Update documentation

.github/workflows/test.yml

@@ -0,0 +1,34 @@
+name: Test build
+
+on:
+  pull_request:
+    branches:
+      - main
+      - dev
+      - dev-next
+
+jobs:
+  build:
+    name: Debug build
+    runs-on: ubuntu-latest
+    steps:
+      - name: Checkout
+        uses: actions/checkout@v2
+        with:
+          fetch-depth: 0
+      - name: Get latest go version
+        id: version
+        run: |
+          echo ::set-output name=go_version::$(curl -s https://raw.githubusercontent.com/actions/go-versions/main/versions-manifest.json | grep -oE '"version": "[0-9]{1}.[0-9]{1,}(.[0-9]{1,})?"' | head -1 | cut -d':' -f2 | sed 's/ //g; s/"//g')
+      - name: Setup Go
+        uses: actions/setup-go@v2
+        with:
+          go-version: ${{ steps.version.outputs.go_version }}
+      - name: Cache go module
+        uses: actions/cache@v2
+        with:
+          path: |
+            ~/go/pkg/mod
+          key: go-${{ hashFiles('**/go.sum') }}
+      - name: Run Test
+        run: make test

.goreleaser.yaml

@@ -9,8 +9,9 @@ builds:
     gcflags:
       - all=-trimpath={{.Env.GOPATH}}
     ldflags:
-      - -X github.com/sagernet/sing-box/constant.Commit={{ .ShortCommit }} -s -w -buildid=
+      - -s -w -buildid=
     tags:
+      - with_gvisor
       - with_quic
       - with_wireguard
       - with_clash_api

Dockerfile

@@ -8,9 +8,9 @@ ENV CGO_ENABLED=0
 RUN set -ex \
     && apk add git build-base \
     && export COMMIT=$(git rev-parse --short HEAD) \
-    && go build -v -trimpath -tags 'no_gvisor,with_quic,with_wireguard,with_acme' \
+    && go build -v -trimpath -tags with_quic,with_wireguard,with_acme \
         -o /go/bin/sing-box \
-        -ldflags "-X github.com/sagernet/sing-box/constant.Commit=${COMMIT} -w -s -buildid=" \
+        -ldflags "-s -w -buildid=" \
         ./cmd/sing-box
 FROM alpine AS dist
 LABEL maintainer="nekohasekai <contact-git@sekai.icu>"

Makefile

@@ -1,9 +1,8 @@
 NAME = sing-box
 COMMIT = $(shell git rev-parse --short HEAD)
-TAGS ?= with_quic,with_wireguard,with_clash_api
-PARAMS = -v -trimpath -tags '$(TAGS)' -ldflags \
-		'-X "github.com/sagernet/sing-box/constant.Commit=$(COMMIT)" \
-		-w -s -buildid='
+TAGS ?= with_gvisor,with_quic,with_wireguard,with_clash_api
+TAGS_TEST ?= with_gvisor,with_quic,with_wireguard,with_grpc,with_ech,with_utls,with_shadowsocksr
+PARAMS = -v -trimpath -tags "$(TAGS)" -ldflags "-s -w -buildid="
 MAIN = ./cmd/sing-box
 
 .PHONY: test release
@@ -61,11 +60,15 @@ release_install:
 	go install -v github.com/tcnksm/ghr@latest
 
 test:
-	@go test -v . && \
-	pushd test && \
+	@go test -v ./... && \
+	cd test && \
 	go mod tidy && \
-	go test -v -tags with_quic,with_wireguard,with_grpc,with_ech,with_utls,with_shadowsocksr . && \
-	popd
+	go test -v -tags "$(TAGS_TEST)" .
+test_stdio:
+	@go test -v ./... && \
+	cd test && \
+	go mod tidy && \
+	go test -v -tags "$(TAGS_TEST),force_stdio" .
 
 clean:
 	rm -rf bin dist

adapter/experimental.go

@@ -4,6 +4,7 @@ import (
 	"context"
 	"net"
 
+	"github.com/sagernet/sing-box/common/urltest"
 	N "github.com/sagernet/sing/common/network"
 )
 
@@ -12,6 +13,7 @@ type ClashServer interface {
 	Mode() string
 	StoreSelected() bool
 	CacheFile() ClashCacheFile
+	HistoryStorage() *urltest.HistoryStorage
 	RoutedConnection(ctx context.Context, conn net.Conn, metadata InboundContext, matchedRule Rule) (net.Conn, Tracker)
 	RoutedPacketConnection(ctx context.Context, conn N.PacketConn, metadata InboundContext, matchedRule Rule) (N.PacketConn, Tracker)
 }

adapter/router.go

@@ -11,7 +11,7 @@ import (
 	"github.com/sagernet/sing/common/control"
 	N "github.com/sagernet/sing/common/network"
 
-	"golang.org/x/net/dns/dnsmessage"
+	mdns "github.com/miekg/dns"
 )
 
 type Router interface {
@@ -27,11 +27,11 @@ type Router interface {
 	GeoIPReader() *geoip.Reader
 	LoadGeosite(code string) (Rule, error)
 
-	Exchange(ctx context.Context, message *dnsmessage.Message) (*dnsmessage.Message, error)
+	Exchange(ctx context.Context, message *mdns.Msg) (*mdns.Msg, error)
 	Lookup(ctx context.Context, domain string, strategy dns.DomainStrategy) ([]netip.Addr, error)
 	LookupDefault(ctx context.Context, domain string) ([]netip.Addr, error)
 
-	InterfaceBindManager() control.BindManager
+	InterfaceFinder() control.InterfaceFinder
 	DefaultInterface() string
 	AutoDetectInterface() bool
 	DefaultMark() int

cmd/sing-box/cmd_version.go

@@ -3,9 +3,9 @@ package main
 import (
 	"os"
 	"runtime"
+	"runtime/debug"
 
 	C "github.com/sagernet/sing-box/constant"
-	F "github.com/sagernet/sing/common/format"
 
 	"github.com/spf13/cobra"
 )
@@ -25,30 +25,40 @@ func init() {
 }
 
 func printVersion(cmd *cobra.Command, args []string) {
-	var version string
-	if !nameOnly {
-		version = "sing-box "
+	if nameOnly {
+		os.Stdout.WriteString(C.Version + "\n")
+		return
 	}
-	version += F.ToString(C.Version)
-	if C.Commit != "" {
-		version += "." + C.Commit
-	}
-	if !nameOnly {
-		version += " ("
-		version += runtime.Version()
-		version += ", "
-		version += runtime.GOOS
-		version += "/"
-		version += runtime.GOARCH
-		version += ", "
-		version += "CGO "
-		if C.CGO_ENABLED {
-			version += "enabled"
-		} else {
-			version += "disabled"
+	version := "sing-box version " + C.Version + "\n\n"
+	version += "Environment: " + runtime.Version() + " " + runtime.GOOS + "/" + runtime.GOARCH + "\n"
+
+	var tags string
+	var revision string
+
+	debugInfo, loaded := debug.ReadBuildInfo()
+	if loaded {
+		for _, setting := range debugInfo.Settings {
+			switch setting.Key {
+			case "-tags":
+				tags = setting.Value
+			case "vcs.revision":
+				revision = setting.Value
+			}
 		}
-		version += ")"
 	}
-	version += "\n"
+
+	if tags != "" {
+		version += "Tags: " + tags + "\n"
+	}
+	if revision != "" {
+		version += "Revision: " + revision + "\n"
+	}
+
+	if C.CGO_ENABLED {
+		version += "CGO: enabled\n"
+	} else {
+		version += "CGO: disabled\n"
+	}
+
 	os.Stdout.WriteString(version)
 }

cmd/sing-box/main.go

@@ -3,6 +3,7 @@ package main
 import (
 	"os"
 
+	_ "github.com/sagernet/sing-box/include"
 	"github.com/sagernet/sing-box/log"
 
 	"github.com/spf13/cobra"

common/baderror/baderror.go

@@ -26,7 +26,7 @@ func WrapH2(err error) error {
 	if err == io.ErrUnexpectedEOF {
 		return io.EOF
 	}
-	if Contains(err, "client disconnected", "body closed by handler") {
+	if Contains(err, "client disconnected", "body closed by handler", "response body closed", "; CANCEL") {
 		return net.ErrClosed
 	}
 	return err

common/dialer/default.go

@@ -65,25 +65,23 @@ func NewDefault(router adapter.Router, options option.DialerOptions) *DefaultDia
 	var listener net.ListenConfig
 	if options.BindInterface != "" {
 		warnBindInterfaceOnUnsupportedPlatform.Check()
-		bindFunc := control.BindToInterface(router.InterfaceBindManager(), options.BindInterface)
+		bindFunc := control.BindToInterface(router.InterfaceFinder(), options.BindInterface, -1)
 		dialer.Control = control.Append(dialer.Control, bindFunc)
 		listener.Control = control.Append(listener.Control, bindFunc)
 	} else if router.AutoDetectInterface() {
-		if C.IsWindows {
-			bindFunc := control.BindToInterfaceIndexFunc(func(network, address string) int {
-				return router.InterfaceMonitor().DefaultInterfaceIndex(M.ParseSocksaddr(address).Addr)
-			})
-			dialer.Control = control.Append(dialer.Control, bindFunc)
-			listener.Control = control.Append(listener.Control, bindFunc)
-		} else {
-			bindFunc := control.BindToInterfaceFunc(router.InterfaceBindManager(), func(network, address string) string {
-				return router.InterfaceMonitor().DefaultInterfaceName(M.ParseSocksaddr(address).Addr)
-			})
-			dialer.Control = control.Append(dialer.Control, bindFunc)
-			listener.Control = control.Append(listener.Control, bindFunc)
-		}
+		const useInterfaceName = C.IsLinux
+		bindFunc := control.BindToInterfaceFunc(router.InterfaceFinder(), func(network string, address string) (interfaceName string, interfaceIndex int) {
+			remoteAddr := M.ParseSocksaddr(address).Addr
+			if C.IsLinux {
+				return router.InterfaceMonitor().DefaultInterfaceName(remoteAddr), -1
+			} else {
+				return "", router.InterfaceMonitor().DefaultInterfaceIndex(remoteAddr)
+			}
+		})
+		dialer.Control = control.Append(dialer.Control, bindFunc)
+		listener.Control = control.Append(listener.Control, bindFunc)
 	} else if router.DefaultInterface() != "" {
-		bindFunc := control.BindToInterface(router.InterfaceBindManager(), router.DefaultInterface())
+		bindFunc := control.BindToInterface(router.InterfaceFinder(), router.DefaultInterface(), -1)
 		dialer.Control = control.Append(dialer.Control, bindFunc)
 		listener.Control = control.Append(listener.Control, bindFunc)
 	}
@@ -112,7 +110,13 @@ func NewDefault(router adapter.Router, options option.DialerOptions) *DefaultDia
 	if options.TCPFastOpen {
 		warnTFOOnUnsupportedPlatform.Check()
 	}
-	if !options.UDPFragment {
+	var udpFragment bool
+	if options.UDPFragment != nil {
+		udpFragment = *options.UDPFragment
+	} else {
+		udpFragment = options.UDPFragmentDefault
+	}
+	if !udpFragment {
 		dialer.Control = control.Append(dialer.Control, control.DisableUDPFragment())
 		listener.Control = control.Append(listener.Control, control.DisableUDPFragment())
 	}

common/mux/client.go

@@ -466,10 +466,7 @@ func (c *ClientPacketAddrConn) ReadPacket(buffer *buf.Buffer) (destination M.Soc
 	if err != nil {
 		return
 	}
-	if buffer.FreeLen() < int(length) {
-		return destination, io.ErrShortBuffer
-	}
-	_, err = io.ReadFull(c.ExtendedConn, buffer.Extend(int(length)))
+	_, err = buffer.ReadFullFrom(c.ExtendedConn, int(length))
 	return
 }
 

common/mux/service.go

@@ -3,7 +3,6 @@ package mux
 import (
 	"context"
 	"encoding/binary"
-	"io"
 	"net"
 
 	"github.com/sagernet/sing-box/adapter"
@@ -158,9 +157,6 @@ func (c *ServerPacketConn) ReadPacket(buffer *buf.Buffer) (destination M.Socksad
 	if err != nil {
 		return
 	}
-	if buffer.FreeLen() < int(length) {
-		return destination, io.ErrShortBuffer
-	}
 	_, err = buffer.ReadFullFrom(c.ExtendedConn, int(length))
 	if err != nil {
 		return
@@ -223,9 +219,6 @@ func (c *ServerPacketAddrConn) ReadPacket(buffer *buf.Buffer) (destination M.Soc
 	if err != nil {
 		return
 	}
-	if buffer.FreeLen() < int(length) {
-		return destination, io.ErrShortBuffer
-	}
 	_, err = buffer.ReadFullFrom(c.ExtendedConn, int(length))
 	if err != nil {
 		return

common/sniff/dns.go

@@ -11,9 +11,10 @@ import (
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing/common"
 	"github.com/sagernet/sing/common/buf"
+	M "github.com/sagernet/sing/common/metadata"
 	"github.com/sagernet/sing/common/task"
 
-	"golang.org/x/net/dns/dnsmessage"
+	mDNS "github.com/miekg/dns"
 )
 
 func StreamDomainNameQuery(readCtx context.Context, reader io.Reader) (*adapter.InboundContext, error) {
@@ -44,18 +45,13 @@ func StreamDomainNameQuery(readCtx context.Context, reader io.Reader) (*adapter.
 }
 
 func DomainNameQuery(ctx context.Context, packet []byte) (*adapter.InboundContext, error) {
-	var parser dnsmessage.Parser
-	_, err := parser.Start(packet)
+	var msg mDNS.Msg
+	err := msg.Unpack(packet)
 	if err != nil {
 		return nil, err
 	}
-	question, err := parser.Question()
-	if err != nil {
+	if len(msg.Question) == 0 || msg.Question[0].Qclass != mDNS.ClassINET || !M.IsDomainName(msg.Question[0].Name) {
 		return nil, os.ErrInvalid
 	}
-	domain := question.Name.String()
-	if question.Class == dnsmessage.ClassINET && IsDomainName(domain) {
-		return &adapter.InboundContext{Protocol: C.ProtocolDNS /*, Domain: domain*/}, nil
-	}
-	return nil, os.ErrInvalid
+	return &adapter.InboundContext{Protocol: C.ProtocolDNS}, nil
 }

common/sniff/domain.go

@@ -1,6 +0,0 @@
-package sniff
-
-import _ "unsafe" // for linkname
-
-//go:linkname IsDomainName net.isDomainName
-func IsDomainName(domain string) bool

common/tls/acme.go

@@ -7,11 +7,11 @@ import (
 	"crypto/tls"
 	"strings"
 
-	"github.com/sagernet/certmagic"
 	"github.com/sagernet/sing-box/adapter"
 	"github.com/sagernet/sing-box/option"
 	E "github.com/sagernet/sing/common/exceptions"
 
+	"github.com/caddyserver/certmagic"
 	"github.com/mholt/acmez/acme"
 )
 

common/tls/ech_client.go

@@ -18,7 +18,6 @@ import (
 	E "github.com/sagernet/sing/common/exceptions"
 
 	mDNS "github.com/miekg/dns"
-	"golang.org/x/net/dns/dnsmessage"
 )
 
 type echClientConfig struct {
@@ -166,19 +165,17 @@ func newECHClient(router adapter.Router, serverAddress string, options option.Ou
 	return &echClientConfig{&tlsConfig}, nil
 }
 
-const typeHTTPS = 65
-
 func fetchECHClientConfig(router adapter.Router) func(ctx context.Context, serverName string) ([]cftls.ECHConfig, error) {
 	return func(ctx context.Context, serverName string) ([]cftls.ECHConfig, error) {
-		message := &dnsmessage.Message{
-			Header: dnsmessage.Header{
+		message := &mDNS.Msg{
+			MsgHdr: mDNS.MsgHdr{
 				RecursionDesired: true,
 			},
-			Questions: []dnsmessage.Question{
+			Question: []mDNS.Question{
 				{
-					Name:  dnsmessage.MustNewName(serverName + "."),
-					Type:  typeHTTPS,
-					Class: dnsmessage.ClassINET,
+					Name:   serverName + ".",
+					Qtype:  mDNS.TypeHTTPS,
+					Qclass: mDNS.ClassINET,
 				},
 			},
 		}
@@ -186,19 +183,10 @@ func fetchECHClientConfig(router adapter.Router) func(ctx context.Context, serve
 		if err != nil {
 			return nil, err
 		}
-		if response.RCode != dnsmessage.RCodeSuccess {
-			return nil, dns.RCodeError(response.RCode)
+		if response.Rcode != mDNS.RcodeSuccess {
+			return nil, dns.RCodeError(response.Rcode)
 		}
-		content, err := response.Pack()
-		if err != nil {
-			return nil, err
-		}
-		var mMsg mDNS.Msg
-		err = mMsg.Unpack(content)
-		if err != nil {
-			return nil, err
-		}
-		for _, rr := range mMsg.Answer {
+		for _, rr := range response.Answer {
 			switch resource := rr.(type) {
 			case *mDNS.HTTPS:
 				for _, value := range resource.Value {

constant/proxy.go

@@ -25,4 +25,5 @@ const (
 
 const (
 	TypeSelector = "selector"
+	TypeURLTest  = "urltest"
 )

constant/quic.go

@@ -1,5 +0,0 @@
-//go:build with_quic
-
-package constant
-
-const QUIC_AVAILABLE = true

constant/quic_stub.go

@@ -1,9 +0,0 @@
-//go:build !with_quic
-
-package constant
-
-import E "github.com/sagernet/sing/common/exceptions"
-
-const QUIC_AVAILABLE = false
-
-var ErrQUICNotIncluded = E.New(`QUIC is not included in this build, rebuild with -tags with_quic`)

constant/timeout.go

@@ -3,10 +3,11 @@ package constant
 import "time"
 
 const (
-	TCPTimeout         = 5 * time.Second
-	ReadPayloadTimeout = 300 * time.Millisecond
-	DNSTimeout         = 10 * time.Second
-	QUICTimeout        = 30 * time.Second
-	STUNTimeout        = 15 * time.Second
-	UDPTimeout         = 5 * time.Minute
+	TCPTimeout             = 5 * time.Second
+	ReadPayloadTimeout     = 300 * time.Millisecond
+	DNSTimeout             = 10 * time.Second
+	QUICTimeout            = 30 * time.Second
+	STUNTimeout            = 15 * time.Second
+	UDPTimeout             = 5 * time.Minute
+	DefaultURLTestInterval = 1 * time.Minute
 )

constant/version.go

@@ -1,6 +1,3 @@
 package constant
 
-var (
-	Version = "1.1-beta4"
-	Commit  = ""
-)
+var Version = "1.1-beta6"

docs/changelog.md

@@ -1,3 +1,41 @@
+#### 1.1-beta7
+
+* Add v2ray mux and XUDP support for VMess inbound
+* Add XUDP support for VMess outbound
+* Disable DF on direct outbound by default
+* Fix bugs in 1.1-beta6
+
+#### 1.1-beta6
+
+* Add [URLTest outbound](/configuration/outbound/urltest)
+* Fix bugs in 1.1-beta5
+
+#### 1.1-beta5
+
+* Print tags in version command
+* Redirect clash hello to external ui
+* Move shadowsocksr implementation to clash
+* Make gVisor optional **1**
+* Refactor to miekg/dns
+* Refactor bind control
+* Fix build on go1.18
+* Fix clash store-selected
+* Fix close grpc conn
+* Fix port rule match logic
+* Fix clash api proxy type
+
+*1*:
+
+The build tag `no_gvisor` is replaced by `with_gvisor`.
+
+The default tun stack is changed to system.
+
+#### 1.0.4
+
+* Fix close grpc conn
+* Fix port rule match logic
+* Fix clash api proxy type
+
 #### 1.1-beta4
 
 * Add internal simple-obfs and v2ray-plugin [Shadowsocks plugins](/configuration/outbound/shadowsocks#plugin)

docs/configuration/dns/rule.md

@@ -104,8 +104,10 @@
 
     The default rule uses the following matching logic:  
     (`domain` || `domain_suffix` || `domain_keyword` || `domain_regex` || `geosite`) &&  
+    (`port` || `port_range`) &&  
     (`source_geoip` || `source_ip_cidr`) &&  
-    `other fields`  
+    (`source_port` || `source_port_range`) &&  
+    `other fields`
 
 #### inbound
 

docs/configuration/dns/rule.zh.md

@@ -103,8 +103,10 @@
 
     默认规则使用以下匹配逻辑:  
     (`domain` || `domain_suffix` || `domain_keyword` || `domain_regex` || `geosite`) &&  
+    (`port` || `port_range`) &&  
     (`source_geoip` || `source_ip_cidr`) &&  
-    `other fields`  
+    (`source_port` || `source_port_range`) &&  
+    `other fields`
 
 #### inbound
 

docs/configuration/inbound/tun.md

@@ -16,7 +16,7 @@
   "auto_route": true,
   "strict_route": true,
   "endpoint_independent_nat": false,
-  "stack": "gvisor",
+  "stack": "system",
   "include_uid": [
     0
   ],
@@ -112,15 +112,15 @@ UDP NAT expiration time in seconds, default is 300 (5 minutes).
 
 TCP/IP stack.
 
-| Stack            | Description                                                                    | Status            |
-|------------------|--------------------------------------------------------------------------------|-------------------|
-| gVisor (default) | Based on [google/gvisor](https://github.com/google/gvisor)                     | recommended       |
- | system           | Less compatibility and sometimes better performance.                           | recommended       |
-| LWIP             | Based on [eycorsican/go-tun2socks](https://github.com/eycorsican/go-tun2socks) | upstream archived |
+| Stack            | Description                                                                      | Status            |
+|------------------|----------------------------------------------------------------------------------|-------------------|
+| system (default) | Sometimes better performance                                                     | recommended       |
+| gVisor           | Better compatibility, based on [google/gvisor](https://github.com/google/gvisor) | recommended       |
+| LWIP             | Based on [eycorsican/go-tun2socks](https://github.com/eycorsican/go-tun2socks)   | upstream archived |
 
 !!! warning ""
 
-    The LWIP stack is not included by default, see [Installation](/#installation).
+    gVisor and LWIP stacks is not included by default, see [Installation](/#installation).
 
 #### include_uid
 

docs/configuration/inbound/tun.zh.md

@@ -16,7 +16,7 @@
   "auto_route": true,
   "strict_route": true,
   "endpoint_independent_nat": false,
-  "stack": "gvisor",
+  "stack": "system",
   "include_uid": [
     0
   ],
@@ -107,15 +107,15 @@ UDP NAT 过期时间，以秒为单位，默认为 300（5 分钟）。
 
 TCP/IP 栈。
 
-| 栈                | 描述                                                                       | 状态    |
-|------------------|--------------------------------------------------------------------------|-------|
-| gVisor (default) | 基于 [google/gvisor](https://github.com/google/gvisor)                     | 推荐    |
-| system           | 兼容性较差，有时性能更好。                                                            | 推荐    |
-| LWIP             | 基于 [eycorsican/go-tun2socks](https://github.com/eycorsican/go-tun2socks) | 上游已存档 |
+| 栈           | 描述                                                                       | 状态    |
+|-------------|--------------------------------------------------------------------------|-------|
+| system （默认） | 有时性能更好                                                                   | 推荐    |
+| gVisor      | 兼容性较好，基于 [google/gvisor](https://github.com/google/gvisor)               | 推荐    |
+| LWIP        | 基于 [eycorsican/go-tun2socks](https://github.com/eycorsican/go-tun2socks) | 上游已存档 |
 
 !!! warning ""
 
-    默认安装不包含 LWIP 栈，请参阅 [安装](/zh/#_2)。
+    默认安装不包含 gVisor 和 LWIP 栈，请参阅 [安装](/zh/#_2)。
 
 #### include_uid
 
@@ -145,10 +145,10 @@ TCP/IP 栈。
 
 限制被路由的 Android 用户。
 
-| 常用用户 | ID  |
+| 常用用户 | ID |
 |--|-----|
-| 您 | 0   |
-| 工作资料 | 10  |
+| 您 | 0 |
+| 工作资料 | 10 |
 
 #### include_package
 

docs/configuration/outbound/index.md

@@ -15,21 +15,24 @@
 
 ### Fields
 
-| Type          | Format                       |
-|---------------|------------------------------|
-| `direct`      | [Direct](./direct)           |
-| `block`       | [Block](./block)             |
-| `socks`       | [SOCKS](./socks)             |
-| `http`        | [HTTP](./http)               |
-| `shadowsocks` | [Shadowsocks](./shadowsocks) |
-| `vmess`       | [VMess](./vmess)             |
-| `trojan`      | [Trojan](./trojan)           |
-| `wireguard`   | [Wireguard](./wireguard)     |
-| `hysteria`    | [Hysteria](./hysteria)       |
-| `tor`         | [Tor](./tor)                 |
-| `ssh`         | [SSH](./ssh)                 |
-| `dns`         | [DNS](./dns)                 |
-| `selector`    | [Selector](./selector)       |
+| Type           | Format                         |
+|----------------|--------------------------------|
+| `direct`       | [Direct](./direct)             |
+| `block`        | [Block](./block)               |
+| `socks`        | [SOCKS](./socks)               |
+| `http`         | [HTTP](./http)                 |
+| `shadowsocks`  | [Shadowsocks](./shadowsocks)   |
+| `vmess`        | [VMess](./vmess)               |
+| `trojan`       | [Trojan](./trojan)             |
+| `wireguard`    | [Wireguard](./wireguard)       |
+| `hysteria`     | [Hysteria](./hysteria)         |
+| `shadowsocksr` | [ShadowsocksR](./shadowsocksr) |
+| `vless`        | [VLESS](./vless)               |
+| `tor`          | [Tor](./tor)                   |
+| `ssh`          | [SSH](./ssh)                   |
+| `dns`          | [DNS](./dns)                   |
+| `selector`     | [Selector](./selector)         |
+| `urltest`      | [URLTest](./urltest)           |
 
 #### tag
 

docs/configuration/outbound/index.zh.md

@@ -15,21 +15,24 @@
 
 ### 字段
 
-| 类型            | 格式                           |
-|---------------|------------------------------|
-| `direct`      | [Direct](./direct)           |
-| `block`       | [Block](./block)             |
-| `socks`       | [SOCKS](./socks)             |
-| `http`        | [HTTP](./http)               |
-| `shadowsocks` | [Shadowsocks](./shadowsocks) |
-| `vmess`       | [VMess](./vmess)             |
-| `trojan`      | [Trojan](./trojan)           |
-| `wireguard`   | [Wireguard](./wireguard)     |
-| `hysteria`    | [Hysteria](./hysteria)       |
-| `tor`         | [Tor](./tor)                 |
-| `ssh`         | [SSH](./ssh)                 |
-| `dns`         | [DNS](./dns)                 |
-| `selector`    | [Selector](./selector)       |
+| 类型             | 格式                             |
+|----------------|--------------------------------|
+| `direct`       | [Direct](./direct)             |
+| `block`        | [Block](./block)               |
+| `socks`        | [SOCKS](./socks)               |
+| `http`         | [HTTP](./http)                 |
+| `shadowsocks`  | [Shadowsocks](./shadowsocks)   |
+| `vmess`        | [VMess](./vmess)               |
+| `trojan`       | [Trojan](./trojan)             |
+| `wireguard`    | [Wireguard](./wireguard)       |
+| `hysteria`     | [Hysteria](./hysteria)         |
+| `shadowsocksr` | [ShadowsocksR](./shadowsocksr) |
+| `vless`        | [VLESS](./vless)               |
+| `tor`          | [Tor](./tor)                   |
+| `ssh`          | [SSH](./ssh)                   |
+| `dns`          | [DNS](./dns)                   |
+| `selector`     | [Selector](./selector)         |
+| `urltest`      | [URLTest](./urltest)           |
 
 #### tag
 

docs/configuration/outbound/urltest.md

@@ -0,0 +1,37 @@
+### Structure
+
+```json
+{
+  "type": "urltest",
+  "tag": "auto",
+  
+  "outbounds": [
+    "proxy-a",
+    "proxy-b",
+    "proxy-c"
+  ],
+  "url": "http://www.gstatic.com/generate_204",
+  "interval": "1m",
+  "tolerance": 50
+}
+```
+
+### Fields
+
+#### outbounds
+
+==Required==
+
+List of outbound tags to test.
+
+#### url
+
+The URL to test. `http://www.gstatic.com/generate_204` will be used if empty.
+
+#### interval
+
+The test interval. `1m` will be used if empty.
+
+#### tolerance
+
+The test tolerance in milliseconds. `50` will be used if empty.

docs/configuration/outbound/urltest.zh.md

@@ -0,0 +1,37 @@
+### 结构
+
+```json
+{
+  "type": "urltest",
+  "tag": "auto",
+  
+  "outbounds": [
+    "proxy-a",
+    "proxy-b",
+    "proxy-c"
+  ],
+  "url": "http://www.gstatic.com/generate_204",
+  "interval": "1m",
+  "tolerance": 50
+}
+```
+
+### 字段
+
+#### outbounds
+
+==必填==
+
+用于测试的出站标签列表。
+
+#### url
+
+用于测试的链接。默认使用 `http://www.gstatic.com/generate_204`。
+
+#### interval
+
+测试间隔。 默认使用 `1m`。
+
+#### tolerance
+
+以毫秒为单位的测试容差。 默认使用 `50`。

docs/configuration/outbound/vmess.md

@@ -14,7 +14,7 @@
   "authenticated_length": true,
   "network": "tcp",
   "tls": {},
-  "packet_addr": false,
+  "packet_encoding": "",
   "multiplex": {},
   "transport": {},
 
@@ -84,9 +84,13 @@ Both is enabled by default.
 
