router.ClashServer(); clashServer != nil && clashServer.StoreSelected() {
+			err := clashServer.CacheFile().StoreSelected(s.tag, tag)
+			if err != nil {
+				s.logger.Error("store selected: ", err)
+			}
+		}
+	}
 	return true
 }
 

outbound/shadowsocks.go

@@ -10,6 +10,7 @@ import (
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
+	"github.com/sagernet/sing-box/transport/sip003"
 	"github.com/sagernet/sing-shadowsocks"
 	"github.com/sagernet/sing-shadowsocks/shadowimpl"
 	"github.com/sagernet/sing/common"
@@ -27,6 +28,7 @@ type Shadowsocks struct {
 	dialer          N.Dialer
 	method          shadowsocks.Method
 	serverAddr      M.Socksaddr
+	plugin          sip003.Plugin
 	uot             bool
 	multiplexDialer N.Dialer
 }
@@ -49,6 +51,12 @@ func NewShadowsocks(ctx context.Context, router adapter.Router, logger log.Conte
 		serverAddr: options.ServerOptions.Build(),
 		uot:        options.UoT,
 	}
+	if options.Plugin != "" {
+		outbound.plugin, err = sip003.CreatePlugin(options.Plugin, options.PluginOptions, router, outbound.dialer, outbound.serverAddr)
+		if err != nil {
+			return nil, err
+		}
+	}
 	if !options.UoT {
 		outbound.multiplexDialer, err = mux.NewClientWithOptions(ctx, (*shadowsocksDialer)(outbound), common.PtrValueOrDefault(options.MultiplexOptions))
 		if err != nil {
@@ -135,7 +143,13 @@ type shadowsocksDialer Shadowsocks
 func (h *shadowsocksDialer) DialContext(ctx context.Context, network string, destination M.Socksaddr) (net.Conn, error) {
 	switch N.NetworkName(network) {
 	case N.NetworkTCP:
-		outConn, err := h.dialer.DialContext(ctx, N.NetworkTCP, h.serverAddr)
+		var outConn net.Conn
+		var err error
+		if h.plugin != nil {
+			outConn, err = h.plugin.DialContext(ctx)
+		} else {
+			outConn, err = h.dialer.DialContext(ctx, N.NetworkTCP, h.serverAddr)
+		}
 		if err != nil {
 			return nil, err
 		}

outbound/shadowsocksr.go

@@ -0,0 +1,140 @@
+//go:build with_shadowsocksr
+
+package outbound
+
+import (
+	"context"
+	"net"
+	"strings"
+
+	"github.com/sagernet/shadowsocksr"
+	"github.com/sagernet/shadowsocksr/obfs"
+	"github.com/sagernet/shadowsocksr/protocol"
+	"github.com/sagernet/shadowsocksr/ssr"
+	"github.com/sagernet/shadowsocksr/streamCipher"
+	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/common/dialer"
+	C "github.com/sagernet/sing-box/constant"
+	"github.com/sagernet/sing-box/log"
+	"github.com/sagernet/sing-box/option"
+	"github.com/sagernet/sing-shadowsocks"
+	"github.com/sagernet/sing-shadowsocks/shadowimpl"
+	"github.com/sagernet/sing/common"
+	"github.com/sagernet/sing/common/bufio"
+	E "github.com/sagernet/sing/common/exceptions"
+	M "github.com/sagernet/sing/common/metadata"
+	N "github.com/sagernet/sing/common/network"
+)
+
+var _ adapter.Outbound = (*ShadowsocksR)(nil)
+
+type ShadowsocksR struct {
+	myOutboundAdapter
+	dialer         N.Dialer
+	serverAddr     M.Socksaddr
+	method         shadowsocks.Method
+	cipher         string
+	password       string
+	obfs           string
+	obfsParams     *ssr.ServerInfo
+	protocol       string
+	protocolParams *ssr.ServerInfo
+}
+
+func NewShadowsocksR(ctx context.Context, router adapter.Router, logger log.ContextLogger, tag string, options option.ShadowsocksROutboundOptions) (*ShadowsocksR, error) {
+	outbound := &ShadowsocksR{
+		myOutboundAdapter: myOutboundAdapter{
+			protocol: C.TypeShadowsocksR,
+			network:  options.Network.Build(),
+			router:   router,
+			logger:   logger,
+			tag:      tag,
+		},
+		dialer:     dialer.New(router, options.DialerOptions),
+		serverAddr: options.ServerOptions.Build(),
+		cipher:     options.Method,
+		password:   options.Password,
+		obfs:       options.Obfs,
+		protocol:   options.Protocol,
+	}
+	var err error
+	outbound.method, err = shadowimpl.FetchMethod(options.Method, options.Password)
+	if err != nil {
+		return nil, err
+	}
+	if _, err = streamCipher.NewStreamCipher(options.Method, options.Password); err != nil {
+		return nil, E.New(strings.ToLower(err.Error()))
+	}
+	if obfs.NewObfs(options.Obfs) == nil {
+		return nil, E.New("unknown obfs: " + options.Obfs)
+	}
+	outbound.obfsParams = &ssr.ServerInfo{
+		Host:   outbound.serverAddr.AddrString(),
+		Port:   outbound.serverAddr.Port,
+		TcpMss: 1460,
+		Param:  options.ObfsParam,
+	}
+	if protocol.NewProtocol(options.Protocol) == nil {
+		return nil, E.New("unknown protocol: " + options.Protocol)
+	}
+	outbound.protocolParams = &ssr.ServerInfo{
+		Host:   outbound.serverAddr.AddrString(),
+		Port:   outbound.serverAddr.Port,
+		TcpMss: 1460,
+		Param:  options.Protocol,
+	}
+	if outbound.method == nil {
+		outbound.network = common.Filter(outbound.network, func(it string) bool { return it == N.NetworkTCP })
+	}
+	return outbound, nil
+}
+
+func (h *ShadowsocksR) DialContext(ctx context.Context, network string, destination M.Socksaddr) (net.Conn, error) {
+	switch network {
+	case N.NetworkTCP:
+		h.logger.InfoContext(ctx, "outbound connection to ", destination)
+		conn, err := h.dialer.DialContext(ctx, network, h.serverAddr)
+		if err != nil {
+			return nil, err
+		}
+		cipher, err := streamCipher.NewStreamCipher(h.cipher, h.password)
+		if err != nil {
+			return nil, E.New(strings.ToLower(err.Error()))
+		}
+		ssConn := shadowsocksr.NewSSTCPConn(conn, cipher)
+		ssConn.IObfs = obfs.NewObfs(h.obfs)
+		ssConn.IObfs.SetServerInfo(h.obfsParams)
+		ssConn.IProtocol = protocol.NewProtocol(h.protocol)
+		ssConn.IProtocol.SetServerInfo(h.protocolParams)
+		err = M.SocksaddrSerializer.WriteAddrPort(ssConn, destination)
+		if err != nil {
+			return nil, E.Cause(err, "write request")
+		}
+		return ssConn, nil
+	case N.NetworkUDP:
+		conn, err := h.ListenPacket(ctx, destination)
+		if err != nil {
+			return nil, err
+		}
+		return &bufio.BindPacketConn{PacketConn: conn, Addr: destination}, nil
+	default:
+		return nil, E.Extend(N.ErrUnknownNetwork, network)
+	}
+}
+
+func (h *ShadowsocksR) ListenPacket(ctx context.Context, destination M.Socksaddr) (net.PacketConn, error) {
+	h.logger.InfoContext(ctx, "outbound packet connection to ", destination)
+	outConn, err := h.dialer.DialContext(ctx, N.NetworkUDP, h.serverAddr)
+	if err != nil {
+		return nil, err
+	}
+	return h.method.DialPacketConn(outConn), nil
+}
+
+func (h *ShadowsocksR) NewConnection(ctx context.Context, conn net.Conn, metadata adapter.InboundContext) error {
+	return NewConnection(ctx, h, conn, metadata)
+}
+
+func (h *ShadowsocksR) NewPacketConnection(ctx context.Context, conn N.PacketConn, metadata adapter.InboundContext) error {
+	return NewPacketConnection(ctx, h, conn, metadata)
+}

outbound/shadowsocksr_stub.go

@@ -0,0 +1,16 @@
+//go:build !with_shadowsocksr
+
+package outbound
+
+import (
+	"context"
+
+	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/log"
+	"github.com/sagernet/sing-box/option"
+	E "github.com/sagernet/sing/common/exceptions"
+)
+
+func NewShadowsocksR(ctx context.Context, router adapter.Router, logger log.ContextLogger, tag string, options option.ShadowsocksROutboundOptions) (adapter.Outbound, error) {
+	return nil, E.New(`ShadowsocksR is not included in this build, rebuild with -tags with_shadowsocksr`)
+}

outbound/shadowtls.go

@@ -2,12 +2,12 @@ package outbound
 
 import (
 	"context"
-	"crypto/tls"
 	"net"
 	"os"
 
 	"github.com/sagernet/sing-box/adapter"
 	"github.com/sagernet/sing-box/common/dialer"
+	"github.com/sagernet/sing-box/common/tls"
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
@@ -22,7 +22,7 @@ type ShadowTLS struct {
 	myOutboundAdapter
 	dialer     N.Dialer
 	serverAddr M.Socksaddr
-	tlsConfig  *tls.Config
+	tlsConfig  tls.Config
 }
 
 func NewShadowTLS(ctx context.Context, router adapter.Router, logger log.ContextLogger, tag string, options option.ShadowTLSOutboundOptions) (*ShadowTLS, error) {
@@ -43,7 +43,7 @@ func NewShadowTLS(ctx context.Context, router adapter.Router, logger log.Context
 	options.TLS.MinVersion = "1.2"
 	options.TLS.MaxVersion = "1.2"
 	var err error
-	outbound.tlsConfig, err = dialer.TLSConfig(options.Server, common.PtrValueOrDefault(options.TLS))
+	outbound.tlsConfig, err = tls.NewClient(router, options.Server, common.PtrValueOrDefault(options.TLS))
 	if err != nil {
 		return nil, err
 	}
@@ -60,11 +60,7 @@ func (s *ShadowTLS) DialContext(ctx context.Context, network string, destination
 	if err != nil {
 		return nil, err
 	}
-	tlsConn, err := dialer.TLSClient(ctx, conn, s.tlsConfig)
-	if err != nil {
-		return nil, err
-	}
-	err = tlsConn.HandshakeContext(ctx)
+	_, err = tls.ClientHandshake(ctx, conn, s.tlsConfig)
 	if err != nil {
 		return nil, err
 	}

outbound/socks.go

@@ -20,8 +20,9 @@ var _ adapter.Outbound = (*Socks)(nil)
 
 type Socks struct {
 	myOutboundAdapter
-	client *socks.Client
-	uot    bool
+	client  *socks.Client
+	resolve bool
+	uot     bool
 }
 
 func NewSocks(router adapter.Router, logger log.ContextLogger, tag string, options option.SocksOutboundOptions) (*Socks, error) {
@@ -45,6 +46,7 @@ func NewSocks(router adapter.Router, logger log.ContextLogger, tag string, optio
 			tag:      tag,
 		},
 		socks.NewClient(detour, options.ServerOptions.Build(), version, options.Username, options.Password),
+		version == socks.Version4,
 		options.UoT,
 	}, nil
 }
@@ -72,6 +74,13 @@ func (h *Socks) DialContext(ctx context.Context, network string, destination M.S
 	default:
 		return nil, E.Extend(N.ErrUnknownNetwork, network)
 	}
+	if destination.IsFqdn() {
+		addrs, err := h.router.LookupDefault(ctx, destination.Fqdn)
+		if err != nil {
+			return nil, err
+		}
+		return N.DialSerial(ctx, h.client, network, destination, addrs)
+	}
 	return h.client.DialContext(ctx, network, destination)
 }
 

outbound/trojan.go

@@ -2,12 +2,12 @@ package outbound
 
 import (
 	"context"
-	"crypto/tls"
 	"net"
 
 	"github.com/sagernet/sing-box/adapter"
 	"github.com/sagernet/sing-box/common/dialer"
 	"github.com/sagernet/sing-box/common/mux"
+	"github.com/sagernet/sing-box/common/tls"
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
@@ -28,7 +28,7 @@ type Trojan struct {
 	serverAddr      M.Socksaddr
 	key             [56]byte
 	multiplexDialer N.Dialer
-	tlsConfig       *tls.Config
+	tlsConfig       tls.Config
 	transport       adapter.V2RayClientTransport
 }
 