 TLS configuration, see [TLS](/configuration/shared/tls/#outbound).
 
-#### packet_addr
+#### packet_encoding
 
-Enable packetaddr support.
+| Encoding   | Description           |
+|------------|-----------------------|
+| (none)     | Disabled              |
+| packetaddr | Supported by v2ray 5+ |
+| xudp       | Supported by xray     |
 
 #### multiplex
 

docs/configuration/outbound/vmess.zh.md

@@ -14,7 +14,7 @@
   "authenticated_length": true,
   "network": "tcp",
   "tls": {},
-  "packet_addr": false,
+  "packet_encoding": "",
   "multiplex": {},
   "transport": {},
 
@@ -84,9 +84,13 @@ VMess 用户 ID。
 
 TLS 配置, 参阅 [TLS](/zh/configuration/shared/tls/#outbound)。
 
-#### packet_addr
+#### packet_encoding
 
-启用 packetaddr 支持。
+| 编码         | 描述            |
+|------------|---------------|
+| (空)        | 禁用            |
+| packetaddr | 由 v2ray 5+ 支持 |
+| xudp       | 由 xray 支持     |
 
 #### multiplex
 

docs/configuration/outbound/wireguard.md

@@ -26,6 +26,10 @@
 
     WireGuard is not included by default, see [Installation](/#installation).
 
+!!! warning ""
+
+    gVisor, which is required by the unprivileged WireGuard is not included by default, see [Installation](/#installation).
+
 ### Fields
 
 #### server
@@ -44,7 +48,9 @@ The server port.
 
 Use system tun support.
 
-Requires privileges and cannot conflict with system interfaces.
+Requires privilege and cannot conflict with system interfaces.
+
+Forced if gVisor not included in the build.
 
 #### interface_name
 

docs/configuration/outbound/wireguard.zh.md

@@ -26,6 +26,10 @@
 
     默认安装不包含 WireGuard, 参阅 [安装](/zh/#_2)。
 
+!!! warning ""
+
+    默认安装不包含被非特权 WireGuard 需要的 gVisor, 参阅 [安装](/zh/#_2)。
+
 ### 字段
 
 #### server
@@ -46,6 +50,8 @@
 
 需要特权且不能与系统接口冲突。
 
+如果 gVisor 未包含在构建中，则强制执行。
+
 #### interface_name
 
 启用 `system_interface` 时的自定义设备名称。

docs/configuration/route/rule.md

@@ -107,8 +107,10 @@
 
     The default rule uses the following matching logic:  
     (`domain` || `domain_suffix` || `domain_keyword` || `domain_regex` || `geosite` || `geoip` || `ip_cidr`) &&  
+    (`port` || `port_range`) &&  
     (`source_geoip` || `source_ip_cidr`) &&  
-    `other fields`  
+    (`source_port` || `source_port_range`) &&  
+    `other fields`
 
 #### inbound
 

docs/configuration/route/rule.zh.md

@@ -105,8 +105,10 @@
 
     默认规则使用以下匹配逻辑:  
     (`domain` || `domain_suffix` || `domain_keyword` || `domain_regex` || `geosite` || `geoip` || `ip_cidr`) &&  
+    (`port` || `port_range`) &&  
     (`source_geoip` || `source_ip_cidr`) &&  
-    `other fields`  
+    (`source_port` || `source_port_range`) &&  
+    `other fields`
 
 #### inbound
 

docs/contributing/sub-projects.md

@@ -53,17 +53,6 @@ we need to do this.
 
 The library needs to be updated with the upstream.
 
-#### certmagic
-
-Link: [GitHub repository](https://github.com/SagerNet/certmagic)
-
-Fork of `caddyserver/certmagic`
-
-Since upstream uses `miekg/dns` and we use `x/net/dnsmessage`, we need to replace its DNS part with our own
-implementation.
-
-The library needs to be updated with the upstream.
-
 #### smux
 
 Link: [GitHub repository](https://github.com/SagerNet/smux)

docs/index.md

@@ -32,7 +32,7 @@ go install -v -tags with_clash_api github.com/sagernet/sing-box/cmd/sing-box@lat
 | `with_utls`                        | Build with [uTLS](https://github.com/refraction-networking/utls) support for TLS outbound, see [TLS](./configuration/shared/tls#utls).                                                                                                                                                                                          |
 | `with_acme`                        | Build with ACME TLS certificate issuer support, see [TLS](./configuration/shared/tls).                                                                                                                                                                                                                                          |
 | `with_clash_api`                   | Build with Clash API support, see [Experimental](./configuration/experimental#clash-api-fields).                                                                                                                                                                                                                                |
-| `no_gvisor`                        | Build without gVisor Tun stack support, see [Tun inbound](./configuration/inbound/tun#stack).                                                                                                                                                                                                                                   |
+| `with_gvisor`                      | Build with gVisor support, see [Tun inbound](./configuration/inbound/tun#stack) and [WireGuard outbound](./configuration/outbound/wireguard#system_interface).                                                                                                                                                                  |
 | `with_embedded_tor` (CGO required) | Build with embedded Tor support, see [Tor outbound](./configuration/outbound/tor).                                                                                                                                                                                                                                              |
 | `with_lwip` (CGO required)         | Build with LWIP Tun stack support, see [Tun inbound](./configuration/inbound/tun#stack).                                                                                                                                                                                                                                        |
 

docs/index.zh.md

@@ -25,14 +25,14 @@ go install -v -tags with_clash_api github.com/sagernet/sing-box/cmd/sing-box@lat
 | 构建标志                         | 描述                                                                                                                                                                                                                                                                           |
 |------------------------------|------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------|
 | `with_quic`                  | 启用 QUIC 支持，参阅 [QUIC 和 HTTP3 DNS 传输层](./configuration/dns/server)，[Naive 入站](./configuration/inbound/naive)，[Hysteria 入站](./configuration/inbound/hysteria)，[Hysteria 出站](./configuration/outbound/hysteria) 和 [V2Ray 传输层#QUIC](./configuration/shared/v2ray-transport#quic)。 |
-| `with_grpc`                  | 启用标准 gRPC 支持，参阅 [V2Ray 传输层#gRPC](./configuration/shared/v2ray-transport#grpc)。                                                                                                                                                                                               |
+| `with_grpc`                  | 启用标准 gRPCuTLS](https://github.com/refraction-networking/utls) 支持， 参阅 [TLS](./configuration/shared/tls#utls)。                                                                                                                                                                      |
+| `with_acme`                  | 启用 ACME TLS 证书签发支持，参阅 [TLS](./configuration/shared/tls)。                                                                                                                                                                                                                     |
+| `with_clash_api`             | 启用 Clash api 支 支持，参阅 [V2Ray 传输层#gRPC](./configuration/shared/v2ray-transport#grpc)。                                                                                                                                                                                               |
 | `with_wireguard`             | 启用 WireGuard 支持，参阅 [WireGuard 出站](./configuration/outbound/wireguard)。                                                                                                                                                                                                       |
 | `with_shadowsocksr`          | 启用 ShadowsocksR 支持，参阅 [ShadowsocksR 出站](./configuration/outbound/shadowsocksr)。                                                                                                                                                                                              |
 | `with_ech`                   | 启用 TLS ECH 扩展支持，参阅 [TLS](./configuration/shared/tls#ech)。                                                                                                                                                                                                                    |
-| `with_utls`                  | 启用 [uTLS](https://github.com/refraction-networking/utls) 支持， 参阅 [TLS](./configuration/shared/tls#utls)。                                                                                                                                                                      |
-| `with_acme`                  | 启用 ACME TLS 证书签发支持，参阅 [TLS](./configuration/shared/tls)。                                                                                                                                                                                                                     |
-| `with_clash_api`             | 启用 Clash api 支持，参阅 [实验性](./configuration/experimental#clash-api-fields)。                                                                                                                                                                                                     |
-| `no_gvisor`                  | 禁用 gVisor Tun 栈支持，参阅 [Tun 入站](./configuration/inbound/tun#stack)。                                                                                                                                                                                                            |
+| `with_utls`                  | 启用 [持，参阅 [实验性](./configuration/experimental#clash-api-fields)。                                                                                                                                                                                                     |
+| `with_gvisor`                | 启用 gVisor 支持，参阅 [Tun 入站](./configuration/inbound/tun#stack) 和 [WireGuard 出站](./configuration/outbound/wireguard#system_interface)。                                                                                                                                           |
 | `with_embedded_tor` (需要 CGO) | 启用 嵌入式 Tor 支持，参阅 [Tor 出站](./configuration/outbound/tor)。                                                                                                                                                                                                                     |
 | `with_lwip` (需要 CGO)         | 启用 LWIP Tun 栈支持，参阅 [Tun 入站](./configuration/inbound/tun#stack)。                                                                                                                                                                                                              |
 

experimental/clashapi/proxies.go

@@ -61,7 +61,6 @@ func findProxyByName(router adapter.Router) func(next http.Handler) http.Handler
 func proxyInfo(server *Server, detour adapter.Outbound) *badjson.JSONObject {
 	var info badjson.JSONObject
 	var clashType string
-	var isGroup bool
 	switch detour.Type() {
 	case C.TypeDirect:
 		clashType = "Direct"
@@ -70,18 +69,31 @@ func proxyInfo(server *Server, detour adapter.Outbound) *badjson.JSONObject {
 	case C.TypeSocks:
 		clashType = "Socks"
 	case C.TypeHTTP:
-		clashType = "Http"
+		clashType = "HTTP"
 	case C.TypeShadowsocks:
 		clashType = "Shadowsocks"
 	case C.TypeVMess:
-		clashType = "Vmess"
+		clashType = "VMess"
 	case C.TypeTrojan:
 		clashType = "Trojan"
+	case C.TypeHysteria:
+		clashType = "Hysteria"
+	case C.TypeWireGuard:
+		clashType = "WireGuard"
+	case C.TypeShadowsocksR:
+		clashType = "ShadowsocksR"
+	case C.TypeVLESS:
+		clashType = "VLESS"
+	case C.TypeTor:
+		clashType = "Tor"
+	case C.TypeSSH:
+		clashType = "SSH"
 	case C.TypeSelector:
 		clashType = "Selector"
-		isGroup = true
+	case C.TypeURLTest:
+		clashType = "URLTest"
 	default:
-		clashType = "Socks"
+		clashType = "Direct"
 	}
 	info.Put("type", clashType)
 	info.Put("name", detour.Tag())
@@ -92,10 +104,9 @@ func proxyInfo(server *Server, detour adapter.Outbound) *badjson.JSONObject {
 	} else {
 		info.Put("history", []*urltest.History{})
 	}
-	if isGroup {
-		selector := detour.(adapter.OutboundGroup)
-		info.Put("now", selector.Now())
-		info.Put("all", selector.All())
+	if group, isGroup := detour.(adapter.OutboundGroup); isGroup {
+		info.Put("now", group.Now())
+		info.Put("all", group.All())
 	}
 	return &info
 }

experimental/clashapi/server.go

@@ -61,6 +61,7 @@ func NewServer(router adapter.Router, logFactory log.ObservableFactory, options
 		server.mode = "rule"
 	}
 	if options.StoreSelected {
+		server.storeSelected = true
 		cachePath := os.ExpandEnv(options.CacheFile)
 		if cachePath == "" {
 			cachePath = "cache.db"
@@ -80,7 +81,7 @@ func NewServer(router adapter.Router, logFactory log.ObservableFactory, options
 	chiRouter.Use(cors.Handler)
 	chiRouter.Group(func(r chi.Router) {
 		r.Use(authentication(options.Secret))
-		r.Get("/", hello)
+		r.Get("/", hello(options.ExternalUI != ""))
 		r.Get("/logs", getLogs(logFactory))
 		r.Get("/traffic", traffic(trafficManager))
 		r.Get("/version", version)
@@ -143,6 +144,10 @@ func (s *Server) CacheFile() adapter.ClashCacheFile {
 	return s.cacheFile
 }
 
+func (s *Server) HistoryStorage() *urltest.HistoryStorage {
+	return s.urlTestHistory
+}
+
 func (s *Server) RoutedConnection(ctx context.Context, conn net.Conn, metadata adapter.InboundContext, matchedRule adapter.Rule) (net.Conn, adapter.Tracker) {
 	tracker := trafficontrol.NewTCPTracker(conn, s.trafficManager, castMetadata(metadata), s.router, matchedRule)
 	return tracker, tracker
@@ -232,8 +237,14 @@ func authentication(serverSecret string) func(next http.Handler) http.Handler {
 	}
 }
 
-func hello(w http.ResponseWriter, r *http.Request) {
-	render.JSON(w, r, render.M{"hello": "clash"})
+func hello(redirect bool) func(w http.ResponseWriter, r *http.Request) {
+	return func(w http.ResponseWriter, r *http.Request) {
+		if redirect {
+			http.Redirect(w, r, "/ui/", http.StatusTemporaryRedirect)
+		} else {
+			render.JSON(w, r, render.M{"hello": "clash"})
+		}
+	}
 }
 
 var upgrader = websocket.Upgrader{

go.mod

@@ -4,6 +4,8 @@ go 1.18
 
 require (
 	berty.tech/go-libtor v1.0.385
+	github.com/Dreamacro/clash v1.11.8
+	github.com/caddyserver/certmagic v0.17.1
 	github.com/cloudflare/circl v1.2.1-0.20220831060716-4cf0150356fc
 	github.com/cretz/bine v0.2.0
 	github.com/database64128/tfo-go v1.1.2
@@ -20,14 +22,12 @@ require (
 	github.com/oschwald/maxminddb-golang v1.10.0
 	github.com/pires/go-proxyproto v0.6.2
 	github.com/refraction-networking/utls v1.1.2
-	github.com/sagernet/certmagic v0.0.0-20220819042630-4a57f8b6853a
 	github.com/sagernet/quic-go v0.0.0-20220818150011-de611ab3e2bb
-	github.com/sagernet/shadowsocksr v0.0.0-20220912092645-c9ab93f81bb0
-	github.com/sagernet/sing v0.0.0-20220913004915-27ddefbb8921
-	github.com/sagernet/sing-dns v0.0.0-20220822023312-3e086b06d666
+	github.com/sagernet/sing v0.0.0-20220921101604-86d7d510231f
+	github.com/sagernet/sing-dns v0.0.0-20220915084601-812e0864b45b
 	github.com/sagernet/sing-shadowsocks v0.0.0-20220819002358-7461bb09a8f6
-	github.com/sagernet/sing-tun v0.0.0-20220911034209-c7dd5d457e24
-	github.com/sagernet/sing-vmess v0.0.0-20220913015714-c4ab86d40e12
+	github.com/sagernet/sing-tun v0.0.0-20220922083325-80ee99472704
+	github.com/sagernet/sing-vmess v0.0.0-20220921140858-b6a1bdee672f
 	github.com/sagernet/smux v0.0.0-20220831015742-e0f1988e3195
 	github.com/sagernet/websocket v0.0.0-20220913015213-615516348b4e
 	github.com/spf13/cobra v1.5.0
@@ -35,10 +35,10 @@ require (
 	go.etcd.io/bbolt v1.3.6
 	go.uber.org/atomic v1.10.0
 	go4.org/netipx v0.0.0-20220812043211-3cc044ffd68d
-	golang.org/x/crypto v0.0.0-20220829220503-c86fa9a7ed90
+	golang.org/x/crypto v0.0.0-20220919173607-35f4265a4bc0
 	golang.org/x/net v0.0.0-20220909164309-bea034e7d591
-	golang.org/x/sys v0.0.0-20220909162455-aba9fc2a8ff2
-	golang.zx2c4.com/wireguard v0.0.0-20220904105730-b51010ba13f0
+	golang.org/x/sys v0.0.0-20220913120320-3275c407cedc
+	golang.zx2c4.com/wireguard v0.0.0-20220829161405-d1d08426b27b
 	google.golang.org/grpc v1.49.0
 	google.golang.org/protobuf v1.28.1
 	gvisor.dev/gvisor v0.0.0-20220901235040-6ca97ef2ce1c

go.sum

@@ -3,6 +3,8 @@ berty.tech/go-libtor v1.0.385/go.mod h1:9swOOQVb+kmvuAlsgWUK/4c52pm69AdbJsxLzk+f
 cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
 cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
 github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
+github.com/Dreamacro/clash v1.11.8 h1:t/sy3/tiihRlvV3SsliYFjj8rKpbLw5IJ2PymiHcwS8=
+github.com/Dreamacro/clash v1.11.8/go.mod h1:LsWCcJFoKuL1C5F2c0m/1690wihTHYSU3J+im09yTwQ=
 github.com/ajg/form v1.5.1 h1:t9c7v8JUKu/XxOGBU0yjNpaMloxGEJhUkqFRq0ibGeU=
 github.com/ajg/form v1.5.1/go.mod h1:uL1WgH+h2mgNtvBq0339dVnzXdBETtL2LeUXaIv25UY=
 github.com/andybalholm/brotli v1.0.4 h1:V7DdXeJtZscaqfNuAdSRuRFzuiKlHSC/Zh3zl9qY3JY=
@@ -10,6 +12,8 @@ github.com/andybalholm/brotli v1.0.4/go.mod h1:fO7iG3H7G2nSZ7m0zPUDn85XEX2GTukHG
 github.com/antihax/optional v1.0.0/go.mod h1:uupD/76wgC+ih3iEmQUL+0Ugr19nfwCT1kdvxnR2qWY=
 github.com/benbjohnson/clock v1.1.0 h1:Q92kusRqC1XV2MjkWETPvjJVqKetz1OzxZB7mHJLju8=
 github.com/benbjohnson/clock v1.1.0/go.mod h1:J11/hYXuz8f4ySSvYwY0FKfm+ezbsZBKZxNJlLklBHA=
+github.com/caddyserver/certmagic v0.17.1 h1:VrWANhQAj3brK7jAUKyN6XBHg56WsyorI/84Ilq1tCQ=
+github.com/caddyserver/certmagic v0.17.1/go.mod h1:pSS2aZcdKlrTZrb2DKuRafckx20o5Fz1EdDKEB8KOQM=
 github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU=
 github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
 github.com/cloudflare/circl v1.2.1-0.20220831060716-4cf0150356fc h1:307gdRLiZ08dwOIKwc5lAQ19DRFaQQvdhHalyB4Asx8=
@@ -91,8 +95,8 @@ github.com/klauspost/cpuid/v2 v2.1.0/go.mod h1:RVVoqg1df56z8g3pUjL/3lE5UfnlrJX8t
 github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
 github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
 github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
-github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
 github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
+github.com/kr/text v0.2.0 h1:5Nx0Ya0ZqY2ygV366QzturHI13Jq95ApcVaJBhpS+AY=
 github.com/libdns/libdns v0.2.1 h1:Wu59T7wSHRgtA0cfxC+n1c/e+O3upJGWytknkmFEDis=
 github.com/libdns/libdns v0.2.1/go.mod h1:yQCXzk1lEZmmCPa857bnk4TsOiqYasqpyOEeSObbb40=
 github.com/logrusorgru/aurora v2.0.3+incompatible h1:tOpm7WcpBTn4fjmVfgpQq0EfczGlG91VSDkswnjF5A8=
@@ -133,28 +137,24 @@ github.com/rogpeppe/fastuuid v1.2.0/go.mod h1:jVj6XXZzXRy/MSR5jhDC/2q6DgLz+nrA6L
 github.com/russross/blackfriday/v2 v2.1.0/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
 github.com/sagernet/abx-go v0.0.0-20220819185957-dba1257d738e h1:5CFRo8FJbCuf5s/eTBdZpmMbn8Fe2eSMLNAYfKanA34=
 github.com/sagernet/abx-go v0.0.0-20220819185957-dba1257d738e/go.mod h1:qbt0dWObotCfcjAJJ9AxtFPNSDUfZF+6dCpgKEOBn/g=
-github.com/sagernet/certmagic v0.0.0-20220819042630-4a57f8b6853a h1:SE3Xn4GOQ+kxbgGa2Xp0H2CCsx1o2pVTt0f+hmfuHH4=
-github.com/sagernet/certmagic v0.0.0-20220819042630-4a57f8b6853a/go.mod h1:Q+ZXyesnkjV5B70B1ixk65ecKrlJ2jz0atv3fPKsVVo=
 github.com/sagernet/go-tun2socks v1.16.12-0.20220818015926-16cb67876a61 h1:5+m7c6AkmAylhauulqN/c5dnh8/KssrE9c93TQrXldA=
 github.com/sagernet/go-tun2socks v1.16.12-0.20220818015926-16cb67876a61/go.mod h1:QUQ4RRHD6hGGHdFMEtR8T2P6GS6R3D/CXKdaYHKKXms=
 github.com/sagernet/netlink v0.0.0-20220905062125-8043b4a9aa97 h1:iL5gZI3uFp0X6EslacyapiRz7LLSJyr4RajF/BhMVyE=
 github.com/sagernet/netlink v0.0.0-20220905062125-8043b4a9aa97/go.mod h1:xLnfdiJbSp8rNqYEdIW/6eDO4mVoogml14Bh2hSiFpM=
 github.com/sagernet/quic-go v0.0.0-20220818150011-de611ab3e2bb h1:wc0yQ+SBn4TaTYRwpwvEm3nc4eRdxk6vtRbouLVZAzk=
 github.com/sagernet/quic-go v0.0.0-20220818150011-de611ab3e2bb/go.mod h1:MIccjRKnPTjWwAOpl+AUGWOkzyTd9tERytudxu+1ra4=
-github.com/sagernet/shadowsocksr v0.0.0-20220912092645-c9ab93f81bb0 h1:lQ4RFWY/wBYmXl/zJJCwQbhiEIbgEqC7j+nhZYkgwmU=
-github.com/sagernet/shadowsocksr v0.0.0-20220912092645-c9ab93f81bb0/go.mod h1:xSHLCsdgy5QIozXFEv6uDgMWzyrRdFFjr3TgL+juu6g=
 github.com/sagernet/sing v0.0.0-20220812082120-05f9836bff8f/go.mod h1:QVsS5L/ZA2Q5UhQwLrn0Trw+msNd/NPGEhBKR/ioWiY=
 github.com/sagernet/sing v0.0.0-20220817130738-ce854cda8522/go.mod h1:QVsS5L/ZA2Q5UhQwLrn0Trw+msNd/NPGEhBKR/ioWiY=
-github.com/sagernet/sing v0.0.0-20220913004915-27ddefbb8921 h1:xUHzlIbdlPV/fkToIO9futp9lmKIY+72ezk/whQ8XsI=
-github.com/sagernet/sing v0.0.0-20220913004915-27ddefbb8921/go.mod h1:kZvzh1VDa/Dg/Bt5WaYKU0jl5ept8KKDpl3Ay4gRtRQ=
-github.com/sagernet/sing-dns v0.0.0-20220822023312-3e086b06d666 h1:XUTocA/Ek0dFxUX+xJCWMPPFZCn2GC/uLrBjTSr1vHY=
-github.com/sagernet/sing-dns v0.0.0-20220822023312-3e086b06d666/go.mod h1:eDyH7AJmqBGjZQdQmpZIzlbTREudZuWDExMuGKgjRVM=
+github.com/sagernet/sing v0.0.0-20220921101604-86d7d510231f h1:GX416thAwyc0vHBOal/qplvdhFgYO2dHD5GqADCJ0Ig=
+github.com/sagernet/sing v0.0.0-20220921101604-86d7d510231f/go.mod h1:x3NHUeJBQwV75L51zwmLKQdLtRvR+M4PmXkfQtU1vIY=
+github.com/sagernet/sing-dns v0.0.0-20220915084601-812e0864b45b h1:cXCMNJ9heZ+c6l+qUcku60x9KyXo4SOAaJfg/6spOmU=
+github.com/sagernet/sing-dns v0.0.0-20220915084601-812e0864b45b/go.mod h1:SrvWLfOSlnFmH32CWXicfilAGgIXR0VjrH6yRbuXYww=
 github.com/sagernet/sing-shadowsocks v0.0.0-20220819002358-7461bb09a8f6 h1:JJfDeYYhWunvtxsU/mOVNTmFQmnzGx9dY034qG6G3g4=
 github.com/sagernet/sing-shadowsocks v0.0.0-20220819002358-7461bb09a8f6/go.mod h1:EX3RbZvrwAkPI2nuGa78T2iQXmrkT+/VQtskjou42xM=
-github.com/sagernet/sing-tun v0.0.0-20220911034209-c7dd5d457e24 h1:LsmPeFvj4GhiV5Y7Rm8I845XysdxVN4MQmfZ36P5bmw=
-github.com/sagernet/sing-tun v0.0.0-20220911034209-c7dd5d457e24/go.mod h1:5AhPUv9jWDQ3pv3Mj78SL/1TSjhoaj6WNASxRKLqXqM=
-github.com/sagernet/sing-vmess v0.0.0-20220913015714-c4ab86d40e12 h1:4HYGbTDDemgBVTmaspXbkgjJlXc3hYVjNxSddJndq8Y=
-github.com/sagernet/sing-vmess v0.0.0-20220913015714-c4ab86d40e12/go.mod h1:u66Vv7NHXJWfeAmhh7JuJp/cwxmuQlM56QoZ7B7Mmd0=
+github.com/sagernet/sing-tun v0.0.0-20220922083325-80ee99472704 h1:DOQQXQbB2gq4n2FuMHrL07HRs2naCCsuiu/9l1JFb9A=
+github.com/sagernet/sing-tun v0.0.0-20220922083325-80ee99472704/go.mod h1:5AhPUv9jWDQ3pv3Mj78SL/1TSjhoaj6WNASxRKLqXqM=
+github.com/sagernet/sing-vmess v0.0.0-20220921140858-b6a1bdee672f h1:xyJ3Wbibcug4DxLi/FCHX2Td667SfieyZv645b8+eEE=
+github.com/sagernet/sing-vmess v0.0.0-20220921140858-b6a1bdee672f/go.mod h1:bwhAdSNET1X+j9DOXGj9NIQR39xgcWIk1rOQ9lLD+gM=
 github.com/sagernet/smux v0.0.0-20220831015742-e0f1988e3195 h1:5VBIbVw9q7aKbrFdT83mjkyvQ+VaRsQ6yflTepfln38=
 github.com/sagernet/smux v0.0.0-20220831015742-e0f1988e3195/go.mod h1:yedWtra8nyGJ+SyI+ziwuaGMzBatbB10P1IOOZbbSK8=
 github.com/sagernet/websocket v0.0.0-20220913015213-615516348b4e h1:7uw2njHFGE+VpWamge6o56j2RWk4omF6uLKKxMmcWvs=
@@ -194,11 +194,10 @@ golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACk
 golang.org/x/crypto v0.0.0-20190404164418-38d8ce5564a5/go.mod h1:WFFai1msRO1wXaEeE5yQxYXgSfI8pQAWXbQop6sCtWE=
 golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
 golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
-golang.org/x/crypto v0.0.0-20201203163018-be400aefbc4c/go.mod h1:jdWPYTVW3xRLrWPugEBEK3UY2ZEsg3UU495nc5E+M+I=
 golang.org/x/crypto v0.0.0-20210513164829-c07d793c2f9a/go.mod h1:P+XmwS30IXTQdn5tA2iutPOUgjI07+tq3H3K9MVA1s8=
 golang.org/x/crypto v0.0.0-20211108221036-ceb1ce70b4fa/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc=
-golang.org/x/crypto v0.0.0-20220829220503-c86fa9a7ed90 h1:Y/gsMcFOcR+6S6f3YeMKl5g+dZMEWqcz5Czj/GWYbkM=
-golang.org/x/crypto v0.0.0-20220829220503-c86fa9a7ed90/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4=
+golang.org/x/crypto v0.0.0-20220919173607-35f4265a4bc0 h1:a5Yg6ylndHHYJqIPrdq0AhvR6KTvDTAvgBtaidhEevY=
+golang.org/x/crypto v0.0.0-20220919173607-35f4265a4bc0/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4=
 golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
 golang.org/x/exp v0.0.0-20220722155223-a9213eeb770e h1:+WEEuIdZHnUeJJmEUjyYC2gfUMj69yZXw17EnHg/otA=
 golang.org/x/exp v0.0.0-20220722155223-a9213eeb770e/go.mod h1:Kr81I6Kryrl9sr8s2FK3vxD90NdsKWRuOIl2O4CvYbA=
@@ -239,8 +238,8 @@ golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJ
 golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
-golang.org/x/sync v0.0.0-20210220032951-036812b2e83c h1:5KslGYwFpkhGh+Q16bwMP3cOontH8FOep7tGV86Y7SQ=
 golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20220819030929-7fc1605a5dde h1:ejfdSekXMDxDLbRrJMwUk6KnSLZ2McaUCVcIKM+N6jc=
 golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
 golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
 golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
@@ -248,7 +247,6 @@ golang.org/x/sys v0.0.0-20190403152447-81d4e9dc473e/go.mod h1:h1NjWce9XRLGQEsW7w
 golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190904154756-749cb33beabd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20191005200804-aed5e4c7ecf9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
-golang.org/x/sys v0.0.0-20191026070338-33540a1f6037/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20200217220822-9197077df867/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
@@ -266,9 +264,8 @@ golang.org/x/sys v0.0.0-20220412211240-33da011f77ad/go.mod h1:oPkhp1MJrh7nUepCBc
 golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220704084225-05e143d24a9e/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220731174439-a90be440212d/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
-golang.org/x/sys v0.0.0-20220909162455-aba9fc2a8ff2 h1:wM1k/lXfpc5HdkJJyW9GELpd8ERGdnh8sMGL6Gzq3Ho=
-golang.org/x/sys v0.0.0-20220909162455-aba9fc2a8ff2/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
-golang.org/x/term v0.0.0-20201117132131-f5c789dd3221/go.mod h1:Nr5EML6q2oocZ2LXRh80K7BxOlk5/8JxuGnuhpl+muw=
+golang.org/x/sys v0.0.0-20220913120320-3275c407cedc h1:dpclq5m2YrqPGStKmtw7IcNbKLfbIqKXvNxDJKdIKYc=
+golang.org/x/sys v0.0.0-20220913120320-3275c407cedc/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo=
 golang.org/x/term v0.0.0-20210927222741-03fcf44c2211 h1:JGgROgKl9N8DuW20oFS5gxc+lE67/N3FcwmBPMe7ArY=
 golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
@@ -300,8 +297,8 @@ golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8T
 golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
 golang.zx2c4.com/wintun v0.0.0-20211104114900-415007cec224 h1:Ug9qvr1myri/zFN6xL17LSCBGFDnphBBhzmILHsM5TY=
 golang.zx2c4.com/wintun v0.0.0-20211104114900-415007cec224/go.mod h1:deeaetjYA+DHMHg+sMSMI58GrEteJUUzzw7en6TJQcI=
-golang.zx2c4.com/wireguard v0.0.0-20220904105730-b51010ba13f0 h1:5ZkdpbduT/g+9OtbSDvbF3KvfQG45CtH/ppO8FUmvCQ=
-golang.zx2c4.com/wireguard v0.0.0-20220904105730-b51010ba13f0/go.mod h1:enML0deDxY1ux+B6ANGiwtg0yAJi1rctkTpcHNAVPyg=
+golang.zx2c4.com/wireguard v0.0.0-20220829161405-d1d08426b27b h1:qgrKnOfe1zyURRNdmDlGbN32i38Zjmw0B1+TMdHcOvg=
+golang.zx2c4.com/wireguard v0.0.0-20220829161405-d1d08426b27b/go.mod h1:6y4CqPAy54NwiN4nC8K+R1eMpQDB1P2d25qmunh2RSA=
 google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
 google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
 google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=