@@ -47,7 +47,7 @@ func NewTrojan(ctx context.Context, router adapter.Router, logger log.ContextLog
 	}
 	var err error
 	if options.TLS != nil {
-		outbound.tlsConfig, err = dialer.TLSConfig(options.Server, common.PtrValueOrDefault(options.TLS))
+		outbound.tlsConfig, err = tls.NewClient(router, options.Server, common.PtrValueOrDefault(options.TLS))
 		if err != nil {
 			return nil, err
 		}
@@ -116,7 +116,7 @@ func (h *trojanDialer) DialContext(ctx context.Context, network string, destinat
 	} else {
 		conn, err = h.dialer.DialContext(ctx, N.NetworkTCP, h.serverAddr)
 		if err == nil && h.tlsConfig != nil {
-			conn, err = dialer.TLSClient(ctx, conn, h.tlsConfig)
+			conn, err = tls.ClientHandshake(ctx, conn, h.tlsConfig)
 		}
 	}
 	if err != nil {

outbound/vless.go

@@ -0,0 +1,146 @@
+package outbound
+
+import (
+	"context"
+	"net"
+
+	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/common/dialer"
+	"github.com/sagernet/sing-box/common/tls"
+	C "github.com/sagernet/sing-box/constant"
+	"github.com/sagernet/sing-box/log"
+	"github.com/sagernet/sing-box/option"
+	"github.com/sagernet/sing-box/transport/v2ray"
+	"github.com/sagernet/sing-box/transport/vless"
+	"github.com/sagernet/sing-vmess/packetaddr"
+	"github.com/sagernet/sing/common"
+	E "github.com/sagernet/sing/common/exceptions"
+	M "github.com/sagernet/sing/common/metadata"
+	N "github.com/sagernet/sing/common/network"
+)
+
+var _ adapter.Outbound = (*VLESS)(nil)
+
+type VLESS struct {
+	myOutboundAdapter
+	dialer     N.Dialer
+	client     *vless.Client
+	serverAddr M.Socksaddr
+	tlsConfig  tls.Config
+	transport  adapter.V2RayClientTransport
+	packetAddr bool
+	xudp       bool
+}
+
+func NewVLESS(ctx context.Context, router adapter.Router, logger log.ContextLogger, tag string, options option.VLESSOutboundOptions) (*VLESS, error) {
+	outbound := &VLESS{
+		myOutboundAdapter: myOutboundAdapter{
+			protocol: C.TypeVLESS,
+			network:  options.Network.Build(),
+			router:   router,
+			logger:   logger,
+			tag:      tag,
+		},
+		dialer:     dialer.New(router, options.DialerOptions),
+		serverAddr: options.ServerOptions.Build(),
+	}
+	var err error
+	if options.TLS != nil {
+		outbound.tlsConfig, err = tls.NewClient(router, options.Server, common.PtrValueOrDefault(options.TLS))
+		if err != nil {
+			return nil, err
+		}
+	}
+	if options.Transport != nil {
+		outbound.transport, err = v2ray.NewClientTransport(ctx, outbound.dialer, outbound.serverAddr, common.PtrValueOrDefault(options.Transport), outbound.tlsConfig)
+		if err != nil {
+			return nil, E.Cause(err, "create client transport: ", options.Transport.Type)
+		}
+	}
+	switch options.PacketEncoding {
+	case "":
+	case "packetaddr":
+		outbound.packetAddr = true
+	case "xudp":
+		outbound.xudp = true
+	default:
+		return nil, E.New("unknown packet encoding: ", options.PacketEncoding)
+	}
+	outbound.client, err = vless.NewClient(options.UUID)
+	if err != nil {
+		return nil, err
+	}
+	return outbound, nil
+}
+
+func (h *VLESS) Close() error {
+	return common.Close(h.transport)
+}
+
+func (h *VLESS) DialContext(ctx context.Context, network string, destination M.Socksaddr) (net.Conn, error) {
+	ctx, metadata := adapter.AppendContext(ctx)
+	metadata.Outbound = h.tag
+	metadata.Destination = destination
+	var conn net.Conn
+	var err error
+	if h.transport != nil {
+		conn, err = h.transport.DialContext(ctx)
+	} else {
+		conn, err = h.dialer.DialContext(ctx, N.NetworkTCP, h.serverAddr)
+		if err == nil && h.tlsConfig != nil {
+			conn, err = tls.ClientHandshake(ctx, conn, h.tlsConfig)
+		}
+	}
+	if err != nil {
+		return nil, err
+	}
+	switch N.NetworkName(network) {
+	case N.NetworkTCP:
+	case N.NetworkUDP:
+	}
+	switch N.NetworkName(network) {
+	case N.NetworkTCP:
+		h.logger.InfoContext(ctx, "outbound connection to ", destination)
+		return h.client.DialEarlyConn(conn, destination), nil
+	case N.NetworkUDP:
+		h.logger.InfoContext(ctx, "outbound packet connection to ", destination)
+		return h.client.DialPacketConn(conn, destination), nil
+	default:
+		return nil, E.Extend(N.ErrUnknownNetwork, network)
+	}
+}
+
+func (h *VLESS) ListenPacket(ctx context.Context, destination M.Socksaddr) (net.PacketConn, error) {
+	h.logger.InfoContext(ctx, "outbound packet connection to ", destination)
+	ctx, metadata := adapter.AppendContext(ctx)
+	metadata.Outbound = h.tag
+	metadata.Destination = destination
+	var conn net.Conn
+	var err error
+	if h.transport != nil {
+		conn, err = h.transport.DialContext(ctx)
+	} else {
+		conn, err = h.dialer.DialContext(ctx, N.NetworkTCP, h.serverAddr)
+		if err == nil && h.tlsConfig != nil {
+			conn, err = tls.ClientHandshake(ctx, conn, h.tlsConfig)
+		}
+	}
+	if err != nil {
+		return nil, err
+	}
+	if h.xudp {
+		return h.client.DialXUDPPacketConn(conn, destination), nil
+	} else if h.packetAddr {
+		return packetaddr.NewConn(h.client.DialPacketConn(conn, M.Socksaddr{Fqdn: packetaddr.SeqPacketMagicAddress}), destination), nil
+	} else {
+		return h.client.DialPacketConn(conn, destination), nil
+	}
+}
+
+func (h *VLESS) NewConnection(ctx context.Context, conn net.Conn, metadata adapter.InboundContext) error {
+	return NewEarlyConnection(ctx, h, conn, metadata)
+}
+
+func (h *VLESS) NewPacketConnection(ctx context.Context, conn N.PacketConn, metadata adapter.InboundContext) error {
+	return NewPacketConnection(ctx, h, conn, metadata)
+}

outbound/vmess.go

@@ -2,12 +2,12 @@ package outbound
 
 import (
 	"context"
-	"crypto/tls"
 	"net"
 
 	"github.com/sagernet/sing-box/adapter"
 	"github.com/sagernet/sing-box/common/dialer"
 	"github.com/sagernet/sing-box/common/mux"
+	"github.com/sagernet/sing-box/common/tls"
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
@@ -28,7 +28,7 @@ type VMess struct {
 	client          *vmess.Client
 	serverAddr      M.Socksaddr
 	multiplexDialer N.Dialer
-	tlsConfig       *tls.Config
+	tlsConfig       tls.Config
 	transport       adapter.V2RayClientTransport
 	packetAddr      bool
 }
@@ -47,7 +47,7 @@ func NewVMess(ctx context.Context, router adapter.Router, logger log.ContextLogg
 	}
 	var err error
 	if options.TLS != nil {
-		outbound.tlsConfig, err = dialer.TLSConfig(options.Server, common.PtrValueOrDefault(options.TLS))
+		outbound.tlsConfig, err = tls.NewClient(router, options.Server, common.PtrValueOrDefault(options.TLS))
 		if err != nil {
 			return nil, err
 		}
@@ -142,7 +142,7 @@ func (h *vmessDialer) DialContext(ctx context.Context, network string, destinati
 	} else {
 		conn, err = h.dialer.DialContext(ctx, N.NetworkTCP, h.serverAddr)
 		if err == nil && h.tlsConfig != nil {
-			conn, err = dialer.TLSClient(ctx, conn, h.tlsConfig)
+			conn, err = tls.ClientHandshake(ctx, conn, h.tlsConfig)
 		}
 	}
 	if err != nil {
@@ -169,7 +169,7 @@ func (h *vmessDialer) ListenPacket(ctx context.Context, destination M.Socksaddr)
 	} else {
 		conn, err = h.dialer.DialContext(ctx, N.NetworkTCP, h.serverAddr)
 		if err == nil && h.tlsConfig != nil {
-			conn, err = dialer.TLSClient(ctx, conn, h.tlsConfig)
+			conn, err = tls.ClientHandshake(ctx, conn, h.tlsConfig)
 		}
 	}
 	if err != nil {

route/router.go

@@ -93,7 +93,7 @@ type Router struct {
 	networkMonitor                     tun.NetworkUpdateMonitor
 	interfaceMonitor                   tun.DefaultInterfaceMonitor
 	packageManager                     tun.PackageManager
-	trafficController                  adapter.TrafficController
+	clashServer                        adapter.ClashServer
 	processSearcher                    process.Searcher
 }
 
@@ -588,8 +588,8 @@ func (r *Router) RouteConnection(ctx context.Context, conn net.Conn, metadata ad
 		conn.Close()
 		return E.New("missing supported outbound, closing connection")
 	}
-	if r.trafficController != nil {
-		trackerConn, tracker := r.trafficController.RoutedConnection(ctx, conn, metadata, matchedRule)
+	if r.clashServer != nil {
+		trackerConn, tracker := r.clashServer.RoutedConnection(ctx, conn, metadata, matchedRule)
 		defer tracker.Leave()
 		conn = trackerConn
 	}
@@ -661,8 +661,8 @@ func (r *Router) RoutePacketConnection(ctx context.Context, conn N.PacketConn, m
 		conn.Close()
 		return E.New("missing supported outbound, closing packet connection")
 	}
-	if r.trafficController != nil {
-		trackerConn, tracker := r.trafficController.RoutedPacketConnection(ctx, conn, metadata, matchedRule)
+	if r.clashServer != nil {
+		trackerConn, tracker := r.clashServer.RoutedPacketConnection(ctx, conn, metadata, matchedRule)
 		defer tracker.Leave()
 		conn = trackerConn
 	}
@@ -746,8 +746,12 @@ func (r *Router) PackageManager() tun.PackageManager {
 	return r.packageManager
 }
 
-func (r *Router) SetTrafficController(controller adapter.TrafficController) {
-	r.trafficController = controller
+func (r *Router) ClashServer() adapter.ClashServer {
+	return r.clashServer
+}
+
+func (r *Router) SetClashServer(controller adapter.ClashServer) {
+	r.clashServer = controller
 }
 
 func hasRule(rules []option.Rule, cond func(rule option.DefaultRule) bool) bool {

route/router_dns.go

@@ -82,6 +82,9 @@ func (r *Router) Lookup(ctx context.Context, domain string, strategy dns.DomainS
 		r.dnsLogger.InfoContext(ctx, "lookup succeed for ", domain, ": ", strings.Join(F.MapToString(addrs), " "))
 	} else {
 		r.dnsLogger.ErrorContext(ctx, E.Cause(err, "lookup failed for ", domain))
+		if err == nil {
+			err = dns.RCodeNameError
+		}
 	}
 	return addrs, err
 }

route/rule.go

@@ -192,6 +192,11 @@ func NewDefaultRule(router adapter.Router, logger log.ContextLogger, options opt
 		rule.items = append(rule.items, item)
 		rule.allItems = append(rule.allItems, item)
 	}
+	if options.ClashMode != "" {
+		item := NewClashModeItem(router, options.ClashMode)
+		rule.items = append(rule.items, item)
+		rule.allItems = append(rule.allItems, item)
+	}
 	return rule, nil
 }
 

route/rule_clash_mode.go

@@ -0,0 +1,33 @@
+package route
+
+import (
+	"strings"
+
+	"github.com/sagernet/sing-box/adapter"
+)
+
+var _ RuleItem = (*ClashModeItem)(nil)
+
+type ClashModeItem struct {
+	router adapter.Router
+	mode   string
+}
+
+func NewClashModeItem(router adapter.Router, mode string) *ClashModeItem {
+	return &ClashModeItem{
+		router: router,
+		mode:   strings.ToLower(mode),
+	}
+}
+
+func (r *ClashModeItem) Match(metadata *adapter.InboundContext) bool {
+	clashServer := r.router.ClashServer()
+	if clashServer == nil {
+		return false
+	}
+	return clashServer.Mode() == r.mode
+}
+
+func (r *ClashModeItem) String() string {
+	return "clash_mode=" + r.mode
+}

route/rule_dns.go

@@ -180,6 +180,11 @@ func NewDefaultDNSRule(router adapter.Router, logger log.ContextLogger, options
 		rule.items = append(rule.items, item)
 		rule.allItems = append(rule.allItems, item)
 	}
+	if options.ClashMode != "" {
+		item := NewClashModeItem(router, options.ClashMode)
+		rule.items = append(rule.items, item)
+		rule.allItems = append(rule.allItems, item)
+	}
 	return rule, nil
 }
 

test/box_test.go

@@ -53,8 +53,8 @@ func testSuit(t *testing.T, clientPort uint16, testPort uint16) {
 	dialUDP := func() (net.PacketConn, error) {
 		return dialer.ListenPacket(context.Background(), M.ParseSocksaddrHostPort("127.0.0.1", testPort))
 	}
-	// require.NoError(t, testPingPongWithConn(t, testPort, dialTCP))
-	// require.NoError(t, testPingPongWithPacketConn(t, testPort, dialUDP))
+	require.NoError(t, testPingPongWithConn(t, testPort, dialTCP))
+	require.NoError(t, testPingPongWithPacketConn(t, testPort, dialUDP))
 	require.NoError(t, testLargeDataWithConn(t, testPort, dialTCP))
 	require.NoError(t, testLargeDataWithPacketConn(t, testPort, dialUDP))
 
@@ -80,6 +80,22 @@ func testSuitSimple(t *testing.T, clientPort uint16, testPort uint16) {
 	}
 	require.NoError(t, testPingPongWithConn(t, testPort, dialTCP))
 	require.NoError(t, testPingPongWithPacketConn(t, testPort, dialUDP))
+	require.NoError(t, testPingPongWithConn(t, testPort, dialTCP))
+	require.NoError(t, testPingPongWithPacketConn(t, testPort, dialUDP))
+}
+
+func testSuitSimple1(t *testing.T, clientPort uint16, testPort uint16) {
+	dialer := socks.NewClient(N.SystemDialer, M.ParseSocksaddrHostPort("127.0.0.1", clientPort), socks.Version5, "", "")
+	dialTCP := func() (net.Conn, error) {
+		return dialer.DialContext(context.Background(), "tcp", M.ParseSocksaddrHostPort("127.0.0.1", testPort))
+	}
+	dialUDP := func() (net.PacketConn, error) {
+		return dialer.ListenPacket(context.Background(), M.ParseSocksaddrHostPort("127.0.0.1", testPort))
+	}
+	require.NoError(t, testPingPongWithConn(t, testPort, dialTCP))
+	require.NoError(t, testPingPongWithPacketConn(t, testPort, dialUDP))
+	require.NoError(t, testPingPongWithConn(t, testPort, dialTCP))
+	require.NoError(t, testLargeDataWithPacketConn(t, testPort, dialUDP))
 }
 
 func testSuitWg(t *testing.T, clientPort uint16, testPort uint16) {
@@ -94,8 +110,8 @@ func testSuitWg(t *testing.T, clientPort uint16, testPort uint16) {
 		}
 		return bufio.NewUnbindPacketConn(conn), nil
 	}
+	require.NoError(t, testPingPongWithConn(t, testPort, dialTCP))
+	require.NoError(t, testPingPongWithPacketConn(t, testPort, dialUDP))
 	require.NoError(t, testLargeDataWithConn(t, testPort, dialTCP))
 	require.NoError(t, testLargeDataWithPacketConn(t, testPort, dialUDP))
-	// require.NoError(t, testPingPongWithConn(t, testPort, dialTCP))
-	// require.NoError(t, testPingPongWithPacketConn(t, testPort, dialUDP))
 }

test/clash_test.go

@@ -37,6 +37,8 @@ const (
 	ImageHysteria              = "tobyxdd/hysteria:latest"
 	ImageNginx                 = "nginx:stable"
 	ImageShadowTLS             = "ghcr.io/ihciah/shadow-tls:latest"
+	ImageShadowsocksR          = "teddysun/shadowsocks-r:latest"
+	ImageXRayCore              = "teddysun/xray:latest"
 )
 
 var allImages = []string{
@@ -49,6 +51,8 @@ var allImages = []string{
 	ImageHysteria,
 	ImageNginx,
 	ImageShadowTLS,
+	ImageShadowsocksR,
+	ImageXRayCore,
 }
 
 var localIP = netip.MustParseAddr("127.0.0.1")
@@ -385,21 +389,24 @@ func testLargeDataWithPacketConn(t *testing.T, port uint16, pcc func() (net.Pack
 		hashMap := map[int][]byte{}
 		mux := sync.Mutex{}
 		for i := 0; i < times; i++ {
-			buf := make([]byte, chunkSize)
-			if _, err = rand.Read(buf[1:]); err != nil {
-				t.Log(err.Error())
-				continue
-			}
-			buf[0] = byte(i)
+			go func(idx int) {
+				buf := make([]byte, chunkSize)
+				if _, err := rand.Read(buf[1:]); err != nil {
+					t.Log(err.Error())
+					return
+				}
+				buf[0] = byte(idx)
 