inbound/hysteria_stub.go

@@ -6,11 +6,11 @@ import (
 	"context"
 
 	"github.com/sagernet/sing-box/adapter"
-	C "github.com/sagernet/sing-box/constant"
+	I "github.com/sagernet/sing-box/include"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
 )
 
 func NewHysteria(ctx context.Context, router adapter.Router, logger log.ContextLogger, tag string, options option.HysteriaInboundOptions) (adapter.Inbound, error) {
-	return nil, C.ErrQUICNotIncluded
+	return nil, I.ErrQUICNotIncluded
 }

inbound/naive.go

@@ -15,6 +15,7 @@ import (
 	"github.com/sagernet/sing-box/adapter"
 	"github.com/sagernet/sing-box/common/tls"
 	C "github.com/sagernet/sing-box/constant"
+	"github.com/sagernet/sing-box/include"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
 	"github.com/sagernet/sing/common"
@@ -105,7 +106,7 @@ func (n *Naive) Start() error {
 
 	if common.Contains(n.network, N.NetworkUDP) {
 		err := n.configureHTTP3Listener()
-		if !C.QUIC_AVAILABLE && len(n.network) > 1 {
+		if !include.WithQUIC && len(n.network) > 1 {
 			log.Warn(E.Cause(err, "naive http3 disabled"))
 		} else if err != nil {
 			return err

inbound/naive_quic_stub.go

@@ -3,9 +3,9 @@
 package inbound
 
 import (
-	C "github.com/sagernet/sing-box/constant"
+	I "github.com/sagernet/sing-box/include"
 )
 
 func (n *Naive) configureHTTP3Listener() error {
-	return C.ErrQUICNotIncluded
+	return I.ErrQUICNotIncluded
 }

inbound/tun.go

@@ -190,7 +190,7 @@ func (t *Tun) NewConnection(ctx context.Context, conn net.Conn, upstreamMetadata
 	if err != nil {
 		t.NewError(ctx, err)
 	}
-	return err
+	return nil
 }
 
 func (t *Tun) NewPacketConnection(ctx context.Context, conn N.PacketConn, upstreamMetadata M.Metadata) error {
@@ -212,7 +212,7 @@ func (t *Tun) NewPacketConnection(ctx context.Context, conn N.PacketConn, upstre
 	if err != nil {
 		t.NewError(ctx, err)
 	}
-	return err
+	return nil
 }
 
 func (t *Tun) NewError(ctx context.Context, err error) {

include/quic.go

@@ -0,0 +1,7 @@
+//go:build with_quic
+
+package include
+
+import _ "github.com/sagernet/sing-dns/quic"
+
+const WithQUIC = true

include/quic_stub.go

@@ -0,0 +1,21 @@
+//go:build !with_quic
+
+package include
+
+import (
+	"context"
+
+	"github.com/sagernet/sing-dns"
+	E "github.com/sagernet/sing/common/exceptions"
+	N "github.com/sagernet/sing/common/network"
+)
+
+const WithQUIC = false
+
+var ErrQUICNotIncluded = E.New(`QUIC is not included in this build, rebuild with -tags with_quic`)
+
+func init() {
+	dns.RegisterTransport([]string{"quic", "h3"}, func(ctx context.Context, dialer N.Dialer, link string) (dns.Transport, error) {
+		return nil, ErrQUICNotIncluded
+	})
+}

mkdocs.yml

@@ -90,6 +90,7 @@ nav:
           - SSH: configuration/outbound/ssh.md
           - DNS: configuration/outbound/dns.md
           - Selector: configuration/outbound/selector.md
+          - URLTest: configuration/outbound/urltest.md
   - FAQ:
       - faq/index.md
       - Known Issues: faq/known-issues.md

option/clash.go

@@ -14,3 +14,10 @@ type SelectorOutboundOptions struct {
 	Outbounds []string `json:"outbounds"`
 	Default   string   `json:"default,omitempty"`
 }
+
+type URLTestOutboundOptions struct {
+	Outbounds []string `json:"outbounds"`
+	URL       string   `json:"url,omitempty"`
+	Interval  Duration `json:"interval,omitempty"`
+	Tolerance uint16   `json:"tolerance,omitempty"`
+}

option/outbound.go

@@ -24,6 +24,7 @@ type _Outbound struct {
 	ShadowsocksROptions ShadowsocksROutboundOptions `json:"-"`
 	VLESSOptions        VLESSOutboundOptions        `json:"-"`
 	SelectorOptions     SelectorOutboundOptions     `json:"-"`
+	URLTestOptions      URLTestOutboundOptions      `json:"-"`
 }
 
 type Outbound _Outbound
@@ -61,6 +62,8 @@ func (h Outbound) MarshalJSON() ([]byte, error) {
 		v = h.VLESSOptions
 	case C.TypeSelector:
 		v = h.SelectorOptions
+	case C.TypeURLTest:
+		v = h.URLTestOptions
 	default:
 		return nil, E.New("unknown outbound type: ", h.Type)
 	}
@@ -104,6 +107,8 @@ func (h *Outbound) UnmarshalJSON(bytes []byte) error {
 		v = &h.VLESSOptions
 	case C.TypeSelector:
 		v = &h.SelectorOptions
+	case C.TypeURLTest:
+		v = &h.URLTestOptions
 	default:
 		return E.New("unknown outbound type: ", h.Type)
 	}
@@ -115,17 +120,18 @@ func (h *Outbound) UnmarshalJSON(bytes []byte) error {
 }
 
 type DialerOptions struct {
-	Detour         string         `json:"detour,omitempty"`
-	BindInterface  string         `json:"bind_interface,omitempty"`
-	BindAddress    *ListenAddress `json:"bind_address,omitempty"`
-	ProtectPath    string         `json:"protect_path,omitempty"`
-	RoutingMark    int            `json:"routing_mark,omitempty"`
-	ReuseAddr      bool           `json:"reuse_addr,omitempty"`
-	ConnectTimeout Duration       `json:"connect_timeout,omitempty"`
-	TCPFastOpen    bool           `json:"tcp_fast_open,omitempty"`
-	UDPFragment    bool           `json:"udp_fragment,omitempty"`
-	DomainStrategy DomainStrategy `json:"domain_strategy,omitempty"`
-	FallbackDelay  Duration       `json:"fallback_delay,omitempty"`
+	Detour             string         `json:"detour,omitempty"`
+	BindInterface      string         `json:"bind_interface,omitempty"`
+	BindAddress        *ListenAddress `json:"bind_address,omitempty"`
+	ProtectPath        string         `json:"protect_path,omitempty"`
+	RoutingMark        int            `json:"routing_mark,omitempty"`
+	ReuseAddr          bool           `json:"reuse_addr,omitempty"`
+	ConnectTimeout     Duration       `json:"connect_timeout,omitempty"`
+	TCPFastOpen        bool           `json:"tcp_fast_open,omitempty"`
+	UDPFragment        *bool          `json:"udp_fragment,omitempty"`
+	UDPFragmentDefault bool           `json:"-"`
+	DomainStrategy     DomainStrategy `json:"domain_strategy,omitempty"`
+	FallbackDelay      Duration       `json:"fallback_delay,omitempty"`
 }
 
 type ServerOptions struct {

option/vmess.go

@@ -23,7 +23,7 @@ type VMessOutboundOptions struct {
 	AuthenticatedLength bool                   `json:"authenticated_length,omitempty"`
 	Network             NetworkList            `json:"network,omitempty"`
 	TLS                 *OutboundTLSOptions    `json:"tls,omitempty"`
-	PacketAddr          bool                   `json:"packet_addr,omitempty"`
+	PacketEncoding      string                 `json:"packet_encoding,omitempty"`
 	Multiplex           *MultiplexOptions      `json:"multiplex,omitempty"`
 	Transport           *V2RayTransportOptions `json:"transport,omitempty"`
 }

outbound/builder.go

@@ -47,6 +47,8 @@ func New(ctx context.Context, router adapter.Router, logger log.ContextLogger, o
 		return NewVLESS(ctx, router, logger, options.Tag, options.VLESSOptions)
 	case C.TypeSelector:
 		return NewSelector(router, logger, options.Tag, options.SelectorOptions)
+	case C.TypeURLTest:
+		return NewURLTest(router, logger, options.Tag, options.URLTestOptions)
 	default:
 		return nil, E.New("unknown outbound type: ", options.Type)
 	}

outbound/direct.go

@@ -35,6 +35,7 @@ type Direct struct {
 }
 
 func NewDirect(router adapter.Router, logger log.ContextLogger, tag string, options option.DirectOutboundOptions) (*Direct, error) {
+	options.UDPFragmentDefault = true
 	outbound := &Direct{
 		myOutboundAdapter: myOutboundAdapter{
 			protocol: C.TypeDirect,

outbound/dns.go

@@ -16,7 +16,7 @@ import (
 	N "github.com/sagernet/sing/common/network"
 	"github.com/sagernet/sing/common/task"
 
-	"golang.org/x/net/dns/dnsmessage"
+	mDNS "github.com/miekg/dns"
 )
 
 var _ adapter.Outbound = (*DNS)(nil)
@@ -72,7 +72,7 @@ func (d *DNS) handleConnection(ctx context.Context, conn net.Conn, metadata adap
 	if err != nil {
 		return err
 	}
-	var message dnsmessage.Message
+	var message mDNS.Msg
 	err = message.Unpack(buffer.Bytes())
 	if err != nil {
 		return err
@@ -88,7 +88,7 @@ func (d *DNS) handleConnection(ctx context.Context, conn net.Conn, metadata adap
 		responseBuffer := common.Dup(_responseBuffer)
 		defer responseBuffer.Release()
 		responseBuffer.Resize(2, 0)
-		n, err := response.AppendPack(responseBuffer.Index(0))
+		n, err := response.PackBuffer(responseBuffer.FreeBytes())
 		if err != nil {
 			return err
 		}
@@ -117,7 +117,7 @@ func (d *DNS) NewPacketConnection(ctx context.Context, conn N.PacketConn, metada
 			if err != nil {
 				return err
 			}
-			var message dnsmessage.Message
+			var message mDNS.Msg
 			err = message.Unpack(buffer.Bytes())
 			if err != nil {
 				return err
@@ -131,7 +131,7 @@ func (d *DNS) NewPacketConnection(ctx context.Context, conn N.PacketConn, metada
 				}
 				timeout.Update()
 				responseBuffer := buf.NewPacket()
-				n, err := response.AppendPack(responseBuffer.Index(0))
+				n, err := response.PackBuffer(responseBuffer.FreeBytes())
 				if err != nil {
 					responseBuffer.Release()
 					return err

outbound/hysteria_stub.go

@@ -6,11 +6,11 @@ import (
 	"context"
 
 	"github.com/sagernet/sing-box/adapter"
-	C "github.com/sagernet/sing-box/constant"
+	I "github.com/sagernet/sing-box/include"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
 )
 
 func NewHysteria(ctx context.Context, router adapter.Router, logger log.ContextLogger, tag string, options option.HysteriaOutboundOptions) (adapter.Outbound, error) {
-	return nil, C.ErrQUICNotIncluded
+	return nil, I.ErrQUICNotIncluded
 }

outbound/shadowsocksr.go

@@ -4,41 +4,36 @@ package outbound
 
 import (
 	"context"
+	"errors"
+	"fmt"
 	"net"
-	"strings"
 
-	"github.com/sagernet/shadowsocksr"
-	"github.com/sagernet/shadowsocksr/obfs"
-	"github.com/sagernet/shadowsocksr/protocol"
-	"github.com/sagernet/shadowsocksr/ssr"
-	"github.com/sagernet/shadowsocksr/streamCipher"
 	"github.com/sagernet/sing-box/adapter"
 	"github.com/sagernet/sing-box/common/dialer"
 	C "github.com/sagernet/sing-box/constant"
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
-	"github.com/sagernet/sing-shadowsocks"
-	"github.com/sagernet/sing-shadowsocks/shadowimpl"
-	"github.com/sagernet/sing/common"
+	"github.com/sagernet/sing-box/transport/clashssr/obfs"
+	"github.com/sagernet/sing-box/transport/clashssr/protocol"
 	"github.com/sagernet/sing/common/bufio"
 	E "github.com/sagernet/sing/common/exceptions"
 	M "github.com/sagernet/sing/common/metadata"
 	N "github.com/sagernet/sing/common/network"
+
+	"github.com/Dreamacro/clash/transport/shadowsocks/core"
+	"github.com/Dreamacro/clash/transport/shadowsocks/shadowstream"
+	"github.com/Dreamacro/clash/transport/socks5"
 )
 
 var _ adapter.Outbound = (*ShadowsocksR)(nil)
 
 type ShadowsocksR struct {
 	myOutboundAdapter
-	dialer         N.Dialer
-	serverAddr     M.Socksaddr
-	method         shadowsocks.Method
-	cipher         string
-	password       string
-	obfs           string
-	obfsParams     *ssr.ServerInfo
-	protocol       string
-	protocolParams *ssr.ServerInfo
+	dialer     N.Dialer
+	serverAddr M.Socksaddr
+	cipher     core.Cipher
+	obfs       obfs.Obfs
+	protocol   protocol.Protocol
 }
 
 func NewShadowsocksR(ctx context.Context, router adapter.Router, logger log.ContextLogger, tag string, options option.ShadowsocksROutboundOptions) (*ShadowsocksR, error) {
@@ -52,40 +47,54 @@ func NewShadowsocksR(ctx context.Context, router adapter.Router, logger log.Cont
 		},
 		dialer:     dialer.New(router, options.DialerOptions),
 		serverAddr: options.ServerOptions.Build(),
-		cipher:     options.Method,
-		password:   options.Password,
-		obfs:       options.Obfs,
-		protocol:   options.Protocol,
 	}
+	var cipher string
 	var err error
-	outbound.method, err = shadowimpl.FetchMethod(options.Method, options.Password)
+	switch options.Method {
+	case "none":
+		cipher = "dummy"
+	default:
+		cipher = options.Method
+	}
+	outbound.cipher, err = core.PickCipher(cipher, nil, options.Password)
 	if err != nil {
 		return nil, err
 	}
-	if _, err = streamCipher.NewStreamCipher(options.Method, options.Password); err != nil {
-		return nil, E.New(strings.ToLower(err.Error()))
+	var (
+		ivSize int
+		key    []byte
+	)
+	if cipher == "dummy" {
+		ivSize = 0
+		key = core.Kdf(options.Password, 16)
+	} else {
+		streamCipher, ok := outbound.cipher.(*core.StreamCipher)
+		if !ok {
+			return nil, fmt.Errorf("%s is not none or a supported stream cipher in ssr", cipher)
+		}
+		ivSize = streamCipher.IVSize()
+		key = streamCipher.Key
 	}
-	if obfs.NewObfs(options.Obfs) == nil {
-		return nil, E.New("unknown obfs: " + options.Obfs)
-	}
-	outbound.obfsParams = &ssr.ServerInfo{
-		Host:   outbound.serverAddr.AddrString(),
-		Port:   outbound.serverAddr.Port,
-		TcpMss: 1460,
+	obfs, obfsOverhead, err := obfs.PickObfs(options.Obfs, &obfs.Base{
+		Host:   options.Server,
+		Port:   int(options.ServerPort),
+		Key:    key,
+		IVSize: ivSize,
 		Param:  options.ObfsParam,
+	})
+	if err != nil {
+		return nil, E.Cause(err, "initialize obfs")
 	}
-	if protocol.NewProtocol(options.Protocol) == nil {
-		return nil, E.New("unknown protocol: " + options.Protocol)
-	}
-	outbound.protocolParams = &ssr.ServerInfo{
-		Host:   outbound.serverAddr.AddrString(),
-		Port:   outbound.serverAddr.Port,
-		TcpMss: 1460,
-		Param:  options.Protocol,
-	}
-	if outbound.method == nil {
-		outbound.network = common.Filter(outbound.network, func(it string) bool { return it == N.NetworkTCP })
+	protocol, err := protocol.PickProtocol(options.Protocol, &protocol.Base{
+		Key:      key,
+		Overhead: obfsOverhead,
+		Param:    options.ProtocolParam,
+	})
+	if err != nil {
+		return nil, E.Cause(err, "initialize protocol")
 	}
+	outbound.obfs = obfs
+	outbound.protocol = protocol
 	return outbound, nil
 }
 
@@ -97,20 +106,17 @@ func (h *ShadowsocksR) DialContext(ctx context.Context, network string, destinat
 		if err != nil {
 			return nil, err
 		}
-		cipher, err := streamCipher.NewStreamCipher(h.cipher, h.password)
+		conn = h.cipher.StreamConn(h.obfs.StreamConn(conn))
+		writeIv, err := conn.(*shadowstream.Conn).ObtainWriteIV()
 		if err != nil {
-			return nil, E.New(strings.ToLower(err.Error()))
+			return nil, err
 		}
-		ssConn := shadowsocksr.NewSSTCPConn(conn, cipher)
-		ssConn.IObfs = obfs.NewObfs(h.obfs)
-		ssConn.IObfs.SetServerInfo(h.obfsParams)
-		ssConn.IProtocol = protocol.NewProtocol(h.protocol)
-		ssConn.IProtocol.SetServerInfo(h.protocolParams)
-		err = M.SocksaddrSerializer.WriteAddrPort(ssConn, destination)
+		conn = h.protocol.StreamConn(conn, writeIv)
+		err = M.SocksaddrSerializer.WriteAddrPort(conn, destination)
 		if err != nil {
 			return nil, E.Cause(err, "write request")
 		}
-		return ssConn, nil
+		return conn, nil
 	case N.NetworkUDP:
 		conn, err := h.ListenPacket(ctx, destination)
 		if err != nil {
@@ -128,7 +134,10 @@ func (h *ShadowsocksR) ListenPacket(ctx context.Context, destination M.Socksaddr
 	if err != nil {
 		return nil, err
 	}
-	return h.method.DialPacketConn(outConn), nil
+	packetConn := h.cipher.PacketConn(bufio.NewUnbindPacketConn(outConn))
+	packetConn = h.protocol.PacketConn(packetConn)
+	packetConn = &ssPacketConn{packetConn, outConn.RemoteAddr()}
+	return packetConn, nil
 }
 
 func (h *ShadowsocksR) NewConnection(ctx context.Context, conn net.Conn, metadata adapter.InboundContext) error {
@@ -138,3 +147,36 @@ func (h *ShadowsocksR) NewConnection(ctx context.Context, conn net.Conn, metadat
 func (h *ShadowsocksR) NewPacketConnection(ctx context.Context, conn N.PacketConn, metadata adapter.InboundContext) error {
 	return NewPacketConnection(ctx, h, conn, metadata)
 }
+
+type ssPacketConn struct {
+	net.PacketConn
+	rAddr net.Addr
+}
+
+func (spc *ssPacketConn) WriteTo(b []byte, addr net.Addr) (n int, err error) {
+	packet, err := socks5.EncodeUDPPacket(socks5.ParseAddrToSocksAddr(addr), b)
+	if err != nil {
+		return
+	}
+	return spc.PacketConn.WriteTo(packet[3:], spc.rAddr)
+}
+
+func (spc *ssPacketConn) ReadFrom(b []byte) (int, net.Addr, error) {
+	n, _, e := spc.PacketConn.ReadFrom(b)
+	if e != nil {
+		return 0, nil, e
+	}
+
+	addr := socks5.SplitAddr(b[:n])
+	if addr == nil {
+		return 0, nil, errors.New("parse addr error")
+	}
+
+	udpAddr := addr.UDPAddr()
+	if udpAddr == nil {
+		return 0, nil, errors.New("parse addr error")
+	}
+
+	copy(b, b[len(addr):])
+	return n - len(addr), udpAddr, e
+}

outbound/urltest.go

@@ -0,0 +1,287 @@
+package outbound
+
+import (
+	"context"
+	"net"
+	"sort"
+	"time"
+
+	"github.com/sagernet/sing-box/adapter"
+	"github.com/sagernet/sing-box/common/urltest"
+	C "github.com/sagernet/sing-box/constant"
+	"github.com/sagernet/sing-box/log"
+	"github.com/sagernet/sing-box/option"
+	"github.com/sagernet/sing/common"
+	"github.com/sagernet/sing/common/batch"
+	E "github.com/sagernet/sing/common/exceptions"
+	M "github.com/sagernet/sing/common/metadata"
+	N "github.com/sagernet/sing/common/network"
+)
+
+var (
+	_ adapter.Outbound      = (*URLTest)(nil)
+	_ adapter.OutboundGroup = (*URLTest)(nil)
+)
+
+type URLTest struct {
+	myOutboundAdapter
+	tags      []string
+	link      string
+	interval  time.Duration
+	tolerance uint16
+	group     *URLTestGroup
+}
+
+func NewURLTest(router adapter.Router, logger log.ContextLogger, tag string, options option.URLTestOutboundOptions) (*URLTest, error) {
+	outbound := &URLTest{
+		myOutboundAdapter: myOutboundAdapter{
+			protocol: C.TypeURLTest,
+			router:   router,
+			logger:   logger,
+			tag:      tag,
+		},
+		tags:      options.Outbounds,
+		link:      options.URL,
+		interval:  time.Duration(options.Interval),
+		tolerance: options.Tolerance,
+	}
+	if len(outbound.tags) == 0 {
+		return nil, E.New("missing tags")
+	}
+	return outbound, nil
+}
+
+func (s *URLTest) Network() []string {
+	if s.group == nil {
+		return []string{N.NetworkTCP, N.NetworkUDP}
+	}
+	return s.group.Select(N.NetworkTCP).Network()
+}
+
+func (s *URLTest) Start() error {
+	outbounds := make([]adapter.Outbound, 0, len(s.tags))
+	for i, tag := range s.tags {
+		detour, loaded := s.router.Outbound(tag)
+		if !loaded {
+			return E.New("outbound ", i, " not found: ", tag)
+		}
+		outbounds = append(outbounds, detour)
+	}
+	s.group = NewURLTestGroup(s.router, s.logger, outbounds, s.link, s.interval, s.tolerance)
+	return s.group.Start()
+}
+
+func (s URLTest) Close() error {
+	return common.Close(
+		common.PtrOrNil(s.group),
+	)
+}
+
+func (s *URLTest) Now() string {
+	return s.group.Select(N.NetworkTCP).Tag()
+}
+
+func (s *URLTest) All() []string {
+	return s.tags
+}
+
+func (s *URLTest) DialContext(ctx context.Context, network string, destination M.Socksaddr) (net.Conn, error) {
+	outbound := s.group.Select(network)
+	conn, err := outbound.DialContext(ctx, network, destination)
+	if err == nil {
+		return conn, nil
+	}
+	s.logger.ErrorContext(ctx, err)
+	go s.group.checkOutbounds()
+	outbounds := s.group.Fallback(outbound)
+	for _, fallback := range outbounds {
+		conn, err = fallback.DialContext(ctx, network, destination)
+		if err == nil {
+			return conn, nil
+		}
+	}
+	return nil, err
+}
+
+func (s *URLTest) ListenPacket(ctx context.Context, destination M.Socksaddr) (net.PacketConn, error) {
+	outbound := s.group.Select(N.NetworkUDP)
+	conn, err := outbound.ListenPacket(ctx, destination)
+	if err == nil {
+		return conn, nil
+	}
+	s.logger.ErrorContext(ctx, err)
+	go s.group.checkOutbounds()
+	outbounds := s.group.Fallback(outbound)
+	for _, fallback := range outbounds {
+		conn, err = fallback.ListenPacket(ctx, destination)
+		if err == nil {
+			return conn, nil
+		}
+	}
+	return nil, err
+}
+
+func (s *URLTest) NewConnection(ctx context.Context, conn net.Conn, metadata adapter.InboundContext) error {
+	return NewConnection(ctx, s, conn, metadata)
+}
+
+func (s *URLTest) NewPacketConnection(ctx context.Context, conn N.PacketConn, metadata adapter.InboundContext) error {
+	return NewPacketConnection(ctx, s, conn, metadata)
+}
+
+type URLTestGroup struct {
+	router    adapter.Router
+	logger    log.Logger
+	outbounds []adapter.Outbound
+	link      string
+	interval  time.Duration
+	tolerance uint16
+	history   *urltest.HistoryStorage
+
+	ticker *time.Ticker
+	close  chan struct{}
+}
+
+func NewURLTestGroup(router adapter.Router, logger log.Logger, outbounds []adapter.Outbound, link string, interval time.Duration, tolerance uint16) *URLTestGroup {
+	if link == "" {
+		//goland:noinspection HttpUrlsUsage
+		link = "http://www.gstatic.com/generate_204"
+	}
+	if interval == 0 {
+		interval = C.DefaultURLTestInterval
+	}
+	if tolerance == 0 {
+		tolerance = 50
+	}
+	var history *urltest.HistoryStorage
+	if clashServer := router.ClashServer(); clashServer != nil {
+		history = clashServer.HistoryStorage()
+	} else {
+		history = urltest.NewHistoryStorage()
+	}
+	return &URLTestGroup{
+		router:    router,
+		logger:    logger,
+		outbounds: outbounds,
+		link:      link,
+		interval:  interval,
+		tolerance: tolerance,
+		history:   history,
+		close:     make(chan struct{}),
+	}
+}
+
+func (g *URLTestGroup) Start() error {
+	g.ticker = time.NewTicker(g.interval)
+	go g.loopCheck()
+	return nil
+}
+
+func (g *URLTestGroup) Close() error {
+	g.ticker.Stop()
+	close(g.close)
+	return nil
+}
+
+func (g *URLTestGroup) Select(network string) adapter.Outbound {
+	var minDelay uint16
+	var minTime time.Time
+	var minOutbound adapter.Outbound
+	for _, detour := range g.outbounds {
+		if !common.Contains(detour.Network(), network) {
+			continue
+		}
+		history := g.history.LoadURLTestHistory(RealTag(detour))
+		if history == nil {
+			continue
+		}
+		if minDelay == 0 || minDelay > history.Delay+g.tolerance || minDelay > history.Delay-g.tolerance && minTime.Before(history.Time) {
+			minDelay = history.Delay
+			minTime = history.Time
+			minOutbound = detour
+		}
+	}
+	if minOutbound == nil {
+		for _, detour := range g.outbounds {
+			if !common.Contains(detour.Network(), network) {
+				continue
+			}
+			minOutbound = detour
+			break
+		}
+	}
+	return minOutbound
+}
+
+func (g *URLTestGroup) Fallback(used adapter.Outbound) []adapter.Outbound {
+	outbounds := make([]adapter.Outbound, 0, len(g.outbounds)-1)
+	for _, detour := range g.outbounds {
+		if detour != used {
+			outbounds = append(outbounds, detour)
+		}
+	}
+	sort.Slice(outbounds, func(i, j int) bool {
+		oi := outbounds[i]
+		oj := outbounds[j]
+		hi := g.history.LoadURLTestHistory(RealTag(oi))
+		if hi == nil {
+			return false
+		}
+		hj := g.history.LoadURLTestHistory(RealTag(oj))
+		if hj == nil {
+			return false
+		}
+		return hi.Delay < hj.Delay
+	})
+	return outbounds
+}
+
+func (g *URLTestGroup) loopCheck() {
+	go g.checkOutbounds()
+	for {
+		select {
+		case <-g.close:
+			return
+		case <-g.ticker.C:
+			g.checkOutbounds()
+		}
+	}
+}
+
+func (g *URLTestGroup) checkOutbounds() {
+	b, _ := batch.New(context.Background(), batch.WithConcurrencyNum[any](10))
+	checked := make(map[string]bool)
+	for _, detour := range g.outbounds {
+		tag := detour.Tag()
+		realTag := RealTag(detour)
+		if checked[realTag] {
+			continue
+		}
+		history := g.history.LoadURLTestHistory(realTag)
+		if history != nil && time.Now().Sub(history.Time) < g.interval {
+			continue
+		}
+		checked[realTag] = true
+		p, loaded := g.router.Outbound(realTag)
+		if !loaded {
+			continue
+		}
+		b.Go(realTag, func() (any, error) {
+			ctx, cancel := context.WithTimeout(context.Background(), C.TCPTimeout)
+			defer cancel()
+			t, err := urltest.URLTest(ctx, g.link, p)
+			if err != nil {
+				g.logger.Debug("outbound ", tag, " unavailable: ", err)
+				g.history.DeleteURLTestHistory(realTag)
+			} else {
+				g.logger.Debug("outbound ", tag, " available: ", t, "ms")
+				g.history.StoreURLTestHistory(realTag, &urltest.History{
+					Time:  time.Now(),
+					Delay: t,
+				})
+			}
+			return nil, nil
+		})
+	}
+	b.Wait()
+}

outbound/vless.go

@@ -11,8 +11,9 @@ import (
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
 	"github.com/sagernet/sing-box/transport/v2ray"
-	"github.com/sagernet/sing-box/transport/vless"
+	"github.com/sagernet/sing-dns"
 	"github.com/sagernet/sing-vmess/packetaddr"
+	"github.com/sagernet/sing-vmess/vless"
 	"github.com/sagernet/sing/common"
 	E "github.com/sagernet/sing/common/exceptions"
 	M "github.com/sagernet/sing/common/metadata"
@@ -104,7 +105,7 @@ func (h *VLESS) DialContext(ctx context.Context, network string, destination M.S
 		return h.client.DialEarlyConn(conn, destination), nil
 	case N.NetworkUDP:
 		h.logger.InfoContext(ctx, "outbound packet connection to ", destination)
-		return h.client.DialPacketConn(conn, destination), nil
+		return h.client.DialEarlyPacketConn(conn, destination), nil
 	default:
 		return nil, E.Extend(N.ErrUnknownNetwork, network)
 	}
@@ -129,11 +130,11 @@ func (h *VLESS) ListenPacket(ctx context.Context, destination M.Socksaddr) (net.
 		return nil, err
 	}
 	if h.xudp {
-		return h.client.DialXUDPPacketConn(conn, destination), nil
+		return h.client.DialEarlyXUDPPacketConn(conn, destination), nil
 	} else if h.packetAddr {
-		return packetaddr.NewConn(h.client.DialPacketConn(conn, M.Socksaddr{Fqdn: packetaddr.SeqPacketMagicAddress}), destination), nil
+		return dialer.NewResolvePacketConn(ctx, h.router, dns.DomainStrategyAsIS, packetaddr.NewConn(h.client.DialEarlyPacketConn(conn, M.Socksaddr{Fqdn: packetaddr.SeqPacketMagicAddress}), destination)), nil
 	} else {
-		return h.client.DialPacketConn(conn, destination), nil
+		return h.client.DialEarlyPacketConn(conn, destination), nil
 	}
 }
 

outbound/vmess.go

@@ -12,6 +12,7 @@ import (
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
 	"github.com/sagernet/sing-box/transport/v2ray"
+	"github.com/sagernet/sing-dns"
 	"github.com/sagernet/sing-vmess"
 	"github.com/sagernet/sing-vmess/packetaddr"
 	"github.com/sagernet/sing/common"
@@ -31,6 +32,7 @@ type VMess struct {
 	tlsConfig       tls.Config
 	transport       adapter.V2RayClientTransport
 	packetAddr      bool
+	xudp            bool
 }
 
 func NewVMess(ctx context.Context, router adapter.Router, logger log.ContextLogger, tag string, options option.VMessOutboundOptions) (*VMess, error) {
@@ -62,8 +64,14 @@ func NewVMess(ctx context.Context, router adapter.Router, logger log.ContextLogg
 	if err != nil {
 		return nil, err
 	}
-	if outbound.multiplexDialer == nil && options.PacketAddr {
+	switch options.PacketEncoding {
+	case "":
+	case "packetaddr":
 		outbound.packetAddr = true
+	case "xudp":
+		outbound.xudp = true
+	default:
+		return nil, E.New("unknown packet encoding: ", options.PacketEncoding)
 	}
 	var clientOptions []vmess.ClientOption
 	if options.GlobalPadding {
@@ -176,7 +184,9 @@ func (h *vmessDialer) ListenPacket(ctx context.Context, destination M.Socksaddr)
 		return nil, err
 	}
 	if h.packetAddr {
-		return packetaddr.NewConn(h.client.DialEarlyPacketConn(conn, M.Socksaddr{Fqdn: packetaddr.SeqPacketMagicAddress}), destination), nil
+		return dialer.NewResolvePacketConn(ctx, h.router, dns.DomainStrategyAsIS, packetaddr.NewConn(h.client.DialEarlyPacketConn(conn, M.Socksaddr{Fqdn: packetaddr.SeqPacketMagicAddress}), destination)), nil
+	} else if h.xudp {
+		return h.client.DialEarlyXUDPPacketConn(conn, destination), nil
 	} else {
 		return h.client.DialEarlyPacketConn(conn, destination), nil
 	}

outbound/wireguard.go

@@ -16,6 +16,7 @@ import (
 	"github.com/sagernet/sing-box/log"
 	"github.com/sagernet/sing-box/option"
 	"github.com/sagernet/sing-box/transport/wireguard"
+	"github.com/sagernet/sing-tun"
 	"github.com/sagernet/sing/common"
 	"github.com/sagernet/sing/common/debug"
 	E "github.com/sagernet/sing/common/exceptions"
@@ -98,7 +99,7 @@ func NewWireGuard(ctx context.Context, router adapter.Router, logger log.Context
 	}
 	var wireTunDevice wireguard.Device
 	var err error
-	if !options.SystemInterface {
+	if !options.SystemInterface && tun.WithGVisor {
 		wireTunDevice, err = wireguard.NewStackDevice(localPrefixes, mtu)
 	} else {
 		wireTunDevice, err = wireguard.NewSystemDevice(router, options.InterfaceName, localPrefixes, mtu)

release/local/debug.sh

@@ -13,7 +13,7 @@ pushd $PROJECT
 git fetch
 git reset FETCH_HEAD --hard
 git clean -fdx
-go install -v -trimpath -ldflags "-s -w -buildid=" -tags no_gvisor,with_quic,with_acme,debug ./cmd/sing-box
+go install -v -trimpath -ldflags "-s -w -buildid=" -tags with_quic,with_acme,debug ./cmd/sing-box
 popd
 
 sudo systemctl stop sing-box

release/local/install.sh

@@ -10,7 +10,7 @@ DIR=$(dirname "$0")
 PROJECT=$DIR/../..
 
 pushd $PROJECT
-go install -v -trimpath -ldflags "-s -w -buildid=" -tags no_gvisor,with_quic,with_wireguard,with_acme ./cmd/sing-box
+go install -v -trimpath -ldflags "-s -w -buildid=" -tags with_quic,with_wireguard,with_acme ./cmd/sing-box
 popd
 
 sudo cp $(go env GOPATH)/bin/sing-box /usr/local/bin/

release/local/install_go.sh

@@ -1,7 +1,7 @@
 #!/usr/bin/env bash
 
 set -e -o pipefail
-curl -Lo go.tar.gz https://go.dev/dl/go1.19.linux-amd64.tar.gz
+curl -Lo go.tar.gz https://go.dev/dl/go1.19.1.linux-amd64.tar.gz
 sudo rm -rf /usr/local/go
 sudo tar -C /usr/local -xzf go.tar.gz
 rm go.tar.gz

release/local/reinstall.sh

@@ -10,7 +10,7 @@ DIR=$(dirname "$0")
 PROJECT=$DIR/../..
 
 pushd $PROJECT
-go install -v -trimpath -ldflags "-s -w -buildid=" -tags no_gvisor,with_quic,with_wireguard,with_acme ./cmd/sing-box
+go install -v -trimpath -ldflags "-s -w -buildid=" -tags with_quic,with_wireguard,with_acme ./cmd/sing-box
 popd
 
 sudo systemctl stop sing-box

route/interface_finder.go

@@ -0,0 +1,50 @@
+package route
+
+import (
+	"net"
+
+	"github.com/sagernet/sing/common/control"
+)
+
+var _ control.InterfaceFinder = (*myInterfaceFinder)(nil)
+
+type myInterfaceFinder struct {
+	ifs []net.Interface
+}
+
+func (f *myInterfaceFinder) update() error {
+	ifs, err := net.Interfaces()
+	if err != nil {
+		return err
+	}
+	f.ifs = ifs
+	return nil
+}
+
+func (f *myInterfaceFinder) InterfaceIndexByName(name string) (interfaceIndex int, err error) {
+	for _, netInterface := range f.ifs {
+		if netInterface.Name == name {
+			return netInterface.Index, nil
+		}
+	}
+	netInterface, err := net.InterfaceByName(name)
+	if err != nil {
+		return
+	}
+	f.update()
+	return netInterface.Index, nil
+}
+
+func (f *myInterfaceFinder) InterfaceNameByIndex(index int) (interfaceName string, err error) {
+	for _, netInterface := range f.ifs {
+		if netInterface.Index == index {
+			return netInterface.Name, nil
+		}
+	}
+	netInterface, err := net.InterfaceByIndex(index)
+	if err != nil {
+		return
+	}
+	f.update()
+	return netInterface.Name, nil
+}

route/router.go

@@ -86,7 +86,7 @@ type Router struct {
 	transports                         []dns.Transport
 	transportMap                       map[string]dns.Transport
 	transportDomainStrategy            map[dns.Transport]dns.DomainStrategy
-	interfaceBindManager               control.BindManager
+	interfaceFinder                    myInterfaceFinder
 	autoDetectInterface                bool
 	defaultInterface                   string
 	defaultMark                        int
@@ -123,7 +123,6 @@ func NewRouter(ctx context.Context, logger log.ContextLogger, dnsLogger log.Cont
 		defaultDetour:         options.Final,
 		dnsClient:             dns.NewClient(dnsOptions.DNSClientOptions.DisableCache, dnsOptions.DNSClientOptions.DisableExpire),
 		defaultDomainStrategy: dns.DomainStrategy(dnsOptions.Strategy),
-		interfaceBindManager:  control.NewBindManager(),
 		autoDetectInterface:   options.AutoDetectInterface,
 		defaultInterface:      options.DefaultInterface,
 		defaultMark:           options.DefaultMark,
@@ -196,7 +195,7 @@ func NewRouter(ctx context.Context, logger log.ContextLogger, dnsLogger log.Cont
 					return nil, E.New("parse dns server[", tag, "]: missing address_resolver")
 				}
 			}
-			transport, err := dns.NewTransport(ctx, detour, server.Address)
+			transport, err := dns.CreateTransport(ctx, detour, server.Address)
 			if err != nil {
 				return nil, E.Cause(err, "parse dns server[", tag, "]")
 			}
@@ -233,7 +232,7 @@ func NewRouter(ctx context.Context, logger log.ContextLogger, dnsLogger log.Cont
 	}
 	if defaultTransport == nil {
 		if len(transports) == 0 {
-			transports = append(transports, dns.NewLocalTransport())
+			transports = append(transports, &dns.LocalTransport{})
 		}
 		defaultTransport = transports[0]
 	}
@@ -247,13 +246,11 @@ func NewRouter(ctx context.Context, logger log.ContextLogger, dnsLogger log.Cont
 			return inbound.HTTPOptions.SetSystemProxy || inbound.MixedOptions.SetSystemProxy || C.IsAndroid && inbound.TunOptions.AutoRoute
 		})
 
-	if router.interfaceBindManager != nil || needInterfaceMonitor {
+	if needInterfaceMonitor {
 		networkMonitor, err := tun.NewNetworkUpdateMonitor(router)
 		if err == nil {
 			router.networkMonitor = networkMonitor
-			if router.interfaceBindManager != nil {
-				networkMonitor.RegisterCallback(router.interfaceBindManager.Update)
-			}
+			networkMonitor.RegisterCallback(router.interfaceFinder.update)
 		}
 	}
 
@@ -557,7 +554,7 @@ func (r *Router) RouteConnection(ctx context.Context, conn net.Conn, metadata ad
 		if err == nil {
 			metadata.Protocol = sniffMetadata.Protocol
 			metadata.Domain = sniffMetadata.Domain
-			if metadata.SniffOverrideDestination && sniff.IsDomainName(metadata.Domain) {
+			if metadata.SniffOverrideDestination && M.IsDomainName(metadata.Domain) {
 				metadata.Destination = M.Socksaddr{
 					Fqdn: metadata.Domain,
 					Port: metadata.Destination.Port,
@@ -634,7 +631,7 @@ func (r *Router) RoutePacketConnection(ctx context.Context, conn N.PacketConn, m
 		if err == nil {
 			metadata.Protocol = sniffMetadata.Protocol
 			metadata.Domain = sniffMetadata.Domain
-			if metadata.SniffOverrideDestination && sniff.IsDomainName(metadata.Domain) {
+			if metadata.SniffOverrideDestination && M.IsDomainName(metadata.Domain) {
 				metadata.Destination = M.Socksaddr{
 					Fqdn: metadata.Domain,
 					Port: metadata.Destination.Port,
@@ -714,8 +711,8 @@ func (r *Router) match(ctx context.Context, metadata *adapter.InboundContext, de
 	return nil, defaultOutbound
 }
 
-func (r *Router) InterfaceBindManager() control.BindManager {
-	return r.interfaceBindManager
+func (r *Router) InterfaceFinder() control.InterfaceFinder {
+	return &r.interfaceFinder
 }
 
 func (r *Router) AutoDetectInterface() bool {

route/router_dns.go

@@ -12,7 +12,7 @@ import (
 	E "github.com/sagernet/sing/common/exceptions"
 	F "github.com/sagernet/sing/common/format"
 
-	"golang.org/x/net/dns/dnsmessage"
+	mDNS "github.com/miekg/dns"
 )
 
 func (r *Router) matchDNS(ctx context.Context) (context.Context, dns.Transport, dns.DomainStrategy) {
@@ -40,29 +40,29 @@ func (r *Router) matchDNS(ctx context.Context) (context.Context, dns.Transport,
 	return ctx, r.defaultTransport, r.defaultDomainStrategy
 }
 
-func (r *Router) Exchange(ctx context.Context, message *dnsmessage.Message) (*dnsmessage.Message, error) {
-	if len(message.Questions) > 0 {
-		r.dnsLogger.DebugContext(ctx, "exchange ", formatDNSQuestion(message.Questions[0]))
+func (r *Router) Exchange(ctx context.Context, message *mDNS.Msg) (*mDNS.Msg, error) {
+	if len(message.Question) > 0 {
+		r.dnsLogger.DebugContext(ctx, "exchange ", formatQuestion(message.Question[0].String()))
 	}
 	ctx, metadata := adapter.AppendContext(ctx)
-	if len(message.Questions) > 0 {
-		switch message.Questions[0].Type {
-		case dnsmessage.TypeA:
+	if len(message.Question) > 0 {
+		switch message.Question[0].Qtype {
+		case mDNS.TypeA:
 			metadata.IPVersion = 4
-		case dnsmessage.TypeAAAA:
+		case mDNS.TypeAAAA:
 			metadata.IPVersion = 6
 		}
-		metadata.Domain = string(message.Questions[0].Name.Data[:message.Questions[0].Name.Length-1])
+		metadata.Domain = fqdnToDomain(message.Question[0].Name)
 	}
 	ctx, transport, strategy := r.matchDNS(ctx)
 	ctx, cancel := context.WithTimeout(ctx, C.DNSTimeout)
 	defer cancel()
 	response, err := r.dnsClient.Exchange(ctx, transport, message, strategy)
-	if err != nil && len(message.Questions) > 0 {
-		r.dnsLogger.ErrorContext(ctx, E.Cause(err, "exchange failed for ", message.Questions[0].Name.String()))
+	if err != nil && len(message.Question) > 0 {
+		r.dnsLogger.ErrorContext(ctx, E.Cause(err, "exchange failed for ", formatQuestion(message.Question[0].String())))
 	}
-	if len(message.Questions) > 0 && response != nil {
-		LogDNSAnswers(r.dnsLogger, ctx, message.Questions[0].Name.String(), response.Answers)
+	if len(message.Question) > 0 && response != nil {
+		LogDNSAnswers(r.dnsLogger, ctx, message.Question[0].Name, response.Answer)
 	}
 	return response, err
 }
@@ -93,61 +93,26 @@ func (r *Router) LookupDefault(ctx context.Context, domain string) ([]netip.Addr
 	return r.Lookup(ctx, domain, dns.DomainStrategyAsIS)
 }
 
-func LogDNSAnswers(logger log.ContextLogger, ctx context.Context, domain string, answers []dnsmessage.Resource) {
-	for _, rawAnswer := range answers {
-		var content string
-		switch answer := rawAnswer.Body.(type) {
-		case *dnsmessage.AResource:
-			content = netip.AddrFrom4(answer.A).String()
-		case *dnsmessage.NSResource:
-			content = answer.NS.String()
-		case *dnsmessage.CNAMEResource:
-			content = answer.CNAME.String()
-		case *dnsmessage.SOAResource:
-			content = answer.MBox.String()
-		case *dnsmessage.PTRResource:
-			content = answer.PTR.String()
-		case *dnsmessage.MXResource:
-			content = answer.MX.String()
-		case *dnsmessage.TXTResource:
-			content = strings.Join(answer.TXT, " ")
-		case *dnsmessage.AAAAResource:
-			content = netip.AddrFrom16(answer.AAAA).String()
-		case *dnsmessage.SRVResource:
-			content = answer.Target.String()
-		case *dnsmessage.UnknownResource:
-			content = answer.Type.String()
-		default:
-			continue
-		}
-		rType := formatDNSType(rawAnswer.Header.Type)
-		if rType == "" {
-			logger.InfoContext(ctx, "exchanged ", domain, " ", rType)
-		} else {
-			logger.InfoContext(ctx, "exchanged ", domain, " ", rType, " ", content)
-		}
+func LogDNSAnswers(logger log.ContextLogger, ctx context.Context, domain string, answers []mDNS.RR) {
+	for _, answer := range answers {
+		logger.InfoContext(ctx, "exchanged ", domain, " ", mDNS.Type(answer.Header().Rrtype).String(), " ", formatQuestion(answer.String()))
 	}
 }
 
-func formatDNSQuestion(question dnsmessage.Question) string {
-	var qType string
-	qType = question.Type.String()
-	if len(qType) > 4 {
-		qType = qType[4:]
+func fqdnToDomain(fqdn string) string {
+	if mDNS.IsFqdn(fqdn) {
+		return fqdn[:len(fqdn)-1]
 	}
-	var qClass string
-	qClass = question.Class.String()
-	if len(qClass) > 5 {
-		qClass = qClass[5:]
-	}
-	return string(question.Name.Data[:question.Name.Length-1]) + " " + qType + " " + qClass
+	return fqdn
 }
 
-func formatDNSType(qType dnsmessage.Type) string {
-	qTypeName := qType.String()
-	if len(qTypeName) > 4 {
-		return qTypeName[4:]
-	} else {
-		return F.ToString("unknown (type ", qTypeName, ")")
+func formatQuestion(string string) string {
+	if strings.HasPrefix(string, ";") {
+		string = string[1:]
 	}
+	string = strings.ReplaceAll(string, "\t", " ")
+	for strings.Contains(string, "  ") {
+		string = strings.ReplaceAll(string, "  ", " ")
+	}
+	return string
 }

route/rule.go

@@ -41,7 +41,9 @@ var _ adapter.Rule = (*DefaultRule)(nil)
 type DefaultRule struct {
 	items                   []RuleItem
 	sourceAddressItems      []RuleItem
+	sourcePortItems         []RuleItem
 	destinationAddressItems []RuleItem
+	destinationPortItems    []RuleItem
 	allItems                []RuleItem
 	invert                  bool
 	outbound                string
@@ -143,7 +145,7 @@ func NewDefaultRule(router adapter.Router, logger log.ContextLogger, options opt
 	}
 	if len(options.SourcePort) > 0 {
 		item := NewPortItem(true, options.SourcePort)
-		rule.items = append(rule.items, item)
+		rule.sourcePortItems = append(rule.sourcePortItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.SourcePortRange) > 0 {
@@ -151,12 +153,12 @@ func NewDefaultRule(router adapter.Router, logger log.ContextLogger, options opt
 		if err != nil {
 			return nil, E.Cause(err, "source_port_range")
 		}
-		rule.items = append(rule.items, item)
+		rule.sourcePortItems = append(rule.sourcePortItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.Port) > 0 {
 		item := NewPortItem(false, options.Port)
-		rule.items = append(rule.items, item)
+		rule.destinationPortItems = append(rule.destinationPortItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.PortRange) > 0 {
@@ -164,7 +166,7 @@ func NewDefaultRule(router adapter.Router, logger log.ContextLogger, options opt
 		if err != nil {
 			return nil, E.Cause(err, "port_range")
 		}
-		rule.items = append(rule.items, item)
+		rule.destinationPortItems = append(rule.destinationPortItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.ProcessName) > 0 {
@@ -256,6 +258,19 @@ func (r *DefaultRule) Match(metadata *adapter.InboundContext) bool {
 		}
 	}
 