-			hash := md5.Sum(buf)
-			mux.Lock()
-			hashMap[i] = hash[:]
-			mux.Unlock()
-			if _, err = pc.WriteTo(buf, addr); err != nil {
-				t.Log(err)
-				continue
-			}
+				hash := md5.Sum(buf)
+				mux.Lock()
+				hashMap[idx] = hash[:]
+				mux.Unlock()
+
+				if _, err := pc.WriteTo(buf, addr); err != nil {
+					t.Log(err.Error())
+					return
+				}
+			}(i)
 		}
 
 		return hashMap, nil

test/config/shadowsocksr.json

@@ -0,0 +1,19 @@
+{
+  "server": "0.0.0.0",
+  "server_ipv6": "::",
+  "server_port": 10000,
+  "local_address": "127.0.0.1",
+  "local_port": 1080,
+  "password": "password0",
+  "timeout": 120,
+  "method": "aes-256-cfb",
+  "protocol": "origin",
+  "protocol_param": "",
+  "obfs": "plain",
+  "obfs_param": "",
+  "redirect": "",
+  "dns_ipv6": false,
+  "fast_open": true,
+  "workers": 1,
+  "forbidden_ip": ""
+}

test/config/vless-server.json

@@ -0,0 +1,25 @@
+{
+  "log": {
+    "loglevel": "debug"
+  },
+  "inbounds": [
+    {
+      "listen": "0.0.0.0",
+      "port": 1234,
+      "protocol": "vless",
+      "settings": {
+        "decryption": "none",
+        "clients": [
+          {
+            "id": "b831381d-6324-4d53-ad4f-8cda48b30811"
+          }
+        ]
+      }
+    }
+  ],
+  "outbounds": [
+    {
+      "protocol": "freedom"
+    }
+  ]
+}

test/go.mod

@@ -7,14 +7,14 @@ require github.com/sagernet/sing-box v0.0.0
 replace github.com/sagernet/sing-box => ../
 
 require (
-	github.com/docker/docker v20.10.17+incompatible
+	github.com/docker/docker v20.10.18+incompatible
 	github.com/docker/go-connections v0.4.0
-	github.com/gofrs/uuid v4.2.0+incompatible
-	github.com/sagernet/sing v0.0.0-20220903085538-02b9ca1cc133
+	github.com/gofrs/uuid v4.3.0+incompatible
+	github.com/sagernet/sing v0.0.0-20220913004915-27ddefbb8921
 	github.com/sagernet/sing-shadowsocks v0.0.0-20220819002358-7461bb09a8f6
 	github.com/spyzhov/ajson v0.7.1
 	github.com/stretchr/testify v1.8.0
-	golang.org/x/net v0.0.0-20220826154423-83b083e8dc8b
+	golang.org/x/net v0.0.0-20220909164309-bea034e7d591
 )
 
 //replace github.com/sagernet/sing => ../../sing
@@ -23,6 +23,8 @@ require (
 	berty.tech/go-libtor v1.0.385 // indirect
 	github.com/Microsoft/go-winio v0.5.1 // indirect
 	github.com/ajg/form v1.5.1 // indirect
+	github.com/andybalholm/brotli v1.0.4 // indirect
+	github.com/cloudflare/circl v1.2.1-0.20220831060716-4cf0150356fc // indirect
 	github.com/cretz/bine v0.2.0 // indirect
 	github.com/database64128/tfo-go v1.1.2 // indirect
 	github.com/davecgh/go-spew v1.1.1 // indirect
@@ -37,8 +39,8 @@ require (
 	github.com/golang/mock v1.6.0 // indirect
 	github.com/golang/protobuf v1.5.2 // indirect
 	github.com/google/btree v1.0.1 // indirect
-	github.com/gorilla/websocket v1.5.0 // indirect
 	github.com/hashicorp/yamux v0.1.1 // indirect
+	github.com/klauspost/compress v1.13.6 // indirect
 	github.com/klauspost/cpuid/v2 v2.1.0 // indirect
 	github.com/libdns/libdns v0.2.1 // indirect
 	github.com/logrusorgru/aurora v2.0.3+incompatible // indirect
@@ -46,6 +48,7 @@ require (
 	github.com/marten-seemann/qtls-go1-18 v0.1.2 // indirect
 	github.com/marten-seemann/qtls-go1-19 v0.1.0 // indirect
 	github.com/mholt/acmez v1.0.4 // indirect
+	github.com/miekg/dns v1.1.50 // indirect
 	github.com/moby/term v0.0.0-20220808134915-39b0c02b01ae // indirect
 	github.com/morikuni/aec v1.0.0 // indirect
 	github.com/nxadm/tail v1.4.8 // indirect
@@ -56,17 +59,21 @@ require (
 	github.com/pires/go-proxyproto v0.6.2 // indirect
 	github.com/pkg/errors v0.9.1 // indirect
 	github.com/pmezard/go-difflib v1.0.0 // indirect
+	github.com/refraction-networking/utls v1.1.2 // indirect
 	github.com/sagernet/abx-go v0.0.0-20220819185957-dba1257d738e // indirect
 	github.com/sagernet/certmagic v0.0.0-20220819042630-4a57f8b6853a // indirect
 	github.com/sagernet/go-tun2socks v1.16.12-0.20220818015926-16cb67876a61 // indirect
-	github.com/sagernet/netlink v0.0.0-20220826133217-3fb4ff92ea17 // indirect
+	github.com/sagernet/netlink v0.0.0-20220905062125-8043b4a9aa97 // indirect
 	github.com/sagernet/quic-go v0.0.0-20220818150011-de611ab3e2bb // indirect
-	github.com/sagernet/sing-dns v0.0.0-20220903082137-b1102b8fc961 // indirect
-	github.com/sagernet/sing-tun v0.0.0-20220828031750-185b6c880a83 // indirect
-	github.com/sagernet/sing-vmess v0.0.0-20220907073918-72d7fdf6825f // indirect
+	github.com/sagernet/shadowsocksr v0.0.0-20220912092645-c9ab93f81bb0 // indirect
+	github.com/sagernet/sing-dns v0.0.0-20220822023312-3e086b06d666 // indirect
+	github.com/sagernet/sing-tun v0.0.0-20220911034209-c7dd5d457e24 // indirect
+	github.com/sagernet/sing-vmess v0.0.0-20220913015714-c4ab86d40e12 // indirect
 	github.com/sagernet/smux v0.0.0-20220831015742-e0f1988e3195 // indirect
+	github.com/sagernet/websocket v0.0.0-20220913015213-615516348b4e // indirect
 	github.com/sirupsen/logrus v1.8.1 // indirect
 	github.com/vishvananda/netns v0.0.0-20211101163701-50045581ed74 // indirect
+	go.etcd.io/bbolt v1.3.6 // indirect
 	go.uber.org/atomic v1.10.0 // indirect
 	go.uber.org/multierr v1.6.0 // indirect
 	go.uber.org/zap v1.22.0 // indirect
@@ -74,19 +81,18 @@ require (
 	golang.org/x/crypto v0.0.0-20220829220503-c86fa9a7ed90 // indirect
 	golang.org/x/exp v0.0.0-20220722155223-a9213eeb770e // indirect
 	golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4 // indirect
-	golang.org/x/sys v0.0.0-20220829200755-d48e67d00261 // indirect
+	golang.org/x/sys v0.0.0-20220909162455-aba9fc2a8ff2 // indirect
 	golang.org/x/text v0.3.7 // indirect
 	golang.org/x/time v0.0.0-20191024005414-555d28b269f0 // indirect
 	golang.org/x/tools v0.1.11-0.20220513221640-090b14e8501f // indirect
 	golang.zx2c4.com/wintun v0.0.0-20211104114900-415007cec224 // indirect
-	golang.zx2c4.com/wireguard v0.0.0-20220829161405-d1d08426b27b // indirect
+	golang.zx2c4.com/wireguard v0.0.0-20220904105730-b51010ba13f0 // indirect
 	google.golang.org/genproto v0.0.0-20210722135532-667f2b7c528f // indirect
 	google.golang.org/grpc v1.49.0 // indirect
 	google.golang.org/protobuf v1.28.1 // indirect
 	gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7 // indirect
-	gopkg.in/yaml.v2 v2.4.0 // indirect
 	gopkg.in/yaml.v3 v3.0.1 // indirect
 	gotest.tools/v3 v3.3.0 // indirect
-	gvisor.dev/gvisor v0.0.0-20220819163037-ba6e795b139a // indirect
+	gvisor.dev/gvisor v0.0.0-20220901235040-6ca97ef2ce1c // indirect
 	lukechampine.com/blake3 v1.1.7 // indirect
 )