+	if len(r.sourcePortItems) > 0 {
+		var sourcePortMatch bool
+		for _, item := range r.sourcePortItems {
+			if item.Match(metadata) {
+				sourcePortMatch = true
+				break
+			}
+		}
+		if !sourcePortMatch {
+			return r.invert
+		}
+	}
+
 	if len(r.destinationAddressItems) > 0 {
 		var destinationAddressMatch bool
 		for _, item := range r.destinationAddressItems {
@@ -269,6 +284,19 @@ func (r *DefaultRule) Match(metadata *adapter.InboundContext) bool {
 		}
 	}
 
+	if len(r.destinationPortItems) > 0 {
+		var destinationPortMatch bool
+		for _, item := range r.destinationPortItems {
+			if item.Match(metadata) {
+				destinationPortMatch = true
+				break
+			}
+		}
+		if !destinationPortMatch {
+			return r.invert
+		}
+	}
+
 	return !r.invert
 }
 

route/rule_dns.go

@@ -39,12 +39,15 @@ func NewDNSRule(router adapter.Router, logger log.ContextLogger, options option.
 var _ adapter.DNSRule = (*DefaultDNSRule)(nil)
 
 type DefaultDNSRule struct {
-	items        []RuleItem
-	addressItems []RuleItem
-	allItems     []RuleItem
-	invert       bool
-	outbound     string
-	disableCache bool
+	items                   []RuleItem
+	sourceAddressItems      []RuleItem
+	sourcePortItems         []RuleItem
+	destinationAddressItems []RuleItem
+	destinationPortItems    []RuleItem
+	allItems                []RuleItem
+	invert                  bool
+	outbound                string
+	disableCache            bool
 }
 
 func NewDefaultDNSRule(router adapter.Router, logger log.ContextLogger, options option.DefaultDNSRule) (*DefaultDNSRule, error) {
@@ -90,12 +93,12 @@ func NewDefaultDNSRule(router adapter.Router, logger log.ContextLogger, options
 	}
 	if len(options.Domain) > 0 || len(options.DomainSuffix) > 0 {
 		item := NewDomainItem(options.Domain, options.DomainSuffix)
-		rule.addressItems = append(rule.addressItems, item)
+		rule.destinationAddressItems = append(rule.destinationAddressItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.DomainKeyword) > 0 {
 		item := NewDomainKeywordItem(options.DomainKeyword)
-		rule.addressItems = append(rule.addressItems, item)
+		rule.destinationAddressItems = append(rule.destinationAddressItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.DomainRegex) > 0 {
@@ -103,17 +106,17 @@ func NewDefaultDNSRule(router adapter.Router, logger log.ContextLogger, options
 		if err != nil {
 			return nil, E.Cause(err, "domain_regex")
 		}
-		rule.addressItems = append(rule.addressItems, item)
+		rule.destinationAddressItems = append(rule.destinationAddressItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.Geosite) > 0 {
 		item := NewGeositeItem(router, logger, options.Geosite)
-		rule.addressItems = append(rule.addressItems, item)
+		rule.destinationAddressItems = append(rule.destinationAddressItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.SourceGeoIP) > 0 {
 		item := NewGeoIPItem(router, logger, true, options.SourceGeoIP)
-		rule.items = append(rule.items, item)
+		rule.sourceAddressItems = append(rule.sourceAddressItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.SourceIPCIDR) > 0 {
@@ -121,12 +124,12 @@ func NewDefaultDNSRule(router adapter.Router, logger log.ContextLogger, options
 		if err != nil {
 			return nil, E.Cause(err, "source_ipcidr")
 		}
-		rule.items = append(rule.items, item)
+		rule.sourceAddressItems = append(rule.sourceAddressItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.SourcePort) > 0 {
 		item := NewPortItem(true, options.SourcePort)
-		rule.items = append(rule.items, item)
+		rule.sourcePortItems = append(rule.sourcePortItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.SourcePortRange) > 0 {
@@ -134,12 +137,12 @@ func NewDefaultDNSRule(router adapter.Router, logger log.ContextLogger, options
 		if err != nil {
 			return nil, E.Cause(err, "source_port_range")
 		}
-		rule.items = append(rule.items, item)
+		rule.sourcePortItems = append(rule.sourcePortItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.Port) > 0 {
 		item := NewPortItem(false, options.Port)
-		rule.items = append(rule.items, item)
+		rule.destinationPortItems = append(rule.destinationPortItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.PortRange) > 0 {
@@ -147,7 +150,7 @@ func NewDefaultDNSRule(router adapter.Router, logger log.ContextLogger, options
 		if err != nil {
 			return nil, E.Cause(err, "port_range")
 		}
-		rule.items = append(rule.items, item)
+		rule.destinationPortItems = append(rule.destinationPortItems, item)
 		rule.allItems = append(rule.allItems, item)
 	}
 	if len(options.ProcessName) > 0 {
@@ -230,18 +233,59 @@ func (r *DefaultDNSRule) Match(metadata *adapter.InboundContext) bool {
 			return r.invert
 		}
 	}
-	if len(r.addressItems) > 0 {
-		var addressMatch bool
-		for _, item := range r.addressItems {
+
+	if len(r.sourceAddressItems) > 0 {
+		var sourceAddressMatch bool
+		for _, item := range r.sourceAddressItems {
 			if item.Match(metadata) {
-				addressMatch = true
+				sourceAddressMatch = true
 				break
 			}
 		}
-		if !addressMatch {
+		if !sourceAddressMatch {
 			return r.invert
 		}
 	}
+
+	if len(r.sourcePortItems) > 0 {
+		var sourcePortMatch bool
+		for _, item := range r.sourcePortItems {
+			if item.Match(metadata) {
+				sourcePortMatch = true
+				break
+			}
+		}
+		if !sourcePortMatch {
+			return r.invert
+		}
+	}
+
+	if len(r.destinationAddressItems) > 0 {
+		var destinationAddressMatch bool
+		for _, item := range r.destinationAddressItems {
+			if item.Match(metadata) {
+				destinationAddressMatch = true
+				break
+			}
+		}
+		if !destinationAddressMatch {
+			return r.invert
+		}
+	}
+
+	if len(r.destinationPortItems) > 0 {
+		var destinationPortMatch bool
+		for _, item := range r.destinationPortItems {
+			if item.Match(metadata) {
+				destinationPortMatch = true
+				break
+			}
+		}
+		if !destinationPortMatch {
+			return r.invert
+		}
+	}
+
 	return !r.invert
 }
 

test/config/vmess-mux-client.json

@@ -0,0 +1,41 @@
+{
+  "log": {
+    "loglevel": "debug"
+  },
+  "inbounds": [
+    {
+      "listen": "127.0.0.1",
+      "port": "1080",
+      "protocol": "socks",
+      "settings": {
+        "auth": "noauth",
+        "udp": true,
+        "ip": "127.0.0.1"
+      }
+    }
+  ],
+  "outbounds": [
+    {
+      "protocol": "vmess",
+      "settings": {
+        "vnext": [
+          {
+            "address": "127.0.0.1",
+            "port": 1234,
+            "users": [
+              {
+                "id": "",
+                "alterId": 0,
+                "security": "none",
+                "experiments": ""
+              }
+            ]
+          }
+        ]
+      },
+      "mux": {
+        "enabled": true
+      }
+    }
+  ]
+}

test/go.mod

@@ -10,7 +10,7 @@ require (
 	github.com/docker/docker v20.10.18+incompatible
 	github.com/docker/go-connections v0.4.0
 	github.com/gofrs/uuid v4.3.0+incompatible
-	github.com/sagernet/sing v0.0.0-20220913004915-27ddefbb8921
+	github.com/sagernet/sing v0.0.0-20220916071326-834794b006ea
 	github.com/sagernet/sing-shadowsocks v0.0.0-20220819002358-7461bb09a8f6
 	github.com/spyzhov/ajson v0.7.1
 	github.com/stretchr/testify v1.8.0
@@ -21,9 +21,11 @@ require (
 
 require (
 	berty.tech/go-libtor v1.0.385 // indirect
+	github.com/Dreamacro/clash v1.11.8 // indirect
 	github.com/Microsoft/go-winio v0.5.1 // indirect
 	github.com/ajg/form v1.5.1 // indirect
 	github.com/andybalholm/brotli v1.0.4 // indirect
+	github.com/caddyserver/certmagic v0.17.1 // indirect
 	github.com/cloudflare/circl v1.2.1-0.20220831060716-4cf0150356fc // indirect
 	github.com/cretz/bine v0.2.0 // indirect
 	github.com/database64128/tfo-go v1.1.2 // indirect
@@ -61,17 +63,15 @@ require (
 	github.com/pmezard/go-difflib v1.0.0 // indirect
 	github.com/refraction-networking/utls v1.1.2 // indirect
 	github.com/sagernet/abx-go v0.0.0-20220819185957-dba1257d738e // indirect
-	github.com/sagernet/certmagic v0.0.0-20220819042630-4a57f8b6853a // indirect
 	github.com/sagernet/go-tun2socks v1.16.12-0.20220818015926-16cb67876a61 // indirect
 	github.com/sagernet/netlink v0.0.0-20220905062125-8043b4a9aa97 // indirect
 	github.com/sagernet/quic-go v0.0.0-20220818150011-de611ab3e2bb // indirect
-	github.com/sagernet/shadowsocksr v0.0.0-20220912092645-c9ab93f81bb0 // indirect
-	github.com/sagernet/sing-dns v0.0.0-20220822023312-3e086b06d666 // indirect
-	github.com/sagernet/sing-tun v0.0.0-20220911034209-c7dd5d457e24 // indirect
-	github.com/sagernet/sing-vmess v0.0.0-20220913015714-c4ab86d40e12 // indirect
+	github.com/sagernet/sing-dns v0.0.0-20220915084601-812e0864b45b // indirect
+	github.com/sagernet/sing-tun v0.0.0-20220916073459-0032242c9617 // indirect
+	github.com/sagernet/sing-vmess v0.0.0-20220917033734-9b634758039d // indirect
 	github.com/sagernet/smux v0.0.0-20220831015742-e0f1988e3195 // indirect
 	github.com/sagernet/websocket v0.0.0-20220913015213-615516348b4e // indirect
-	github.com/sirupsen/logrus v1.8.1 // indirect
+	github.com/sirupsen/logrus v1.9.0 // indirect
 	github.com/vishvananda/netns v0.0.0-20211101163701-50045581ed74 // indirect
 	go.etcd.io/bbolt v1.3.6 // indirect
 	go.uber.org/atomic v1.10.0 // indirect
@@ -81,12 +81,12 @@ require (
 	golang.org/x/crypto v0.0.0-20220829220503-c86fa9a7ed90 // indirect
 	golang.org/x/exp v0.0.0-20220722155223-a9213eeb770e // indirect
 	golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4 // indirect
-	golang.org/x/sys v0.0.0-20220909162455-aba9fc2a8ff2 // indirect
+	golang.org/x/sys v0.0.0-20220913120320-3275c407cedc // indirect
 	golang.org/x/text v0.3.7 // indirect
 	golang.org/x/time v0.0.0-20191024005414-555d28b269f0 // indirect
 	golang.org/x/tools v0.1.11-0.20220513221640-090b14e8501f // indirect
 	golang.zx2c4.com/wintun v0.0.0-20211104114900-415007cec224 // indirect
-	golang.zx2c4.com/wireguard v0.0.0-20220904105730-b51010ba13f0 // indirect
+	golang.zx2c4.com/wireguard v0.0.0-20220829161405-d1d08426b27b // indirect
 	google.golang.org/genproto v0.0.0-20210722135532-667f2b7c528f // indirect
 	google.golang.org/grpc v1.49.0 // indirect
 	google.golang.org/protobuf v1.28.1 // indirect

test/go.sum

@@ -5,6 +5,8 @@ cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMT
 github.com/Azure/go-ansiterm v0.0.0-20210617225240-d185dfc1b5a1 h1:UQHMgLO+TxOElx5B5HZ4hJQsoJ/PvUvKRhJHDQXO8P8=
 github.com/Azure/go-ansiterm v0.0.0-20210617225240-d185dfc1b5a1/go.mod h1:xomTg63KZ2rFqZQzSB4Vz2SUXa1BpHTVz9L5PTmPC4E=
 github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
+github.com/Dreamacro/clash v1.11.8 h1:t/sy3/tiihRlvV3SsliYFjj8rKpbLw5IJ2PymiHcwS8=
+github.com/Dreamacro/clash v1.11.8/go.mod h1:LsWCcJFoKuL1C5F2c0m/1690wihTHYSU3J+im09yTwQ=
 github.com/Microsoft/go-winio v0.5.1 h1:aPJp2QD7OOrhO5tQXqQoGSJc+DjDtWTGLOmNyAm6FgY=
 github.com/Microsoft/go-winio v0.5.1/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84=
 github.com/ajg/form v1.5.1 h1:t9c7v8JUKu/XxOGBU0yjNpaMloxGEJhUkqFRq0ibGeU=
@@ -14,6 +16,8 @@ github.com/andybalholm/brotli v1.0.4/go.mod h1:fO7iG3H7G2nSZ7m0zPUDn85XEX2GTukHG
 github.com/antihax/optional v1.0.0/go.mod h1:uupD/76wgC+ih3iEmQUL+0Ugr19nfwCT1kdvxnR2qWY=
 github.com/benbjohnson/clock v1.1.0 h1:Q92kusRqC1XV2MjkWETPvjJVqKetz1OzxZB7mHJLju8=
 github.com/benbjohnson/clock v1.1.0/go.mod h1:J11/hYXuz8f4ySSvYwY0FKfm+ezbsZBKZxNJlLklBHA=
+github.com/caddyserver/certmagic v0.17.1 h1:VrWANhQAj3brK7jAUKyN6XBHg56WsyorI/84Ilq1tCQ=
+github.com/caddyserver/certmagic v0.17.1/go.mod h1:pSS2aZcdKlrTZrb2DKuRafckx20o5Fz1EdDKEB8KOQM=
 github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU=
 github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
 github.com/cloudflare/circl v1.2.1-0.20220831060716-4cf0150356fc h1:307gdRLiZ08dwOIKwc5lAQ19DRFaQQvdhHalyB4Asx8=
@@ -103,8 +107,8 @@ github.com/klauspost/cpuid/v2 v2.1.0/go.mod h1:RVVoqg1df56z8g3pUjL/3lE5UfnlrJX8t
 github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
 github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
 github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
-github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
 github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
+github.com/kr/text v0.2.0 h1:5Nx0Ya0ZqY2ygV366QzturHI13Jq95ApcVaJBhpS+AY=
 github.com/libdns/libdns v0.2.1 h1:Wu59T7wSHRgtA0cfxC+n1c/e+O3upJGWytknkmFEDis=
 github.com/libdns/libdns v0.2.1/go.mod h1:yQCXzk1lEZmmCPa857bnk4TsOiqYasqpyOEeSObbb40=
 github.com/logrusorgru/aurora v2.0.3+incompatible h1:tOpm7WcpBTn4fjmVfgpQq0EfczGlG91VSDkswnjF5A8=
@@ -153,35 +157,31 @@ github.com/refraction-networking/utls v1.1.2/go.mod h1:+D89TUtA8+NKVFj1IXWr0p3tS
 github.com/rogpeppe/fastuuid v1.2.0/go.mod h1:jVj6XXZzXRy/MSR5jhDC/2q6DgLz+nrA6LYCDYWNEvQ=
 github.com/sagernet/abx-go v0.0.0-20220819185957-dba1257d738e h1:5CFRo8FJbCuf5s/eTBdZpmMbn8Fe2eSMLNAYfKanA34=
 github.com/sagernet/abx-go v0.0.0-20220819185957-dba1257d738e/go.mod h1:qbt0dWObotCfcjAJJ9AxtFPNSDUfZF+6dCpgKEOBn/g=
-github.com/sagernet/certmagic v0.0.0-20220819042630-4a57f8b6853a h1:SE3Xn4GOQ+kxbgGa2Xp0H2CCsx1o2pVTt0f+hmfuHH4=
-github.com/sagernet/certmagic v0.0.0-20220819042630-4a57f8b6853a/go.mod h1:Q+ZXyesnkjV5B70B1ixk65ecKrlJ2jz0atv3fPKsVVo=
 github.com/sagernet/go-tun2socks v1.16.12-0.20220818015926-16cb67876a61 h1:5+m7c6AkmAylhauulqN/c5dnh8/KssrE9c93TQrXldA=
 github.com/sagernet/go-tun2socks v1.16.12-0.20220818015926-16cb67876a61/go.mod h1:QUQ4RRHD6hGGHdFMEtR8T2P6GS6R3D/CXKdaYHKKXms=
 github.com/sagernet/netlink v0.0.0-20220905062125-8043b4a9aa97 h1:iL5gZI3uFp0X6EslacyapiRz7LLSJyr4RajF/BhMVyE=
 github.com/sagernet/netlink v0.0.0-20220905062125-8043b4a9aa97/go.mod h1:xLnfdiJbSp8rNqYEdIW/6eDO4mVoogml14Bh2hSiFpM=
 github.com/sagernet/quic-go v0.0.0-20220818150011-de611ab3e2bb h1:wc0yQ+SBn4TaTYRwpwvEm3nc4eRdxk6vtRbouLVZAzk=
 github.com/sagernet/quic-go v0.0.0-20220818150011-de611ab3e2bb/go.mod h1:MIccjRKnPTjWwAOpl+AUGWOkzyTd9tERytudxu+1ra4=
-github.com/sagernet/shadowsocksr v0.0.0-20220912092645-c9ab93f81bb0 h1:lQ4RFWY/wBYmXl/zJJCwQbhiEIbgEqC7j+nhZYkgwmU=
-github.com/sagernet/shadowsocksr v0.0.0-20220912092645-c9ab93f81bb0/go.mod h1:xSHLCsdgy5QIozXFEv6uDgMWzyrRdFFjr3TgL+juu6g=
 github.com/sagernet/sing v0.0.0-20220812082120-05f9836bff8f/go.mod h1:QVsS5L/ZA2Q5UhQwLrn0Trw+msNd/NPGEhBKR/ioWiY=
 github.com/sagernet/sing v0.0.0-20220817130738-ce854cda8522/go.mod h1:QVsS5L/ZA2Q5UhQwLrn0Trw+msNd/NPGEhBKR/ioWiY=
-github.com/sagernet/sing v0.0.0-20220913004915-27ddefbb8921 h1:xUHzlIbdlPV/fkToIO9futp9lmKIY+72ezk/whQ8XsI=
-github.com/sagernet/sing v0.0.0-20220913004915-27ddefbb8921/go.mod h1:kZvzh1VDa/Dg/Bt5WaYKU0jl5ept8KKDpl3Ay4gRtRQ=
-github.com/sagernet/sing-dns v0.0.0-20220822023312-3e086b06d666 h1:XUTocA/Ek0dFxUX+xJCWMPPFZCn2GC/uLrBjTSr1vHY=
-github.com/sagernet/sing-dns v0.0.0-20220822023312-3e086b06d666/go.mod h1:eDyH7AJmqBGjZQdQmpZIzlbTREudZuWDExMuGKgjRVM=
+github.com/sagernet/sing v0.0.0-20220916071326-834794b006ea h1:ZAWvZdeByPBBz3Vs+w3Erbh+DDo7D4biokoPhXl0nNU=
+github.com/sagernet/sing v0.0.0-20220916071326-834794b006ea/go.mod h1:x3NHUeJBQwV75L51zwmLKQdLtRvR+M4PmXkfQtU1vIY=
+github.com/sagernet/sing-dns v0.0.0-20220915084601-812e0864b45b h1:cXCMNJ9heZ+c6l+qUcku60x9KyXo4SOAaJfg/6spOmU=
+github.com/sagernet/sing-dns v0.0.0-20220915084601-812e0864b45b/go.mod h1:SrvWLfOSlnFmH32CWXicfilAGgIXR0VjrH6yRbuXYww=
 github.com/sagernet/sing-shadowsocks v0.0.0-20220819002358-7461bb09a8f6 h1:JJfDeYYhWunvtxsU/mOVNTmFQmnzGx9dY034qG6G3g4=
 github.com/sagernet/sing-shadowsocks v0.0.0-20220819002358-7461bb09a8f6/go.mod h1:EX3RbZvrwAkPI2nuGa78T2iQXmrkT+/VQtskjou42xM=
-github.com/sagernet/sing-tun v0.0.0-20220911034209-c7dd5d457e24 h1:LsmPeFvj4GhiV5Y7Rm8I845XysdxVN4MQmfZ36P5bmw=
-github.com/sagernet/sing-tun v0.0.0-20220911034209-c7dd5d457e24/go.mod h1:5AhPUv9jWDQ3pv3Mj78SL/1TSjhoaj6WNASxRKLqXqM=
-github.com/sagernet/sing-vmess v0.0.0-20220913015714-c4ab86d40e12 h1:4HYGbTDDemgBVTmaspXbkgjJlXc3hYVjNxSddJndq8Y=
-github.com/sagernet/sing-vmess v0.0.0-20220913015714-c4ab86d40e12/go.mod h1:u66Vv7NHXJWfeAmhh7JuJp/cwxmuQlM56QoZ7B7Mmd0=
+github.com/sagernet/sing-tun v0.0.0-20220916073459-0032242c9617 h1:fNTNmylhB/UjoBLusmrFu2B1fat4OCkDkQXTgrE7ZsE=
+github.com/sagernet/sing-tun v0.0.0-20220916073459-0032242c9617/go.mod h1:5AhPUv9jWDQ3pv3Mj78SL/1TSjhoaj6WNASxRKLqXqM=
+github.com/sagernet/sing-vmess v0.0.0-20220917033734-9b634758039d h1:/GNWxSrQj4chFYk2jahIXNPdvUa9DW8IdgyqYFbq9oQ=
+github.com/sagernet/sing-vmess v0.0.0-20220917033734-9b634758039d/go.mod h1:u66Vv7NHXJWfeAmhh7JuJp/cwxmuQlM56QoZ7B7Mmd0=
 github.com/sagernet/smux v0.0.0-20220831015742-e0f1988e3195 h1:5VBIbVw9q7aKbrFdT83mjkyvQ+VaRsQ6yflTepfln38=
 github.com/sagernet/smux v0.0.0-20220831015742-e0f1988e3195/go.mod h1:yedWtra8nyGJ+SyI+ziwuaGMzBatbB10P1IOOZbbSK8=
 github.com/sagernet/websocket v0.0.0-20220913015213-615516348b4e h1:7uw2njHFGE+VpWamge6o56j2RWk4omF6uLKKxMmcWvs=
 github.com/sagernet/websocket v0.0.0-20220913015213-615516348b4e/go.mod h1:45TUl8+gH4SIKr4ykREbxKWTxkDlSzFENzctB1dVRRY=
 github.com/sirupsen/logrus v1.7.0/go.mod h1:yWOB1SBYBC5VeMP7gHvWumXLIWorT60ONWic61uBYv0=
-github.com/sirupsen/logrus v1.8.1 h1:dJKuHgqk1NNQlqoA6BTlM1Wf9DOH3NBjQyu0h9+AZZE=
-github.com/sirupsen/logrus v1.8.1/go.mod h1:yWOB1SBYBC5VeMP7gHvWumXLIWorT60ONWic61uBYv0=
+github.com/sirupsen/logrus v1.9.0 h1:trlNQbNUG3OdDrDil03MCb1H2o9nJ1x4/5LYw7byDE0=
+github.com/sirupsen/logrus v1.9.0/go.mod h1:naHLuLoDiP4jHNo9R0sCBMtWGeIprob74mVsIT4qYEQ=
 github.com/spf13/pflag v1.0.3/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4=
 github.com/spyzhov/ajson v0.7.1 h1:1MDIlPc6x0zjNtpa7tDzRAyFAvRX+X8ZsvtYz5lZg6A=
 github.com/spyzhov/ajson v0.7.1/go.mod h1:63V+CGM6f1Bu/p4nLIN8885ojBdt88TbLoSFzyqMuVA=
@@ -218,7 +218,6 @@ golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACk
 golang.org/x/crypto v0.0.0-20190404164418-38d8ce5564a5/go.mod h1:WFFai1msRO1wXaEeE5yQxYXgSfI8pQAWXbQop6sCtWE=
 golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
 golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
-golang.org/x/crypto v0.0.0-20201203163018-be400aefbc4c/go.mod h1:jdWPYTVW3xRLrWPugEBEK3UY2ZEsg3UU495nc5E+M+I=
 golang.org/x/crypto v0.0.0-20210513164829-c07d793c2f9a/go.mod h1:P+XmwS30IXTQdn5tA2iutPOUgjI07+tq3H3K9MVA1s8=
 golang.org/x/crypto v0.0.0-20211108221036-ceb1ce70b4fa/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc=
 golang.org/x/crypto v0.0.0-20220829220503-c86fa9a7ed90 h1:Y/gsMcFOcR+6S6f3YeMKl5g+dZMEWqcz5Czj/GWYbkM=
@@ -266,8 +265,8 @@ golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJ
 golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
-golang.org/x/sync v0.0.0-20210220032951-036812b2e83c h1:5KslGYwFpkhGh+Q16bwMP3cOontH8FOep7tGV86Y7SQ=
 golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20220819030929-7fc1605a5dde h1:ejfdSekXMDxDLbRrJMwUk6KnSLZ2McaUCVcIKM+N6jc=
 golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
 golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
 golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
@@ -295,10 +294,10 @@ golang.org/x/sys v0.0.0-20210630005230-0f9fa26af87c/go.mod h1:oPkhp1MJrh7nUepCBc
 golang.org/x/sys v0.0.0-20220412211240-33da011f77ad/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220704084225-05e143d24a9e/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20220715151400-c0bba94af5f8/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220731174439-a90be440212d/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
-golang.org/x/sys v0.0.0-20220909162455-aba9fc2a8ff2 h1:wM1k/lXfpc5HdkJJyW9GELpd8ERGdnh8sMGL6Gzq3Ho=
-golang.org/x/sys v0.0.0-20220909162455-aba9fc2a8ff2/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
-golang.org/x/term v0.0.0-20201117132131-f5c789dd3221/go.mod h1:Nr5EML6q2oocZ2LXRh80K7BxOlk5/8JxuGnuhpl+muw=
+golang.org/x/sys v0.0.0-20220913120320-3275c407cedc h1:dpclq5m2YrqPGStKmtw7IcNbKLfbIqKXvNxDJKdIKYc=
+golang.org/x/sys v0.0.0-20220913120320-3275c407cedc/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo=
 golang.org/x/term v0.0.0-20210927222741-03fcf44c2211 h1:JGgROgKl9N8DuW20oFS5gxc+lE67/N3FcwmBPMe7ArY=
 golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
@@ -334,8 +333,8 @@ golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8T
 golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
 golang.zx2c4.com/wintun v0.0.0-20211104114900-415007cec224 h1:Ug9qvr1myri/zFN6xL17LSCBGFDnphBBhzmILHsM5TY=
 golang.zx2c4.com/wintun v0.0.0-20211104114900-415007cec224/go.mod h1:deeaetjYA+DHMHg+sMSMI58GrEteJUUzzw7en6TJQcI=
-golang.zx2c4.com/wireguard v0.0.0-20220904105730-b51010ba13f0 h1:5ZkdpbduT/g+9OtbSDvbF3KvfQG45CtH/ppO8FUmvCQ=
-golang.zx2c4.com/wireguard v0.0.0-20220904105730-b51010ba13f0/go.mod h1:enML0deDxY1ux+B6ANGiwtg0yAJi1rctkTpcHNAVPyg=
+golang.zx2c4.com/wireguard v0.0.0-20220829161405-d1d08426b27b h1:qgrKnOfe1zyURRNdmDlGbN32i38Zjmw0B1+TMdHcOvg=
+golang.zx2c4.com/wireguard v0.0.0-20220829161405-d1d08426b27b/go.mod h1:6y4CqPAy54NwiN4nC8K+R1eMpQDB1P2d25qmunh2RSA=
 google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
 google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
 google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=

test/hysteria_test.go

@@ -114,7 +114,7 @@ func TestHysteriaInbound(t *testing.T) {
 			caPem:                  "/etc/hysteria/ca.pem",
 		},
 	})
-	testSuit(t, clientPort, testPort)
+	testSuitSimple1(t, clientPort, testPort)
 }
 
 func TestHysteriaOutbound(t *testing.T) {
@@ -162,5 +162,5 @@ func TestHysteriaOutbound(t *testing.T) {
 			},
 		},
 	})
-	testSuit(t, clientPort, testPort)
+	testSuitSimple1(t, clientPort, testPort)
 }

test/mux_cool_test.go

@@ -0,0 +1,109 @@
+package main
+
+import (
+	"net/netip"
+	"os"
+	"testing"
+
+	C "github.com/sagernet/sing-box/constant"
+	"github.com/sagernet/sing-box/option"
+
+	"github.com/spyzhov/ajson"
+	"github.com/stretchr/testify/require"
+)
+
+func TestMuxCoolServer(t *testing.T) {
+	userId := newUUID()
+	content, err := os.ReadFile("config/vmess-mux-client.json")
+	require.NoError(t, err)
+	config, err := ajson.Unmarshal(content)
+	require.NoError(t, err)
+
+	config.MustKey("inbounds").MustIndex(0).MustKey("port").SetNumeric(float64(clientPort))
+	outbound := config.MustKey("outbounds").MustIndex(0).MustKey("settings").MustKey("vnext").MustIndex(0)
+	outbound.MustKey("port").SetNumeric(float64(serverPort))
+	user := outbound.MustKey("users").MustIndex(0)
+	user.MustKey("id").SetString(userId.String())
+
+	content, err = ajson.Marshal(config)
+	require.NoError(t, err)
+
+	startDockerContainer(t, DockerOptions{
+		Image:      ImageV2RayCore,
+		Ports:      []uint16{serverPort, testPort},
+		EntryPoint: "v2ray",
+		Stdin:      content,
+	})
+
+	startInstance(t, option.Options{
+		Inbounds: []option.Inbound{
+			{
+				Type: C.TypeVMess,
+				VMessOptions: option.VMessInboundOptions{
+					ListenOptions: option.ListenOptions{
+						Listen:     option.ListenAddress(netip.IPv4Unspecified()),
+						ListenPort: serverPort,
+					},
+					Users: []option.VMessUser{
+						{
+							Name: "sekai",
+							UUID: userId.String(),
+						},
+					},
+				},
+			},
+		},
+	})
+
+	testSuit(t, clientPort, testPort)
+}
+
+func TestMuxCoolClient(t *testing.T) {
+	user := newUUID()
+	content, err := os.ReadFile("config/vmess-server.json")
+	require.NoError(t, err)
+	config, err := ajson.Unmarshal(content)
+	require.NoError(t, err)
+
+	inbound := config.MustKey("inbounds").MustIndex(0)
+	inbound.MustKey("port").SetNumeric(float64(serverPort))
+	inbound.MustKey("settings").MustKey("clients").MustIndex(0).MustKey("id").SetString(user.String())
+
+	content, err = ajson.Marshal(config)
+	require.NoError(t, err)
+
+	startDockerContainer(t, DockerOptions{
+		Image:      ImageXRayCore,
+		Ports:      []uint16{serverPort, testPort},
+		EntryPoint: "xray",
+		Stdin:      content,
+	})
+
+	startInstance(t, option.Options{
+		Inbounds: []option.Inbound{
+			{
+				Type: C.TypeMixed,
+				MixedOptions: option.HTTPMixedInboundOptions{
+					ListenOptions: option.ListenOptions{
+						Listen:     option.ListenAddress(netip.IPv4Unspecified()),
+						ListenPort: clientPort,
+					},
+				},
+			},
+		},
+		Outbounds: []option.Outbound{
+			{
+				Type: C.TypeVMess,
+				VMessOptions: option.VMessOutboundOptions{
+					ServerOptions: option.ServerOptions{
+						Server:     "127.0.0.1",
+						ServerPort: serverPort,
+					},
+					UUID:           user.String(),
+					PacketEncoding: "xudp",
+				},
+			},
+		},
+	})
+	testSuit(t, clientPort, testPort)
+}

test/v2ray_transport_test.go

@@ -266,7 +266,7 @@ func TestVMessQUICSelf(t *testing.T) {
 			},
 		},
 	})
-	testSuit(t, clientPort, testPort)
+	testSuitSimple1(t, clientPort, testPort)
 }
 
 func testV2RayTransportNOTLSSelf(t *testing.T, transport *option.V2RayTransportOptions) {

test/vmess_test.go

@@ -306,7 +306,7 @@ func testVMessSelf(t *testing.T, security string, alterId int, globalPadding boo
 					AlterId:             alterId,
 					GlobalPadding:       globalPadding,
 					AuthenticatedLength: authenticatedLength,
-					PacketAddr:          packetAddr,
+					PacketEncoding:      "packetaddr",
 				},
 			},
 		},

transport/clashssr/obfs/base.go

@@ -0,0 +1,9 @@
+package obfs
+
+type Base struct {
+	Host   string
+	Port   int
+	Key    []byte
+	IVSize int
+	Param  string
+}

transport/clashssr/obfs/http_post.go

@@ -0,0 +1,9 @@
+package obfs
+
+func init() {
+	register("http_post", newHTTPPost, 0)
+}
+
+func newHTTPPost(b *Base) Obfs {
+	return &httpObfs{Base: b, post: true}
+}

transport/clashssr/obfs/http_simple.go

@@ -0,0 +1,405 @@
+package obfs
+
+import (
+	"bytes"
+	"encoding/hex"
+	"io"
+	"math/rand"
+	"net"
+	"strconv"
+	"strings"
+
+	"github.com/Dreamacro/clash/common/pool"
+)
+
+func init() {
+	register("http_simple", newHTTPSimple, 0)
+}
+
+type httpObfs struct {
+	*Base
+	post bool
+}
+
+func newHTTPSimple(b *Base) Obfs {
+	return &httpObfs{Base: b}
+}
+
+type httpConn struct {
+	net.Conn
+	*httpObfs
+	hasSentHeader bool
+	hasRecvHeader bool
+	buf           []byte
+}
+
+func (h *httpObfs) StreamConn(c net.Conn) net.Conn {
+	return &httpConn{Conn: c, httpObfs: h}
+}
+
+func (c *httpConn) Read(b []byte) (int, error) {
+	if c.buf != nil {
+		n := copy(b, c.buf)
+		if n == len(c.buf) {
+			c.buf = nil
+		} else {
+			c.buf = c.buf[n:]
+		}
+		return n, nil
+	}
+
+	if c.hasRecvHeader {
+		return c.Conn.Read(b)
+	}
+
+	buf := pool.Get(pool.RelayBufferSize)
+	defer pool.Put(buf)
+	n, err := c.Conn.Read(buf)
+	if err != nil {
+		return 0, err
+	}
+	pos := bytes.Index(buf[:n], []byte("\r\n\r\n"))
+	if pos == -1 {
+		return 0, io.EOF
+	}
+	c.hasRecvHeader = true
+	dataLength := n - pos - 4
+	n = copy(b, buf[4+pos:n])
+	if dataLength > n {
+		c.buf = append(c.buf, buf[4+pos+n:4+pos+dataLength]...)
+	}
+	return n, nil
+}
+
+func (c *httpConn) Write(b []byte) (int, error) {
+	if c.hasSentHeader {
+		return c.Conn.Write(b)
+	}
+	// 30: head length
+	headLength := c.IVSize + 30
+
+	bLength := len(b)
+	headDataLength := bLength
+	if bLength-headLength > 64 {
+		headDataLength = headLength + rand.Intn(65)
+	}
+	headData := b[:headDataLength]
+	b = b[headDataLength:]
+
+	var body string
+	host := c.Host
+	if len(c.Param) > 0 {
+		pos := strings.Index(c.Param, "#")
+		if pos != -1 {
+			body = strings.ReplaceAll(c.Param[pos+1:], "\n", "\r\n")
+			body = strings.ReplaceAll(body, "\\n", "\r\n")
+			host = c.Param[:pos]
+		} else {
+			host = c.Param
+		}
+	}
+	hosts := strings.Split(host, ",")
+	host = hosts[rand.Intn(len(hosts))]
+
+	buf := pool.GetBuffer()
+	defer pool.PutBuffer(buf)
+	if c.post {
+		buf.WriteString("POST /")
+	} else {
+		buf.WriteString("GET /")
+	}
+	packURLEncodedHeadData(buf, headData)
+	buf.WriteString(" HTTP/1.1\r\nHost: " + host)
+	if c.Port != 80 {
+		buf.WriteString(":" + strconv.Itoa(c.Port))
+	}
+	buf.WriteString("\r\n")
+	if len(body) > 0 {
+		buf.WriteString(body + "\r\n\r\n")
+	} else {
+		buf.WriteString("User-Agent: ")
+		buf.WriteString(userAgent[rand.Intn(len(userAgent))])
+		buf.WriteString("\r\nAccept: text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8\r\nAccept-Language: en-US,en;q=0.8\r\nAccept-Encoding: gzip, deflate\r\n")
+		if c.post {
+			packBoundary(buf)
+		}
+		buf.WriteString("DNT: 1\r\nConnection: keep-alive\r\n\r\n")
+	}
+	buf.Write(b)
+	_, err := c.Conn.Write(buf.Bytes())
+	if err != nil {
+		return 0, nil
+	}
+	c.hasSentHeader = true
+	return bLength, nil
+}
+
+func packURLEncodedHeadData(buf *bytes.Buffer, data []byte) {
+	dataLength := len(data)
+	for i := 0; i < dataLength; i++ {
+		buf.WriteRune('%')
+		buf.WriteString(hex.EncodeToString(data[i : i+1]))
+	}
+}
+
+func packBoundary(buf *bytes.Buffer) {
+	buf.WriteString("Content-Type: multipart/form-data; boundary=")
+	set := "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789"
+	for i := 0; i < 32; i++ {
+		buf.WriteByte(set[rand.Intn(62)])
+	}
+	buf.WriteString("\r\n")
+}
+
+var userAgent = []string{
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/65.0.3325.162 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/45.0.2454.85 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.0; Moto C Build/NRD90M.059) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/68.0.3440.106 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.102 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0.1; SM-G532M Build/MMB29T; wv) AppleWebKit/537.36 (KHTML, like Gecko) Version/4.0 Chrome/55.0.2883.91 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.2; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/46.0.2490.80 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/41.0.2272.101 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.2; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.102 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/40.0.2214.111 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/62.0.3202.94 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 5.1.1; SM-J120M Build/LMY47X) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/46.0.2490.80 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.0; Moto G (5) Build/NPPS25.137-93-14) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.2; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/51.0.2704.106 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/65.0.3325.181 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.0; SM-G570M) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.80 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 5.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/46.0.2490.80 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.102 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/49.0.2623.112 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0; CAM-L03 Build/HUAWEICAM-L03) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/41.0.2272.76 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/66.0.3359.117 Safari/537.36",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US) AppleWebKit/534.3 (KHTML, like Gecko) Chrome/6.0.472.63 Safari/534.3",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/55.0.2883.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.102 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/47.0.2526.106 Safari/537.36",
+	"Mozilla/5.0 (Windows; U; Windows NT 6.1; en-US) AppleWebKit/534.7 (KHTML, like Gecko) Chrome/7.0.517.44 Safari/534.7",
+	"Mozilla/5.0 (Windows NT 6.3; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/52.0.2743.116 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/68.0.3440.75 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/54.0.2840.71 Safari/537.36",
+	"Mozilla/5.0 (Windows; U; Windows NT 6.1; en-US) AppleWebKit/534.3 (KHTML, like Gecko) Chrome/6.0.472.63 Safari/534.3",
+	"Mozilla/5.0 (Linux; Android 8.0.0; FIG-LX3) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.80 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/40.0.2214.115 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/52.0.2743.116 Safari/537.36",
+	"Mozilla/5.0 (Windows; U; Windows NT 6.1; en-US) AppleWebKit/534.10 (KHTML, like Gecko) Chrome/8.0.552.237 Safari/534.10",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/60.0.3112.90 Safari/537.36",
+	"Mozilla/5.0 (X11; U; Linux x86_64; en-US) AppleWebKit/533.2 (KHTML, like Gecko) Chrome/5.0.342.1 Safari/533.2",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.102 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/49.0.2623.110 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/62.0.3202.89 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/58.0.3029.81 Safari/537.36",
+	"Mozilla/5.0 (X11; Datanyze; Linux x86_64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/65.0.3325.181 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/63.0.3239.132 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/54.0.2840.71 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/35.0.1916.153 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 5.1.1; SM-J111M Build/LMY47V) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/57.0.2987.133 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/51.0.2704.106 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/65.0.3325.181 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/37.0.2062.120 Safari/537.36",
+	"Mozilla/5.0 (Macintosh; Intel Mac OS X 10_13_6) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/63.0.3239.84 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/54.0.2840.99 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/32.0.1700.107 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0.1; SM-J700M Build/MMB29K) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/51.0.2704.63 Safari/537.36",
+	"Mozilla/5.0 (X11; Linux i686) AppleWebKit/534.30 (KHTML, like Gecko) Slackware/Chrome/12.0.742.100 Safari/534.30",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/46.0.2490.86 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/64.0.3282.167 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/48.0.2564.116 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/50.0.2661.102 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/53.0.2785.143 Safari/537.36",
+	"Mozilla/5.0 (X11; Linux i686) AppleWebKit/534.30 (KHTML, like Gecko) Chrome/12.0.742.100 Safari/534.30",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 8.0.0; WAS-LX3 Build/HUAWEIWAS-LX3) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/54.0.2840.99 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/57.0.2987.133 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/49.0.2623.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/50.0.2661.102 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/31.0.1650.57 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/67.0.3396.99 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/60.0.3112.101 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/68.0.3440.1805 Safari/537.36 MVisionPlayer/1.0.0.0",
+	"Mozilla/5.0 (Linux; Android 7.0; TRT-LX3 Build/HUAWEITRT-LX3) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Macintosh; Intel Mac OS X 10_10_3) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/41.0.2272.89 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0; vivo 1610 Build/MMB29M) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/53.0.2785.124 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.2; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/56.0.2924.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/67.0.3396.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/57.0.2987.133 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/47.0.2526.111 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 4.4.2; de-de; SAMSUNG GT-I9195 Build/KOT49H) AppleWebKit/537.36 (KHTML, like Gecko) Version/1.5 Chrome/28.0.1500.94 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.110 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/39.0.2171.95 Safari/537.36",
+	"Mozilla/5.0 (Macintosh; Intel Mac OS X 10_10_3) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/42.0.2311.90 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/49.0.2623.110 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 8.0.0; ANE-LX3 Build/HUAWEIANE-LX3) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/49.0.2623.112 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/56.0.2924.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/49.0.2623.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/53.0.2785.143 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/56.0.2924.87 Safari/537.36",
+	"Mozilla/5.0 (X11; U; Linux i586; en-US) AppleWebKit/533.2 (KHTML, like Gecko) Chrome/5.0.342.1 Safari/533.2",
+	"Mozilla/5.0 (Windows NT 6.3; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/43.0.2357.65 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.0; SM-G610M) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.80 Mobile Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0.1; SM-J500M Build/MMB29M) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US) AppleWebKit/534.7 (KHTML, like Gecko) Chrome/7.0.517.44 Safari/534.7",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/41.0.2272.104 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/59.0.3071.115 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/56.0.2924.87 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0; vivo 1606 Build/MMB29M) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/53.0.2785.124 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/55.0.2883.87 Safari/537.36",
+	"Mozilla/5.0 (X11; Linux x86_64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/42.0.2311.135 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.0; SM-G610M Build/NRD90M) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.1; vivo 1716 Build/N2G47H) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/61.0.3163.98 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/56.0.2924.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/55.0.2883.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/45.0.2454.93 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.0; SM-G570M Build/NRD90M) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/60.0.3112.90 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0; MYA-L22 Build/HUAWEIMYA-L22) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/62.0.3202.84 Mobile Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 5.1; A1601 Build/LMY47I) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/52.0.2743.98 Mobile Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.0; TRT-LX2 Build/HUAWEITRT-LX2; wv) AppleWebKit/537.36 (KHTML, like Gecko) Version/4.0 Chrome/59.0.3071.125 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.2; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/55.0.2883.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/55.0.2883.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 5.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/55.0.2883.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.102 Safari/537.36",
+	"Mozilla/5.0 (Windows; U; Windows NT 6.1; en-US) AppleWebKit/534.17 (KHTML, like Gecko) Chrome/10.0.649.0 Safari/534.17",
+	"Mozilla/5.0 (Linux; Android 6.0; CAM-L21 Build/HUAWEICAM-L21; wv) AppleWebKit/537.36 (KHTML, like Gecko) Version/4.0 Chrome/62.0.3202.84 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/62.0.3202.94 Safari/537.36",
+	"Mozilla/5.0 (X11; Linux x86_64) AppleWebKit/534.24 (KHTML, like Gecko) Chrome/11.0.696.3 Safari/534.24",
+	"Mozilla/5.0 (Linux; Android 7.1.2; Redmi 4X Build/N2G47H) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/63.0.3239.111 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/51.0.2704.106 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/66.0.3359.181 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 4.4.2; SM-G7102 Build/KOT49H) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/62.0.3202.84 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/48.0.2564.109 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 5.1; HUAWEI CUN-L22 Build/HUAWEICUN-L22; wv) AppleWebKit/537.36 (KHTML, like Gecko) Version/4.0 Chrome/62.0.3202.84 Mobile Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 5.1.1; A37fw Build/LMY47V) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/62.0.3202.84 Mobile Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.0; SM-J730GM Build/NRD90M) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/63.0.3239.111 Mobile Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.0; SM-G610F Build/NRD90M) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/63.0.3239.111 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/41.0.2272.101 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.1.2; Redmi Note 5A Build/N2G47H; wv) AppleWebKit/537.36 (KHTML, like Gecko) Version/4.0 Chrome/63.0.3239.111 Mobile Safari/537.36",
+	"Mozilla/5.0 (Macintosh; Intel Mac OS X 10_14_1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.77 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.0; Redmi Note 4 Build/NRD90M) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/63.0.3239.111 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/47.0.2526.106 Safari/537.36",
+	"Mozilla/5.0 (Unknown; Linux) AppleWebKit/538.1 (KHTML, like Gecko) Chrome/v1.0.0 Safari/538.1",
+	"Mozilla/5.0 (Linux; Android 7.0; BLL-L22 Build/HUAWEIBLL-L22) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/55.0.2883.91 Mobile Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.0; SM-J710F Build/NRD90M) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/62.0.3202.84 Mobile Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0.1; SM-G532M Build/MMB29T) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/55.0.2883.91 Mobile Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.1.1; CPH1723 Build/N6F26Q) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/61.0.3163.98 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/41.0.2272.118 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/61.0.3163.79 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/45.0.2454.101 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/50.0.2661.94 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/66.0.3359.139 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 8.0.0; FIG-LX3 Build/HUAWEIFIG-LX3) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows; U; Windows NT 6.1; de-DE) AppleWebKit/534.17 (KHTML, like Gecko) Chrome/10.0.649.0 Safari/534.17",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/52.0.2743.116 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/51.0.2704.63 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/41.0.2228.0 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.67 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/62.0.3202.94 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.110 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/67.0.3396.99 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/54.0.2840.99 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.67 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/58.0.3029.110 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.67 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.77 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.67 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/43.0.2357.65 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 7.1; Mi A1 Build/N2G47H) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/58.0.3029.83 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/66.0.3359.117 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/57.0.2987.133 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/65.0.3325.181 Safari/537.36",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US) AppleWebKit/533.4 (KHTML, like Gecko) Chrome/5.0.375.99 Safari/533.4",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/36.0.1985.125 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/62.0.3202.89 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/47.0.2526.111 Safari/537.36 MVisionPlayer/1.0.0.0",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/51.0.2704.103 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 5.1; A37f Build/LMY47V) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/43.0.2357.93 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/63.0.3239.132 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/56.0.2924.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/57.0.2987.133 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/60.0.3112.113 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.2; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/57.0.2987.133 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/61.0.3163.100 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/46.0.2490.86 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.110 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/41.0.2272.76 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/55.0.2883.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 5.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/57.0.2987.133 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.77 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.102 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/46.0.2490.80 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0.1; CPH1607 Build/MMB29M; wv) AppleWebKit/537.36 (KHTML, like Gecko) Version/4.0 Chrome/63.0.3239.111 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/54.0.2840.99 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/39.0.2171.95 Safari/537.36",
+	"Mozilla/5.0 (Macintosh; Intel Mac OS X 10_12_6) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/61.0.3163.100 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0.1; vivo 1603 Build/MMB29M) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/58.0.3029.83 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/64.0.3282.186 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0.1; SM-G532M Build/MMB29T) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/58.0.3029.110 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/67.0.3396.87 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0.1; Redmi 4A Build/MMB29M; wv) AppleWebKit/537.36 (KHTML, like Gecko) Version/4.0 Chrome/60.0.3112.116 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/51.0.2704.103 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.0) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/49.0.2623.112 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/60.0.3112.113 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/60.0.3112.90 Safari/537.36",
+	"Mozilla/5.0 (X11; Linux x86_64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/44.0.2403.157 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 5.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/46.0.2490.71 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 5.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/60.0.3112.90 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.2; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/60.0.3112.90 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/60.0.3112.113 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.2; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/42.0.2311.90 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/63.0.3239.132 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/57.0.2987.133 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/60.0.3112.90 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.77 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/67.0.3396.99 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/61.0.3163.100 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.77 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.102 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.31 (KHTML, like Gecko) Chrome/26.0.1410.64 Safari/537.31",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/63.0.3239.84 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/55.0.2883.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/57.0.2987.133 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/64.0.3282.186 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/59.0.3071.115 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/68.0.3440.106 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/55.0.2883.87 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/46.0.2490.80 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/36.0.1985.143 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 5.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/49.0.2623.112 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.67 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/65.0.3325.181 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/66.0.3359.181 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/67.0.3396.99 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/52.0.2743.116 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/51.0.2704.106 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.3; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/69.0.3497.100 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0.1; SM-G532G Build/MMB29T) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/63.0.3239.83 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/48.0.2564.109 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/66.0.3359.117 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/66.0.3359.139 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.102 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.67 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/34.0.1847.131 Safari/537.36",
+	"Mozilla/5.0 (Linux; Android 6.0; vivo 1713 Build/MRA58K) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/53.0.2785.124 Mobile Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/62.0.3202.89 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/46.0.2490.80 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/41.0.2272.101 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/70.0.3538.67 Safari/537.36",
+	"Mozilla/5.0 (Windows NT 6.1; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/68.0.3440.106 Safari/537.36",
+}

transport/clashssr/obfs/obfs.go

@@ -0,0 +1,42 @@
+package obfs
+
+import (
+	"errors"
+	"fmt"
+	"net"
+)
+
+var (
+	errTLS12TicketAuthIncorrectMagicNumber = errors.New("tls1.2_ticket_auth incorrect magic number")
+	errTLS12TicketAuthTooShortData         = errors.New("tls1.2_ticket_auth too short data")
+	errTLS12TicketAuthHMACError            = errors.New("tls1.2_ticket_auth hmac verifying failed")
+)
+
+type authData struct {
+	clientID [32]byte
+}
+
+type Obfs interface {
+	StreamConn(net.Conn) net.Conn
+}
+
+type obfsCreator func(b *Base) Obfs
+
+var obfsList = make(map[string]struct {
+	overhead int
+	new      obfsCreator
+})
+
+func register(name string, c obfsCreator, o int) {
+	obfsList[name] = struct {
+		overhead int
+		new      obfsCreator
+	}{overhead: o, new: c}
+}
+
+func PickObfs(name string, b *Base) (Obfs, int, error) {
+	if choice, ok := obfsList[name]; ok {
+		return choice.new(b), choice.overhead, nil
+	}
+	return nil, 0, fmt.Errorf("Obfs %s not supported", name)
+}

transport/clashssr/obfs/plain.go

@@ -0,0 +1,15 @@
+package obfs
+
+import "net"
+
+type plain struct{}
+
+func init() {
+	register("plain", newPlain, 0)
+}
+
+func newPlain(b *Base) Obfs {
+	return &plain{}
+}
+
+func (p *plain) StreamConn(c net.Conn) net.Conn { return c }

transport/clashssr/obfs/random_head.go

@@ -0,0 +1,71 @@
+package obfs
+
+import (
+	"encoding/binary"
+	"hash/crc32"
+	"math/rand"
+	"net"
+
+	"github.com/Dreamacro/clash/common/pool"
+)
+
+func init() {
+	register("random_head", newRandomHead, 0)
+}
+
+type randomHead struct {
+	*Base
+}
+
+func newRandomHead(b *Base) Obfs {
+	return &randomHead{Base: b}
+}
+
+type randomHeadConn struct {
+	net.Conn
+	*randomHead
+	hasSentHeader bool
+	rawTransSent  bool
+	rawTransRecv  bool
+	buf           []byte
+}
+
+func (r *randomHead) StreamConn(c net.Conn) net.Conn {
+	return &randomHeadConn{Conn: c, randomHead: r}
+}
+
+func (c *randomHeadConn) Read(b []byte) (int, error) {
+	if c.rawTransRecv {
+		return c.Conn.Read(b)
+	}
+	buf := pool.Get(pool.RelayBufferSize)
+	defer pool.Put(buf)
+	c.Conn.Read(buf)
+	c.rawTransRecv = true
+	c.Write(nil)
+	return 0, nil
+}
+
+func (c *randomHeadConn) Write(b []byte) (int, error) {
+	if c.rawTransSent {
+		return c.Conn.Write(b)
+	}
+	c.buf = append(c.buf, b...)
+	if !c.hasSentHeader {
+		c.hasSentHeader = true
+		dataLength := rand.Intn(96) + 4
+		buf := pool.Get(dataLength + 4)
+		defer pool.Put(buf)
+		rand.Read(buf[:dataLength])
+		binary.LittleEndian.PutUint32(buf[dataLength:], 0xffffffff-crc32.ChecksumIEEE(buf[:dataLength]))
+		_, err := c.Conn.Write(buf)
+		return len(b), err
+	}
+	if c.rawTransRecv {
+		_, err := c.Conn.Write(c.buf)
+		c.buf = nil
+		c.rawTransSent = true
+		return len(b), err
+	}
+	return len(b), nil
+}