test/go.sum

@@ -9,11 +9,15 @@ github.com/Microsoft/go-winio v0.5.1 h1:aPJp2QD7OOrhO5tQXqQoGSJc+DjDtWTGLOmNyAm6
 github.com/Microsoft/go-winio v0.5.1/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84=
 github.com/ajg/form v1.5.1 h1:t9c7v8JUKu/XxOGBU0yjNpaMloxGEJhUkqFRq0ibGeU=
 github.com/ajg/form v1.5.1/go.mod h1:uL1WgH+h2mgNtvBq0339dVnzXdBETtL2LeUXaIv25UY=
+github.com/andybalholm/brotli v1.0.4 h1:V7DdXeJtZscaqfNuAdSRuRFzuiKlHSC/Zh3zl9qY3JY=
+github.com/andybalholm/brotli v1.0.4/go.mod h1:fO7iG3H7G2nSZ7m0zPUDn85XEX2GTukHGRSepvi9Eig=
 github.com/antihax/optional v1.0.0/go.mod h1:uupD/76wgC+ih3iEmQUL+0Ugr19nfwCT1kdvxnR2qWY=
 github.com/benbjohnson/clock v1.1.0 h1:Q92kusRqC1XV2MjkWETPvjJVqKetz1OzxZB7mHJLju8=
 github.com/benbjohnson/clock v1.1.0/go.mod h1:J11/hYXuz8f4ySSvYwY0FKfm+ezbsZBKZxNJlLklBHA=
 github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU=
 github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
+github.com/cloudflare/circl v1.2.1-0.20220831060716-4cf0150356fc h1:307gdRLiZ08dwOIKwc5lAQ19DRFaQQvdhHalyB4Asx8=
+github.com/cloudflare/circl v1.2.1-0.20220831060716-4cf0150356fc/go.mod h1:+CauBF6R70Jqcyl8N2hC8pAXYbWkGIezuSbuGLtRhnw=
 github.com/cncf/udpa/go v0.0.0-20191209042840-269d4d468f6f/go.mod h1:M8M6+tZqaGXZJjfX53e64911xZQV5JYwmTeXPW+k8Sc=
 github.com/cncf/udpa/go v0.0.0-20201120205902-5459f2c99403/go.mod h1:WmhPx2Nbnhtbo57+VJT5O0JRkEi1Wbu0z5j0R8u5Hbk=
 github.com/cncf/xds/go v0.0.0-20210312221358-fbca930ec8ed/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs=
@@ -28,8 +32,8 @@ github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c
 github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
 github.com/docker/distribution v2.8.1+incompatible h1:Q50tZOPR6T/hjNsyc9g8/syEs6bk8XXApsHjKukMl68=
 github.com/docker/distribution v2.8.1+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w=
-github.com/docker/docker v20.10.17+incompatible h1:JYCuMrWaVNophQTOrMMoSwudOVEfcegoZZrleKc1xwE=
-github.com/docker/docker v20.10.17+incompatible/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
+github.com/docker/docker v20.10.18+incompatible h1:SN84VYXTBNGn92T/QwIRPlum9zfemfitN7pbsp26WSc=
+github.com/docker/docker v20.10.18+incompatible/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
 github.com/docker/go-connections v0.4.0 h1:El9xVISelRB7BuFusrZozjnkIM5YnzCViNKohAFqRJQ=
 github.com/docker/go-connections v0.4.0/go.mod h1:Gbd7IOopHjR8Iph03tsViu4nIes5XhDvyHbTtUxmeec=
 github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw=
@@ -53,8 +57,8 @@ github.com/go-chi/render v1.0.2 h1:4ER/udB0+fMWB2Jlf15RV3F4A2FDuYi/9f+lFttR/Lg=
 github.com/go-chi/render v1.0.2/go.mod h1:/gr3hVkmYR0YlEy3LxCuVRFzEu9Ruok+gFqbIofjao0=
 github.com/go-task/slim-sprig v0.0.0-20210107165309-348f09dbbbc0 h1:p104kn46Q8WdvHunIJ9dAyjPVtrBPhSr3KT2yUst43I=
 github.com/go-task/slim-sprig v0.0.0-20210107165309-348f09dbbbc0/go.mod h1:fyg7847qk6SyHyPtNmDHnmrv/HOrqktSC+C9fM+CJOE=
-github.com/gofrs/uuid v4.2.0+incompatible h1:yyYWMnhkhrKwwr8gAOcOCYxOOscHgDS9yZgBrnJfGa0=
-github.com/gofrs/uuid v4.2.0+incompatible/go.mod h1:b2aQJv3Z4Fp6yNu3cdSllBxTCLRxnplIgP/c0N/04lM=
+github.com/gofrs/uuid v4.3.0+incompatible h1:CaSVZxm5B+7o45rtab4jC2G37WGYX1zQfuU2i6DSvnc=
+github.com/gofrs/uuid v4.3.0+incompatible/go.mod h1:b2aQJv3Z4Fp6yNu3cdSllBxTCLRxnplIgP/c0N/04lM=
 github.com/gogo/protobuf v1.3.2 h1:Ov1cvc58UF3b5XjBnZv7+opcTcQFZebYjWzi34vdm4Q=
 github.com/gogo/protobuf v1.3.2/go.mod h1:P1XiOD3dCwIKUDQYPy72D8LYyHL2YPYrpS2s69NZV8Q=
 github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
@@ -85,14 +89,14 @@ github.com/google/go-cmp v0.5.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/
 github.com/google/go-cmp v0.5.5/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
 github.com/google/go-cmp v0.5.8 h1:e6P7q2lk1O+qJJb4BtCQXlK8vWEO8V1ZeuEdJNOqZyg=
 github.com/google/uuid v1.1.2/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
-github.com/gorilla/websocket v1.5.0 h1:PPwGk2jz7EePpoHN/+ClbZu8SPxiqlu12wZP/3sWmnc=
-github.com/gorilla/websocket v1.5.0/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE=
 github.com/grpc-ecosystem/grpc-gateway v1.16.0/go.mod h1:BDjrQk3hbvj6Nolgz8mAMFbcEtjT1g+wF4CSlocrBnw=
 github.com/hashicorp/yamux v0.1.1 h1:yrQxtgseBDrq9Y652vSRDvsKCJKOUD+GzTS4Y0Y8pvE=
 github.com/hashicorp/yamux v0.1.1/go.mod h1:CtWFDAQgb7dxtzFs4tWbplKIe2jSi3+5vKbgIO0SLnQ=
 github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU=
 github.com/kisielk/errcheck v1.5.0/go.mod h1:pFxgyoBC7bSaBwPgfKdkLd5X25qrDl4LWUI2bnpBCr8=
 github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
+github.com/klauspost/compress v1.13.6 h1:P76CopJELS0TiO2mebmnzgWaajssP/EszplttgQxcgc=
+github.com/klauspost/compress v1.13.6/go.mod h1:/3/Vjq9QcHkK5uEr5lBEmyoZ1iFhe47etQ6QUkpK6sk=
 github.com/klauspost/cpuid/v2 v2.0.9/go.mod h1:FInQzS24/EEf25PyTYn52gqo7WaD8xa0213Md/qVLRg=
 github.com/klauspost/cpuid/v2 v2.1.0 h1:eyi1Ad2aNJMW95zcSbmGg7Cg6cq3ADwLpMAP96d8rF0=
 github.com/klauspost/cpuid/v2 v2.1.0/go.mod h1:RVVoqg1df56z8g3pUjL/3lE5UfnlrJX8tyFgg4nqhuY=
@@ -113,6 +117,8 @@ github.com/marten-seemann/qtls-go1-19 v0.1.0 h1:rLFKD/9mp/uq1SYGYuVZhm83wkmU95pK
 github.com/marten-seemann/qtls-go1-19 v0.1.0/go.mod h1:5HTDWtVudo/WFsHKRNuOhWlbdjrfs5JHrYb0wIJqGpI=
 github.com/mholt/acmez v1.0.4 h1:N3cE4Pek+dSolbsofIkAYz6H1d3pE+2G0os7QHslf80=
 github.com/mholt/acmez v1.0.4/go.mod h1:qFGLZ4u+ehWINeJZjzPlsnjJBCPAADWTcIqE/7DAYQY=
+github.com/miekg/dns v1.1.50 h1:DQUfb9uc6smULcREF09Uc+/Gd46YWqJd5DbpPE9xkcA=
+github.com/miekg/dns v1.1.50/go.mod h1:e3IlAVfNqAllflbibAZEWOXOQ+Ynzk/dDozDxY7XnME=
 github.com/moby/term v0.0.0-20220808134915-39b0c02b01ae h1:O4SWKdcHVCvYqyDV+9CJA1fcDN2L11Bule0iFy3YlAI=
 github.com/moby/term v0.0.0-20220808134915-39b0c02b01ae/go.mod h1:E2VnQOmVuvZB6UYnnDB0qG5Nq/1tD9acaOpo6xmt0Kw=
 github.com/morikuni/aec v1.0.0 h1:nP9CBfwrvYnBRgY6qfDQkygYDmYwOilePFkwzv4dU8A=
@@ -142,6 +148,8 @@ github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINE
 github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
 github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
 github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
+github.com/refraction-networking/utls v1.1.2 h1:a7GQauRt72VG+wtNm0lnrAaCGlyX47gEi1++dSsDBpw=
+github.com/refraction-networking/utls v1.1.2/go.mod h1:+D89TUtA8+NKVFj1IXWr0p3tSdX1+SqUB7rL0QnGqyg=
 github.com/rogpeppe/fastuuid v1.2.0/go.mod h1:jVj6XXZzXRy/MSR5jhDC/2q6DgLz+nrA6LYCDYWNEvQ=
 github.com/sagernet/abx-go v0.0.0-20220819185957-dba1257d738e h1:5CFRo8FJbCuf5s/eTBdZpmMbn8Fe2eSMLNAYfKanA34=
 github.com/sagernet/abx-go v0.0.0-20220819185957-dba1257d738e/go.mod h1:qbt0dWObotCfcjAJJ9AxtFPNSDUfZF+6dCpgKEOBn/g=
@@ -149,24 +157,28 @@ github.com/sagernet/certmagic v0.0.0-20220819042630-4a57f8b6853a h1:SE3Xn4GOQ+kx
 github.com/sagernet/certmagic v0.0.0-20220819042630-4a57f8b6853a/go.mod h1:Q+ZXyesnkjV5B70B1ixk65ecKrlJ2jz0atv3fPKsVVo=
 github.com/sagernet/go-tun2socks v1.16.12-0.20220818015926-16cb67876a61 h1:5+m7c6AkmAylhauulqN/c5dnh8/KssrE9c93TQrXldA=
 github.com/sagernet/go-tun2socks v1.16.12-0.20220818015926-16cb67876a61/go.mod h1:QUQ4RRHD6hGGHdFMEtR8T2P6GS6R3D/CXKdaYHKKXms=
-github.com/sagernet/netlink v0.0.0-20220826133217-3fb4ff92ea17 h1:zvm6IrIgo4rLizJCHkH+SWUBhm+jyjjozX031QdAlj8=
-github.com/sagernet/netlink v0.0.0-20220826133217-3fb4ff92ea17/go.mod h1:xLnfdiJbSp8rNqYEdIW/6eDO4mVoogml14Bh2hSiFpM=
+github.com/sagernet/netlink v0.0.0-20220905062125-8043b4a9aa97 h1:iL5gZI3uFp0X6EslacyapiRz7LLSJyr4RajF/BhMVyE=
+github.com/sagernet/netlink v0.0.0-20220905062125-8043b4a9aa97/go.mod h1:xLnfdiJbSp8rNqYEdIW/6eDO4mVoogml14Bh2hSiFpM=
 github.com/sagernet/quic-go v0.0.0-20220818150011-de611ab3e2bb h1:wc0yQ+SBn4TaTYRwpwvEm3nc4eRdxk6vtRbouLVZAzk=
 github.com/sagernet/quic-go v0.0.0-20220818150011-de611ab3e2bb/go.mod h1:MIccjRKnPTjWwAOpl+AUGWOkzyTd9tERytudxu+1ra4=
+github.com/sagernet/shadowsocksr v0.0.0-20220912092645-c9ab93f81bb0 h1:lQ4RFWY/wBYmXl/zJJCwQbhiEIbgEqC7j+nhZYkgwmU=
+github.com/sagernet/shadowsocksr v0.0.0-20220912092645-c9ab93f81bb0/go.mod h1:xSHLCsdgy5QIozXFEv6uDgMWzyrRdFFjr3TgL+juu6g=
 github.com/sagernet/sing v0.0.0-20220812082120-05f9836bff8f/go.mod h1:QVsS5L/ZA2Q5UhQwLrn0Trw+msNd/NPGEhBKR/ioWiY=
 github.com/sagernet/sing v0.0.0-20220817130738-ce854cda8522/go.mod h1:QVsS5L/ZA2Q5UhQwLrn0Trw+msNd/NPGEhBKR/ioWiY=
-github.com/sagernet/sing v0.0.0-20220903085538-02b9ca1cc133 h1:krnb8wKEFIdXhmJYlhJMbEcPsJFISy2fz90uHVz7hMU=
-github.com/sagernet/sing v0.0.0-20220903085538-02b9ca1cc133/go.mod h1:kZvzh1VDa/Dg/Bt5WaYKU0jl5ept8KKDpl3Ay4gRtRQ=
-github.com/sagernet/sing-dns v0.0.0-20220903082137-b1102b8fc961 h1:5JeqhvCGV6AQQiAO0V67Loh2eyO3JNjIQnvRF8NnTE0=
-github.com/sagernet/sing-dns v0.0.0-20220903082137-b1102b8fc961/go.mod h1:vKBBy4mNJRaFuJ8H6kYIOPofsZ1JT5mgdwIlebtvnZ4=
+github.com/sagernet/sing v0.0.0-20220913004915-27ddefbb8921 h1:xUHzlIbdlPV/fkToIO9futp9lmKIY+72ezk/whQ8XsI=
+github.com/sagernet/sing v0.0.0-20220913004915-27ddefbb8921/go.mod h1:kZvzh1VDa/Dg/Bt5WaYKU0jl5ept8KKDpl3Ay4gRtRQ=
+github.com/sagernet/sing-dns v0.0.0-20220822023312-3e086b06d666 h1:XUTocA/Ek0dFxUX+xJCWMPPFZCn2GC/uLrBjTSr1vHY=
+github.com/sagernet/sing-dns v0.0.0-20220822023312-3e086b06d666/go.mod h1:eDyH7AJmqBGjZQdQmpZIzlbTREudZuWDExMuGKgjRVM=
 github.com/sagernet/sing-shadowsocks v0.0.0-20220819002358-7461bb09a8f6 h1:JJfDeYYhWunvtxsU/mOVNTmFQmnzGx9dY034qG6G3g4=
 github.com/sagernet/sing-shadowsocks v0.0.0-20220819002358-7461bb09a8f6/go.mod h1:EX3RbZvrwAkPI2nuGa78T2iQXmrkT+/VQtskjou42xM=
-github.com/sagernet/sing-tun v0.0.0-20220828031750-185b6c880a83 h1:SoWiHYuOCVedqA7T/CJSZUUrcPGKQb2wFKEq8DphiAI=
-github.com/sagernet/sing-tun v0.0.0-20220828031750-185b6c880a83/go.mod h1:76r07HS1WRcEI4mE9pFsohfTBUt1j/G9Avz6DaOP3VU=
-github.com/sagernet/sing-vmess v0.0.0-20220907073918-72d7fdf6825f h1:6l9aXZqAl1JqXJWi89KHpWnM/moQUPGG+XiwMc+yD0A=
-github.com/sagernet/sing-vmess v0.0.0-20220907073918-72d7fdf6825f/go.mod h1:u66Vv7NHXJWfeAmhh7JuJp/cwxmuQlM56QoZ7B7Mmd0=
+github.com/sagernet/sing-tun v0.0.0-20220911034209-c7dd5d457e24 h1:LsmPeFvj4GhiV5Y7Rm8I845XysdxVN4MQmfZ36P5bmw=
+github.com/sagernet/sing-tun v0.0.0-20220911034209-c7dd5d457e24/go.mod h1:5AhPUv9jWDQ3pv3Mj78SL/1TSjhoaj6WNASxRKLqXqM=
+github.com/sagernet/sing-vmess v0.0.0-20220913015714-c4ab86d40e12 h1:4HYGbTDDemgBVTmaspXbkgjJlXc3hYVjNxSddJndq8Y=
+github.com/sagernet/sing-vmess v0.0.0-20220913015714-c4ab86d40e12/go.mod h1:u66Vv7NHXJWfeAmhh7JuJp/cwxmuQlM56QoZ7B7Mmd0=
 github.com/sagernet/smux v0.0.0-20220831015742-e0f1988e3195 h1:5VBIbVw9q7aKbrFdT83mjkyvQ+VaRsQ6yflTepfln38=
 github.com/sagernet/smux v0.0.0-20220831015742-e0f1988e3195/go.mod h1:yedWtra8nyGJ+SyI+ziwuaGMzBatbB10P1IOOZbbSK8=
+github.com/sagernet/websocket v0.0.0-20220913015213-615516348b4e h1:7uw2njHFGE+VpWamge6o56j2RWk4omF6uLKKxMmcWvs=
+github.com/sagernet/websocket v0.0.0-20220913015213-615516348b4e/go.mod h1:45TUl8+gH4SIKr4ykREbxKWTxkDlSzFENzctB1dVRRY=
 github.com/sirupsen/logrus v1.7.0/go.mod h1:yWOB1SBYBC5VeMP7gHvWumXLIWorT60ONWic61uBYv0=
 github.com/sirupsen/logrus v1.8.1 h1:dJKuHgqk1NNQlqoA6BTlM1Wf9DOH3NBjQyu0h9+AZZE=
 github.com/sirupsen/logrus v1.8.1/go.mod h1:yWOB1SBYBC5VeMP7gHvWumXLIWorT60ONWic61uBYv0=
@@ -187,6 +199,8 @@ github.com/vishvananda/netns v0.0.0-20211101163701-50045581ed74/go.mod h1:DD4vA1
 github.com/yuin/goldmark v1.1.27/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
 github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
 github.com/yuin/goldmark v1.3.5/go.mod h1:mwnBkeHKe2W/ZEtQ+71ViKU8L12m81fl3OWwC1Zlc8k=
+go.etcd.io/bbolt v1.3.6 h1:/ecaJf0sk1l4l6V4awd65v2C3ILy7MSj+s/x1ADCIMU=
+go.etcd.io/bbolt v1.3.6/go.mod h1:qXsaaIqmgQH0T+OPdb99Bf+PKfBBQVAdyD6TY9G8XM4=
 go.opentelemetry.io/proto/otlp v0.7.0/go.mod h1:PqfVotwruBrMGOCsRd/89rSnXhoiJIqeYNgFYFoEGnI=
 go.uber.org/atomic v1.7.0/go.mod h1:fEN4uk6kAWBTFdckzkM89CLk9XfWZrxpCo0nPH17wJc=
 go.uber.org/atomic v1.10.0 h1:9qC72Qh0+3MqyJbAn8YU5xVq1frD8bn3JtD2oXtafVQ=
@@ -204,7 +218,9 @@ golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACk
 golang.org/x/crypto v0.0.0-20190404164418-38d8ce5564a5/go.mod h1:WFFai1msRO1wXaEeE5yQxYXgSfI8pQAWXbQop6sCtWE=
 golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
 golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
+golang.org/x/crypto v0.0.0-20201203163018-be400aefbc4c/go.mod h1:jdWPYTVW3xRLrWPugEBEK3UY2ZEsg3UU495nc5E+M+I=
 golang.org/x/crypto v0.0.0-20210513164829-c07d793c2f9a/go.mod h1:P+XmwS30IXTQdn5tA2iutPOUgjI07+tq3H3K9MVA1s8=
+golang.org/x/crypto v0.0.0-20211108221036-ceb1ce70b4fa/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc=
 golang.org/x/crypto v0.0.0-20220829220503-c86fa9a7ed90 h1:Y/gsMcFOcR+6S6f3YeMKl5g+dZMEWqcz5Czj/GWYbkM=
 golang.org/x/crypto v0.0.0-20220829220503-c86fa9a7ed90/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4=
 golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
@@ -237,9 +253,11 @@ golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwY
 golang.org/x/net v0.0.0-20210226172049-e18ecbb05110/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
 golang.org/x/net v0.0.0-20210405180319-a5a99cb37ef4/go.mod h1:p54w0d4576C0XHj96bSt6lcn1PtDYWL6XObtHCRCNQM=
 golang.org/x/net v0.0.0-20210525063256-abc453219eb5/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y=
+golang.org/x/net v0.0.0-20210726213435-c6fcb2dbf985/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y=
+golang.org/x/net v0.0.0-20211111160137-58aab5ef257a/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y=
 golang.org/x/net v0.0.0-20220630215102-69896b714898/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c=
-golang.org/x/net v0.0.0-20220826154423-83b083e8dc8b h1:ZmngSVLe/wycRns9MKikG9OWIEjGcGAkacif7oYQaUY=
-golang.org/x/net v0.0.0-20220826154423-83b083e8dc8b/go.mod h1:YDH+HFinaLZZlnHAfSS6ZXJJ9M9t4Dl22yv3iI2vPwk=
+golang.org/x/net v0.0.0-20220909164309-bea034e7d591 h1:D0B/7al0LLrVC8aWF4+oxpv/m8bc7ViFfVS8/gXGdqI=
+golang.org/x/net v0.0.0-20220909164309-bea034e7d591/go.mod h1:YDH+HFinaLZZlnHAfSS6ZXJJ9M9t4Dl22yv3iI2vPwk=
 golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
 golang.org/x/oauth2 v0.0.0-20200107190931-bf48bf16ab8d/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
 golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
@@ -248,6 +266,7 @@ golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJ
 golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20210220032951-036812b2e83c h1:5KslGYwFpkhGh+Q16bwMP3cOontH8FOep7tGV86Y7SQ=
 golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
 golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
@@ -261,6 +280,7 @@ golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7w
 golang.org/x/sys v0.0.0-20200217220822-9197077df867/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20200519105757-fe76b779f299/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200923182605-d9f96fdee20d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20210112080510-489259a85091/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
@@ -271,12 +291,14 @@ golang.org/x/sys v0.0.0-20210423082822-04245dca01da/go.mod h1:h1NjWce9XRLGQEsW7w
 golang.org/x/sys v0.0.0-20210510120138-977fb7262007/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20210616094352-59db8d763f22/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210630005230-0f9fa26af87c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220412211240-33da011f77ad/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220704084225-05e143d24a9e/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220731174439-a90be440212d/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
-golang.org/x/sys v0.0.0-20220829200755-d48e67d00261 h1:v6hYoSR9T5oet+pMXwUWkbiVqx/63mlHjefrHmxwfeY=
-golang.org/x/sys v0.0.0-20220829200755-d48e67d00261/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20220909162455-aba9fc2a8ff2 h1:wM1k/lXfpc5HdkJJyW9GELpd8ERGdnh8sMGL6Gzq3Ho=
+golang.org/x/sys v0.0.0-20220909162455-aba9fc2a8ff2/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/term v0.0.0-20201117132131-f5c789dd3221/go.mod h1:Nr5EML6q2oocZ2LXRh80K7BxOlk5/8JxuGnuhpl+muw=
 golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo=
 golang.org/x/term v0.0.0-20210927222741-03fcf44c2211 h1:JGgROgKl9N8DuW20oFS5gxc+lE67/N3FcwmBPMe7ArY=
 golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
@@ -303,6 +325,7 @@ golang.org/x/tools v0.0.0-20210106214847-113979e3529a/go.mod h1:emZCQorbCU4vsT4f
 golang.org/x/tools v0.1.0/go.mod h1:xkSsbof2nBLbhDlRMhhhyNLN/zl3eTqcnHD5viDpcZ0=
 golang.org/x/tools v0.1.1/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
 golang.org/x/tools v0.1.5/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
+golang.org/x/tools v0.1.6-0.20210726203631-07bc1bf47fb2/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
 golang.org/x/tools v0.1.11-0.20220513221640-090b14e8501f h1:OKYpQQVE3DKSc3r3zHVzq46vq5YH7x8xpR3/k9ixmUg=
 golang.org/x/tools v0.1.11-0.20220513221640-090b14e8501f/go.mod h1:SgwaegtQh8clINPpECJMqnxLv9I09HLqnW3RMqW0CA4=
 golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
@@ -311,8 +334,8 @@ golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8T
 golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
 golang.zx2c4.com/wintun v0.0.0-20211104114900-415007cec224 h1:Ug9qvr1myri/zFN6xL17LSCBGFDnphBBhzmILHsM5TY=
 golang.zx2c4.com/wintun v0.0.0-20211104114900-415007cec224/go.mod h1:deeaetjYA+DHMHg+sMSMI58GrEteJUUzzw7en6TJQcI=
-golang.zx2c4.com/wireguard v0.0.0-20220829161405-d1d08426b27b h1:qgrKnOfe1zyURRNdmDlGbN32i38Zjmw0B1+TMdHcOvg=
-golang.zx2c4.com/wireguard v0.0.0-20220829161405-d1d08426b27b/go.mod h1:6y4CqPAy54NwiN4nC8K+R1eMpQDB1P2d25qmunh2RSA=
+golang.zx2c4.com/wireguard v0.0.0-20220904105730-b51010ba13f0 h1:5ZkdpbduT/g+9OtbSDvbF3KvfQG45CtH/ppO8FUmvCQ=
+golang.zx2c4.com/wireguard v0.0.0-20220904105730-b51010ba13f0/go.mod h1:enML0deDxY1ux+B6ANGiwtg0yAJi1rctkTpcHNAVPyg=
 google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
 google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
 google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
@@ -354,9 +377,8 @@ gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
 gopkg.in/yaml.v2 v2.2.3/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
 gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
 gopkg.in/yaml.v2 v2.2.8/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
+gopkg.in/yaml.v2 v2.3.0 h1:clyUAQHOM3G0M3f5vQj7LuJrETvjVot3Z5el9nffUtU=
 gopkg.in/yaml.v2 v2.3.0/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
-gopkg.in/yaml.v2 v2.4.0 h1:D8xgwECY7CYvx+Y2n4sBz93Jn9JRvxdiyyo8CTfuKaY=
-gopkg.in/yaml.v2 v2.4.0/go.mod h1:RDklbk79AGWmwhnvt/jBztapEOGDOx6ZbXqjP6csGnQ=
 gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
 gopkg.in/yaml.v3 v3.0.0-20210107192922-496545a6307b/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
 gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
@@ -364,8 +386,8 @@ gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
 gotest.tools/v3 v3.0.2/go.mod h1:3SzNCllyD9/Y+b5r9JIKQ474KzkZyqLqEfYqMsX94Bk=
 gotest.tools/v3 v3.3.0 h1:MfDY1b1/0xN1CyMlQDac0ziEy9zJQd9CXBRRDHw2jJo=
 gotest.tools/v3 v3.3.0/go.mod h1:Mcr9QNxkg0uMvy/YElmo4SpXgJKWgQvYrT7Kw5RzJ1A=
-gvisor.dev/gvisor v0.0.0-20220819163037-ba6e795b139a h1:W1h3JsEzYWg7eD4908iHv49p7AOx7JPKsoh/fsxgylM=
-gvisor.dev/gvisor v0.0.0-20220819163037-ba6e795b139a/go.mod h1:TIvkJD0sxe8pIob3p6T8IzxXunlp6yfgktvTNp+DGNM=
+gvisor.dev/gvisor v0.0.0-20220901235040-6ca97ef2ce1c h1:m5lcgWnL3OElQNVyp3qcncItJ2c0sQlSGjYK2+nJTA4=
+gvisor.dev/gvisor v0.0.0-20220901235040-6ca97ef2ce1c/go.mod h1:TIvkJD0sxe8pIob3p6T8IzxXunlp6yfgktvTNp+DGNM=
 honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
 honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
 lukechampine.com/blake3 v1.1.7 h1:GgRMhmdsuK8+ii6UZFDL8Nb+VyMwadAgcJyfYHxG6n0=