transport/clashssr/obfs/tls1.2_ticket_auth.go

@@ -0,0 +1,226 @@
+package obfs
+
+import (
+	"bytes"
+	"crypto/hmac"
+	"encoding/binary"
+	"math/rand"
+	"net"
+	"strings"
+	"time"
+
+	"github.com/Dreamacro/clash/common/pool"
+	"github.com/Dreamacro/clash/transport/ssr/tools"
+)
+
+func init() {
+	register("tls1.2_ticket_auth", newTLS12Ticket, 5)
+	register("tls1.2_ticket_fastauth", newTLS12Ticket, 5)
+}
+
+type tls12Ticket struct {
+	*Base
+	*authData
+}
+
+func newTLS12Ticket(b *Base) Obfs {
+	r := &tls12Ticket{Base: b, authData: &authData{}}
+	rand.Read(r.clientID[:])
+	return r
+}
+
+type tls12TicketConn struct {
+	net.Conn
+	*tls12Ticket
+	handshakeStatus int
+	decoded         bytes.Buffer
+	underDecoded    bytes.Buffer
+	sendBuf         bytes.Buffer
+}
+
+func (t *tls12Ticket) StreamConn(c net.Conn) net.Conn {
+	return &tls12TicketConn{Conn: c, tls12Ticket: t}
+}
+
+func (c *tls12TicketConn) Read(b []byte) (int, error) {
+	if c.decoded.Len() > 0 {
+		return c.decoded.Read(b)
+	}
+
+	buf := pool.Get(pool.RelayBufferSize)
+	defer pool.Put(buf)
+	n, err := c.Conn.Read(buf)
+	if err != nil {
+		return 0, err
+	}
+
+	if c.handshakeStatus == 8 {
+		c.underDecoded.Write(buf[:n])
+		for c.underDecoded.Len() > 5 {
+			if !bytes.Equal(c.underDecoded.Bytes()[:3], []byte{0x17, 3, 3}) {
+				c.underDecoded.Reset()
+				return 0, errTLS12TicketAuthIncorrectMagicNumber
+			}
+			size := int(binary.BigEndian.Uint16(c.underDecoded.Bytes()[3:5]))
+			if c.underDecoded.Len() < 5+size {
+				break
+			}
+			c.underDecoded.Next(5)
+			c.decoded.Write(c.underDecoded.Next(size))
+		}
+		n, _ = c.decoded.Read(b)
+		return n, nil
+	}
+
+	if n < 11+32+1+32 {
+		return 0, errTLS12TicketAuthTooShortData
+	}
+
+	if !hmac.Equal(buf[33:43], c.hmacSHA1(buf[11:33])[:10]) || !hmac.Equal(buf[n-10:n], c.hmacSHA1(buf[:n-10])[:10]) {
+		return 0, errTLS12TicketAuthHMACError
+	}
+
+	c.Write(nil)
+	return 0, nil
+}
+
+func (c *tls12TicketConn) Write(b []byte) (int, error) {
+	length := len(b)
+	if c.handshakeStatus == 8 {
+		buf := pool.GetBuffer()
+		defer pool.PutBuffer(buf)
+		for len(b) > 2048 {
+			size := rand.Intn(4096) + 100
+			if len(b) < size {
+				size = len(b)
+			}
+			packData(buf, b[:size])
+			b = b[size:]
+		}
+		if len(b) > 0 {
+			packData(buf, b)
+		}
+		_, err := c.Conn.Write(buf.Bytes())
+		if err != nil {
+			return 0, err
+		}
+		return length, nil
+	}
+
+	if len(b) > 0 {
+		packData(&c.sendBuf, b)
+	}
+
+	if c.handshakeStatus == 0 {
+		c.handshakeStatus = 1
+
+		data := pool.GetBuffer()
+		defer pool.PutBuffer(data)
+
+		data.Write([]byte{3, 3})
+		c.packAuthData(data)
+		data.WriteByte(0x20)
+		data.Write(c.clientID[:])
+		data.Write([]byte{0x00, 0x1c, 0xc0, 0x2b, 0xc0, 0x2f, 0xcc, 0xa9, 0xcc, 0xa8, 0xcc, 0x14, 0xcc, 0x13, 0xc0, 0x0a, 0xc0, 0x14, 0xc0, 0x09, 0xc0, 0x13, 0x00, 0x9c, 0x00, 0x35, 0x00, 0x2f, 0x00, 0x0a})
+		data.Write([]byte{0x1, 0x0})
+
+		ext := pool.GetBuffer()
+		defer pool.PutBuffer(ext)
+
+		host := c.getHost()
+		ext.Write([]byte{0xff, 0x01, 0x00, 0x01, 0x00})
+		packSNIData(ext, host)
+		ext.Write([]byte{0, 0x17, 0, 0})
+		c.packTicketBuf(ext, host)
+		ext.Write([]byte{0x00, 0x0d, 0x00, 0x16, 0x00, 0x14, 0x06, 0x01, 0x06, 0x03, 0x05, 0x01, 0x05, 0x03, 0x04, 0x01, 0x04, 0x03, 0x03, 0x01, 0x03, 0x03, 0x02, 0x01, 0x02, 0x03})
+		ext.Write([]byte{0x00, 0x05, 0x00, 0x05, 0x01, 0x00, 0x00, 0x00, 0x00})
+		ext.Write([]byte{0x00, 0x12, 0x00, 0x00})
+		ext.Write([]byte{0x75, 0x50, 0x00, 0x00})
+		ext.Write([]byte{0x00, 0x0b, 0x00, 0x02, 0x01, 0x00})
+		ext.Write([]byte{0x00, 0x0a, 0x00, 0x06, 0x00, 0x04, 0x00, 0x17, 0x00, 0x18})
+
+		binary.Write(data, binary.BigEndian, uint16(ext.Len()))
+		data.ReadFrom(ext)
+
+		ret := pool.GetBuffer()
+		defer pool.PutBuffer(ret)
+
+		ret.Write([]byte{0x16, 3, 1})
+		binary.Write(ret, binary.BigEndian, uint16(data.Len()+4))
+		ret.Write([]byte{1, 0})
+		binary.Write(ret, binary.BigEndian, uint16(data.Len()))
+		ret.ReadFrom(data)
+
+		_, err := c.Conn.Write(ret.Bytes())
+		if err != nil {
+			return 0, err
+		}
+		return length, nil
+	} else if c.handshakeStatus == 1 && len(b) == 0 {
+		buf := pool.GetBuffer()
+		defer pool.PutBuffer(buf)
+
+		buf.Write([]byte{0x14, 3, 3, 0, 1, 1, 0x16, 3, 3, 0, 0x20})
+		tools.AppendRandBytes(buf, 22)
+		buf.Write(c.hmacSHA1(buf.Bytes())[:10])
+		buf.ReadFrom(&c.sendBuf)
+
+		c.handshakeStatus = 8
+
+		_, err := c.Conn.Write(buf.Bytes())
+		return 0, err
+	}
+	return length, nil
+}
+
+func packData(buf *bytes.Buffer, data []byte) {
+	buf.Write([]byte{0x17, 3, 3})
+	binary.Write(buf, binary.BigEndian, uint16(len(data)))
+	buf.Write(data)
+}
+
+func (t *tls12Ticket) packAuthData(buf *bytes.Buffer) {
+	binary.Write(buf, binary.BigEndian, uint32(time.Now().Unix()))
+	tools.AppendRandBytes(buf, 18)
+	buf.Write(t.hmacSHA1(buf.Bytes()[buf.Len()-22:])[:10])
+}
+
+func packSNIData(buf *bytes.Buffer, u string) {
+	len := uint16(len(u))
+	buf.Write([]byte{0, 0})
+	binary.Write(buf, binary.BigEndian, len+5)
+	binary.Write(buf, binary.BigEndian, len+3)
+	buf.WriteByte(0)
+	binary.Write(buf, binary.BigEndian, len)
+	buf.WriteString(u)
+}
+
+func (c *tls12TicketConn) packTicketBuf(buf *bytes.Buffer, u string) {
+	length := 16 * (rand.Intn(17) + 8)
+	buf.Write([]byte{0, 0x23})
+	binary.Write(buf, binary.BigEndian, uint16(length))
+	tools.AppendRandBytes(buf, length)
+}
+
+func (t *tls12Ticket) hmacSHA1(data []byte) []byte {
+	key := pool.Get(len(t.Key) + 32)
+	defer pool.Put(key)
+	copy(key, t.Key)
+	copy(key[len(t.Key):], t.clientID[:])
+
+	sha1Data := tools.HmacSHA1(key, data)
+	return sha1Data[:10]
+}
+
+func (t *tls12Ticket) getHost() string {
+	host := t.Param
+	if len(host) == 0 {
+		host = t.Host
+	}
+	if len(host) > 0 && host[len(host)-1] >= '0' && host[len(host)-1] <= '9' {
+		host = ""
+	}
+	hosts := strings.Split(host, ",")
+	host = hosts[rand.Intn(len(hosts))]
+	return host
+}

transport/clashssr/protocol/auth_aes128_md5.go

@@ -0,0 +1,18 @@
+package protocol
+
+import "github.com/Dreamacro/clash/transport/ssr/tools"
+
+func init() {
+	register("auth_aes128_md5", newAuthAES128MD5, 9)
+}
+
+func newAuthAES128MD5(b *Base) Protocol {
+	a := &authAES128{
+		Base:               b,
+		authData:           &authData{},
+		authAES128Function: &authAES128Function{salt: "auth_aes128_md5", hmac: tools.HmacMD5, hashDigest: tools.MD5Sum},
+		userData:           &userData{},
+	}
+	a.initUserData()
+	return a
+}

transport/clashssr/protocol/auth_aes128_sha1.go

@@ -0,0 +1,277 @@
+package protocol
+
+import (
+	"bytes"
+	"encoding/binary"
+	"math"
+	"math/rand"
+	"net"
+	"strconv"
+	"strings"
+
+	"github.com/Dreamacro/clash/common/pool"
+	"github.com/Dreamacro/clash/transport/ssr/tools"
+)
+
+type (
+	hmacMethod       func(key, data []byte) []byte
+	hashDigestMethod func([]byte) []byte
+)
+
+func init() {
+	register("auth_aes128_sha1", newAuthAES128SHA1, 9)
+}
+
+type authAES128Function struct {
+	salt       string
+	hmac       hmacMethod
+	hashDigest hashDigestMethod
+}
+
+type authAES128 struct {
+	*Base
+	*authData
+	*authAES128Function
+	*userData
+	iv            []byte
+	hasSentHeader bool
+	rawTrans      bool
+	packID        uint32
+	recvID        uint32
+}
+
+func newAuthAES128SHA1(b *Base) Protocol {
+	a := &authAES128{
+		Base:               b,
+		authData:           &authData{},
+		authAES128Function: &authAES128Function{salt: "auth_aes128_sha1", hmac: tools.HmacSHA1, hashDigest: tools.SHA1Sum},
+		userData:           &userData{},
+	}
+	a.initUserData()
+	return a
+}
+
+func (a *authAES128) initUserData() {
+	params := strings.Split(a.Param, ":")
+	if len(params) > 1 {
+		if userID, err := strconv.ParseUint(params[0], 10, 32); err == nil {
+			binary.LittleEndian.PutUint32(a.userID[:], uint32(userID))
+			a.userKey = a.hashDigest([]byte(params[1]))
+		}
+	}
+	if len(a.userKey) == 0 {
+		a.userKey = a.Key
+		rand.Read(a.userID[:])
+	}
+}
+
+func (a *authAES128) StreamConn(c net.Conn, iv []byte) net.Conn {
+	p := &authAES128{
+		Base:               a.Base,
+		authData:           a.next(),
+		authAES128Function: a.authAES128Function,
+		userData:           a.userData,
+		packID:             1,
+		recvID:             1,
+	}
+	p.iv = iv
+	return &Conn{Conn: c, Protocol: p}
+}
+
+func (a *authAES128) PacketConn(c net.PacketConn) net.PacketConn {
+	p := &authAES128{
+		Base:               a.Base,
+		authAES128Function: a.authAES128Function,
+		userData:           a.userData,
+	}
+	return &PacketConn{PacketConn: c, Protocol: p}
+}
+
+func (a *authAES128) Decode(dst, src *bytes.Buffer) error {
+	if a.rawTrans {
+		dst.ReadFrom(src)
+		return nil
+	}
+	for src.Len() > 4 {
+		macKey := pool.Get(len(a.userKey) + 4)
+		defer pool.Put(macKey)
+		copy(macKey, a.userKey)
+		binary.LittleEndian.PutUint32(macKey[len(a.userKey):], a.recvID)
+		if !bytes.Equal(a.hmac(macKey, src.Bytes()[:2])[:2], src.Bytes()[2:4]) {
+			src.Reset()
+			return errAuthAES128MACError
+		}
+
+		length := int(binary.LittleEndian.Uint16(src.Bytes()[:2]))
+		if length >= 8192 || length < 7 {
+			a.rawTrans = true
+			src.Reset()
+			return errAuthAES128LengthError
+		}
+		if length > src.Len() {
+			break
+		}
+
+		if !bytes.Equal(a.hmac(macKey, src.Bytes()[:length-4])[:4], src.Bytes()[length-4:length]) {
+			a.rawTrans = true
+			src.Reset()
+			return errAuthAES128ChksumError
+		}
+
+		a.recvID++
+
+		pos := int(src.Bytes()[4])
+		if pos < 255 {
+			pos += 4
+		} else {
+			pos = int(binary.LittleEndian.Uint16(src.Bytes()[5:7])) + 4
+		}
+		dst.Write(src.Bytes()[pos : length-4])
+		src.Next(length)
+	}
+	return nil
+}
+
+func (a *authAES128) Encode(buf *bytes.Buffer, b []byte) error {
+	fullDataLength := len(b)
+	if !a.hasSentHeader {
+		dataLength := getDataLength(b)
+		a.packAuthData(buf, b[:dataLength])
+		b = b[dataLength:]
+		a.hasSentHeader = true
+	}
+	for len(b) > 8100 {
+		a.packData(buf, b[:8100], fullDataLength)
+		b = b[8100:]
+	}
+	if len(b) > 0 {
+		a.packData(buf, b, fullDataLength)
+	}
+	return nil
+}
+
+func (a *authAES128) DecodePacket(b []byte) ([]byte, error) {
+	if len(b) < 4 {
+		return nil, errAuthAES128LengthError
+	}
+	if !bytes.Equal(a.hmac(a.Key, b[:len(b)-4])[:4], b[len(b)-4:]) {
+		return nil, errAuthAES128ChksumError
+	}
+	return b[:len(b)-4], nil
+}
+
+func (a *authAES128) EncodePacket(buf *bytes.Buffer, b []byte) error {
+	buf.Write(b)
+	buf.Write(a.userID[:])
+	buf.Write(a.hmac(a.userKey, buf.Bytes())[:4])
+	return nil
+}
+
+func (a *authAES128) packData(poolBuf *bytes.Buffer, data []byte, fullDataLength int) {
+	dataLength := len(data)
+	randDataLength := a.getRandDataLengthForPackData(dataLength, fullDataLength)
+	/*
+		2:	uint16 LittleEndian packedDataLength
+		2:	hmac of packedDataLength
+		3:	maxRandDataLengthPrefix (min:1)
+		4:	hmac of packedData except the last 4 bytes
+	*/
+	packedDataLength := 2 + 2 + 3 + randDataLength + dataLength + 4
+	if randDataLength < 128 {
+		packedDataLength -= 2
+	}
+
+	macKey := pool.Get(len(a.userKey) + 4)
+	defer pool.Put(macKey)
+	copy(macKey, a.userKey)
+	binary.LittleEndian.PutUint32(macKey[len(a.userKey):], a.packID)
+	a.packID++
+
+	binary.Write(poolBuf, binary.LittleEndian, uint16(packedDataLength))
+	poolBuf.Write(a.hmac(macKey, poolBuf.Bytes()[poolBuf.Len()-2:])[:2])
+	a.packRandData(poolBuf, randDataLength)
+	poolBuf.Write(data)
+	poolBuf.Write(a.hmac(macKey, poolBuf.Bytes()[poolBuf.Len()-packedDataLength+4:])[:4])
+}
+
+func trapezoidRandom(max int, d float64) int {
+	base := rand.Float64()
+	if d-0 > 1e-6 {
+		a := 1 - d
+		base = (math.Sqrt(a*a+4*d*base) - a) / (2 * d)
+	}
+	return int(base * float64(max))
+}
+
+func (a *authAES128) getRandDataLengthForPackData(dataLength, fullDataLength int) int {
+	if fullDataLength >= 32*1024-a.Overhead {
+		return 0
+	}
+	// 1460: tcp_mss
+	revLength := 1460 - dataLength - 9
+	if revLength == 0 {
+		return 0
+	}
+	if revLength < 0 {
+		if revLength > -1460 {
+			return trapezoidRandom(revLength+1460, -0.3)
+		}
+		return rand.Intn(32)
+	}
+	if dataLength > 900 {
+		return rand.Intn(revLength)
+	}
+	return trapezoidRandom(revLength, -0.3)
+}
+
+func (a *authAES128) packAuthData(poolBuf *bytes.Buffer, data []byte) {
+	if len(data) == 0 {
+		return
+	}
+	dataLength := len(data)
+	randDataLength := a.getRandDataLengthForPackAuthData(dataLength)
+	/*
+		7:	checkHead(1) and hmac of checkHead(6)
+		4:	userID
+		16:	encrypted data of authdata(12), uint16 BigEndian packedDataLength(2) and uint16 BigEndian randDataLength(2)
+		4:	hmac of userID and encrypted data
+		4:	hmac of packedAuthData except the last 4 bytes
+	*/
+	packedAuthDataLength := 7 + 4 + 16 + 4 + randDataLength + dataLength + 4
+
+	macKey := pool.Get(len(a.iv) + len(a.Key))
+	defer pool.Put(macKey)
+	copy(macKey, a.iv)
+	copy(macKey[len(a.iv):], a.Key)
+
+	poolBuf.WriteByte(byte(rand.Intn(256)))
+	poolBuf.Write(a.hmac(macKey, poolBuf.Bytes())[:6])
+	poolBuf.Write(a.userID[:])
+	err := a.authData.putEncryptedData(poolBuf, a.userKey, [2]int{packedAuthDataLength, randDataLength}, a.salt)
+	if err != nil {
+		poolBuf.Reset()
+		return
+	}
+	poolBuf.Write(a.hmac(macKey, poolBuf.Bytes()[7:])[:4])
+	tools.AppendRandBytes(poolBuf, randDataLength)
+	poolBuf.Write(data)
+	poolBuf.Write(a.hmac(a.userKey, poolBuf.Bytes())[:4])
+}
+
+func (a *authAES128) getRandDataLengthForPackAuthData(size int) int {
+	if size > 400 {
+		return rand.Intn(512)
+	}
+	return rand.Intn(1024)
+}
+
+func (a *authAES128) packRandData(poolBuf *bytes.Buffer, size int) {
+	if size < 128 {
+		poolBuf.WriteByte(byte(size + 1))
+		tools.AppendRandBytes(poolBuf, size)
+		return
+	}
+	poolBuf.WriteByte(255)
+	binary.Write(poolBuf, binary.LittleEndian, uint16(size+3))
+	tools.AppendRandBytes(poolBuf, size)
+}

transport/clashssr/protocol/auth_chain_a.go

@@ -0,0 +1,306 @@
+package protocol
+
+import (
+	"bytes"
+	"crypto/cipher"
+	"crypto/rand"
+	"crypto/rc4"
+	"encoding/base64"
+	"encoding/binary"
+	"net"
+	"strconv"
+	"strings"
+
+	"github.com/Dreamacro/clash/common/pool"
+	"github.com/Dreamacro/clash/transport/shadowsocks/core"
+	"github.com/Dreamacro/clash/transport/ssr/tools"
+)
+
+func init() {
+	register("auth_chain_a", newAuthChainA, 4)
+}
+
+type randDataLengthMethod func(int, []byte, *tools.XorShift128Plus) int
+
+type authChainA struct {
+	*Base
+	*authData
+	*userData
+	iv             []byte
+	salt           string
+	hasSentHeader  bool
+	rawTrans       bool
+	lastClientHash []byte
+	lastServerHash []byte
+	encrypter      cipher.Stream
+	decrypter      cipher.Stream
+	randomClient   tools.XorShift128Plus
+	randomServer   tools.XorShift128Plus
+	randDataLength randDataLengthMethod
+	packID         uint32
+	recvID         uint32
+}
+
+func newAuthChainA(b *Base) Protocol {
+	a := &authChainA{
+		Base:     b,
+		authData: &authData{},
+		userData: &userData{},
+		salt:     "auth_chain_a",
+	}
+	a.initUserData()
+	return a
+}
+
+func (a *authChainA) initUserData() {
+	params := strings.Split(a.Param, ":")
+	if len(params) > 1 {
+		if userID, err := strconv.ParseUint(params[0], 10, 32); err == nil {
+			binary.LittleEndian.PutUint32(a.userID[:], uint32(userID))
+			a.userKey = []byte(params[1])
+		}
+	}
+	if len(a.userKey) == 0 {
+		a.userKey = a.Key
+		rand.Read(a.userID[:])
+	}
+}
+
+func (a *authChainA) StreamConn(c net.Conn, iv []byte) net.Conn {
+	p := &authChainA{
+		Base:     a.Base,
+		authData: a.next(),
+		userData: a.userData,
+		salt:     a.salt,
+		packID:   1,
+		recvID:   1,
+	}
+	p.iv = iv
+	p.randDataLength = p.getRandLength
+	return &Conn{Conn: c, Protocol: p}
+}
+
+func (a *authChainA) PacketConn(c net.PacketConn) net.PacketConn {
+	p := &authChainA{
+		Base:     a.Base,
+		salt:     a.salt,
+		userData: a.userData,
+	}
+	return &PacketConn{PacketConn: c, Protocol: p}
+}
+
+func (a *authChainA) Decode(dst, src *bytes.Buffer) error {
+	if a.rawTrans {
+		dst.ReadFrom(src)
+		return nil
+	}
+	for src.Len() > 4 {
+		macKey := pool.Get(len(a.userKey) + 4)
+		defer pool.Put(macKey)
+		copy(macKey, a.userKey)
+		binary.LittleEndian.PutUint32(macKey[len(a.userKey):], a.recvID)
+
+		dataLength := int(binary.LittleEndian.Uint16(src.Bytes()[:2]) ^ binary.LittleEndian.Uint16(a.lastServerHash[14:16]))
+		randDataLength := a.randDataLength(dataLength, a.lastServerHash, &a.randomServer)
+		length := dataLength + randDataLength
+
+		if length >= 4096 {
+			a.rawTrans = true
+			src.Reset()
+			return errAuthChainLengthError
+		}
+
+		if 4+length > src.Len() {
+			break
+		}
+
+		serverHash := tools.HmacMD5(macKey, src.Bytes()[:length+2])
+		if !bytes.Equal(serverHash[:2], src.Bytes()[length+2:length+4]) {
+			a.rawTrans = true
+			src.Reset()
+			return errAuthChainChksumError
+		}
+		a.lastServerHash = serverHash
+
+		pos := 2
+		if dataLength > 0 && randDataLength > 0 {
+			pos += getRandStartPos(randDataLength, &a.randomServer)
+		}
+		wantedData := src.Bytes()[pos : pos+dataLength]
+		a.decrypter.XORKeyStream(wantedData, wantedData)
+		if a.recvID == 1 {
+			dst.Write(wantedData[2:])
+		} else {
+			dst.Write(wantedData)
+		}
+		a.recvID++
+		src.Next(length + 4)
+	}
+	return nil
+}
+
+func (a *authChainA) Encode(buf *bytes.Buffer, b []byte) error {
+	if !a.hasSentHeader {
+		dataLength := getDataLength(b)
+		a.packAuthData(buf, b[:dataLength])
+		b = b[dataLength:]
+		a.hasSentHeader = true
+	}
+	for len(b) > 2800 {
+		a.packData(buf, b[:2800])
+		b = b[2800:]
+	}
+	if len(b) > 0 {
+		a.packData(buf, b)
+	}
+	return nil
+}
+
+func (a *authChainA) DecodePacket(b []byte) ([]byte, error) {
+	if len(b) < 9 {
+		return nil, errAuthChainLengthError
+	}
+	if !bytes.Equal(tools.HmacMD5(a.userKey, b[:len(b)-1])[:1], b[len(b)-1:]) {
+		return nil, errAuthChainChksumError
+	}
+	md5Data := tools.HmacMD5(a.Key, b[len(b)-8:len(b)-1])
+
+	randDataLength := udpGetRandLength(md5Data, &a.randomServer)
+
+	key := core.Kdf(base64.StdEncoding.EncodeToString(a.userKey)+base64.StdEncoding.EncodeToString(md5Data), 16)
+	rc4Cipher, err := rc4.NewCipher(key)
+	if err != nil {
+		return nil, err
+	}
+	wantedData := b[:len(b)-8-randDataLength]
+	rc4Cipher.XORKeyStream(wantedData, wantedData)
+	return wantedData, nil
+}
+
+func (a *authChainA) EncodePacket(buf *bytes.Buffer, b []byte) error {
+	authData := pool.Get(3)
+	defer pool.Put(authData)
+	rand.Read(authData)
+
+	md5Data := tools.HmacMD5(a.Key, authData)
+
+	randDataLength := udpGetRandLength(md5Data, &a.randomClient)
+
+	key := core.Kdf(base64.StdEncoding.EncodeToString(a.userKey)+base64.StdEncoding.EncodeToString(md5Data), 16)
+	rc4Cipher, err := rc4.NewCipher(key)
+	if err != nil {
+		return err
+	}
+	rc4Cipher.XORKeyStream(b, b)
+
+	buf.Write(b)
+	tools.AppendRandBytes(buf, randDataLength)
+	buf.Write(authData)
+	binary.Write(buf, binary.LittleEndian, binary.LittleEndian.Uint32(a.userID[:])^binary.LittleEndian.Uint32(md5Data[:4]))
+	buf.Write(tools.HmacMD5(a.userKey, buf.Bytes())[:1])
+	return nil
+}
+
+func (a *authChainA) packAuthData(poolBuf *bytes.Buffer, data []byte) {
+	/*
+		dataLength := len(data)
+		12:	checkHead(4) and hmac of checkHead(8)
+		4:	uint32 LittleEndian uid (uid = userID ^ last client hash)
+		16:	encrypted data of authdata(12), uint16 LittleEndian overhead(2) and uint16 LittleEndian number zero(2)
+		4:	last server hash(4)
+		packedAuthDataLength := 12 + 4 + 16 + 4 + dataLength
+	*/
+
+	macKey := pool.Get(len(a.iv) + len(a.Key))
+	defer pool.Put(macKey)
+	copy(macKey, a.iv)
+	copy(macKey[len(a.iv):], a.Key)
+
+	// check head
+	tools.AppendRandBytes(poolBuf, 4)
+	a.lastClientHash = tools.HmacMD5(macKey, poolBuf.Bytes())
+	a.initRC4Cipher()
+	poolBuf.Write(a.lastClientHash[:8])
+	// uid
+	binary.Write(poolBuf, binary.LittleEndian, binary.LittleEndian.Uint32(a.userID[:])^binary.LittleEndian.Uint32(a.lastClientHash[8:12]))
+	// encrypted data
+	err := a.putEncryptedData(poolBuf, a.userKey, [2]int{a.Overhead, 0}, a.salt)
+	if err != nil {
+		poolBuf.Reset()
+		return
+	}
+	// last server hash
+	a.lastServerHash = tools.HmacMD5(a.userKey, poolBuf.Bytes()[12:])
+	poolBuf.Write(a.lastServerHash[:4])
+	// packed data
+	a.packData(poolBuf, data)
+}
+
+func (a *authChainA) packData(poolBuf *bytes.Buffer, data []byte) {
+	a.encrypter.XORKeyStream(data, data)
+
+	macKey := pool.Get(len(a.userKey) + 4)
+	defer pool.Put(macKey)
+	copy(macKey, a.userKey)
+	binary.LittleEndian.PutUint32(macKey[len(a.userKey):], a.packID)
+	a.packID++
+
+	length := uint16(len(data)) ^ binary.LittleEndian.Uint16(a.lastClientHash[14:16])
+
+	originalLength := poolBuf.Len()
+	binary.Write(poolBuf, binary.LittleEndian, length)
+	a.putMixedRandDataAndData(poolBuf, data)
+	a.lastClientHash = tools.HmacMD5(macKey, poolBuf.Bytes()[originalLength:])
+	poolBuf.Write(a.lastClientHash[:2])
+}
+
+func (a *authChainA) putMixedRandDataAndData(poolBuf *bytes.Buffer, data []byte) {
+	randDataLength := a.randDataLength(len(data), a.lastClientHash, &a.randomClient)
+	if len(data) == 0 {
+		tools.AppendRandBytes(poolBuf, randDataLength)
+		return
+	}
+	if randDataLength > 0 {
+		startPos := getRandStartPos(randDataLength, &a.randomClient)
+		tools.AppendRandBytes(poolBuf, startPos)
+		poolBuf.Write(data)
+		tools.AppendRandBytes(poolBuf, randDataLength-startPos)
+		return
+	}
+	poolBuf.Write(data)
+}
+
+func getRandStartPos(length int, random *tools.XorShift128Plus) int {
+	if length == 0 {
+		return 0
+	}
+	return int(int64(random.Next()%8589934609) % int64(length))
+}
+
+func (a *authChainA) getRandLength(length int, lastHash []byte, random *tools.XorShift128Plus) int {
+	if length > 1440 {
+		return 0
+	}
+	random.InitFromBinAndLength(lastHash, length)
+	if length > 1300 {
+		return int(random.Next() % 31)
+	}
+	if length > 900 {
+		return int(random.Next() % 127)
+	}
+	if length > 400 {
+		return int(random.Next() % 521)
+	}
+	return int(random.Next() % 1021)
+}
+
+func (a *authChainA) initRC4Cipher() {
+	key := core.Kdf(base64.StdEncoding.EncodeToString(a.userKey)+base64.StdEncoding.EncodeToString(a.lastClientHash), 16)
+	a.encrypter, _ = rc4.NewCipher(key)
+	a.decrypter, _ = rc4.NewCipher(key)
+}
+
+func udpGetRandLength(lastHash []byte, random *tools.XorShift128Plus) int {
+	random.InitFromBin(lastHash)
+	return int(random.Next() % 127)
+}