test/hysteria_test.go

@@ -9,9 +9,6 @@ import (
 )
 
 func TestHysteriaSelf(t *testing.T) {
-	if !C.QUIC_AVAILABLE {
-		t.Skip("QUIC not included")
-	}
 	_, certPem, keyPem := createSelfSignedCertificate(t, "example.org")
 	startInstance(t, option.Options{
 		Inbounds: []option.Inbound{
@@ -80,13 +77,10 @@ func TestHysteriaSelf(t *testing.T) {
 			},
 		},
 	})
-	testSuitSimple(t, clientPort, testPort)
+	testSuitSimple1(t, clientPort, testPort)
 }
 
 func TestHysteriaInbound(t *testing.T) {
-	if !C.QUIC_AVAILABLE {
-		t.Skip("QUIC not included")
-	}
 	caPem, certPem, keyPem := createSelfSignedCertificate(t, "example.org")
 	startInstance(t, option.Options{
 		Inbounds: []option.Inbound{
@@ -124,9 +118,6 @@ func TestHysteriaInbound(t *testing.T) {
 }
 
 func TestHysteriaOutbound(t *testing.T) {
-	if !C.QUIC_AVAILABLE {
-		t.Skip("QUIC not included")
-	}
 	_, certPem, keyPem := createSelfSignedCertificate(t, "example.org")
 	startDockerContainer(t, DockerOptions{
 		Image: ImageHysteria,
@@ -171,5 +162,5 @@ func TestHysteriaOutbound(t *testing.T) {
 			},
 		},
 	})
-	testSuitSimple(t, clientPort, testPort)
+	testSuit(t, clientPort, testPort)
 }

test/naive_test.go

@@ -99,9 +99,6 @@ func TestNaiveInbound(t *testing.T) {
 }
 
 func TestNaiveHTTP3Inbound(t *testing.T) {
-	if !C.QUIC_AVAILABLE {
-		t.Skip("QUIC not included")
-	}
 	caPem, certPem, keyPem := createSelfSignedCertificate(t, "example.org")
 	startInstance(t, option.Options{
 		Inbounds: []option.Inbound{

test/shadowsocksr_test.go

@@ -0,0 +1,48 @@
+package main
+
+import (
+	"net/netip"
+	"testing"
+
+	C "github.com/sagernet/sing-box/constant"
+	"github.com/sagernet/sing-box/option"
+)
+
+func TestShadowsocksR(t *testing.T) {
+	startDockerContainer(t, DockerOptions{
+		Image: ImageShadowsocksR,
+		Ports: []uint16{serverPort, testPort},
+		Bind: map[string]string{
+			"shadowsocksr.json": "/etc/shadowsocks-r/config.json",
+		},
+	})
+	startInstance(t, option.Options{
+		Inbounds: []option.Inbound{
+			{
+				Type: C.TypeMixed,
+				MixedOptions: option.HTTPMixedInboundOptions{
+					ListenOptions: option.ListenOptions{
+						Listen:     option.ListenAddress(netip.IPv4Unspecified()),
+						ListenPort: clientPort,
+					},
+				},
+			},
+		},
+		Outbounds: []option.Outbound{
+			{
+				Type: C.TypeShadowsocksR,
+				ShadowsocksROptions: option.ShadowsocksROutboundOptions{
+					ServerOptions: option.ServerOptions{
+						Server:     "127.0.0.1",
+						ServerPort: serverPort,
+					},
+					Method:   "aes-256-cfb",
+					Password: "password0",
+					Obfs:     "plain",
+					Protocol: "origin",
+				},
+			},
+		},
+	})
+	testSuit(t, clientPort, testPort)
+}

test/tls_test.go

@@ -0,0 +1,84 @@
+package main
+
+import (
+	"net/netip"
+	"testing"
+
+	C "github.com/sagernet/sing-box/constant"
+	"github.com/sagernet/sing-box/option"
+)
+
+func TestUTLS(t *testing.T) {
+	_, certPem, keyPem := createSelfSignedCertificate(t, "example.org")
+	startInstance(t, option.Options{
+		Inbounds: []option.Inbound{
+			{
+				Type: C.TypeMixed,
+				Tag:  "mixed-in",
+				MixedOptions: option.HTTPMixedInboundOptions{
+					ListenOptions: option.ListenOptions{
+						Listen:     option.ListenAddress(netip.IPv4Unspecified()),
+						ListenPort: clientPort,
+					},
+				},
+			},
+			{
+				Type: C.TypeTrojan,
+				TrojanOptions: option.TrojanInboundOptions{
+					ListenOptions: option.ListenOptions{
+						Listen:     option.ListenAddress(netip.IPv4Unspecified()),
+						ListenPort: serverPort,
+					},
+					Users: []option.TrojanUser{
+						{
+							Name:     "sekai",
+							Password: "password",
+						},
+					},
+					TLS: &option.InboundTLSOptions{
+						Enabled:         true,
+						ServerName:      "example.org",
+						CertificatePath: certPem,
+						KeyPath:         keyPem,
+					},
+				},
+			},
+		},
+		Outbounds: []option.Outbound{
+			{
+				Type: C.TypeDirect,
+			},
+			{
+				Type: C.TypeTrojan,
+				Tag:  "trojan-out",
+				TrojanOptions: option.TrojanOutboundOptions{
+					ServerOptions: option.ServerOptions{
+						Server:     "127.0.0.1",
+						ServerPort: serverPort,
+					},
+					Password: "password",
+					TLS: &option.OutboundTLSOptions{
+						Enabled:         true,
+						ServerName:      "example.org",
+						CertificatePath: certPem,
+						UTLS: &option.OutboundUTLSOptions{
+							Enabled:     true,
+							Fingerprint: "chrome",
+						},
+					},
+				},
+			},
+		},
+		Route: &option.RouteOptions{
+			Rules: []option.Rule{
+				{
+					DefaultOptions: option.DefaultRule{
+						Inbound:  []string{"mixed-in"},
+						Outbound: "trojan-out",
+					},
+				},
+			},
+		},
+	})
+	testSuit(t, clientPort, testPort)
+}

test/trojan_test.go

@@ -122,3 +122,62 @@ func TestTrojanSelf(t *testing.T) {
 	})
 	testSuit(t, clientPort, testPort)
 }
+
+func TestTrojanPlainSelf(t *testing.T) {
+	startInstance(t, option.Options{
+		Inbounds: []option.Inbound{
+			{
+				Type: C.TypeMixed,
+				Tag:  "mixed-in",
+				MixedOptions: option.HTTPMixedInboundOptions{
+					ListenOptions: option.ListenOptions{
+						Listen:     option.ListenAddress(netip.IPv4Unspecified()),
+						ListenPort: clientPort,
+					},
+				},
+			},
+			{
+				Type: C.TypeTrojan,
+				TrojanOptions: option.TrojanInboundOptions{
+					ListenOptions: option.ListenOptions{
+						Listen:     option.ListenAddress(netip.IPv4Unspecified()),
+						ListenPort: serverPort,
+					},
+					Users: []option.TrojanUser{
+						{
+							Name:     "sekai",
+							Password: "password",
+						},
+					},
+				},
+			},
+		},
+		Outbounds: []option.Outbound{
+			{
+				Type: C.TypeDirect,
+			},
+			{
+				Type: C.TypeTrojan,
+				Tag:  "trojan-out",
+				TrojanOptions: option.TrojanOutboundOptions{
+					ServerOptions: option.ServerOptions{
+						Server:     "127.0.0.1",
+						ServerPort: serverPort,
+					},
+					Password: "password",
+				},
+			},
+		},
+		Route: &option.RouteOptions{
+			Rules: []option.Rule{
+				{
+					DefaultOptions: option.DefaultRule{
+						Inbound:  []string{"mixed-in"},
+						Outbound: "trojan-out",
+					},
+				},
+			},
+		},
+	})
+	testSuit(t, clientPort, testPort)
+}

test/v2ray_grpc_test.go

@@ -161,7 +161,7 @@ func testV2RayGRPCOutbound(t *testing.T, forceLite bool) {
 			},
 		},
 	})
-	testSuitSimple(t, clientPort, testPort)
+	testSuit(t, clientPort, testPort)
 }
 
 func TestV2RayGRPCLite(t *testing.T) {

test/v2ray_transport_test.go

@@ -266,7 +266,7 @@ func TestVMessQUICSelf(t *testing.T) {
 			},
 		},
 	})
-	testSuitSimple(t, clientPort, testPort)
+	testSuit(t, clientPort, testPort)
 }
 
 func testV2RayTransportNOTLSSelf(t *testing.T, transport *option.V2RayTransportOptions) {
@@ -330,5 +330,5 @@ func testV2RayTransportNOTLSSelf(t *testing.T, transport *option.V2RayTransportO
 			},
 		},
 	})
-	testSuitSimple(t, clientPort, testPort)
+	testSuit(t, clientPort, testPort)
 }

test/v2ray_ws_test.go

@@ -193,5 +193,5 @@ func testV2RayWebsocketOutbound(t *testing.T, maxEarlyData uint32, earlyDataHead
 			},
 		},
 	})
-	testSuitSimple(t, clientPort, testPort)
+	testSuit(t, clientPort, testPort)
 }

test/vless_test.go

@@ -0,0 +1,120 @@
+package main
+
+import (
+	"net/netip"
+	"os"
+	"testing"
+
+	C "github.com/sagernet/sing-box/constant"
+	"github.com/sagernet/sing-box/option"
+
+	"github.com/spyzhov/ajson"
+	"github.com/stretchr/testify/require"
+)
+
+func TestVLESS(t *testing.T) {
+	content, err := os.ReadFile("config/vless-server.json")
+	require.NoError(t, err)
+	config, err := ajson.Unmarshal(content)
+	require.NoError(t, err)
+
+	user := newUUID()
+	inbound := config.MustKey("inbounds").MustIndex(0)
+	inbound.MustKey("port").SetNumeric(float64(serverPort))
+	inbound.MustKey("settings").MustKey("clients").MustIndex(0).MustKey("id").SetString(user.String())
+
+	content, err = ajson.Marshal(config)
+	require.NoError(t, err)
+
+	startDockerContainer(t, DockerOptions{
+		Image:      ImageV2RayCore,
+		Ports:      []uint16{serverPort, testPort},
+		EntryPoint: "v2ray",
+		Stdin:      content,
+	})
+
+	startInstance(t, option.Options{
+		Inbounds: []option.Inbound{
+			{
+				Type: C.TypeMixed,
+				MixedOptions: option.HTTPMixedInboundOptions{
+					ListenOptions: option.ListenOptions{
+						Listen:     option.ListenAddress(netip.IPv4Unspecified()),
+						ListenPort: clientPort,
+					},
+				},
+			},
+		},
+		Outbounds: []option.Outbound{
+			{
+				Type: C.TypeVLESS,
+				VLESSOptions: option.VLESSOutboundOptions{
+					ServerOptions: option.ServerOptions{
+						Server:     "127.0.0.1",
+						ServerPort: serverPort,
+					},
+					UUID: user.String(),
+				},
+			},
+		},
+	})
+	testSuit(t, clientPort, testPort)
+}
+
+func TestVLESSXRay(t *testing.T) {
+	testVLESSXray(t, "")
+}
+
+func TestVLESSXUDP(t *testing.T) {
+	testVLESSXray(t, "xudp")
+}
+
+func testVLESSXray(t *testing.T, packetEncoding string) {
+	content, err := os.ReadFile("config/vless-server.json")
+	require.NoError(t, err)
+	config, err := ajson.Unmarshal(content)
+	require.NoError(t, err)
+
+	user := newUUID()
+	inbound := config.MustKey("inbounds").MustIndex(0)
+	inbound.MustKey("port").SetNumeric(float64(serverPort))
+	inbound.MustKey("settings").MustKey("clients").MustIndex(0).MustKey("id").SetString(user.String())
+
+	content, err = ajson.Marshal(config)
+	require.NoError(t, err)
+
+	startDockerContainer(t, DockerOptions{
+		Image:      ImageXRayCore,
+		Ports:      []uint16{serverPort, testPort},
+		EntryPoint: "xray",
+		Stdin:      content,
+	})
+
+	startInstance(t, option.Options{
+		Inbounds: []option.Inbound{
+			{
+				Type: C.TypeMixed,
+				MixedOptions: option.HTTPMixedInboundOptions{
+					ListenOptions: option.ListenOptions{
+						Listen:     option.ListenAddress(netip.IPv4Unspecified()),
+						ListenPort: clientPort,
+					},
+				},
+			},
+		},
+		Outbounds: []option.Outbound{
+			{
+				Type: C.TypeVLESS,
+				VLESSOptions: option.VLESSOutboundOptions{
+					ServerOptions: option.ServerOptions{
+						Server:     "127.0.0.1",
+						ServerPort: serverPort,
+					},
+					UUID:           user.String(),
+					PacketEncoding: packetEncoding,
+				},
+			},
+		},
+	})
+	testSuit(t, clientPort, testPort)
+}

test/vmess_test.go

@@ -13,21 +13,24 @@ import (
 	"github.com/stretchr/testify/require"
 )
 
+func newUUID() uuid.UUID {
+	user, _ := uuid.DefaultGenerator.NewV4()
+	return user
+}
+
 func _TestVMessAuto(t *testing.T) {
 	security := "auto"
-	user, err := uuid.DefaultGenerator.NewV4()
-	require.NoError(t, err)
 	t.Run("self", func(t *testing.T) {
-		testVMessSelf(t, security, user, 0, false, false, false)
+		testVMessSelf(t, security, 0, false, false, false)
 	})
 	t.Run("packetaddr", func(t *testing.T) {
-		testVMessSelf(t, security, user, 0, false, false, true)
+		testVMessSelf(t, security, 0, false, false, true)
 	})
 	t.Run("inbound", func(t *testing.T) {
-		testVMessInboundWithV2Ray(t, security, user, 0, false)
+		testVMessInboundWithV2Ray(t, security, 0, false)
 	})
 	t.Run("outbound", func(t *testing.T) {
-		testVMessOutboundWithV2Ray(t, security, user, false, false, 0)
+		testVMessOutboundWithV2Ray(t, security, false, false, 0)
 	})
 }
 
@@ -56,102 +59,97 @@ func TestVMess(t *testing.T) {
 }
 
 func testVMess0(t *testing.T, security string) {
-	user, err := uuid.DefaultGenerator.NewV4()
-	require.NoError(t, err)
 	t.Run("self", func(t *testing.T) {
-		testVMessSelf(t, security, user, 0, false, false, false)
+		testVMessSelf(t, security, 0, false, false, false)
 	})
 	t.Run("self-legacy", func(t *testing.T) {
-		testVMessSelf(t, security, user, 1, false, false, false)
+		testVMessSelf(t, security, 1, false, false, false)
 	})
 	t.Run("packetaddr", func(t *testing.T) {
-		testVMessSelf(t, security, user, 0, false, false, true)
+		testVMessSelf(t, security, 0, false, false, true)
 	})
 	t.Run("outbound", func(t *testing.T) {
-		testVMessOutboundWithV2Ray(t, security, user, false, false, 0)
+		testVMessOutboundWithV2Ray(t, security, false, false, 0)
 	})
 	t.Run("outbound-legacy", func(t *testing.T) {
-		testVMessOutboundWithV2Ray(t, security, user, false, false, 1)
+		testVMessOutboundWithV2Ray(t, security, false, false, 1)
 	})
 }
 
 func testVMess1(t *testing.T, security string) {
-	user, err := uuid.DefaultGenerator.NewV4()
-	require.NoError(t, err)
 	t.Run("self", func(t *testing.T) {
-		testVMessSelf(t, security, user, 0, false, false, false)
+		testVMessSelf(t, security, 0, false, false, false)
 	})
 	t.Run("self-legacy", func(t *testing.T) {
-		testVMessSelf(t, security, user, 1, false, false, false)
+		testVMessSelf(t, security, 1, false, false, false)
 	})
 	t.Run("packetaddr", func(t *testing.T) {
-		testVMessSelf(t, security, user, 0, false, false, true)
+		testVMessSelf(t, security, 0, false, false, true)
 	})
 	t.Run("inbound", func(t *testing.T) {
-		testVMessInboundWithV2Ray(t, security, user, 0, false)
+		testVMessInboundWithV2Ray(t, security, 0, false)
 	})
 	t.Run("outbound", func(t *testing.T) {
-		testVMessOutboundWithV2Ray(t, security, user, false, false, 0)
+		testVMessOutboundWithV2Ray(t, security, false, false, 0)
 	})
 	t.Run("outbound-legacy", func(t *testing.T) {
-		testVMessOutboundWithV2Ray(t, security, user, false, false, 1)
+		testVMessOutboundWithV2Ray(t, security, false, false, 1)
 	})
 }
 
 func testVMess2(t *testing.T, security string) {
-	user, err := uuid.DefaultGenerator.NewV4()
-	require.NoError(t, err)
 	t.Run("self", func(t *testing.T) {
-		testVMessSelf(t, security, user, 0, false, false, false)
+		testVMessSelf(t, security, 0, false, false, false)
 	})
 	t.Run("self-padding", func(t *testing.T) {
-		testVMessSelf(t, security, user, 0, true, false, false)
+		testVMessSelf(t, security, 0, true, false, false)
 	})
 	t.Run("self-authid", func(t *testing.T) {
-		testVMessSelf(t, security, user, 0, false, true, false)
+		testVMessSelf(t, security, 0, false, true, false)
 	})
 	t.Run("self-padding-authid", func(t *testing.T) {
-		testVMessSelf(t, security, user, 0, true, true, false)
+		testVMessSelf(t, security, 0, true, true, false)
 	})
 	t.Run("self-legacy", func(t *testing.T) {
-		testVMessSelf(t, security, user, 1, false, false, false)
+		testVMessSelf(t, security, 1, false, false, false)
 	})
 	t.Run("self-legacy-padding", func(t *testing.T) {
-		testVMessSelf(t, security, user, 1, true, false, false)
+		testVMessSelf(t, security, 1, true, false, false)
 	})
 	t.Run("packetaddr", func(t *testing.T) {
-		testVMessSelf(t, security, user, 0, false, false, true)
+		testVMessSelf(t, security, 0, false, false, true)
 	})
 	t.Run("inbound", func(t *testing.T) {
-		testVMessInboundWithV2Ray(t, security, user, 0, false)
+		testVMessInboundWithV2Ray(t, security, 0, false)
 	})
 	t.Run("inbound-authid", func(t *testing.T) {
-		testVMessInboundWithV2Ray(t, security, user, 0, true)
+		testVMessInboundWithV2Ray(t, security, 0, true)
 	})
 	t.Run("inbound-legacy", func(t *testing.T) {
-		testVMessInboundWithV2Ray(t, security, user, 64, false)
+		testVMessInboundWithV2Ray(t, security, 64, false)
 	})
 	t.Run("outbound", func(t *testing.T) {
-		testVMessOutboundWithV2Ray(t, security, user, false, false, 0)
+		testVMessOutboundWithV2Ray(t, security, false, false, 0)
 	})
 	t.Run("outbound-padding", func(t *testing.T) {
-		testVMessOutboundWithV2Ray(t, security, user, true, false, 0)
+		testVMessOutboundWithV2Ray(t, security, true, false, 0)
 	})
 	t.Run("outbound-authid", func(t *testing.T) {
-		testVMessOutboundWithV2Ray(t, security, user, false, true, 0)
+		testVMessOutboundWithV2Ray(t, security, false, true, 0)
 	})
 	t.Run("outbound-padding-authid", func(t *testing.T) {
-		testVMessOutboundWithV2Ray(t, security, user, true, true, 0)
+		testVMessOutboundWithV2Ray(t, security, true, true, 0)
 	})
 	t.Run("outbound-legacy", func(t *testing.T) {
-		testVMessOutboundWithV2Ray(t, security, user, false, false, 1)
+		testVMessOutboundWithV2Ray(t, security, false, false, 1)
 	})
 	t.Run("outbound-legacy-padding", func(t *testing.T) {
-		testVMessOutboundWithV2Ray(t, security, user, true, false, 1)
+		testVMessOutboundWithV2Ray(t, security, true, false, 1)
 	})
 }
 