transport/clashssr/protocol/auth_chain_b.go

@@ -0,0 +1,97 @@
+package protocol
+
+import (
+	"net"
+	"sort"
+
+	"github.com/Dreamacro/clash/transport/ssr/tools"
+)
+
+func init() {
+	register("auth_chain_b", newAuthChainB, 4)
+}
+
+type authChainB struct {
+	*authChainA
+	dataSizeList  []int
+	dataSizeList2 []int
+}
+
+func newAuthChainB(b *Base) Protocol {
+	a := &authChainB{
+		authChainA: &authChainA{
+			Base:     b,
+			authData: &authData{},
+			userData: &userData{},
+			salt:     "auth_chain_b",
+		},
+	}
+	a.initUserData()
+	return a
+}
+
+func (a *authChainB) StreamConn(c net.Conn, iv []byte) net.Conn {
+	p := &authChainB{
+		authChainA: &authChainA{
+			Base:     a.Base,
+			authData: a.next(),
+			userData: a.userData,
+			salt:     a.salt,
+			packID:   1,
+			recvID:   1,
+		},
+	}
+	p.iv = iv
+	p.randDataLength = p.getRandLength
+	p.initDataSize()
+	return &Conn{Conn: c, Protocol: p}
+}
+
+func (a *authChainB) initDataSize() {
+	a.dataSizeList = a.dataSizeList[:0]
+	a.dataSizeList2 = a.dataSizeList2[:0]
+
+	a.randomServer.InitFromBin(a.Key)
+	length := a.randomServer.Next()%8 + 4
+	for ; length > 0; length-- {
+		a.dataSizeList = append(a.dataSizeList, int(a.randomServer.Next()%2340%2040%1440))
+	}
+	sort.Ints(a.dataSizeList)
+
+	length = a.randomServer.Next()%16 + 8
+	for ; length > 0; length-- {
+		a.dataSizeList2 = append(a.dataSizeList2, int(a.randomServer.Next()%2340%2040%1440))
+	}
+	sort.Ints(a.dataSizeList2)
+}
+
+func (a *authChainB) getRandLength(length int, lashHash []byte, random *tools.XorShift128Plus) int {
+	if length >= 1440 {
+		return 0
+	}
+	random.InitFromBinAndLength(lashHash, length)
+	pos := sort.Search(len(a.dataSizeList), func(i int) bool { return a.dataSizeList[i] >= length+a.Overhead })
+	finalPos := pos + int(random.Next()%uint64(len(a.dataSizeList)))
+	if finalPos < len(a.dataSizeList) {
+		return a.dataSizeList[finalPos] - length - a.Overhead
+	}
+
+	pos = sort.Search(len(a.dataSizeList2), func(i int) bool { return a.dataSizeList2[i] >= length+a.Overhead })
+	finalPos = pos + int(random.Next()%uint64(len(a.dataSizeList2)))
+	if finalPos < len(a.dataSizeList2) {
+		return a.dataSizeList2[finalPos] - length - a.Overhead
+	}
+	if finalPos < pos+len(a.dataSizeList2)-1 {
+		return 0
+	}
+	if length > 1300 {
+		return int(random.Next() % 31)
+	}
+	if length > 900 {
+		return int(random.Next() % 127)
+	}
+	if length > 400 {
+		return int(random.Next() % 521)
+	}
+	return int(random.Next() % 1021)
+}

transport/clashssr/protocol/auth_sha1_v4.go

@@ -0,0 +1,182 @@
+package protocol
+
+import (
+	"bytes"
+	"encoding/binary"
+	"hash/adler32"
+	"hash/crc32"
+	"math/rand"
+	"net"
+
+	"github.com/Dreamacro/clash/common/pool"
+	"github.com/Dreamacro/clash/transport/ssr/tools"
+)
+
+func init() {
+	register("auth_sha1_v4", newAuthSHA1V4, 7)
+}
+
+type authSHA1V4 struct {
+	*Base
+	*authData
+	iv            []byte
+	hasSentHeader bool
+	rawTrans      bool
+}
+
+func newAuthSHA1V4(b *Base) Protocol {
+	return &authSHA1V4{Base: b, authData: &authData{}}
+}
+
+func (a *authSHA1V4) StreamConn(c net.Conn, iv []byte) net.Conn {
+	p := &authSHA1V4{Base: a.Base, authData: a.next()}
+	p.iv = iv
+	return &Conn{Conn: c, Protocol: p}
+}
+
+func (a *authSHA1V4) PacketConn(c net.PacketConn) net.PacketConn {
+	return c
+}
+
+func (a *authSHA1V4) Decode(dst, src *bytes.Buffer) error {
+	if a.rawTrans {
+		dst.ReadFrom(src)
+		return nil
+	}
+	for src.Len() > 4 {
+		if uint16(crc32.ChecksumIEEE(src.Bytes()[:2])&0xffff) != binary.LittleEndian.Uint16(src.Bytes()[2:4]) {
+			src.Reset()
+			return errAuthSHA1V4CRC32Error
+		}
+
+		length := int(binary.BigEndian.Uint16(src.Bytes()[:2]))
+		if length >= 8192 || length < 7 {
+			a.rawTrans = true
+			src.Reset()
+			return errAuthSHA1V4LengthError
+		}
+		if length > src.Len() {
+			break
+		}
+
+		if adler32.Checksum(src.Bytes()[:length-4]) != binary.LittleEndian.Uint32(src.Bytes()[length-4:length]) {
+			a.rawTrans = true
+			src.Reset()
+			return errAuthSHA1V4Adler32Error
+		}
+
+		pos := int(src.Bytes()[4])
+		if pos < 255 {
+			pos += 4
+		} else {
+			pos = int(binary.BigEndian.Uint16(src.Bytes()[5:7])) + 4
+		}
+		dst.Write(src.Bytes()[pos : length-4])
+		src.Next(length)
+	}
+	return nil
+}
+
+func (a *authSHA1V4) Encode(buf *bytes.Buffer, b []byte) error {
+	if !a.hasSentHeader {
+		dataLength := getDataLength(b)
+
+		a.packAuthData(buf, b[:dataLength])
+		b = b[dataLength:]
+
+		a.hasSentHeader = true
+	}
+	for len(b) > 8100 {
+		a.packData(buf, b[:8100])
+		b = b[8100:]
+	}
+	if len(b) > 0 {
+		a.packData(buf, b)
+	}
+
+	return nil
+}
+
+func (a *authSHA1V4) DecodePacket(b []byte) ([]byte, error) { return b, nil }
+
+func (a *authSHA1V4) EncodePacket(buf *bytes.Buffer, b []byte) error {
+	buf.Write(b)
+	return nil
+}
+
+func (a *authSHA1V4) packData(poolBuf *bytes.Buffer, data []byte) {
+	dataLength := len(data)
+	randDataLength := a.getRandDataLength(dataLength)
+	/*
+		2:	uint16 BigEndian packedDataLength
+		2:	uint16 LittleEndian crc32Data & 0xffff
+		3:	maxRandDataLengthPrefix (min:1)
+		4:	adler32Data
+	*/
+	packedDataLength := 2 + 2 + 3 + randDataLength + dataLength + 4
+	if randDataLength < 128 {
+		packedDataLength -= 2
+	}
+
+	binary.Write(poolBuf, binary.BigEndian, uint16(packedDataLength))
+	binary.Write(poolBuf, binary.LittleEndian, uint16(crc32.ChecksumIEEE(poolBuf.Bytes()[poolBuf.Len()-2:])&0xffff))
+	a.packRandData(poolBuf, randDataLength)
+	poolBuf.Write(data)
+	binary.Write(poolBuf, binary.LittleEndian, adler32.Checksum(poolBuf.Bytes()[poolBuf.Len()-packedDataLength+4:]))
+}
+
+func (a *authSHA1V4) packAuthData(poolBuf *bytes.Buffer, data []byte) {
+	dataLength := len(data)
+	randDataLength := a.getRandDataLength(12 + dataLength)
+	/*
+		2:	uint16 BigEndian packedAuthDataLength
+		4:	uint32 LittleEndian crc32Data
+		3:	maxRandDataLengthPrefix (min: 1)
+		12:	authDataLength
+		10:	hmacSHA1DataLength
+	*/
+	packedAuthDataLength := 2 + 4 + 3 + randDataLength + 12 + dataLength + 10
+	if randDataLength < 128 {
+		packedAuthDataLength -= 2
+	}
+
+	salt := []byte("auth_sha1_v4")
+	crcData := pool.Get(len(salt) + len(a.Key) + 2)
+	defer pool.Put(crcData)
+	binary.BigEndian.PutUint16(crcData, uint16(packedAuthDataLength))
+	copy(crcData[2:], salt)
+	copy(crcData[2+len(salt):], a.Key)
+
+	key := pool.Get(len(a.iv) + len(a.Key))
+	defer pool.Put(key)
+	copy(key, a.iv)
+	copy(key[len(a.iv):], a.Key)
+
+	poolBuf.Write(crcData[:2])
+	binary.Write(poolBuf, binary.LittleEndian, crc32.ChecksumIEEE(crcData))
+	a.packRandData(poolBuf, randDataLength)
+	a.putAuthData(poolBuf)
+	poolBuf.Write(data)
+	poolBuf.Write(tools.HmacSHA1(key, poolBuf.Bytes()[poolBuf.Len()-packedAuthDataLength+10:])[:10])
+}
+
+func (a *authSHA1V4) packRandData(poolBuf *bytes.Buffer, size int) {
+	if size < 128 {
+		poolBuf.WriteByte(byte(size + 1))
+		tools.AppendRandBytes(poolBuf, size)
+		return
+	}
+	poolBuf.WriteByte(255)
+	binary.Write(poolBuf, binary.BigEndian, uint16(size+3))
+	tools.AppendRandBytes(poolBuf, size)
+}
+
+func (a *authSHA1V4) getRandDataLength(size int) int {
+	if size > 1200 {
+		return 0
+	}
+	if size > 400 {
+		return rand.Intn(256)
+	}
+	return rand.Intn(512)
+}

transport/clashssr/protocol/base.go

@@ -0,0 +1,75 @@
+package protocol
+
+import (
+	"bytes"
+	"crypto/aes"
+	"crypto/cipher"
+	"encoding/base64"
+	"encoding/binary"
+	"math/rand"
+	"sync"
+	"time"
+
+	"github.com/Dreamacro/clash/common/pool"
+	"github.com/Dreamacro/clash/transport/shadowsocks/core"
+)
+
+type Base struct {
+	Key      []byte
+	Overhead int
+	Param    string
+}
+
+type userData struct {
+	userKey []byte
+	userID  [4]byte
+}
+
+type authData struct {
+	clientID     [4]byte
+	connectionID uint32
+	mutex        sync.Mutex
+}
+
+func (a *authData) next() *authData {
+	r := &authData{}
+	a.mutex.Lock()
+	defer a.mutex.Unlock()
+	if a.connectionID > 0xff000000 || a.connectionID == 0 {
+		rand.Read(a.clientID[:])
+		a.connectionID = rand.Uint32() & 0xffffff
+	}
+	a.connectionID++
+	copy(r.clientID[:], a.clientID[:])
+	r.connectionID = a.connectionID
+	return r
+}
+
+func (a *authData) putAuthData(buf *bytes.Buffer) {
+	binary.Write(buf, binary.LittleEndian, uint32(time.Now().Unix()))
+	buf.Write(a.clientID[:])
+	binary.Write(buf, binary.LittleEndian, a.connectionID)
+}
+
+func (a *authData) putEncryptedData(b *bytes.Buffer, userKey []byte, paddings [2]int, salt string) error {
+	encrypt := pool.Get(16)
+	defer pool.Put(encrypt)
+	binary.LittleEndian.PutUint32(encrypt, uint32(time.Now().Unix()))
+	copy(encrypt[4:], a.clientID[:])
+	binary.LittleEndian.PutUint32(encrypt[8:], a.connectionID)
+	binary.LittleEndian.PutUint16(encrypt[12:], uint16(paddings[0]))
+	binary.LittleEndian.PutUint16(encrypt[14:], uint16(paddings[1]))
+
+	cipherKey := core.Kdf(base64.StdEncoding.EncodeToString(userKey)+salt, 16)
+	block, err := aes.NewCipher(cipherKey)
+	if err != nil {
+		return err
+	}
+	iv := bytes.Repeat([]byte{0}, 16)
+	cbcCipher := cipher.NewCBCEncrypter(block, iv)
+
+	cbcCipher.CryptBlocks(encrypt, encrypt)
+
+	b.Write(encrypt)
+	return nil
+}

transport/clashssr/protocol/origin.go

@@ -0,0 +1,33 @@
+package protocol
+
+import (
+	"bytes"
+	"net"
+)
+
+type origin struct{}
+
+func init() { register("origin", newOrigin, 0) }
+
+func newOrigin(b *Base) Protocol { return &origin{} }
+
+func (o *origin) StreamConn(c net.Conn, iv []byte) net.Conn { return c }
+
+func (o *origin) PacketConn(c net.PacketConn) net.PacketConn { return c }
+
+func (o *origin) Decode(dst, src *bytes.Buffer) error {
+	dst.ReadFrom(src)
+	return nil
+}
+
+func (o *origin) Encode(buf *bytes.Buffer, b []byte) error {
+	buf.Write(b)
+	return nil
+}
+
+func (o *origin) DecodePacket(b []byte) ([]byte, error) { return b, nil }
+
+func (o *origin) EncodePacket(buf *bytes.Buffer, b []byte) error {
+	buf.Write(b)
+	return nil
+}

transport/clashssr/protocol/packet.go

@@ -0,0 +1,36 @@
+package protocol
+
+import (
+	"net"
+
+	"github.com/Dreamacro/clash/common/pool"
+)
+
+type PacketConn struct {
+	net.PacketConn
+	Protocol
+}
+
+func (c *PacketConn) WriteTo(b []byte, addr net.Addr) (int, error) {
+	buf := pool.GetBuffer()
+	defer pool.PutBuffer(buf)
+	err := c.EncodePacket(buf, b)
+	if err != nil {
+		return 0, err
+	}
+	_, err = c.PacketConn.WriteTo(buf.Bytes(), addr)
+	return len(b), err
+}
+
+func (c *PacketConn) ReadFrom(b []byte) (int, net.Addr, error) {
+	n, addr, err := c.PacketConn.ReadFrom(b)
+	if err != nil {
+		return n, addr, err
+	}
+	decoded, err := c.DecodePacket(b[:n])
+	if err != nil {
+		return n, addr, err
+	}
+	copy(b, decoded)
+	return len(decoded), addr, nil
+}

transport/clashssr/protocol/protocol.go

@@ -0,0 +1,76 @@
+package protocol
+
+import (
+	"bytes"
+	"errors"
+	"fmt"
+	"math/rand"
+	"net"
+)
+
+var (
+	errAuthSHA1V4CRC32Error   = errors.New("auth_sha1_v4 decode data wrong crc32")
+	errAuthSHA1V4LengthError  = errors.New("auth_sha1_v4 decode data wrong length")
+	errAuthSHA1V4Adler32Error = errors.New("auth_sha1_v4 decode data wrong adler32")
+	errAuthAES128MACError     = errors.New("auth_aes128 decode data wrong mac")
+	errAuthAES128LengthError  = errors.New("auth_aes128 decode data wrong length")
+	errAuthAES128ChksumError  = errors.New("auth_aes128 decode data wrong checksum")
+	errAuthChainLengthError   = errors.New("auth_chain decode data wrong length")
+	errAuthChainChksumError   = errors.New("auth_chain decode data wrong checksum")
+)
+
+type Protocol interface {
+	StreamConn(net.Conn, []byte) net.Conn
+	PacketConn(net.PacketConn) net.PacketConn
+	Decode(dst, src *bytes.Buffer) error
+	Encode(buf *bytes.Buffer, b []byte) error
+	DecodePacket([]byte) ([]byte, error)
+	EncodePacket(buf *bytes.Buffer, b []byte) error
+}
+
+type protocolCreator func(b *Base) Protocol
+
+var protocolList = make(map[string]struct {
+	overhead int
+	new      protocolCreator
+})
+
+func register(name string, c protocolCreator, o int) {
+	protocolList[name] = struct {
+		overhead int
+		new      protocolCreator
+	}{overhead: o, new: c}
+}
+
+func PickProtocol(name string, b *Base) (Protocol, error) {
+	if choice, ok := protocolList[name]; ok {
+		b.Overhead += choice.overhead
+		return choice.new(b), nil
+	}
+	return nil, fmt.Errorf("protocol %s not supported", name)
+}
+
+func getHeadSize(b []byte, defaultValue int) int {
+	if len(b) < 2 {
+		return defaultValue
+	}
+	headType := b[0] & 7
+	switch headType {
+	case 1:
+		return 7
+	case 4:
+		return 19
+	case 3:
+		return 4 + int(b[1])
+	}
+	return defaultValue
+}
+
+func getDataLength(b []byte) int {
+	bLength := len(b)
+	dataLength := getHeadSize(b, 30) + rand.Intn(32)
+	if bLength < dataLength {
+		return bLength
+	}
+	return dataLength
+}

transport/clashssr/protocol/stream.go

@@ -0,0 +1,50 @@
+package protocol
+
+import (
+	"bytes"
+	"net"
+
+	"github.com/Dreamacro/clash/common/pool"
+)
+
+type Conn struct {
+	net.Conn
+	Protocol
+	decoded      bytes.Buffer
+	underDecoded bytes.Buffer
+}
+
+func (c *Conn) Read(b []byte) (int, error) {
+	if c.decoded.Len() > 0 {
+		return c.decoded.Read(b)
+	}
+
+	buf := pool.Get(pool.RelayBufferSize)
+	defer pool.Put(buf)
+	n, err := c.Conn.Read(buf)
+	if err != nil {
+		return 0, err
+	}
+	c.underDecoded.Write(buf[:n])
+	err = c.Decode(&c.decoded, &c.underDecoded)
+	if err != nil {
+		return 0, err
+	}
+	n, _ = c.decoded.Read(b)
+	return n, nil
+}
+
+func (c *Conn) Write(b []byte) (int, error) {
+	bLength := len(b)
+	buf := pool.GetBuffer()
+	defer pool.PutBuffer(buf)
+	err := c.Encode(buf, b)
+	if err != nil {
+		return 0, err
+	}
+	_, err = c.Conn.Write(buf.Bytes())
+	if err != nil {
+		return 0, err
+	}
+	return bLength, nil
+}

transport/clashssr/tools/bufPool.go

@@ -0,0 +1,11 @@
+package tools
+
+import (
+	"bytes"
+	"crypto/rand"
+	"io"
+)
+
+func AppendRandBytes(b *bytes.Buffer, length int) {
+	b.ReadFrom(io.LimitReader(rand.Reader, int64(length)))
+}

transport/clashssr/tools/crypto.go

@@ -0,0 +1,33 @@
+package tools
+
+import (
+	"crypto/hmac"
+	"crypto/md5"
+	"crypto/sha1"
+)
+
+const HmacSHA1Len = 10
+
+func HmacMD5(key, data []byte) []byte {
+	hmacMD5 := hmac.New(md5.New, key)
+	hmacMD5.Write(data)
+	return hmacMD5.Sum(nil)
+}
+
+func HmacSHA1(key, data []byte) []byte {
+	hmacSHA1 := hmac.New(sha1.New, key)
+	hmacSHA1.Write(data)
+	return hmacSHA1.Sum(nil)
+}
+
+func MD5Sum(b []byte) []byte {
+	h := md5.New()
+	h.Write(b)
+	return h.Sum(nil)
+}
+
+func SHA1Sum(b []byte) []byte {
+	h := sha1.New()
+	h.Write(b)
+	return h.Sum(nil)
+}

transport/clashssr/tools/random.go

@@ -0,0 +1,57 @@
+package tools
+
+import (
+	"encoding/binary"
+
+	"github.com/Dreamacro/clash/common/pool"
+)
+
+// XorShift128Plus - a pseudorandom number generator
+type XorShift128Plus struct {
+	s [2]uint64
+}
+
+func (r *XorShift128Plus) Next() uint64 {
+	x := r.s[0]
+	y := r.s[1]
+	r.s[0] = y
+	x ^= x << 23
+	x ^= y ^ (x >> 17) ^ (y >> 26)
+	r.s[1] = x
+	return x + y
+}
+
+func (r *XorShift128Plus) InitFromBin(bin []byte) {
+	var full []byte
+	if len(bin) < 16 {
+		full := pool.Get(16)[:0]
+		defer pool.Put(full)
+		full = append(full, bin...)
+		for len(full) < 16 {
+			full = append(full, 0)
+		}
+	} else {
+		full = bin
+	}
+	r.s[0] = binary.LittleEndian.Uint64(full[:8])
+	r.s[1] = binary.LittleEndian.Uint64(full[8:16])
+}
+
+func (r *XorShift128Plus) InitFromBinAndLength(bin []byte, length int) {
+	var full []byte
+	if len(bin) < 16 {
+		full := pool.Get(16)[:0]
+		defer pool.Put(full)
+		full = append(full, bin...)
+		for len(full) < 16 {
+			full = append(full, 0)
+		}
+	}
+	full = bin
+	binary.LittleEndian.PutUint16(full, uint16(length))
+	r.s[0] = binary.LittleEndian.Uint64(full[:8])
+	r.s[1] = binary.LittleEndian.Uint64(full[8:16])
+	for i := 0; i < 4; i++ {
+		r.Next()
+	}
+}

transport/hysteria/protocol.go

@@ -487,6 +487,25 @@ func (c *PacketConn) WritePacket(buffer *buf.Buffer, destination M.Socksaddr) er
 	})
 }
 
+func (c *PacketConn) ReadFrom(p []byte) (n int, addr net.Addr, err error) {
+	msg := <-c.msgCh
+	if msg == nil {
+		err = net.ErrClosed
+		return
+	}
+	n = copy(p, msg.Data)
+	addr = M.ParseSocksaddrHostPort(msg.Host, msg.Port).UDPAddr()
+	return
+}
+
+func (c *PacketConn) WriteTo(p []byte, addr net.Addr) (n int, err error) {
+	err = c.WritePacket(buf.As(p), M.SocksaddrFromNet(addr))
+	if err == nil {
+		n = len(p)
+	}
+	return
+}
+
 func (c *PacketConn) LocalAddr() net.Addr {
 	return nil
 }
@@ -507,14 +526,6 @@ func (c *PacketConn) SetWriteDeadline(t time.Time) error {
 	return os.ErrInvalid
 }
 
-func (c *PacketConn) ReadFrom(p []byte) (n int, addr net.Addr, err error) {
-	return 0, nil, os.ErrInvalid
-}
-
-func (c *PacketConn) WriteTo(p []byte, addr net.Addr) (n int, err error) {
-	return 0, os.ErrInvalid
-}
-
 func (c *PacketConn) Read(b []byte) (n int, err error) {
 	return 0, os.ErrInvalid
 }

transport/v2ray/quic_stub.go

@@ -7,7 +7,7 @@ import (
 
 	"github.com/sagernet/sing-box/adapter"
 	"github.com/sagernet/sing-box/common/tls"
-	C "github.com/sagernet/sing-box/constant"
+	I "github.com/sagernet/sing-box/include"
 	"github.com/sagernet/sing-box/option"
 	E "github.com/sagernet/sing/common/exceptions"
 	M "github.com/sagernet/sing/common/metadata"
@@ -15,9 +15,9 @@ import (
 )
 
 func NewQUICServer(ctx context.Context, options option.V2RayQUICOptions, tlsConfig tls.Config, handler N.TCPConnectionHandler, errorHandler E.Handler) (adapter.V2RayServerTransport, error) {
-	return nil, C.ErrQUICNotIncluded
+	return nil, I.ErrQUICNotIncluded
 }
 
 func NewQUICClient(ctx context.Context, dialer N.Dialer, serverAddr M.Socksaddr, options option.V2RayQUICOptions, tlsConfig tls.Config) (adapter.V2RayClientTransport, error) {
-	return nil, C.ErrQUICNotIncluded
+	return nil, I.ErrQUICNotIncluded
 }