-func testVMessInboundWithV2Ray(t *testing.T, security string, uuid uuid.UUID, alterId int, authenticatedLength bool) {
+func testVMessInboundWithV2Ray(t *testing.T, security string, alterId int, authenticatedLength bool) {
+	userId := newUUID()
 	content, err := os.ReadFile("config/vmess-client.json")
 	require.NoError(t, err)
 	config, err := ajson.Unmarshal(content)
@@ -161,7 +159,7 @@ func testVMessInboundWithV2Ray(t *testing.T, security string, uuid uuid.UUID, al
 	outbound := config.MustKey("outbounds").MustIndex(0).MustKey("settings").MustKey("vnext").MustIndex(0)
 	outbound.MustKey("port").SetNumeric(float64(serverPort))
 	user := outbound.MustKey("users").MustIndex(0)
-	user.MustKey("id").SetString(uuid.String())
+	user.MustKey("id").SetString(userId.String())
 	user.MustKey("alterId").SetNumeric(float64(alterId))
 	user.MustKey("security").SetString(security)
 	var experiments string
@@ -193,7 +191,7 @@ func testVMessInboundWithV2Ray(t *testing.T, security string, uuid uuid.UUID, al
 					Users: []option.VMessUser{
 						{
 							Name:    "sekai",
-							UUID:    uuid.String(),
+							UUID:    userId.String(),
 							AlterId: alterId,
 						},
 					},
@@ -205,7 +203,8 @@ func testVMessInboundWithV2Ray(t *testing.T, security string, uuid uuid.UUID, al
 	testSuitSimple(t, clientPort, testPort)
 }
 
-func testVMessOutboundWithV2Ray(t *testing.T, security string, uuid uuid.UUID, globalPadding bool, authenticatedLength bool, alterId int) {
+func testVMessOutboundWithV2Ray(t *testing.T, security string, globalPadding bool, authenticatedLength bool, alterId int) {
+	user := newUUID()
 	content, err := os.ReadFile("config/vmess-server.json")
 	require.NoError(t, err)
 	config, err := ajson.Unmarshal(content)
@@ -213,7 +212,7 @@ func testVMessOutboundWithV2Ray(t *testing.T, security string, uuid uuid.UUID, g
 
 	inbound := config.MustKey("inbounds").MustIndex(0)
 	inbound.MustKey("port").SetNumeric(float64(serverPort))
-	inbound.MustKey("settings").MustKey("clients").MustIndex(0).MustKey("id").SetString(uuid.String())
+	inbound.MustKey("settings").MustKey("clients").MustIndex(0).MustKey("id").SetString(user.String())
 	inbound.MustKey("settings").MustKey("clients").MustIndex(0).MustKey("alterId").SetNumeric(float64(alterId))
 
 	content, err = ajson.Marshal(config)
@@ -248,7 +247,7 @@ func testVMessOutboundWithV2Ray(t *testing.T, security string, uuid uuid.UUID, g
 						ServerPort: serverPort,
 					},
 					Security:            security,
-					UUID:                uuid.String(),
+					UUID:                user.String(),
 					GlobalPadding:       globalPadding,
 					AuthenticatedLength: authenticatedLength,
 					AlterId:             alterId,
@@ -256,10 +255,11 @@ func testVMessOutboundWithV2Ray(t *testing.T, security string, uuid uuid.UUID, g
 			},
 		},
 	})
-	testSuitSimple(t, clientPort, testPort)
+	testSuit(t, clientPort, testPort)
 }
 
-func testVMessSelf(t *testing.T, security string, uuid uuid.UUID, alterId int, globalPadding bool, authenticatedLength bool, packetAddr bool) {
+func testVMessSelf(t *testing.T, security string, alterId int, globalPadding bool, authenticatedLength bool, packetAddr bool) {
+	user := newUUID()
 	startInstance(t, option.Options{
 		Inbounds: []option.Inbound{
 			{
@@ -282,7 +282,7 @@ func testVMessSelf(t *testing.T, security string, uuid uuid.UUID, alterId int, g
 					Users: []option.VMessUser{
 						{
 							Name:    "sekai",
-							UUID:    uuid.String(),
+							UUID:    user.String(),
 							AlterId: alterId,
 						},
 					},
@@ -302,7 +302,7 @@ func testVMessSelf(t *testing.T, security string, uuid uuid.UUID, alterId int, g
 						ServerPort: serverPort,
 					},
 					Security:            security,
-					UUID:                uuid.String(),
+					UUID:                user.String(),
 					AlterId:             alterId,
 					GlobalPadding:       globalPadding,
 					AuthenticatedLength: authenticatedLength,

test/wireguard_test.go

@@ -2,7 +2,6 @@ package main
 
 import (
 	"net/netip"
-	"os"
 	"testing"
 	"time"
 
@@ -50,49 +49,3 @@ func TestWireGuard(t *testing.T) {
 	})
 	testSuitWg(t, clientPort, testPort)
 }
-
-func TestWireGuardSystem(t *testing.T) {
-	if os.Getuid() != 0 {
-		t.Skip("requires root")
-	}
-	startDockerContainer(t, DockerOptions{
-		Image: ImageBoringTun,
-		Cap:   []string{"MKNOD", "NET_ADMIN", "NET_RAW"},
-		Ports: []uint16{serverPort, testPort},
-		Bind: map[string]string{
-			"wireguard.conf": "/etc/wireguard/wg0.conf",
-		},
-		Cmd: []string{"wg0"},
-	})
-	time.Sleep(5 * time.Second)
-	startInstance(t, option.Options{
-		Inbounds: []option.Inbound{
-			{
-				Type: C.TypeMixed,
-				MixedOptions: option.HTTPMixedInboundOptions{
-					ListenOptions: option.ListenOptions{
-						Listen:     option.ListenAddress(netip.IPv4Unspecified()),
-						ListenPort: clientPort,
-					},
-				},
-			},
-		},
-		Outbounds: []option.Outbound{
-			{
-				Type: C.TypeWireGuard,
-				WireGuardOptions: option.WireGuardOutboundOptions{
-					InterfaceName: "wg",
-					ServerOptions: option.ServerOptions{
-						Server:     "127.0.0.1",
-						ServerPort: serverPort,
-					},
-					LocalAddress:  []option.ListenPrefix{option.ListenPrefix(netip.MustParsePrefix("10.0.0.2/32"))},
-					PrivateKey:    "qGnwlkZljMxeECW8fbwAWdvgntnbK7B8UmMFl3zM0mk=",
-					PeerPublicKey: "QsdcBm+oJw2oNv0cIFXLIq1E850lgTBonup4qnKEQBg=",
-				},
-			},
-		},
-	})
-	time.Sleep(10 * time.Second)
-	testSuitWg(t, clientPort, testPort)
-}

transport/cloudflaretls/README.md

@@ -0,0 +1,7 @@
+# cloudflare-tls
+
+kanged from https://github.com/cloudflare/go
+branch: cf
+commit: 4d2a840e50d2b4316aa19934271832d080c44f7f
+go: 1.18.5
+changes: use github.com/cloudflare/circl 4cf0150356fc62a0ea5c0eec2f64b756cb404145

transport/cloudflaretls/alert.go

@@ -0,0 +1,101 @@
+// Copyright 2009 The Go Authors. All rights reserved.
+// Use of this source code is governed by a BSD-style
+// license that can be found in the LICENSE file.
+
+package tls
+
+import "strconv"
+
+type alert uint8
+
+const (
+	// alert level
+	alertLevelWarning = 1
+	alertLevelError   = 2
+)
+
+const (
+	alertCloseNotify                  alert = 0
+	alertUnexpectedMessage            alert = 10
+	alertBadRecordMAC                 alert = 20
+	alertDecryptionFailed             alert = 21
+	alertRecordOverflow               alert = 22
+	alertDecompressionFailure         alert = 30
+	alertHandshakeFailure             alert = 40
+	alertBadCertificate               alert = 42
+	alertUnsupportedCertificate       alert = 43
+	alertCertificateRevoked           alert = 44
+	alertCertificateExpired           alert = 45
+	alertCertificateUnknown           alert = 46
+	alertIllegalParameter             alert = 47
+	alertUnknownCA                    alert = 48
+	alertAccessDenied                 alert = 49
+	alertDecodeError                  alert = 50
+	alertDecryptError                 alert = 51
+	alertExportRestriction            alert = 60
+	alertProtocolVersion              alert = 70
+	alertInsufficientSecurity         alert = 71
+	alertInternalError                alert = 80
+	alertInappropriateFallback        alert = 86
+	alertUserCanceled                 alert = 90
+	alertNoRenegotiation              alert = 100
+	alertMissingExtension             alert = 109
+	alertUnsupportedExtension         alert = 110
+	alertCertificateUnobtainable      alert = 111
+	alertUnrecognizedName             alert = 112
+	alertBadCertificateStatusResponse alert = 113
+	alertBadCertificateHashValue      alert = 114
+	alertUnknownPSKIdentity           alert = 115
+	alertCertificateRequired          alert = 116
+	alertNoApplicationProtocol        alert = 120
+	alertECHRequired                  alert = 121
+)
+
+var alertText = map[alert]string{
+	alertCloseNotify:                  "close notify",
+	alertUnexpectedMessage:            "unexpected message",
+	alertBadRecordMAC:                 "bad record MAC",
+	alertDecryptionFailed:             "decryption failed",
+	alertRecordOverflow:               "record overflow",
+	alertDecompressionFailure:         "decompression failure",
+	alertHandshakeFailure:             "handshake failure",
+	alertBadCertificate:               "bad certificate",
+	alertUnsupportedCertificate:       "unsupported certificate",
+	alertCertificateRevoked:           "revoked certificate",
+	alertCertificateExpired:           "expired certificate",
+	alertCertificateUnknown:           "unknown certificate",
+	alertIllegalParameter:             "illegal parameter",
+	alertUnknownCA:                    "unknown certificate authority",
+	alertAccessDenied:                 "access denied",
+	alertDecodeError:                  "error decoding message",
+	alertDecryptError:                 "error decrypting message",
+	alertExportRestriction:            "export restriction",
+	alertProtocolVersion:              "protocol version not supported",
+	alertInsufficientSecurity:         "insufficient security level",
+	alertInternalError:                "internal error",
+	alertInappropriateFallback:        "inappropriate fallback",
+	alertUserCanceled:                 "user canceled",
+	alertNoRenegotiation:              "no renegotiation",
+	alertMissingExtension:             "missing extension",
+	alertUnsupportedExtension:         "unsupported extension",
+	alertCertificateUnobtainable:      "certificate unobtainable",
+	alertUnrecognizedName:             "unrecognized name",
+	alertBadCertificateStatusResponse: "bad certificate status response",
+	alertBadCertificateHashValue:      "bad certificate hash value",
+	alertUnknownPSKIdentity:           "unknown PSK identity",
+	alertCertificateRequired:          "certificate required",
+	alertNoApplicationProtocol:        "no application protocol",
+	alertECHRequired:                  "ECH required",
+}
+
+func (e alert) String() string {
+	s, ok := alertText[e]
+	if ok {
+		return "tls: " + s
+	}
+	return "tls: alert(" + strconv.Itoa(int(e)) + ")"
+}
+
+func (e alert) Error() string {
+	return e.String()
+}

transport/cloudflaretls/auth.go

@@ -0,0 +1,345 @@
+// Copyright 2017 The Go Authors. All rights reserved.
+// Use of this source code is governed by a BSD-style
+// license that can be found in the LICENSE file.
+
+package tls
+
+import (
+	"bytes"
+	"crypto"
+	"crypto/ecdsa"
+	"crypto/ed25519"
+	"crypto/elliptic"
+	"crypto/rsa"
+	"errors"
+	"fmt"
+	"hash"
+	"io"
+
+	circlPki "github.com/cloudflare/circl/pki"
+	circlSign "github.com/cloudflare/circl/sign"
+)
+
+// verifyHandshakeSignature verifies a signature against pre-hashed
+// (if required) handshake contents.
+func verifyHandshakeSignature(sigType uint8, pubkey crypto.PublicKey, hashFunc crypto.Hash, signed, sig []byte) error {
+	switch sigType {
+	case signatureECDSA:
+		pubKey, ok := pubkey.(*ecdsa.PublicKey)
+		if !ok {
+			return fmt.Errorf("expected an ECDSA public key, got %T", pubkey)
+		}
+		if !ecdsa.VerifyASN1(pubKey, signed, sig) {
+			return errors.New("ECDSA verification failure")
+		}
+	case signatureEd25519:
+		pubKey, ok := pubkey.(ed25519.PublicKey)
+		if !ok {
+			return fmt.Errorf("expected an Ed25519 public key, got %T", pubkey)
+		}
+		if !ed25519.Verify(pubKey, signed, sig) {
+			return errors.New("Ed25519 verification failure")
+		}
+	case signaturePKCS1v15:
+		pubKey, ok := pubkey.(*rsa.PublicKey)
+		if !ok {
+			return fmt.Errorf("expected an RSA public key, got %T", pubkey)
+		}
+		if err := rsa.VerifyPKCS1v15(pubKey, hashFunc, signed, sig); err != nil {
+			return err
+		}
+	case signatureRSAPSS:
+		pubKey, ok := pubkey.(*rsa.PublicKey)
+		if !ok {
+			return fmt.Errorf("expected an RSA public key, got %T", pubkey)
+		}
+		signOpts := &rsa.PSSOptions{SaltLength: rsa.PSSSaltLengthEqualsHash}
+		if err := rsa.VerifyPSS(pubKey, hashFunc, signed, sig, signOpts); err != nil {
+			return err
+		}
+	default:
+		scheme := circlSchemeBySigType(sigType)
+		if scheme == nil {
+			return errors.New("internal error: unknown signature type")
+		}
+		pubKey, ok := pubkey.(circlSign.PublicKey)
+		if !ok {
+			return fmt.Errorf("expected a %s public key, got %T", scheme.Name(), pubkey)
+		}
+		if !scheme.Verify(pubKey, signed, sig, nil) {
+			return fmt.Errorf("%s verification failure", scheme.Name())
+		}
+	}
+	return nil
+}
+
+const (
+	serverSignatureContext = "TLS 1.3, server CertificateVerify\x00"
+	clientSignatureContext = "TLS 1.3, client CertificateVerify\x00"
+)
+
+var signaturePadding = []byte{
+	0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20,
+	0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20,
+	0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20,
+	0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20,
+	0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20,
+	0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20,
+	0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20,
+	0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20,
+}
+
+// signedMessage returns the pre-hashed (if necessary) message to be signed by
+// certificate keys in TLS 1.3. See RFC 8446, Section 4.4.3.
+func signedMessage(sigHash crypto.Hash, context string, transcript hash.Hash) []byte {
+	if sigHash == directSigning {
+		b := &bytes.Buffer{}
+		b.Write(signaturePadding)
+		io.WriteString(b, context)
+		b.Write(transcript.Sum(nil))
+		return b.Bytes()
+	}
+	h := sigHash.New()
+	h.Write(signaturePadding)
+	io.WriteString(h, context)
+	h.Write(transcript.Sum(nil))
+	return h.Sum(nil)
+}
+
+// typeAndHashFromSignatureScheme returns the corresponding signature type and
+// crypto.Hash for a given TLS SignatureScheme.
+func typeAndHashFromSignatureScheme(signatureAlgorithm SignatureScheme) (sigType uint8, hash crypto.Hash, err error) {
+	switch signatureAlgorithm {
+	case PKCS1WithSHA1, PKCS1WithSHA256, PKCS1WithSHA384, PKCS1WithSHA512:
+		sigType = signaturePKCS1v15
+	case PSSWithSHA256, PSSWithSHA384, PSSWithSHA512:
+		sigType = signatureRSAPSS
+	case ECDSAWithSHA1, ECDSAWithP256AndSHA256, ECDSAWithP384AndSHA384, ECDSAWithP521AndSHA512:
+		sigType = signatureECDSA
+	case Ed25519:
+		sigType = signatureEd25519
+	default:
+		scheme := circlPki.SchemeByTLSID(uint(signatureAlgorithm))
+		if scheme == nil {
+			return 0, 0, fmt.Errorf("unsupported signature algorithm: %v", signatureAlgorithm)
+		}
+		sigType = sigTypeByCirclScheme(scheme)
+		if sigType == 0 {
+			return 0, 0, fmt.Errorf("github.com/cloudflare/circl scheme %s not supported",
+				scheme.Name())
+		}
+	}
+	switch signatureAlgorithm {
+	case PKCS1WithSHA1, ECDSAWithSHA1:
+		hash = crypto.SHA1
+	case PKCS1WithSHA256, PSSWithSHA256, ECDSAWithP256AndSHA256:
+		hash = crypto.SHA256
+	case PKCS1WithSHA384, PSSWithSHA384, ECDSAWithP384AndSHA384:
+		hash = crypto.SHA384
+	case PKCS1WithSHA512, PSSWithSHA512, ECDSAWithP521AndSHA512:
+		hash = crypto.SHA512
+	case Ed25519:
+		hash = directSigning
+	default:
+		scheme := circlPki.SchemeByTLSID(uint(signatureAlgorithm))
+		if scheme == nil {
+			return 0, 0, fmt.Errorf("unsupported signature algorithm: %v", signatureAlgorithm)
+		}
+		hash = directSigning
+	}
+	return sigType, hash, nil
+}
+
+// legacyTypeAndHashFromPublicKey returns the fixed signature type and crypto.Hash for
+// a given public key used with TLS 1.0 and 1.1, before the introduction of
+// signature algorithm negotiation.
+func legacyTypeAndHashFromPublicKey(pub crypto.PublicKey) (sigType uint8, hash crypto.Hash, err error) {
+	switch pub.(type) {
+	case *rsa.PublicKey:
+		return signaturePKCS1v15, crypto.MD5SHA1, nil
+	case *ecdsa.PublicKey:
+		return signatureECDSA, crypto.SHA1, nil
+	case ed25519.PublicKey:
+		// RFC 8422 specifies support for Ed25519 in TLS 1.0 and 1.1,
+		// but it requires holding on to a handshake transcript to do a
+		// full signature, and not even OpenSSL bothers with the
+		// complexity, so we can't even test it properly.
+		return 0, 0, fmt.Errorf("tls: Ed25519 public keys are not supported before TLS 1.2")
+	case circlSign.PublicKey:
+		return 0, 0, fmt.Errorf("tls: circl public keys are not supported before TLS 1.2")
+	default:
+		return 0, 0, fmt.Errorf("tls: unsupported public key: %T", pub)
+	}
+}
+
+var rsaSignatureSchemes = []struct {
+	scheme          SignatureScheme
+	minModulusBytes int
+	maxVersion      uint16
+}{
+	// RSA-PSS is used with PSSSaltLengthEqualsHash, and requires
+	//    emLen >= hLen + sLen + 2
+	{PSSWithSHA256, crypto.SHA256.Size()*2 + 2, VersionTLS13},
+	{PSSWithSHA384, crypto.SHA384.Size()*2 + 2, VersionTLS13},
+	{PSSWithSHA512, crypto.SHA512.Size()*2 + 2, VersionTLS13},
+	// PKCS #1 v1.5 uses prefixes from hashPrefixes in crypto/rsa, and requires
+	//    emLen >= len(prefix) + hLen + 11
+	// TLS 1.3 dropped support for PKCS #1 v1.5 in favor of RSA-PSS.
+	{PKCS1WithSHA256, 19 + crypto.SHA256.Size() + 11, VersionTLS12},
+	{PKCS1WithSHA384, 19 + crypto.SHA384.Size() + 11, VersionTLS12},
+	{PKCS1WithSHA512, 19 + crypto.SHA512.Size() + 11, VersionTLS12},
+	{PKCS1WithSHA1, 15 + crypto.SHA1.Size() + 11, VersionTLS12},
+}
+
+// signatureSchemesForCertificate returns the list of supported SignatureSchemes
+// for a given certificate, based on the public key and the protocol version,
+// and optionally filtered by its explicit SupportedSignatureAlgorithms.
+//
+// This function must be kept in sync with supportedSignatureAlgorithms.
+func signatureSchemesForCertificate(version uint16, cert *Certificate) []SignatureScheme {
+	priv, ok := cert.PrivateKey.(crypto.Signer)
+	if !ok {
+		return nil
+	}
+
+	var sigAlgs []SignatureScheme
+	switch pub := priv.Public().(type) {
+	case *ecdsa.PublicKey:
+		if version != VersionTLS13 {
+			// In TLS 1.2 and earlier, ECDSA algorithms are not
+			// constrained to a single curve.
+			sigAlgs = []SignatureScheme{
+				ECDSAWithP256AndSHA256,
+				ECDSAWithP384AndSHA384,
+				ECDSAWithP521AndSHA512,
+				ECDSAWithSHA1,
+			}
+			break
+		}
+		switch pub.Curve {
+		case elliptic.P256():
+			sigAlgs = []SignatureScheme{ECDSAWithP256AndSHA256}
+		case elliptic.P384():
+			sigAlgs = []SignatureScheme{ECDSAWithP384AndSHA384}
+		case elliptic.P521():
+			sigAlgs = []SignatureScheme{ECDSAWithP521AndSHA512}
+		default:
+			return nil
+		}
+	case *rsa.PublicKey:
+		size := pub.Size()
+		sigAlgs = make([]SignatureScheme, 0, len(rsaSignatureSchemes))
+		for _, candidate := range rsaSignatureSchemes {
+			if size >= candidate.minModulusBytes && version <= candidate.maxVersion {
+				sigAlgs = append(sigAlgs, candidate.scheme)
+			}
+		}
+	case ed25519.PublicKey:
+		sigAlgs = []SignatureScheme{Ed25519}
+	case circlSign.PublicKey:
+		scheme := pub.Scheme()
+		tlsScheme, ok := scheme.(circlPki.TLSScheme)
+		if !ok {
+			return nil
+		}
+		sigAlgs = []SignatureScheme{SignatureScheme(tlsScheme.TLSIdentifier())}
+	default:
+		return nil
+	}
+
+	if cert.SupportedSignatureAlgorithms != nil {
+		var filteredSigAlgs []SignatureScheme
+		for _, sigAlg := range sigAlgs {
+			if isSupportedSignatureAlgorithm(sigAlg, cert.SupportedSignatureAlgorithms) {
+				filteredSigAlgs = append(filteredSigAlgs, sigAlg)
+			}
+		}
+		return filteredSigAlgs
+	}
+	return sigAlgs
+}
+
+// selectSignatureSchemeDC picks a SignatureScheme from the peer's preference list
+// that works with the selected delegated credential. It's only called for protocol
+// versions that support delegated credential, so TLS 1.3.
+func selectSignatureSchemeDC(vers uint16, dc *DelegatedCredential, peerAlgs []SignatureScheme, peerAlgsDC []SignatureScheme) (SignatureScheme, error) {
+	if vers != VersionTLS13 {
+		return 0, errors.New("unsupported TLS version for dc")
+	}
+
+	if !isSupportedSignatureAlgorithm(dc.algorithm, peerAlgs) {
+		return undefinedSignatureScheme, errors.New("tls: peer doesn't support the delegated credential's signature")
+	}
+
+	// Pick signature scheme in the peer's preference order, as our
+	// preference order is not configurable.
+	for _, preferredAlg := range peerAlgsDC {
+		if preferredAlg == dc.cred.expCertVerfAlgo {
+			return preferredAlg, nil
+		}
+	}
+	return 0, errors.New("tls: peer doesn't support the delegated credential's signature algorithm")
+}
+
+// selectSignatureScheme picks a SignatureScheme from the peer's preference list
+// that works with the selected certificate. It's only called for protocol
+// versions that support signature algorithms, so TLS 1.2 and 1.3.
+func selectSignatureScheme(vers uint16, c *Certificate, peerAlgs []SignatureScheme) (SignatureScheme, error) {
+	supportedAlgs := signatureSchemesForCertificate(vers, c)
+	if len(supportedAlgs) == 0 {
+		return 0, unsupportedCertificateError(c)
+	}
+	if len(peerAlgs) == 0 && vers == VersionTLS12 {
+		// For TLS 1.2, if the client didn't send signature_algorithms then we
+		// can assume that it supports SHA1. See RFC 5246, Section 7.4.1.4.1.
+		peerAlgs = []SignatureScheme{PKCS1WithSHA1, ECDSAWithSHA1}
+	}
+	// Pick signature scheme in the peer's preference order, as our
+	// preference order is not configurable.
+	for _, preferredAlg := range peerAlgs {
+		if isSupportedSignatureAlgorithm(preferredAlg, supportedAlgs) {
+			return preferredAlg, nil
+		}
+	}
+	return 0, errors.New("tls: peer doesn't support any of the certificate's signature algorithms")
+}
+
+// unsupportedCertificateError returns a helpful error for certificates with
+// an unsupported private key.
+func unsupportedCertificateError(cert *Certificate) error {
+	switch cert.PrivateKey.(type) {
+	case rsa.PrivateKey, ecdsa.PrivateKey:
+		return fmt.Errorf("tls: unsupported certificate: private key is %T, expected *%T",
+			cert.PrivateKey, cert.PrivateKey)
+	case *ed25519.PrivateKey:
+		return fmt.Errorf("tls: unsupported certificate: private key is *ed25519.PrivateKey, expected ed25519.PrivateKey")
+	}
+
+	signer, ok := cert.PrivateKey.(crypto.Signer)
+	if !ok {
+		return fmt.Errorf("tls: certificate private key (%T) does not implement crypto.Signer",
+			cert.PrivateKey)
+	}
+
+	switch pub := signer.Public().(type) {
+	case *ecdsa.PublicKey:
+		switch pub.Curve {
+		case elliptic.P256():
+		case elliptic.P384():
+		case elliptic.P521():
+		default:
+			return fmt.Errorf("tls: unsupported certificate curve (%s)", pub.Curve.Params().Name)
+		}
+	case *rsa.PublicKey:
+		return fmt.Errorf("tls: certificate RSA key size too small for supported signature algorithms")
+	case ed25519.PublicKey:
+	default:
+		return fmt.Errorf("tls: unsupported certificate key (%T)", pub)
+	}
+
+	if cert.SupportedSignatureAlgorithms != nil {
+		return fmt.Errorf("tls: peer doesn't support the certificate custom signature algorithms")
+	}
+
+	return fmt.Errorf("tls: internal error: unsupported key (%T)", cert.PrivateKey)
+}